Organische Säuren und Derivate
Gefilterte Suchergebnisse
Natrium 1-Octansulfonat-Monohydrat, 99 +%, Thermo Scientific Chemicals
CAS: 207596-29-0 Summenformel: C8H19NaO4S Molekulargewicht (g/mol): 234.29 MDL-Nummer: MFCD00149551 InChI-Schlüssel: MBURIAHQXJQKRE-UHFFFAOYSA-M Synonym: sodium octane-1-sulfonate hydrate,1-octanesulfonic acid sodium salt monohydrate,sodium 1-octanesulfonate monohydrate,1-octanesulfonic acid, sodium salt, monohydrate,sodium 1-octanesulfonate hydrate,1-octane sulfonic acid, na,acmc-20p1dl,ksc496c2b,sodium1-octanesulfonatemonohydrate,potassium hydrate octane-1-sulfonate PubChem CID: 23666339 IUPAC-Name: Natrium;-oktan-1-sulfonat;hydrat SMILES: O.[Na+].CCCCCCCCS([O-])(=O)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | MBURIAHQXJQKRE-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium;-oktan-1-sulfonat;hydrat |
| PubChem CID | 23666339 |
| CAS | 207596-29-0 |
| MDL-Nummer | MFCD00149551 |
| Molekulargewicht (g/mol) | 234.29 |
| SMILES | O.[Na+].CCCCCCCCS([O-])(=O)=O |
| Synonym | sodium octane-1-sulfonate hydrate,1-octanesulfonic acid sodium salt monohydrate,sodium 1-octanesulfonate monohydrate,1-octanesulfonic acid, sodium salt, monohydrate,sodium 1-octanesulfonate hydrate,1-octane sulfonic acid, na,acmc-20p1dl,ksc496c2b,sodium1-octanesulfonatemonohydrate,potassium hydrate octane-1-sulfonate |
| Summenformel | C8H19NaO4S |
Trinatriumcitrat-Dihydrat, 99 %, Thermo Scientific Chemicals
CAS: 4-3-6132 Summenformel: C6H9Na3O9 Molekulargewicht (g/mol): 294.10 MDL-Nummer: MFCD00150031 InChI-Schlüssel: NLJMYIDDQXHKNR-UHFFFAOYSA-K Synonym: trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate PubChem CID: 71474 ChEBI: CHEBI:32142 IUPAC-Name: Trinatrium;2-Hydroxypropan-1,2,3-Tricarboxylat;Dihydrat SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | NLJMYIDDQXHKNR-UHFFFAOYSA-K |
|---|---|
| IUPAC-Name | Trinatrium;2-Hydroxypropan-1,2,3-Tricarboxylat;Dihydrat |
| PubChem CID | 71474 |
| CAS | 4-3-6132 |
| ChEBI | CHEBI:32142 |
| MDL-Nummer | MFCD00150031 |
| Molekulargewicht (g/mol) | 294.10 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+] |
| Synonym | trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate |
| Summenformel | C6H9Na3O9 |
Natriumbenzoat, 99 %, Thermo Scientific Chemicals
CAS: 532-32-1 Summenformel: C7H5NaO2 Molekulargewicht (g/mol): 144.11 MDL-Nummer: MFCD00012463 InChI-Schlüssel: WXMKPNITSTVMEF-UHFFFAOYSA-M Synonym: sodium benzoate,benzoic acid, sodium salt,benzoic acid sodium salt,sobenate,antimol,benzoate sodium,benzoate of soda,benzoate, sodium,natrium benzoicum,caswell no. 746 PubChem CID: 517055 SMILES: [Na+].[O-]C(=O)C1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | WXMKPNITSTVMEF-UHFFFAOYSA-M |
|---|---|
| PubChem CID | 517055 |
| CAS | 532-32-1 |
| MDL-Nummer | MFCD00012463 |
| Molekulargewicht (g/mol) | 144.11 |
| SMILES | [Na+].[O-]C(=O)C1=CC=CC=C1 |
| Synonym | sodium benzoate,benzoic acid, sodium salt,benzoic acid sodium salt,sobenate,antimol,benzoate sodium,benzoate of soda,benzoate, sodium,natrium benzoicum,caswell no. 746 |
| Summenformel | C7H5NaO2 |
Harnstoff, AR-zertifiziert für Analysen, Fisher Chemical™
CAS: 57-13-6 Summenformel: CH4N2O Molekulargewicht (g/mol): 60.056 MDL-Nummer: 8022 InChI-Schlüssel: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: Carbamid,Isoharnstoff,Carbonyldiamid,Ureaphil,Carbonyldiamin,Carbamidinsäure,Pseudoharnstoff,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC-Name: Harnstoff SMILES: C(=O)(N)N
