Lösungen für die allgemeine Chemie
- (2)
- (2)
- (2)
- (6)
- (1)
- (2)
- (2)
- (2)
- (1)
- (1)
- (1)
- (3)
- (1)
- (1)
- (4)
- (4)
- (1)
- (2)
- (2)
- (1)
- (2)
Gefilterte Suchergebnisse
Thermo Scientific Chemicals Phenol:Chloroform:Isoamyl-Alkohol 25:24:1, gebrauchsfertige gesättigte wässr. Lösg., pH-Wert 6.7
CAS: 136112-00-0 Summenformel: C12H19Cl3O2 Molekulargewicht (g/mol): 301.632 MDL-Nummer: MFCD00133763 InChI-Schlüssel: ZYWFEOZQIUMEGL-UHFFFAOYSA-N Synonym: phenol-chloroform-isoamyl alcohol mixture,chloroform; isoamyl alcohol; phenol,phenol chloroform isoamyl alcohol,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 125:24:1,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 25:24:1,phenol-chloroform-isoamyl alcohol mixture, vetec tm reagent grade, 25:24:1,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 49.5:49.5:1,phenol:chloroform:isoamyl alcohol 25:24:1, ready-to-use saturated aqueous solution, ph 5.2, with alkaline buffer,phenol:chloroform:isoamyl alcohol 25:24:1, ready-to-use saturated aqueous solution, ph 6.7, with alkaline buffer PubChem CID: 66587205 IUPAC-Name: Chloroform; 3-Methylbutan-1-ol; Phenol SMILES: CC(C)CCO.C1=CC=C(C=C1)O.C(Cl)(Cl)Cl
| InChI-Schlüssel | ZYWFEOZQIUMEGL-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Chloroform; 3-Methylbutan-1-ol; Phenol |
| PubChem CID | 66587205 |
| CAS | 136112-00-0 |
| MDL-Nummer | MFCD00133763 |
| Molekulargewicht (g/mol) | 301.632 |
| SMILES | CC(C)CCO.C1=CC=C(C=C1)O.C(Cl)(Cl)Cl |
| Synonym | phenol-chloroform-isoamyl alcohol mixture,chloroform; isoamyl alcohol; phenol,phenol chloroform isoamyl alcohol,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 125:24:1,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 25:24:1,phenol-chloroform-isoamyl alcohol mixture, vetec tm reagent grade, 25:24:1,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 49.5:49.5:1,phenol:chloroform:isoamyl alcohol 25:24:1, ready-to-use saturated aqueous solution, ph 5.2, with alkaline buffer,phenol:chloroform:isoamyl alcohol 25:24:1, ready-to-use saturated aqueous solution, ph 6.7, with alkaline buffer |
| Summenformel | C12H19Cl3O2 |
Thermo Scientific Chemicals Tris(hydroxymethyl)aminomethanhydrochlorid, 1 M Lsg., pH 7.4, Rnase-frei
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| Chemischer Name oder Material | Neutralization solution |
|---|---|
| Gesundheitsgefahr 3 | P264b-P280-P302+P352-P305+P351+P338-P332+P313-P362 |
| Gesundheitsgefahr 1 | Gehäuse H315-H319 |
| Physikalische Form | Flüssig |
| Empfohlene Lagerung | Umgebungstemperaturen |
| MDL-Nummer | MFCD00283950 |
| TSCA | Ja |
EDTA-Dinatriumsalsalz-Lösung, volumetrisch, Reag. Ph. Eur., 0.1 M EDTA-Na2, für die Chelatometrie, Honeywell Fluka™
Volumetrisch, Reag. Ph. Eur., 0.1 M EDTA-Na2, für die Chelatometrie
| InChI-Schlüssel | ZGTMUACCHSMWAC-UHFFFAOYSA-L |
|---|---|
| PubChem CID | 57339238 |
| CAS | 139-33-3 |
| ChEBI | CHEBI:64734 |
| MDL-Nummer | MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 |
| Molekulargewicht (g/mol) | 336.21 |
| SMILES | [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | Ethylendiamin-Tetraessigsäure-Trinatriumsalz,Dinatrium2-2-bis-carboxymethyl-aminoethyl-carboxymethyl-Aminoessigsäure,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid |
| Summenformel | C10H14N2Na2O8 |
| Gesundheitsgefahr 2 | P273-P280-P305 + P351 + P338 |
|---|---|
| Chemischer Name oder Material | Luff-Schoorl Reagenz |
| UN-Nummer | UN3082 |
| CAS | 7758-98-7 |
EDTA-Dinatriumsalzlösung mit zugefügtem Zinkkomplex (Lösung B), 1 ml Lösung = 1 deutscher Härtegrad in 100 ml Wasser, für die Chelatometrie, Honeywell Fluka™
1 ml-Lösung = 1 deutscher Härtegrad in 100 ml Wasser, für die Komplexometrie
| UN-Nummer | NONH für alle Transportarten |
|---|---|
| CAS | 7732-18-5 |
lösung aus Ethylendiamin-Tetraessigsäure-Dinatriumsalz, 0.2 M, Honeywell Fluka ™
Volumetrisch, 0.2 M EDTA-Na2, für die Chelatometrie
| Chemischer Name oder Material | Ethylendiamin-Tetraessigsäure- Dinatriumsalzlösung |
|---|---|
| InChI-Schlüssel | ZGTMUACCHSMWAC-UHFFFAOYSA-L |
| PubChem CID | 57339238 |
| UN-Nummer | NONH für alle Transportarten |
| ChEBI | CHEBI:64734 |
| MDL-Nummer | MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 |
| Molekulargewicht (g/mol) | 336.21 |
| SMILES | [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | Ethylendiamin-Tetraessigsäure-Trinatriumsalz,Dinatrium2-2-bis-carboxymethyl-aminoethyl-carboxymethyl-Aminoessigsäure,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid |
| Beilstein | 3822669 |
| Summenformel | C10H14N2Na2O8 |
Thermo Scientific Chemicals Phenol:Chloroform:Isoamylalkohol25:24:1, gebrauchsfertige gesättigte wässr. Lösg., pH-Wert 5.2
CAS: 136112-00-0 Summenformel: C12H19Cl3O2 Molekulargewicht (g/mol): 301.632 MDL-Nummer: MFCD00133763 InChI-Schlüssel: ZYWFEOZQIUMEGL-UHFFFAOYSA-N Synonym: phenol-chloroform-isoamyl alcohol mixture,chloroform; isoamyl alcohol; phenol,phenol chloroform isoamyl alcohol,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 125:24:1,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 25:24:1,phenol-chloroform-isoamyl alcohol mixture, vetec tm reagent grade, 25:24:1,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 49.5:49.5:1,phenol:chloroform:isoamyl alcohol 25:24:1, ready-to-use saturated aqueous solution, ph 5.2, with alkaline buffer,phenol:chloroform:isoamyl alcohol 25:24:1, ready-to-use saturated aqueous solution, ph 6.7, with alkaline buffer PubChem CID: 66587205 IUPAC-Name: Chloroform; 3-Methylbutan-1-ol; Phenol SMILES: CC(C)CCO.C1=CC=C(C=C1)O.C(Cl)(Cl)Cl
| InChI-Schlüssel | ZYWFEOZQIUMEGL-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Chloroform; 3-Methylbutan-1-ol; Phenol |
| PubChem CID | 66587205 |
| CAS | 136112-00-0 |
| MDL-Nummer | MFCD00133763 |
| Molekulargewicht (g/mol) | 301.632 |
| SMILES | CC(C)CCO.C1=CC=C(C=C1)O.C(Cl)(Cl)Cl |
| Synonym | phenol-chloroform-isoamyl alcohol mixture,chloroform; isoamyl alcohol; phenol,phenol chloroform isoamyl alcohol,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 125:24:1,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 25:24:1,phenol-chloroform-isoamyl alcohol mixture, vetec tm reagent grade, 25:24:1,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 49.5:49.5:1,phenol:chloroform:isoamyl alcohol 25:24:1, ready-to-use saturated aqueous solution, ph 5.2, with alkaline buffer,phenol:chloroform:isoamyl alcohol 25:24:1, ready-to-use saturated aqueous solution, ph 6.7, with alkaline buffer |
| Summenformel | C12H19Cl3O2 |