Gefilterte Suchergebnisse
Trimethylamin, Pure, 7.3 M (50 Gew.-%) wässrige Lösung, Thermo Scientific Chemicals
CAS: 75-50-3 | C3H9N | 59.11 g/mol
| Chemischer Name oder Material | Trimethylamine |
|---|---|
| InChI-Schlüssel | GETQZCLCWQTVFV-UHFFFAOYSA-N |
| Güte | Rein |
| IUPAC-Name | N,N-Dimethylmethanamin |
| Siedepunkt | 30.0°C to 100.0°C |
| Dichte | 0.8600g/mL |
| Relative Dichte | 0.86 |
| ChEBI | CHEBI:18139 |
| Molekulargewicht (g/mol) | 59.11 |
| SMILES | CN(C)C |
| Formelmasse | 59.11 |
| PubChem CID | 1146 |
| Löslichkeitsinformationen | Solubility in water: freely soluble. Other solubilities: soluble in alcohol, ether, benzene, toluene,, xylene, ethylbenzene and chloroform |
| Farbe | Farblos |
| Gesundheitsgefahr 1 | Gefahr |
| Physikalische Form | Flüssig |
| CAS | 7732-18-5 |
| MDL-Nummer | MFCD00008327 |
| Strukturformel | (CH3)3N |
| Flammpunkt | −45°C |
| Reinheit (%) | 48 to 52% (total base) |
| Synonym | trimethylamine,methanamine, n,n-dimethyl,dimethylmethaneamine,n-trimethylamine,trimethylamine solution,ch3 3n,trimethyl amine,trimethylamin,trimethyl-amine,fema number 3241 |
| Summenformel | C3H9N |
| Schmelzpunkt | -2.0°C |
Lithium-Aluminium-Hydrid, 1 M Lösung in THF, AcroSeal™, Thermo Scientific Chemicals
CAS: 16853-85-3 | AlH4Li | 37.95 g/mol
| Chemischer Name oder Material | Lithium Aluminum hydride |
|---|---|
| InChI-Schlüssel | OCZDCIYGECBNKL-UHFFFAOYSA-N |
| IUPAC-Name | Aluminium;Lithium;Hydrid |
| Dichte | 0.9000g/mL |
| Relative Dichte | 0.9 |
| Molekulargewicht (g/mol) | 37.95 |
| SMILES | [Li+].[AlH4-] |
| Merck Index | 15, 344 |
| Formelmasse | 37.95 |
| Gesundheitsgefahr 2 | GHS-P-Hinweis Kann die Atemwege reizen. Verursacht Hautreizungen. Verursacht schwere Augenschäden. Leicht entzündliche Flüssigkeiten oder Dämpfe. In Berührung mit Wasser entstehen brennbare Gase, die sich spontan entzünden können. Kann explosionsfähige Peroxide bilden. Verdacht auf krebserregende Wirkung. Gesundheitsschädlich beim Verschlucken Kann Schläfrigkeit und Benommenheit verursachen. |
| Gesundheitsgefahr 3 | GHS-P-Hinweis Von Hitze/Funken/offenen Flammen/heißen Oberflächen fernhalten. - Rauchen verboten. BEI BERÜHRUNG MIT DER HAUT (oder dem Haar): Alle kontaminierten Kleidungsstücke sofort ausziehen. Haut mit Wasser abwaschen/duschen. Unter inertem Gas handhaben. Vor Feuchtigkeit schützen. Schutzhandschuhe/Augenschutz/Gesichtsschutz tragen. BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser ausspülen. Eventuell vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter ausspülen. Sofort GIFTINFORMATIONSZENTRUM/Arzt anrufen. |
| PubChem CID | 21226445 |
| Löslichkeitsinformationen | Solubility in water: vigorous reaction. |
| Farbe | Grau |
| Gesundheitsgefahr 1 | Gefahr |
| Physikalische Form | Trübe Lösung |
| Fieser | 01,581; 02,242; 03,176; 04,291; 05,382; 06,325; 07,196; 08,286; 09,274; 10,236; 11,289; 12,272; 13,61; 14,190; 15,184; 16,133; 17,162 |
| CAS | 109-99-9 |
| MDL-Nummer | MFCD00011075 |
| Strukturformel | LiAlH4 |
| Flammpunkt | −17°C |
| Reinheit (%) | 3.9 to 4.5% (as LiAlH4) |
| Synonym | lithium aluminum hydride,lithium aluminum hydride,aluminum lithium hydride,lithiumaluminiumhydride,aluminum iii lithium hydride,lithium alanate,lithium aluminum tetrahydride,lithiumaluminiumhydrid,litiumaluminum hydride,lithim aluminum hydride |
| Summenformel | AlH4Li |