| InChI-Schlüssel | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Harnstoff |
| PubChem CID | 1176 |
| CAS | 57-13-6 |
| ChEBI | CHEBI:48376 |
| MDL-Nummer | 8022 |
| Molekulargewicht (g/mol) | 60.056 |
| SMILES | C(=O)(N)N |
| Synonym | Carbamid,Isoharnstoff,Carbonyldiamid,Ureaphil,Carbonyldiamin,Carbamidinsäure,Pseudoharnstoff,ureaphil,urevert,alphadrate |
| Summenformel | CH4N2O |
Citronensäure, Trinatriumsalz-Dihydrat, ACS-Reagenz, Thermo Scientific Chemicals
CAS: 4-3-6132 Summenformel: C6H5Na3O7·2H2O Molekulargewicht (g/mol): 294.09 InChI-Schlüssel: NLJMYIDDQXHKNR-UHFFFAOYSA-K Synonym: trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate PubChem CID: 71474 ChEBI: CHEBI:32142 IUPAC-Name: Trinatrium;2-Hydroxypropan-1,2,3-Tricarboxylat;Dihydrat SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+]
| InChI-Schlüssel | NLJMYIDDQXHKNR-UHFFFAOYSA-K |
|---|---|
| IUPAC-Name | Trinatrium;2-Hydroxypropan-1,2,3-Tricarboxylat;Dihydrat |
| PubChem CID | 71474 |
| CAS | 4-3-6132 |
| ChEBI | CHEBI:32142 |
| Molekulargewicht (g/mol) | 294.09 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+] |
| Synonym | trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate |
| Summenformel | C6H5Na3O7·2H2O |
Natriumzitratdihydrat (kleine, farblose Granulate), Fisher BioReagents
CAS: 6132-04-3 Summenformel: C6H9Na3O9 Molekulargewicht (g/mol): 294.10 InChI-Schlüssel: NLJMYIDDQXHKNR-UHFFFAOYSA-K Synonym: trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate PubChem CID: 71474 ChEBI: CHEBI:32142 IUPAC-Name: Trinatrium;2-Hydroxypropan-1,2,3-Tricarboxylat;Dihydrat SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | NLJMYIDDQXHKNR-UHFFFAOYSA-K |
|---|---|
| IUPAC-Name | Trinatrium;2-Hydroxypropan-1,2,3-Tricarboxylat;Dihydrat |
| PubChem CID | 71474 |
| CAS | 6132-04-3 |
| ChEBI | CHEBI:32142 |
| Molekulargewicht (g/mol) | 294.10 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+] |
| Synonym | trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate |
| Summenformel | C6H9Na3O9 |
2,2'-Azino-bis(3-Ethylbenzothiazolin6-Sulfonsäure) Diammoniumsalz, 98 %., Thermo Scientific Chemicals
CAS: 30931-67-0 Summenformel: C18H24N6O6S4 Molekulargewicht (g/mol): 548.67 MDL-Nummer: MFCD00010404,MFCD00010404 InChI-Schlüssel: OHDRQQURAXLVGJ-AXMZSLBLSA-N Synonym: ammonium 2,2'-hydrazine-1,2-diylidene bis 3-ethyl-2,3-dihydrobenzo d thiazole-6-sulfonate PubChem CID: 91884754 IUPAC-Name: Diazanium;-3-ethyl-2-[(E)-(3-ethyl-6-sulfonato-1,3-benzothiazol-2-ylidene)hydrazinyliden]-1,3-benzothiazol-6-sulfonat SMILES: [NH4+].[NH4+].CCN1\C(SC2=CC(=CC=C12)S([O-])(=O)=O)=N\N=C1/SC2=CC(=CC=C2N1CC)S([O-])(=O)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | OHDRQQURAXLVGJ-AXMZSLBLSA-N |
|---|---|
| IUPAC-Name | Diazanium;-3-ethyl-2-[(E)-(3-ethyl-6-sulfonato-1,3-benzothiazol-2-ylidene)hydrazinyliden]-1,3-benzothiazol-6-sulfonat |
| PubChem CID | 91884754 |
| CAS | 30931-67-0 |
| MDL-Nummer | MFCD00010404,MFCD00010404 |
| Molekulargewicht (g/mol) | 548.67 |
| SMILES | [NH4+].[NH4+].CCN1\C(SC2=CC(=CC=C12)S([O-])(=O)=O)=N\N=C1/SC2=CC(=CC=C2N1CC)S([O-])(=O)=O |
| Synonym | ammonium 2,2'-hydrazine-1,2-diylidene bis 3-ethyl-2,3-dihydrobenzo d thiazole-6-sulfonate |
| Summenformel | C18H24N6O6S4 |
