Benzol und substituierte Derivate
Gefilterte Suchergebnisse
p-Anisaldehyd +99 %, Thermo Scientific Chemicals
CAS: 123-11-5 Summenformel: C8H8O2 Molekulargewicht (g/mol): 136.15 MDL-Nummer: MFCD00003385 InChI-Schlüssel: ZRSNZINYAWTAHE-UHFFFAOYSA-N Synonym: p-anisaldehyde,anisaldehyde,anisic aldehyde,p-methoxybenzaldehyde,4-anisaldehyde,aubepine,p-anisic aldehyde,p-formylanisole,benzaldehyde, 4-methoxy,crategine PubChem CID: 31244 ChEBI: CHEBI:28235 IUPAC-Name: 4-Methoxybenzaldehyd SMILES: COC1=CC=C(C=C1)C=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ZRSNZINYAWTAHE-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-Methoxybenzaldehyd |
| PubChem CID | 31244 |
| CAS | 123-11-5 |
| ChEBI | CHEBI:28235 |
| MDL-Nummer | MFCD00003385 |
| Molekulargewicht (g/mol) | 136.15 |
| SMILES | COC1=CC=C(C=C1)C=O |
| Synonym | p-anisaldehyde,anisaldehyde,anisic aldehyde,p-methoxybenzaldehyde,4-anisaldehyde,aubepine,p-anisic aldehyde,p-formylanisole,benzaldehyde, 4-methoxy,crategine |
| Summenformel | C8H8O2 |
Benzylalkohol, 99 %, rein, Thermo Scientific Chemicals
CAS: 100-51-6 Summenformel: C7H8O Molekulargewicht (g/mol): 108.14 MDL-Nummer: MFCD00004599,MFCD03792087 InChI-Schlüssel: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC-Name: Phenylmethanol SMILES: OCC1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | WVDDGKGOMKODPV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Phenylmethanol |
| PubChem CID | 244 |
| CAS | 100-51-6 |
| ChEBI | CHEBI:17987 |
| MDL-Nummer | MFCD00004599,MFCD03792087 |
| Molekulargewicht (g/mol) | 108.14 |
| SMILES | OCC1=CC=CC=C1 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| Summenformel | C7H8O |
DAPT, Thermo Scientific Chemicals
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
Isoeugenol, Mischung aus cis/trans-Isomeren 99 %, Thermo Scientific Chemicals
CAS: 97-54-1 Summenformel: C10H12O2 Molekulargewicht (g/mol): 164.20 MDL-Nummer: MFCD00009285 InChI-Schlüssel: BJIOGJUNALELMI-ONEGZZNKSA-N Synonym: isoeugenol,e-isoeugenol,trans-isoeugenol,2-methoxy-4-propenylphenol,4-propenylguaiacol,4-hydroxy-3-methoxy-1-propenylbenzene,2-methoxy-4-prop-1-en-1-yl phenol,trans-p-propenylquaiacol,isoeugenol trans-form,4-hydroxy-3-methoxypropenylbenzene PubChem CID: 853433 ChEBI: CHEBI:50545 SMILES: COC1=CC(\C=C\C)=CC=C1O
| InChI-Schlüssel | BJIOGJUNALELMI-ONEGZZNKSA-N |
|---|---|
| PubChem CID | 853433 |
| CAS | 97-54-1 |
| ChEBI | CHEBI:50545 |
| MDL-Nummer | MFCD00009285 |
| Molekulargewicht (g/mol) | 164.20 |
| SMILES | COC1=CC(\C=C\C)=CC=C1O |
| Synonym | isoeugenol,e-isoeugenol,trans-isoeugenol,2-methoxy-4-propenylphenol,4-propenylguaiacol,4-hydroxy-3-methoxy-1-propenylbenzene,2-methoxy-4-prop-1-en-1-yl phenol,trans-p-propenylquaiacol,isoeugenol trans-form,4-hydroxy-3-methoxypropenylbenzene |
| Summenformel | C10H12O2 |
Natriumsalicylat, 99 %, Thermo Scientific Chemicals
CAS: 54-21-7 Summenformel: C7H5NaO3 Molekulargewicht (g/mol): 160.104 MDL-Nummer: MFCD00002440 InChI-Schlüssel: ABBQHOQBGMUPJH-UHFFFAOYSA-M Synonym: sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl PubChem CID: 16760658 ChEBI: CHEBI:9180 IUPAC-Name: Natrium;2-Hydroxybenzoat SMILES: C1=CC=C(C(=C1)C(=O)[O-])O.[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium;2-Hydroxybenzoat |
| PubChem CID | 16760658 |
| CAS | 54-21-7 |
| ChEBI | CHEBI:9180 |
| MDL-Nummer | MFCD00002440 |
| Molekulargewicht (g/mol) | 160.104 |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] |
| Synonym | sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl |
| Summenformel | C7H5NaO3 |
Thermo Scientific Chemicals Basisches Fuchsin
