Metallorganische Verbindungen
Gefilterte Suchergebnisse
3-(Trimethoxysilyl)propylmethacrylat, 98 %, Thermo Scientific Chemicals
CAS: 2530-85-0 Summenformel: C10H20O5Si Molekulargewicht (g/mol): 248.35 MDL-Nummer: MFCD00008593 InChI-Schlüssel: XDLMVUHYZWKMMD-UHFFFAOYSA-N Synonym: 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester PubChem CID: 17318 IUPAC-Name: 3-Trimethoxysilylpropyl-2-methylprop-2-enoat SMILES: CC(=C)C(=O)OCCC[Si](OC)(OC)OC
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | XDLMVUHYZWKMMD-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Trimethoxysilylpropyl-2-methylprop-2-enoat |
| PubChem CID | 17318 |
| CAS | 2530-85-0 |
| MDL-Nummer | MFCD00008593 |
| Molekulargewicht (g/mol) | 248.35 |
| SMILES | CC(=C)C(=O)OCCC[Si](OC)(OC)OC |
| Synonym | 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester |
| Summenformel | C10H20O5Si |
Chlorotrimethylsilan, 98 %, Thermo Scientific Chemicals
CAS: 75-77-4 Summenformel: C3H9ClSi Molekulargewicht (g/mol): 108.64 MDL-Nummer: MFCD00000502 InChI-Schlüssel: IJOOHPMOJXWVHK-UHFFFAOYSA-N Synonym: trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl PubChem CID: 6397 ChEBI: CHEBI:85069 IUPAC-Name: Chlor(trimethyl)silan SMILES: C[Si](C)(C)Cl
| InChI-Schlüssel | IJOOHPMOJXWVHK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Chlor(trimethyl)silan |
| PubChem CID | 6397 |
| CAS | 75-77-4 |
| ChEBI | CHEBI:85069 |
| MDL-Nummer | MFCD00000502 |
| Molekulargewicht (g/mol) | 108.64 |
| SMILES | C[Si](C)(C)Cl |
| Synonym | trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl |
| Summenformel | C3H9ClSi |
Diisobutylaluminiumhydrid, 1M Lösung in Cyclohexan, AcroSeal™, Thermo Scientific Chemicals
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Chemischer Name oder Material | Diisobutylaluminium hydride |
|---|---|
| Dichte | 0.7010g/mL |
| EINECS-Nummer | 214-729-9 |
| Relative Dichte | 0.701 |
| Molekulargewicht (g/mol) | 142.22 |
| Merck Index | 15, 3212 |
| Namenshinweis | 1M Solution in Hexane |
| Formelmasse | 142.22 |
| Gesundheitsgefahr 2 | GHS H Statement May be fatal if swallowed and enters airways. Toxic to aquatic life with long lasting effects. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. May cause damage to organs through p |
| Gesundheitsgefahr 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective g |
| Löslichkeitsinformationen | Solubility in water: reacts |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Physikalische Form | Lösung |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 110-54-3 |
| MDL-Nummer | MFCD00008928 |
| Strukturformel | [(CH3)2CHCH2]2AlH |
| Flammpunkt | −23°C |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Summenformel | C8H19Al |
| Schmelzpunkt | -70.0°C |
| Chemischer Name oder Material | Lithium bis(trimethylsilyl)amide |
|---|---|
| InChI-Schlüssel | YNESATAKKCNGOF-UHFFFAOYSA-N |
| IUPAC-Name | Lithium; Bis(trimethylsilyl)azanid |
| Siedepunkt | 65.0°C |
| Dichte | 0.9000g/mL |
| EINECS-Nummer | 223-725-6 |
| Relative Dichte | 0.9 |
| Molekulargewicht (g/mol) | 167.33 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Formelmasse | 167.33 |
| Gesundheitsgefahr 2 | GHS-H-Hinweis Flüssigkeit und Dampf leicht entzündbar. Verursacht schwere Verätzungen der Haut und schwere Augenschäden. Kann die Atemwege reizen. Verdacht auf krebserregende Wirkung. Kann explosionsfähige Peroxide bilden. Reagiert heftig mit Wasser.<br/ |