N,N-Dimethylacetamid, 99 %, Thermo Scientific Chemicals
CAS: 127-19-5 Summenformel: C4H9NO Molekulargewicht (g/mol): 87.12 MDL-Nummer: MFCD00008686 InChI-Schlüssel: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC-Name: N,N-Dimethylacetamid SMILES: CN(C)C(C)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | N,N-Dimethylacetamid |
| PubChem CID | 31374 |
| CAS | 127-19-5 |
| ChEBI | CHEBI:84254 |
| MDL-Nummer | MFCD00008686 |
| Molekulargewicht (g/mol) | 87.12 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| Summenformel | C4H9NO |
Harnstoff, 98+%, Thermo Scientific Chemicals
CAS: 57-13-6 Summenformel: CH4N2O Molekulargewicht (g/mol): 60.056 MDL-Nummer: MFCD00008022 InChI-Schlüssel: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC-Name: Harnstoff SMILES: C(=O)(N)N
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Harnstoff |
| PubChem CID | 1176 |
| CAS | 57-13-6 |
| ChEBI | CHEBI:48376 |
| MDL-Nummer | MFCD00008022 |
| Molekulargewicht (g/mol) | 60.056 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| Summenformel | CH4N2O |
Trans-1,2 -Diaminocyclohexan-N,N,N',N'-Tetraessigsäure-Monohydrat, 98 %, Thermo Scientific Chemicals
CAS: 125572-95-4 Summenformel: C14H20N2O8 Molekulargewicht (g/mol): 344.32 MDL-Nummer: MFCD00149243,MFCD00066429,MFCD00003845 InChI-Schlüssel: FCKYPQBAHLOOJQ-NXEZZACHSA-L Synonym: 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd PubChem CID: 2723844 SMILES: [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | FCKYPQBAHLOOJQ-NXEZZACHSA-L |
|---|---|
| PubChem CID | 2723844 |
| CAS | 125572-95-4 |
| MDL-Nummer | MFCD00149243,MFCD00066429,MFCD00003845 |
| Molekulargewicht (g/mol) | 344.32 |
| SMILES | [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| Synonym | 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd |
| Summenformel | C14H20N2O8 |
Harnstoff, hochrein, 99%, Thermo Scientific Chemicals
CAS: 57-13-6 Summenformel: CH4N2O Molekulargewicht (g/mol): 60.056 MDL-Nummer: MFCD00008022 InChI-Schlüssel: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC-Name: Harnstoff SMILES: C(=O)(N)N
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Harnstoff |
| PubChem CID | 1176 |
| CAS | 57-13-6 |
| ChEBI | CHEBI:48376 |
| MDL-Nummer | MFCD00008022 |
| Molekulargewicht (g/mol) | 60.056 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| Summenformel | CH4N2O |
L-Ascorbinsäure-Natriumsalz, 99 %, Thermo Scientific Chemicals
CAS: 134-03-2 Summenformel: C6H7NaO6 Molekulargewicht (g/mol): 198.11 MDL-Nummer: MFCD00082340 InChI-Schlüssel: IFVCRSPJFHGFCG-HXPAKLQESA-N Synonym: sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate PubChem CID: 131674100 IUPAC-Name: (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-on;hydridonatrium SMILES: [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | IFVCRSPJFHGFCG-HXPAKLQESA-N |
|---|---|
| IUPAC-Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-on;hydridonatrium |
| PubChem CID | 131674100 |
| CAS | 134-03-2 |
| MDL-Nummer | MFCD00082340 |
| Molekulargewicht (g/mol) | 198.11 |
| SMILES | [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| Synonym | sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate |
| Summenformel | C6H7NaO6 |
Citronensäure-Monohydrat, ACS Reagenz, Thermo Scientific Chemicals
