Gefilterte Suchergebnisse
Ethylendiamintetraessigsäure- 0,1 M (0,2 N), gebrauchsfertige NIST-Standardlösung zur volumetrischen Analyse, erfüllt die analytische Spezifikation gemäß EU-Arzneibuch, BP, Fisher Chemical
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
Thermo Scientific Chemicals Ethylendiamintetraessigsäure, Dinatriumsalz-Dihydrat, 99+%
CAS: 6381-92-6 Summenformel: C10H18N2Na2O10 Molekulargewicht (g/mol): 372.24 MDL-Nummer: MFCD00150037,MFCD00003541 InChI-Schlüssel: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC-Name: Dinatrium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetat;dihydrat SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
|---|---|
| IUPAC-Name | Dinatrium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetat;dihydrat |
| PubChem CID | 44120005 |
| CAS | 6381-92-6 |
| MDL-Nummer | MFCD00150037,MFCD00003541 |
| Molekulargewicht (g/mol) | 372.24 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| Summenformel | C10H18N2Na2O10 |
Gluconsäure, Natriumsalz, 98 %, Thermo Scientific Chemicals
CAS: 527-07-1 Summenformel: C6H11NaO7 Molekulargewicht (g/mol): 218.137 MDL-Nummer: MFCD00064210 InChI-Schlüssel: UPMFZISCCZSDND-JJKGCWMISA-M Synonym: sodium gluconate,sodium d-gluconate,d-gluconic acid sodium salt,d-gluconic acid, monosodium salt,gluconic acid sodium salt,monosodium gluconate,glonsen,monosodium d-gluconate,gluconate sodium,pasexon 100t PubChem CID: 23672301 ChEBI: CHEBI:84997 IUPAC-Name: Natrium;(2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanoat SMILES: C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | UPMFZISCCZSDND-JJKGCWMISA-M |
|---|---|
| IUPAC-Name | Natrium;(2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanoat |
| PubChem CID | 23672301 |
| CAS | 527-07-1 |
| ChEBI | CHEBI:84997 |
| MDL-Nummer | MFCD00064210 |
| Molekulargewicht (g/mol) | 218.137 |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Na+] |
| Synonym | sodium gluconate,sodium d-gluconate,d-gluconic acid sodium salt,d-gluconic acid, monosodium salt,gluconic acid sodium salt,monosodium gluconate,glonsen,monosodium d-gluconate,gluconate sodium,pasexon 100t |
| Summenformel | C6H11NaO7 |
n-Hydroxyphthalimid, 98 %, Thermo Scientific Chemicals
CAS: 524-38-9 Summenformel: C8H5NO3 Molekulargewicht (g/mol): 163.13 MDL-Nummer: MFCD00005891 InChI-Schlüssel: CFMZSMGAMPBRBE-UHFFFAOYSA-N Synonym: n-hydroxyphthalimide,2-hydroxyisoindoline-1,3-dione,2-hydroxy-1h-isoindole-1,3 2h-dione,nhpi,2-hydroxyphthalimide,1h-isoindole-1,3 2h-dione, 2-hydroxy,phthalimide, n-hydroxy,phthaloxime,unii-bxi99m81x0,2-hydroxyisoindolin-1,3-dione PubChem CID: 10665 IUPAC-Name: 2-Hydroxyisoindol-1,3-dion SMILES: ON1C(=O)C2=CC=CC=C2C1=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | CFMZSMGAMPBRBE-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Hydroxyisoindol-1,3-dion |
| PubChem CID | 10665 |
| CAS | 524-38-9 |
| MDL-Nummer | MFCD00005891 |
| Molekulargewicht (g/mol) | 163.13 |
| SMILES | ON1C(=O)C2=CC=CC=C2C1=O |
| Synonym | n-hydroxyphthalimide,2-hydroxyisoindoline-1,3-dione,2-hydroxy-1h-isoindole-1,3 2h-dione,nhpi,2-hydroxyphthalimide,1h-isoindole-1,3 2h-dione, 2-hydroxy,phthalimide, n-hydroxy,phthaloxime,unii-bxi99m81x0,2-hydroxyisoindolin-1,3-dione |
| Summenformel | C8H5NO3 |
4-Nitrophenylphosphat, Dinatriumsalz, Hexahydrat, 98+%, Thermo Scientific Chemicals