| Gesundheitsgefahr 3 | GHS-P-Hinweis Von Hitze/Funken/offenen Flammen/heißen Oberflächen fernhalten. - Rauchen verboten. BEI BERÜHRUNG DER HAUT (oder des Haars): Alle kontaminierten Kleidungsstücke sofort ausziehen. Haut mit Wasser abwaschen [oder duschen]. Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| PubChem CID | 2733832 |
| Löslichkeitsinformationen | Solubility in water: reacts. |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| CAS | 109-99-9 |
| Strukturformel | ((CH3)3Si)2NLi |
| Flammpunkt | −21°C |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| Summenformel | C6H18LiNSi2 |
Tetraethylorthosilicat, 98 %, Thermo Scientific Chemicals
CAS: 78-10-4 Summenformel: C8H20O4Si Molekulargewicht (g/mol): 208.33 MDL-Nummer: MFCD00009062 InChI-Schlüssel: BOTDANWDWHJENH-UHFFFAOYSA-N Synonym: tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate PubChem CID: 6517 IUPAC-Name: Tetraethylsilikat SMILES: CCO[Si](OCC)(OCC)OCC
| InChI-Schlüssel | BOTDANWDWHJENH-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Tetraethylsilikat |
| PubChem CID | 6517 |
| CAS | 78-10-4 |
| MDL-Nummer | MFCD00009062 |
| Molekulargewicht (g/mol) | 208.33 |
| SMILES | CCO[Si](OCC)(OCC)OCC |
| Synonym | tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate |
| Summenformel | C8H20O4Si |
N,O-Bis-(Trimethylsilyl)-Trifluoracetamid, mit 1 % Trimethylsilylchlorid, Thermo Scientific Chemicals
CAS: 25561-30-2 Summenformel: C8H18F3NOSi2 Molekulargewicht (g/mol): 257.4 MDL-Nummer: MFCD00008269 InChI-Schlüssel: XCOBLONWWXQEBS-GHXNOFRVSA-N Synonym: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate PubChem CID: 9601896 IUPAC-Name: Trimethylsilyl-(1Z)-2,2,2-trifluor-N-trimethylsilylethanimidat SMILES: C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C
| InChI-Schlüssel | XCOBLONWWXQEBS-GHXNOFRVSA-N |
|---|---|
| IUPAC-Name | Trimethylsilyl-(1Z)-2,2,2-trifluor-N-trimethylsilylethanimidat |
| PubChem CID | 9601896 |
| CAS | 25561-30-2 |
| MDL-Nummer | MFCD00008269 |
| Molekulargewicht (g/mol) | 257.4 |
| SMILES | C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| Synonym | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
| Summenformel | C8H18F3NOSi2 |
Kupfer(II)-Acetylacetonat, 98 %, Thermo Scientific Chemicals
CAS: 13395-16-9 Summenformel: C10H14CuO4 Molekulargewicht (g/mol): 261.76 MDL-Nummer: MFCD00000016 InChI-Schlüssel: QYJPSWYYEKYVEJ-FDGPNNRMSA-L Synonym: 2, 4-Pentanedione, metal derivative,Cupric acetylacetonate IUPAC-Name: copper(2+) bis((2Z)-4-oxopent-2-en-2-olate) SMILES: [Cu++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | QYJPSWYYEKYVEJ-FDGPNNRMSA-L |
|---|---|
| IUPAC-Name | copper(2+) bis((2Z)-4-oxopent-2-en-2-olate) |
| CAS | 13395-16-9 |
| MDL-Nummer | MFCD00000016 |
| Molekulargewicht (g/mol) | 261.76 |
| SMILES | [Cu++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | 2, 4-Pentanedione, metal derivative,Cupric acetylacetonate |
| Summenformel | C10H14CuO4 |
(3-Chlorpropyl)triethoxysilan, 97+%
CAS: 5089-70-3 Summenformel: C9H21ClO3Si Molekulargewicht (g/mol): 240.8 MDL-Nummer: MFCD00018985 InChI-Schlüssel: KSCAZPYHLGGNPZ-UHFFFAOYSA-N Synonym: 3-chloropropyl triethoxysilane,3-chloropropyl triethoxy silane,silane, 3-chloropropyl triethoxy,unii-x7rb20518m,triethoxy gamma-chloropropyl silane,gamma-chloropropyltriethoxysilane,triethoxy .gamma.-chloropropyl silane,chloropropyl triethoxysilane,dynasylan cpteo PubChem CID: 78771 IUPAC-Name: 3-Chlorpropyl(triethoxy)silan SMILES: CCO[Si](CCCCl)(OCC)OCC