CAS: 632-99-5 Summenformel: C20H20ClN3 Molekulargewicht (g/mol): 337.85 MDL-Nummer: MFCD00012569 InChI-Schlüssel: AXDJCCTWPBKUKL-UHFFFAOYSA-N Synonym: basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic PubChem CID: 12447 IUPAC-Name: hydrogen 4-[(4-aminophenyl)(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline chloride SMILES: [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | AXDJCCTWPBKUKL-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | hydrogen 4-[(4-aminophenyl)(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline chloride |
| PubChem CID | 12447 |
| CAS | 632-99-5 |
| MDL-Nummer | MFCD00012569 |
| Molekulargewicht (g/mol) | 337.85 |
| SMILES | [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1 |
| Synonym | basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic |
| Summenformel | C20H20ClN3 |
Benzoesäure, 99,6 %, ACS-Reagenz
CAS: 65-85-0 Summenformel: C7H6O2 Molekulargewicht (g/mol): 122.12 InChI-Schlüssel: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC-Name: Benzoesäure SMILES: C1=CC=C(C=C1)C(=O)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Benzoesäure |
| PubChem CID | 243 |
| CAS | 65-85-0 |
| ChEBI | CHEBI:30746 |
| Molekulargewicht (g/mol) | 122.12 |
| SMILES | C1=CC=C(C=C1)C(=O)O |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| Summenformel | C7H6O2 |
4-Dimethylaminobenzaldehyd, 99+ %, Thermo Scientific Chemicals
CAS: 100-10-7 Summenformel: C9H11NO Molekulargewicht (g/mol): 149.19 MDL-Nummer: MFCD00003381 InChI-Schlüssel: BGNGWHSBYQYVRX-UHFFFAOYSA-N Synonym: 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal PubChem CID: 7479 IUPAC-Name: 4-(dimethylamino)benzaldehyde SMILES: CN(C)C1=CC=C(C=O)C=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | BGNGWHSBYQYVRX-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-(dimethylamino)benzaldehyde |
| PubChem CID | 7479 |
| CAS | 100-10-7 |
| MDL-Nummer | MFCD00003381 |
| Molekulargewicht (g/mol) | 149.19 |
| SMILES | CN(C)C1=CC=C(C=O)C=C1 |
| Synonym | 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal |
| Summenformel | C9H11NO |
2-Phenoxyethanol, 94 %, Thermo Scientific Chemicals
CAS: 122-99-6 Summenformel: C8H10O2 Molekulargewicht (g/mol): 138.166 MDL-Nummer: MFCD00002857 InChI-Schlüssel: QCDWFXQBSFUVSP-UHFFFAOYSA-N Synonym: phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane PubChem CID: 31236 ChEBI: CHEBI:64275 IUPAC-Name: 2-Phenoxyethanol SMILES: C1=CC=C(C=C1)OCCO
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | QCDWFXQBSFUVSP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Phenoxyethanol |
| PubChem CID | 31236 |
| CAS | 122-99-6 |
| ChEBI | CHEBI:64275 |
| MDL-Nummer | MFCD00002857 |
| Molekulargewicht (g/mol) | 138.166 |
| SMILES | C1=CC=C(C=C1)OCCO |
| Synonym | phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane |
| Summenformel | C8H10O2 |
Methylendi-p-phenyl diisocyanat, 98 %, Flocken, Thermo Scientific Chemicals
CAS: 101-68-8 Summenformel: C15H10N2O2 Molekulargewicht (g/mol): 250.26 MDL-Nummer: MFCD00036131 InChI-Schlüssel: UPMLOUAZCHDJJD-UHFFFAOYSA-N Synonym: 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate PubChem CID: 7570 ChEBI: CHEBI:53218 IUPAC-Name: 1-Isocyanat-4-[(4-isocyanatphenyl)methyl]Benzol SMILES: C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | UPMLOUAZCHDJJD-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1-Isocyanat-4-[(4-isocyanatphenyl)methyl]Benzol |
| PubChem CID | 7570 |
| CAS | 101-68-8 |
| ChEBI | CHEBI:53218 |
| MDL-Nummer | MFCD00036131 |
| Molekulargewicht (g/mol) | 250.26 |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O |
| Synonym | 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate |
| Summenformel | C15H10N2O2 |
4-Methoxybenzaldehyd, 98 %, Thermo Scientific Chemicals