CAS: 333338-18-4 Summenformel: C6H4NNa2O6P Molekulargewicht (g/mol): 263.05 MDL-Nummer: MFCD00007319 InChI-Schlüssel: VIYFPAMJCJLZKD-UHFFFAOYSA-L Synonym: pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system PubChem CID: 77949 IUPAC-Name: Dinatrium;(4-nitrophenyl)phosphat SMILES: [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | VIYFPAMJCJLZKD-UHFFFAOYSA-L |
|---|---|
| IUPAC-Name | Dinatrium;(4-nitrophenyl)phosphat |
| PubChem CID | 77949 |
| CAS | 333338-18-4 |
| MDL-Nummer | MFCD00007319 |
| Molekulargewicht (g/mol) | 263.05 |
| SMILES | [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 |
| Synonym | pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system |
| Summenformel | C6H4NNa2O6P |
Ethyl-Oleat, Mischung von Isomeren 98 %, Thermo Scientific Chemicals
CAS: 111-62-6 Summenformel: C20H38O2 Molekulargewicht (g/mol): 310.51 InChI-Schlüssel: LVGKNOAMLMIIKO-QXMHVHEDSA-N Synonym: ethyl oleate,ethyl cis-9-octadecenoate,oleic acid, ethyl ester,oleic acid ethyl ester,9-octadecenoic acid z-, ethyl ester,ethyl oleate nf,ethyl z-octadec-9-enoate,ethyl oleate natural,fema no. 2450 PubChem CID: 5363269 ChEBI: CHEBI:84940 IUPAC-Name: Ethyl-(Z)-octadec-9-enoat SMILES: CCCCCCCCC=CCCCCCCCC(=O)OCC
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | LVGKNOAMLMIIKO-QXMHVHEDSA-N |
|---|---|
| IUPAC-Name | Ethyl-(Z)-octadec-9-enoat |
| PubChem CID | 5363269 |
| CAS | 111-62-6 |
| ChEBI | CHEBI:84940 |
| Molekulargewicht (g/mol) | 310.51 |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC |
| Synonym | ethyl oleate,ethyl cis-9-octadecenoate,oleic acid, ethyl ester,oleic acid ethyl ester,9-octadecenoic acid z-, ethyl ester,ethyl oleate nf,ethyl z-octadec-9-enoate,ethyl oleate natural,fema no. 2450 |
| Summenformel | C20H38O2 |
Phosphorsäuretriaethylester 99 %, Thermo Scientific Chemicals
CAS: 78-40-0 Summenformel: C6H15O4P Molekulargewicht (g/mol): 182.16 MDL-Nummer: MFCD00009077 InChI-Schlüssel: DQWPFSLDHJDLRL-UHFFFAOYSA-N Synonym: triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester PubChem CID: 6535 ChEBI: CHEBI:45927 IUPAC-Name: Triethylphosphat SMILES: CCOP(=O)(OCC)OCC
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | DQWPFSLDHJDLRL-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Triethylphosphat |
| PubChem CID | 6535 |
| CAS | 78-40-0 |
| ChEBI | CHEBI:45927 |
| MDL-Nummer | MFCD00009077 |
| Molekulargewicht (g/mol) | 182.16 |
| SMILES | CCOP(=O)(OCC)OCC |
| Synonym | triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester |
| Summenformel | C6H15O4P |
Thermo Scientific Chemicals (-)-Epigallocatechin-gallat, 95 %
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
3-Hydroxybuttersäure, 95 %, Thermo Scientific Chemicals
CAS: 300-85-6 Summenformel: C4H8O3 Molekulargewicht (g/mol): 104.11 MDL-Nummer: MFCD00004546 InChI-Schlüssel: WHBMMWSBFZVSSR-UHFFFAOYSA-N Synonym: 3-hydroxybutyric acid,butanoic acid, 3-hydroxy,beta-hydroxybutyric acid,dl-beta-hydroxybutyric acid,beta-hydroxybuttersaeure,3 hba,3-hydroxybuttersaeure,beta-hydroxy-n-butyric acid,3 hydroxybutyrate,butyric acid, 3-hydroxy PubChem CID: 441 ChEBI: CHEBI:20067 IUPAC-Name: 3-Hydroxybutansäure SMILES: CC(CC(=O)O)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | WHBMMWSBFZVSSR-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Hydroxybutansäure |