CAS: 5949-29-1 Summenformel: C6H8O7·H2O Molekulargewicht (g/mol): 210.15 InChI-Schlüssel: YASYEJJMZJALEJ-UHFFFAOYSA-N Synonym: citric acid monohydrate,citric acid hydrate,2-hydroxypropane-1,2,3-tricarboxylic acid hydrate,citric acid, monohydrate,unii-2968phw8qp,1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate,citrate,acidum citricum monohydricum,citric acid monohydrate usp PubChem CID: 22230 ChEBI: CHEBI:31404 IUPAC-Name: 2-Hydroxypropan-1,2,3-Tricarboxylsäure-; Hydrat SMILES: C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | YASYEJJMZJALEJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Hydroxypropan-1,2,3-Tricarboxylsäure-; Hydrat |
| PubChem CID | 22230 |
| CAS | 5949-29-1 |
| ChEBI | CHEBI:31404 |
| Molekulargewicht (g/mol) | 210.15 |
| SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O |
| Synonym | citric acid monohydrate,citric acid hydrate,2-hydroxypropane-1,2,3-tricarboxylic acid hydrate,citric acid, monohydrate,unii-2968phw8qp,1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate,citrate,acidum citricum monohydricum,citric acid monohydrate usp |
| Summenformel | C6H8O7·H2O |
Propylencarbonat, 99.50 %, Thermo Scientific Chemicals
CAS: 108-32-7 Summenformel: C4H6O3 Molekulargewicht (g/mol): 102.09 MDL-Nummer: MFCD00005385,MFCD00798264,MFCD00798265 InChI-Schlüssel: RUOJZAUFBMNUDX-UHFFFAOYNA-N Synonym: propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate PubChem CID: 7924 IUPAC-Name: 4-methyl-1,3-dioxolan-2-on SMILES: CC1COC(=O)O1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RUOJZAUFBMNUDX-UHFFFAOYNA-N |
|---|---|
| IUPAC-Name | 4-methyl-1,3-dioxolan-2-on |
| PubChem CID | 7924 |
| CAS | 108-32-7 |
| MDL-Nummer | MFCD00005385,MFCD00798264,MFCD00798265 |
| Molekulargewicht (g/mol) | 102.09 |
| SMILES | CC1COC(=O)O1 |
| Synonym | propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate |
| Summenformel | C4H6O3 |
1Heptansulfonsäure-Natriumsalz, Monohydrat, geeignet für die HPLC, Thermo Scientific Chemicals
„Greener Choice“-Produkt
Diese Produkt bietet einen oder mehrere umweltfreundliche Vorteile entsprechend den „Green Guides“ der FTC der USA.
Erfahren Sie mehr über das „Greener Choice“-Programm
Diese Produkt bietet einen oder mehrere umweltfreundliche Vorteile entsprechend den „Green Guides“ der FTC der USA.
Erfahren Sie mehr über das „Greener Choice“-Programm
CAS: 207300-90-1 InChI-Schlüssel: XWZCREJRXRKIRQ-UHFFFAOYSA-M Synonym: Natriumheptan-1-sulfonat; Hydrat,1-Heptansulfonsäure-Natriumsalz-Monohydrat,Natrium-1-Heptansulfonat-Monohydrat,Natrium-1-heptansulfonathydrat,Natrium-1-heptansulfonatmonohydrat,Natriumheptan-1-sulfonat, Hydrat,Natriumheptan-1-sulfonat-Wasser 1/1/1,Natrium-1-Heptansulfonat-Monohydrat t,Natrium-1-Heptansulfonat-Monohydrat, für HPLC PubChem CID: 23687711 IUPAC-Name: Natrium;-heptan-1-sulfonat;hydrat SMILES: CCCCCCCS(=O)(=O)[O-].O.[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | XWZCREJRXRKIRQ-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium;-heptan-1-sulfonat;hydrat |
| PubChem CID | 23687711 |
| CAS | 207300-90-1 |
| SMILES | CCCCCCCS(=O)(=O)[O-].O.[Na+] |
| Synonym | Natriumheptan-1-sulfonat; Hydrat,1-Heptansulfonsäure-Natriumsalz-Monohydrat,Natrium-1-Heptansulfonat-Monohydrat,Natrium-1-heptansulfonathydrat,Natrium-1-heptansulfonatmonohydrat,Natriumheptan-1-sulfonat, Hydrat,Natriumheptan-1-sulfonat-Wasser 1/1/1,Natrium-1-Heptansulfonat-Monohydrat t,Natrium-1-Heptansulfonat-Monohydrat, für HPLC |