CAS: 123-11-5 Summenformel: C8H8O2 Molekulargewicht (g/mol): 136.15 MDL-Nummer: MFCD00003385 InChI-Schlüssel: ZRSNZINYAWTAHE-UHFFFAOYSA-N Synonym: p-anisaldehyde,anisaldehyde,anisic aldehyde,p-methoxybenzaldehyde,4-anisaldehyde,aubepine,p-anisic aldehyde,p-formylanisole,benzaldehyde, 4-methoxy,crategine PubChem CID: 31244 ChEBI: CHEBI:28235 IUPAC-Name: 4-Methoxybenzaldehyd SMILES: COC1=CC=C(C=C1)C=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ZRSNZINYAWTAHE-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-Methoxybenzaldehyd |
| PubChem CID | 31244 |
| CAS | 123-11-5 |
| ChEBI | CHEBI:28235 |
| MDL-Nummer | MFCD00003385 |
| Molekulargewicht (g/mol) | 136.15 |
| SMILES | COC1=CC=C(C=C1)C=O |
| Synonym | p-anisaldehyde,anisaldehyde,anisic aldehyde,p-methoxybenzaldehyde,4-anisaldehyde,aubepine,p-anisic aldehyde,p-formylanisole,benzaldehyde, 4-methoxy,crategine |
| Summenformel | C8H8O2 |
2-Phenoxyethanol, 99 %, Thermo Scientific Chemicals
CAS: 122-99-6 Summenformel: C8H10O2 Molekulargewicht (g/mol): 138.17 MDL-Nummer: MFCD00002857 InChI-Schlüssel: QCDWFXQBSFUVSP-UHFFFAOYSA-N Synonym: phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane PubChem CID: 31236 ChEBI: CHEBI:64275 IUPAC-Name: 2-Phenoxyethanol SMILES: C1=CC=C(C=C1)OCCO
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | QCDWFXQBSFUVSP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Phenoxyethanol |
| PubChem CID | 31236 |
| CAS | 122-99-6 |
| ChEBI | CHEBI:64275 |
| MDL-Nummer | MFCD00002857 |
| Molekulargewicht (g/mol) | 138.17 |
| SMILES | C1=CC=C(C=C1)OCCO |
| Synonym | phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane |
| Summenformel | C8H10O2 |
Methylsalicylat, 98 %, Thermo Scientific Chemicals
CAS: 119-36-8 Summenformel: C8H8O3 Molekulargewicht (g/mol): 152.149 MDL-Nummer: MFCD00002214 InChI-Schlüssel: OSWPMRLSEDHDFF-UHFFFAOYSA-N Synonym: methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester PubChem CID: 4133 ChEBI: CHEBI:31832 IUPAC-Name: Methyl 2-Hydroxybenzoat SMILES: COC(=O)C1=CC=CC=C1O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | OSWPMRLSEDHDFF-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Methyl 2-Hydroxybenzoat |
| PubChem CID | 4133 |
| CAS | 119-36-8 |
| ChEBI | CHEBI:31832 |
| MDL-Nummer | MFCD00002214 |
| Molekulargewicht (g/mol) | 152.149 |
| SMILES | COC(=O)C1=CC=CC=C1O |
| Synonym | methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester |
| Summenformel | C8H8O3 |
Tetrakis(triphenylphosphin)palladium(0), 99 %, Thermo Scientific Chemicals
CAS: 14221-01-3 Summenformel: C72H60P4Pd Molekulargewicht (g/mol): 1155.59 MDL-Nummer: MFCD00010012 InChI-Schlüssel: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC-Name: palladium;triphenylphosphan SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | palladium;triphenylphosphan |
| PubChem CID | 11979704 |
| CAS | 14221-01-3 |
| MDL-Nummer | MFCD00010012 |
| Molekulargewicht (g/mol) | 1155.59 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| Summenformel | C72H60P4Pd |
Veratrol +99 %, Thermo Scientific Chemicals
CAS: 91-16-7 Summenformel: C8H10O2 Molekulargewicht (g/mol): 138.17 MDL-Nummer: MFCD00008357 InChI-Schlüssel: ABDKAPXRBAPSQN-UHFFFAOYSA-N Synonym: veratrole,veratrol,pyrocatechol dimethyl ether,o-dimethoxybenzene,catechol dimethyl ether,benzene, 1,2-dimethoxy,2-methoxyanisole,o,o-dimethyl catechol,2-dimethoxybenzol,benzene, o-dimethoxy PubChem CID: 7043 ChEBI: CHEBI:59114 IUPAC-Name: 1,2-Dimethoxybenzol SMILES: COC1=CC=CC=C1OC
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ABDKAPXRBAPSQN-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1,2-Dimethoxybenzol |
| PubChem CID | 7043 |
| CAS | 91-16-7 |
| ChEBI | CHEBI:59114 |
| MDL-Nummer | MFCD00008357 |
| Molekulargewicht (g/mol) | 138.17 |
| SMILES | COC1=CC=CC=C1OC |
| Synonym | veratrole,veratrol,pyrocatechol dimethyl ether,o-dimethoxybenzene,catechol dimethyl ether,benzene, 1,2-dimethoxy,2-methoxyanisole,o,o-dimethyl catechol,2-dimethoxybenzol,benzene, o-dimethoxy |
| Summenformel | C8H10O2 |