Bariumchlorid, 0.5 N normierte Lösung, Thermo Scientific Chemicals
CAS: 10361-37-2 Summenformel: BaCl2 Molekulargewicht (g/mol): 208.23 MDL-Nummer: MFCD00003445 InChI-Schlüssel: WDIHJSXYQDMJHN-UHFFFAOYSA-L Synonym: barium chloride,barium dichloride,barium chloride solution,ccris 2286,barium chloride, anhydrous,barium chloride, ultra dry,bariumchlorid,dichlorobarium,dsstox_cid_24508 PubChem CID: 25204 ChEBI: CHEBI:63317 IUPAC-Name: Barium(2+);dichlorid SMILES: [Cl-].[Cl-].[Ba++]
| InChI-Schlüssel | WDIHJSXYQDMJHN-UHFFFAOYSA-L |
|---|---|
| IUPAC-Name | Barium(2+);dichlorid |
| PubChem CID | 25204 |
| CAS | 10361-37-2 |
| ChEBI | CHEBI:63317 |
| MDL-Nummer | MFCD00003445 |
| Molekulargewicht (g/mol) | 208.23 |
| SMILES | [Cl-].[Cl-].[Ba++] |
| Synonym | barium chloride,barium dichloride,barium chloride solution,ccris 2286,barium chloride, anhydrous,barium chloride, ultra dry,bariumchlorid,dichlorobarium,dsstox_cid_24508 |
| Summenformel | BaCl2 |
Dess-Martin-Periodinan, 15 Gew.% Lösung in Dichlormethan, Thermo Scientific Chemicals
Dess-Martin Periodinan, 10 bis 15 %, C13H13IO8, CAS-Nummer-87413-09-0, 75-09-2, Dess Martin, Dess-Martin, Dess-Martinperiodinan, Dess-Martin periodinan, 1,1,1-Triacetoxy-1,1-dihydro-1,2-benziodoxol-3 1h-on, Dess Martin Periodinan, Dess-Martin Periodan, Dess-Martin Reagenz, Triacetoxyperiodinan
| Chemischer Name oder Material | Dess-Martin periodinane |
|---|---|
| InChI-Schlüssel | NKLCNNUWBJBICK-UHFFFAOYSA-N |
| PubChem CID | 159087 |
| Dichte | 1.3620g/mL |
| CAS | 75-09-2 |
| Relative Dichte | 1.362 |
| MDL-Nummer | MFCD00130127 |
| Molekulargewicht (g/mol) | 424.14 |
| SMILES | CC(=O)O[I]1(OC(C)=O)(OC(C)=O)OC(=O)C2=CC=CC=C12 |
| Synonym | dess-martin periodinane,triacetoxyperiodinane,1,1,1-triacetoxy-1,1-dihydro-1,2-benziodoxol-3 1h-one,dess-martin reagent,dess-martinperiodinane,dess-martin,dess martin periodinane,dess martin,dess-martin periodane |
| Summenformel | C13H13IO8 |
| Formelmasse | 424.15 |
Benzyltrimethylammonium-Hydroxid, 40 Gew.-% in Methanol, Thermo Scientific Chemicals
CAS: 100-85-6 Summenformel: C10H17NO Molekulargewicht (g/mol): 167.252 MDL-Nummer: MFCD00008281 InChI-Schlüssel: NDKBVBUGCNGSJJ-UHFFFAOYSA-M Synonym: benzyltrimethylammonium hydroxide,triton b,n,n,n-trimethyl-1-phenylmethanaminium hydroxide,trimethylbenzylammonium hydroxide,benzyl trimethylammonium hydroxide,benzyl trimethyl ammonium hydroxide,trimethyl benzylammonium hydroxide,sumquat 2311,benzyltrimetylammonium hydroxide,n,n,n-trimethylbenzenemethanaminium hydroxide PubChem CID: 66854 IUPAC-Name: Benzyl(trimethyl)azanium;Hydroxid SMILES: C[N+](C)(C)CC1=CC=CC=C1.[OH-]
| InChI-Schlüssel | NDKBVBUGCNGSJJ-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Benzyl(trimethyl)azanium;Hydroxid |
| PubChem CID | 66854 |
| CAS | 100-85-6 |
| MDL-Nummer | MFCD00008281 |
| Molekulargewicht (g/mol) | 167.252 |
| SMILES | C[N+](C)(C)CC1=CC=CC=C1.[OH-] |
| Synonym | benzyltrimethylammonium hydroxide,triton b,n,n,n-trimethyl-1-phenylmethanaminium hydroxide,trimethylbenzylammonium hydroxide,benzyl trimethylammonium hydroxide,benzyl trimethyl ammonium hydroxide,trimethyl benzylammonium hydroxide,sumquat 2311,benzyltrimetylammonium hydroxide,n,n,n-trimethylbenzenemethanaminium hydroxide |
| Summenformel | C10H17NO |
Kaliumhydrogenphthalat, 0.05N Standardisierte Lösung, Thermo Scientific Chemicals