| PubChem CID | 441 |
| CAS | 300-85-6 |
| ChEBI | CHEBI:20067 |
| MDL-Nummer | MFCD00004546 |
| Molekulargewicht (g/mol) | 104.11 |
| SMILES | CC(CC(=O)O)O |
| Synonym | 3-hydroxybutyric acid,butanoic acid, 3-hydroxy,beta-hydroxybutyric acid,dl-beta-hydroxybutyric acid,beta-hydroxybuttersaeure,3 hba,3-hydroxybuttersaeure,beta-hydroxy-n-butyric acid,3 hydroxybutyrate,butyric acid, 3-hydroxy |
| Summenformel | C4H8O3 |
1-Pentansulfonsäure, Natriumsalz-Monohydrat, 98+%, HPLC-Qualität, Thermo Scientific Chemicals
CAS: 207605-40-1 Summenformel: C5H11NaO3S·H2O Molekulargewicht (g/mol): 192.22 MDL-Nummer: MFCD00149548 InChI-Schlüssel: FPQYXAFKHLSWTI-UHFFFAOYSA-M Synonym: sodium pentane-1-sulfonate hydrate,1-pentanesulfonic acid sodium salt monohydrate,sodium 1-pentanesulfonate monohydrate,potassium hydrate pentane-1-sulfonate,sodium 1-pentanesulfonate hydrate,sodium hydrate pentane-1-sulfonate,sodium pentane-1-sulfonate-water 1/1/1,1-pentane sulphonic acid sodium salt monohydrate,1-pentanesulfonic acid sodium salt monohydydrate,sodium 1-pentanesulfonate monohydrate, hplc grade PubChem CID: 23693099 IUPAC-Name: Natrium;-pentan-1-sulfonat;hydrat SMILES: CCCCCS(=O)(=O)[O-].O.[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | FPQYXAFKHLSWTI-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium;-pentan-1-sulfonat;hydrat |
| PubChem CID | 23693099 |
| CAS | 207605-40-1 |
| MDL-Nummer | MFCD00149548 |
| Molekulargewicht (g/mol) | 192.22 |
| SMILES | CCCCCS(=O)(=O)[O-].O.[Na+] |
| Synonym | sodium pentane-1-sulfonate hydrate,1-pentanesulfonic acid sodium salt monohydrate,sodium 1-pentanesulfonate monohydrate,potassium hydrate pentane-1-sulfonate,sodium 1-pentanesulfonate hydrate,sodium hydrate pentane-1-sulfonate,sodium pentane-1-sulfonate-water 1/1/1,1-pentane sulphonic acid sodium salt monohydrate,1-pentanesulfonic acid sodium salt monohydydrate,sodium 1-pentanesulfonate monohydrate, hplc grade |
| Summenformel | C5H11NaO3S·H2O |
Natriumcyclamat 99%, Thermo Scientific Chemicals
CAS: 139-05-9 Summenformel: C6H12NNaO3S Molekulargewicht (g/mol): 201.22 MDL-Nummer: MFCD00003827 InChI-Schlüssel: UDIPTWFVPPPURJ-UHFFFAOYSA-M Synonym: sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin PubChem CID: 23665706 ChEBI: CHEBI:82431 IUPAC-Name: Natrium;N-cyclohexylsulfamat SMILES: [Na+].[O-]S(=O)(=O)NC1CCCCC1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | UDIPTWFVPPPURJ-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium;N-cyclohexylsulfamat |
| PubChem CID | 23665706 |
| CAS | 139-05-9 |
| ChEBI | CHEBI:82431 |
| MDL-Nummer | MFCD00003827 |
| Molekulargewicht (g/mol) | 201.22 |
| SMILES | [Na+].[O-]S(=O)(=O)NC1CCCCC1 |
| Synonym | sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin |
| Summenformel | C6H12NNaO3S |
5-Aminolävulinsäure-Hydrochlorid 99%, Thermo Scientific Chemicals
CAS: 9-2-5451 Summenformel: C5H9NO3·HCl Molekulargewicht (g/mol): 167.59 MDL-Nummer: MFCD00012869 InChI-Schlüssel: ZLHFONARZHCSET-UHFFFAOYSA-N Synonym: 5-aminolevulinic acid hydrochloride,5-amino-4-oxopentanoic acid hydrochloride,aminolevulinic acid hydrochloride,levulan,levulan kerastick,aminolevulinic acid hcl,delta-aminolevulinic acid hydrochloride,gliolan,ameluz,5-aminolevulinate hydrochloride PubChem CID: 123608 IUPAC-Name: 5-Amino-4-Oxopentansäure;hydrochlorid SMILES: C(CC(=O)O)C(=O)CN.Cl