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | KSCAZPYHLGGNPZ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Chlorpropyl(triethoxy)silan |
| PubChem CID | 78771 |
| CAS | 5089-70-3 |
| MDL-Nummer | MFCD00018985 |
| Molekulargewicht (g/mol) | 240.8 |
| SMILES | CCO[Si](CCCCl)(OCC)OCC |
| Synonym | 3-chloropropyl triethoxysilane,3-chloropropyl triethoxy silane,silane, 3-chloropropyl triethoxy,unii-x7rb20518m,triethoxy gamma-chloropropyl silane,gamma-chloropropyltriethoxysilane,triethoxy .gamma.-chloropropyl silane,chloropropyl triethoxysilane,dynasylan cpteo |
| Summenformel | C9H21ClO3Si |
Zincon-Mononatriumsalz, Thermo Scientific Chemicals
CAS: 62625-22-3 Summenformel: C20H16N4NaO6S Molekulargewicht (g/mol): 463.42 MDL-Nummer: MFCD00064385 InChI-Schlüssel: IABRINWJUBAIIE-JJECXDOKSA-N PubChem CID: 131856391 IUPAC-Name: 2-[2-[(Z)-N-[(Z)-(6-Oxo-3-sulfocyclohexa-2,4-dien-1-yliden)amino]-C-phenylcarbonimidoyl]hydrazinyl]benzoesäure; Natrium SMILES: C1=CC=C(C=C1)C(=NN=C2C=C(C=CC2=O)S(=O)(=O)O)NNC3=CC=CC=C3C(=O)O.[Na]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | IABRINWJUBAIIE-JJECXDOKSA-N |
|---|---|
| IUPAC-Name | 2-[2-[(Z)-N-[(Z)-(6-Oxo-3-sulfocyclohexa-2,4-dien-1-yliden)amino]-C-phenylcarbonimidoyl]hydrazinyl]benzoesäure; Natrium |
| PubChem CID | 131856391 |
| CAS | 62625-22-3 |
| MDL-Nummer | MFCD00064385 |
| Molekulargewicht (g/mol) | 463.42 |
| SMILES | C1=CC=C(C=C1)C(=NN=C2C=C(C=CC2=O)S(=O)(=O)O)NNC3=CC=CC=C3C(=O)O.[Na] |
| Summenformel | C20H16N4NaO6S |
Natriumtetraethylborat, 97 %, rein, Thermo Scientific Chemicals
CAS: 15523-24-7 Summenformel: C8H20BNa Molekulargewicht (g/mol): 150.04 MDL-Nummer: MFCD00061547 InChI-Schlüssel: SZSBMTRYJRHYNI-UHFFFAOYSA-N Synonym: sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g PubChem CID: 23681030 IUPAC-Name: Natrium; Tetraethylboranuid SMILES: [B-](CC)(CC)(CC)CC.[Na+]
| InChI-Schlüssel | SZSBMTRYJRHYNI-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Natrium; Tetraethylboranuid |
| PubChem CID | 23681030 |
| CAS | 15523-24-7 |
| MDL-Nummer | MFCD00061547 |
| Molekulargewicht (g/mol) | 150.04 |
| SMILES | [B-](CC)(CC)(CC)CC.[Na+] |
| Synonym | sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g |
| Summenformel | C8H20BNa |
3-Aminopropyltriethoxysilan, 99 %, Thermo Scientific Chemicals
CAS: 919-30-2 Summenformel: C9H23NO3Si Molekulargewicht (g/mol): 221.37 MDL-Nummer: MFCD00008207,MFCD01324904 InChI-Schlüssel: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC-Name: 3-Triethoxysilylpropan-1-amin SMILES: CCO[Si](CCCN)(OCC)OCC
| InChI-Schlüssel | WYTZZXDRDKSJID-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Triethoxysilylpropan-1-amin |
| PubChem CID | 13521 |
| CAS | 919-30-2 |
| MDL-Nummer | MFCD00008207,MFCD01324904 |
| Molekulargewicht (g/mol) | 221.37 |
| SMILES | CCO[Si](CCCN)(OCC)OCC |
| Synonym | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
| Summenformel | C9H23NO3Si |
Bis-(trimethylsilyl)-lithiumamid, 1 M Lösung in THF/Ethylbenzol, AcroSeal™, Thermo Scientific Chemicals
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| Chemischer Name oder Material | Bis-(trimethylsilyl)-lithiumamid |
|---|---|
| InChI-Schlüssel | YNESATAKKCNGOF-UHFFFAOYSA-N |
| IUPAC-Name | Lithium; Bis(trimethylsilyl)azanid |
| Dichte | 0.8900 g/ml |
| EINECS-Nummer | 223-725-6 |
| Relative Dichte | 0.89 |
| Molekulargewicht (g/mol) | 167.33 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Namenshinweis | 1 M-Lösung in THF/Ethylbenzol |
| Formelmasse | 167.33 |