CAS: 877-24-7 Summenformel: C8H5KO4 Molekulargewicht (g/mol): 204.222 MDL-Nummer: MFCD00013070 InChI-Schlüssel: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC-Name: Kalium;2-Carboxybenzoat SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
| InChI-Schlüssel | IWZKICVEHNUQTL-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Kalium;2-Carboxybenzoat |
| PubChem CID | 23676735 |
| CAS | 877-24-7 |
| MDL-Nummer | MFCD00013070 |
| Molekulargewicht (g/mol) | 204.222 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
| Summenformel | C8H5KO4 |
Bariumchlorid, 10 % (Gew./Vol.) wässrige Lösung, Thermo Scientific Chemicals
CAS: 10361-37-2 Summenformel: BaCl2 Molekulargewicht (g/mol): 208.23 MDL-Nummer: MFCD00003445 InChI-Schlüssel: WDIHJSXYQDMJHN-UHFFFAOYSA-L Synonym: barium chloride,barium dichloride,barium chloride solution,ccris 2286,barium chloride, anhydrous,barium chloride, ultra dry,bariumchlorid,dichlorobarium,dsstox_cid_24508 PubChem CID: 25204 ChEBI: CHEBI:63317 IUPAC-Name: Barium(2+);dichlorid SMILES: [Cl-].[Cl-].[Ba++]
| InChI-Schlüssel | WDIHJSXYQDMJHN-UHFFFAOYSA-L |
|---|---|
| IUPAC-Name | Barium(2+);dichlorid |
| PubChem CID | 25204 |
| CAS | 10361-37-2 |
| ChEBI | CHEBI:63317 |
| MDL-Nummer | MFCD00003445 |
| Molekulargewicht (g/mol) | 208.23 |
| SMILES | [Cl-].[Cl-].[Ba++] |
| Synonym | barium chloride,barium dichloride,barium chloride solution,ccris 2286,barium chloride, anhydrous,barium chloride, ultra dry,bariumchlorid,dichlorobarium,dsstox_cid_24508 |
| Summenformel | BaCl2 |
Silbersulfat, Pure, 10 g/l Lösung in Schwefelsäure, Thermo Scientific Chemicals
CAS: 10294-26-5 | Ag2H2O4S | 313.81 g/mol
| Dichte | 1.8400g/mL |
|---|---|
| Verpackung | Glasflasche |
| Namenshinweis | 10g/L Solution in Sulfuric Acid |
| Formelmasse | 311.79 |
| PubChem CID | 159865 |
| Physikalische Form | Flüssig |
| Fieser | 01,1015; 03,254; 04,435 |
| Strukturformel | Ag2SO4 |
| Summenformel | Ag2H2O4S |
| Chemischer Name oder Material | Silver sulfate |
| InChI-Schlüssel | YPNVIBVEFVRZPJ-UHFFFAOYSA-N |
| Güte | Rein |
| IUPAC-Name | Disilber; Sulfat |
| EINECS-Nummer | 233-653-7 |
| Relative Dichte | 1.84 |
| Molekulargewicht (g/mol) | 313.81 |
| SMILES | [Ag+].[Ag+].OS(O)(=O)=O |
| Merck Index | 15, 8668 |
| Gesundheitsgefahr 2 | GHS-H-Hinweis: Verursacht schwere Verätzungen der Haut und schwere Augenschäden |
| Gesundheitsgefahr 3 | GHS P Statement: IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| Farbe | Farblos |
| Gesundheitsgefahr 1 | Gefahr |
| CAS | 7664-93-9 |
| MDL-Nummer | MFCD00003407 |
| Synonym | silver sulfate,disilver sulfate,disilver 1+ sulfate,unii-8qg6hv4zpo,disilver 1+ sulphate,sulfuric acid, disilver 1+ salt,8qg6hv4zpo,disilver 1+ ion sulfate,sulfuric acid, silver 1+ salt 1:2,sulfuric acid disilver i salt |
| TSCA | TSCA |
Ammoniak, 0.5 M Lösung in 1,4-Dioxan, AcroSeal™, Thermo Scientific Chemicals
CAS: 7664-41-7 | H3N | 17.03 g/mol
| Chemischer Name oder Material | Ammonia |
|---|---|
| InChI-Schlüssel | QGZKDVFQNNGYKY-UHFFFAOYSA-N |
| Dichte | 1.0230g/mL |
| Relative Dichte | 1.023 |
| ChEBI | CHEBI:16134 |
| Molekulargewicht (g/mol) | 17.03 |
| Konzentration | 0.4 to 0.6M |
| SMILES | N |
| Merck Index | 15, 488 |
| Namenshinweis | 0.5M solution in 1, 4-dioxane |
| Formelmasse | 17.03 |