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ZLHFONARZHCSET-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 5-Amino-4-Oxopentansäure;hydrochlorid |
| PubChem CID | 123608 |
| CAS | 9-2-5451 |
| MDL-Nummer | MFCD00012869 |
| Molekulargewicht (g/mol) | 167.59 |
| SMILES | C(CC(=O)O)C(=O)CN.Cl |
| Synonym | 5-aminolevulinic acid hydrochloride,5-amino-4-oxopentanoic acid hydrochloride,aminolevulinic acid hydrochloride,levulan,levulan kerastick,aminolevulinic acid hcl,delta-aminolevulinic acid hydrochloride,gliolan,ameluz,5-aminolevulinate hydrochloride |
| Summenformel | C5H9NO3·HCl |
2-Mercaptoethanesulfonsäure-Natriumsalz, 98%, Thermo Scientific Chemicals
CAS: 19767-45-4 Summenformel: C2H5NaO3S2 Molekulargewicht (g/mol): 164.18 InChI-Schlüssel: XOGTZOOQQBDUSI-UHFFFAOYSA-M Synonym: mesna,sodium 2-mercaptoethanesulfonate,mesnex,uromitexan,mitexan,2-mercaptoethanesulfonic acid sodium salt,mistabron,mesnum,mistabronco,mucofluid PubChem CID: 23662354 IUPAC-Name: Natrium;-2-sulfanylethansulfonat SMILES: C(CS(=O)(=O)[O-])S.[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | XOGTZOOQQBDUSI-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium;-2-sulfanylethansulfonat |
| PubChem CID | 23662354 |
| CAS | 19767-45-4 |
| Molekulargewicht (g/mol) | 164.18 |
| SMILES | C(CS(=O)(=O)[O-])S.[Na+] |
| Synonym | mesna,sodium 2-mercaptoethanesulfonate,mesnex,uromitexan,mitexan,2-mercaptoethanesulfonic acid sodium salt,mistabron,mesnum,mistabronco,mucofluid |
| Summenformel | C2H5NaO3S2 |
Gluconsäure, Kaliumsalz, 99 %, Thermo Scientific Chemicals
Summenformel: C6H11KO7 Molekulargewicht (g/mol): 234.25 MDL-Nummer: MFCD00064211 InChI-Schlüssel: HLCFGWHYROZGBI-JJKGCWMISA-M Synonym: potassium gluconate,potassium d-gluconate,gluconic acid potassium salt,potassuril,kaon elixir,potassium 2r,3s,4r,5r-2,3,4,5,6-pentahydroxyhexanoate,katorin,potalium,potasoral,sirokal PubChem CID: 16760467 IUPAC-Name: Kalium; (2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanoat SMILES: C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[K+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | HLCFGWHYROZGBI-JJKGCWMISA-M |
|---|---|
| IUPAC-Name | Kalium; (2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanoat |
| PubChem CID | 16760467 |
| MDL-Nummer | MFCD00064211 |
| Molekulargewicht (g/mol) | 234.25 |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[K+] |
| Synonym | potassium gluconate,potassium d-gluconate,gluconic acid potassium salt,potassuril,kaon elixir,potassium 2r,3s,4r,5r-2,3,4,5,6-pentahydroxyhexanoate,katorin,potalium,potasoral,sirokal |
| Summenformel | C6H11KO7 |
Methylbenzoat, 99 %, Thermo Scientific Chemicals
CAS: 93-58-3 Summenformel: C8H8O2 Molekulargewicht (g/mol): 136.15 InChI-Schlüssel: QPJVMBTYPHYUOC-UHFFFAOYSA-N Synonym: methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le PubChem CID: 7150 ChEBI: CHEBI:72775 IUPAC-Name: Methyl-benzoat SMILES: COC(=O)C1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | QPJVMBTYPHYUOC-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Methyl-benzoat |
| PubChem CID | 7150 |
| CAS | 93-58-3 |
| ChEBI | CHEBI:72775 |
| Molekulargewicht (g/mol) | 136.15 |
| SMILES | COC(=O)C1=CC=CC=C1 |
| Synonym | methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le |
| Summenformel | C8H8O2 |