| Gesundheitsgefahr 2 | GHS-H-Satz Verursacht schwere Verätzungen der Haut und schwere Augenschäden Kann die Atemwege reizen. Leicht entzündliche Flüssigkeiten oder Dämpfe. Verdacht auf krebserregende Wirkung. Reagiert heftig mit Wasser. Kann explosionsfähige Peroxide bilden. Kann Schläfrigkeit oder Benommenheit verursachen. |
| Gesundheitsgefahr 3 | GHS-P-Satz Von Hitze/Funken/offenen Flammen/heißen Oberflächen fernhalten. - Rauchen verboten. Schutzhandschuhe/Augenschutz/Gesichtsschutz tragen. BEI BERÜHRUNG MIT DER HAUT (oder dem Haar): Alle kontaminierten Kleidungsstücke sofort ausziehen. Haut mit Wasser abwaschen/duschen. Sofort GIFTINFORMATIONSZENTRUM/Arzt anrufen. BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser ausspülen. Eventuell Vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter ausspülen. BEI VERSCHLUCKEN: Mund ausspülen. KEIN Erbrechen herbeiführen. |
| PubChem CID | 2733832 |
| Löslichkeitsinformationen | Solubility in water: decomposes |
| Farbe | Gelb bis Braun |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Physikalische Form | Trübe Lösung |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| CAS | 100-41-4 |
| MDL-Nummer | MFCD00008261 |
| Flammpunkt | −21 °C |
| Reinheit (%) | 18 bis 22 % aktive Base (als LiNSi) |
| Synonym | Lithiumbistrimethylsilylamid,Lithiumhexamethyldisilazid,Lithium-bis-trimethylsilyl-Amid,Lithium-bis-Trimethylsilyl-Azanid,Lithium-bis-Trimethylsilylamid,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| TSCA | TSCA |
| Summenformel | C6H18LiNSi2 |
Triethoxysilan, 95 %, Thermo Scientific Chemicals
CAS: 998-30-1 Summenformel: C6H16O3Si Molekulargewicht (g/mol): 164.28 MDL-Nummer: MFCD00009061 InChI-Schlüssel: PKDCQJMRWCHQOH-UHFFFAOYSA-N Synonym: triethoxysilane,silane, triethoxy,unii-8t460wdh89,c6h16o3si,si oet 3h;,c2h5o 3sih,4-01-00-01359 beilstein handbook reference,triethoxysilane 10g,triethoxysilyl modified poly 1,2-butadiene,poly 1,2-butadiene , triethoxysilyl modified PubChem CID: 6327710 IUPAC-Name: Triethoxysilizium SMILES: CCO[Si](OCC)OCC
| InChI-Schlüssel | PKDCQJMRWCHQOH-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Triethoxysilizium |
| PubChem CID | 6327710 |
| CAS | 998-30-1 |
| MDL-Nummer | MFCD00009061 |
| Molekulargewicht (g/mol) | 164.28 |
| SMILES | CCO[Si](OCC)OCC |
| Synonym | triethoxysilane,silane, triethoxy,unii-8t460wdh89,c6h16o3si,si oet 3h;,c2h5o 3sih,4-01-00-01359 beilstein handbook reference,triethoxysilane 10g,triethoxysilyl modified poly 1,2-butadiene,poly 1,2-butadiene , triethoxysilyl modified |
| Summenformel | C6H16O3Si |
Dimethylaluminiumchlorid, 0.9M-Lösung in Heptan, AcroSeal™, Thermo Scientific Chemicals
CAS: 1184-58-3 MDL-Nummer: MFCD00000458 InChI-Schlüssel: JGHYBJVUQGTEEB-UHFFFAOYSA-M Synonym: aluminum, chlorodimethyl,dimethylaluminum chloride,dimethylaluminium chloride,chlorodimethylaluminum,dimethylaluminum chloride solution, 1.0 m in hexanes,chloro dimethyl alumane,dimethylaluminum chloride solution PubChem CID: 79147 IUPAC-Name: Chlor(dimethyl)aluman SMILES: C[Al](C)Cl
| InChI-Schlüssel | JGHYBJVUQGTEEB-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Chlor(dimethyl)aluman |
| PubChem CID | 79147 |
| CAS | 1184-58-3 |
| MDL-Nummer | MFCD00000458 |
| SMILES | C[Al](C)Cl |
| Synonym | aluminum, chlorodimethyl,dimethylaluminum chloride,dimethylaluminium chloride,chlorodimethylaluminum,dimethylaluminum chloride solution, 1.0 m in hexanes,chloro dimethyl alumane,dimethylaluminum chloride solution |