| Gesundheitsgefahr 2 | GHS-H-Satz Flüssigkeit und Dampf leicht entzündbar.Verursacht schwere Augenreizungen.Kann die Atemwege reizen.Verdacht auf krebserregende Wirkung.Wiederholter Kontakt kann zu spröder oder rissiger Haut führen. |
| Gesundheitsgefahr 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Do not breathe dust/fume/gas/mist/vapors/spray. Wash face, hands and any exposed skin thoroughly after handling. Use personal protective equipment as required. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. |
| PubChem CID | 222 |
| Löslichkeitsinformationen | Solubility in water: soluble. |
| Farbe | Farblos |
| Gesundheitsgefahr 1 | Gefahr |
| Physikalische Form | Flüssig |
| Fieser | 05,15 |
| CAS | 123-91-1 |
| MDL-Nummer | MFCD00011418 |
| Strukturformel | NH3 |
| Flammpunkt | 11°C |
| Synonym | ammonia,ammonia gas,spirit of hartshorn,nitro-sil,ammoniakgas,ammonia anhydrous,anhydrous ammonia,ammonia, anhydrous,ammoniak,am-fol |
| Summenformel | H3N |
Dilithium-Tetrachlorcuprat, 0.1 M Lösung in THF, Thermo Scientific Chemicals
CAS: 15489-27-7 | Cl4CuLi2 | 219.226 g/mol
| Chemischer Name oder Material | Dilithium tetrachlorocuprate |
|---|---|
| InChI-Schlüssel | HCJWWBBBSCXJMS-UHFFFAOYSA-J |
| IUPAC-Name | Dilithium;Tetrachlorkupfer(2-) |
| Dichte | 0.9100g/mL |
| Verpackung | Glasflasche |
| Relative Dichte | 0.91 |
| Molekulargewicht (g/mol) | 219.226 |
| Konzentration | 0.09 to 0.12M |
| SMILES | [Li+].[Li+].Cl[Cu-2](Cl)(Cl)Cl |
| Namenshinweis | 0.1M Solution in THF |
| Formelmasse | 219.24 |
| Gesundheitsgefahr 2 | GHS-P-Hinweis Kann die Atemwege reizen.Verursacht schwere Augenreizungen.Leicht entzündliche Flüssigkeiten oder Dämpfe.Kann explosionsfähige Peroxide bilden.Verdacht auf krebserregende Wirkung.Gesundheitsschädlich beim VerschluckenKann Schläfrigkeit und Benommenheit verursachen. |
| Gesundheitsgefahr 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Call a POISON CENTER or doctor/physician if you feel unwell. Wash face, hands and any exposed skin thoroughly after handling. If eye irritation persists: Get medical advice/attention. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. Wear protective gloves/protective clothing/eye protection/face protection. |
| PubChem CID | 11074879 |
| Farbe | Farblos |
| Gesundheitsgefahr 1 | Gefahr |
| Physikalische Form | Flüssig |
| Fieser | 04,163; 05,226; 06,203; 07,114; 08,176; 11,190; 12,195 |
| CAS | 109-99-9 |
| MDL-Nummer | MFCD00011081 |
| Strukturformel | Li2CuCl4 |
| Flammpunkt | −17°C |
| Summenformel | Cl4CuLi2 |
Kaliumbis-(trimethylsilyl)amid, 0.7 M Lösung in Toluol, ≥99.4 %, Thermo Scientific Chemicals
CAS: 40949-94-8 | C6H18KNSi2 | 199.485 g/mol
| Chemischer Name oder Material | Potassium bis(trimethylsilyl)amide |
|---|---|
| InChI-Schlüssel | IUBQJLUDMLPAGT-UHFFFAOYSA-N |
| IUPAC-Name | Kalium;bis(trimethylsilyl)azanid |
| Dichte | 0.8760g/mL |
| Molekulargewicht (g/mol) | 199.485 |
| Konzentration | 0.6 to 0.8M (Total base) |
| SMILES | C[Si](C)(C)[N-][Si](C)(C)C.[K+] |
| Namenshinweis | 0.5M solution in toluene |
| Formelmasse | 199.49 |
| Gesundheitsgefahr 2 | GHS P Statement Causes severe skin burns and eye damage. May be fatal if swallowed and enters airways. May cause drowsiness or dizziness. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. Highly flammable liquid and vapor. Suspected of causing cancer. Suspected of causing genetic defects if inhaled. Harmful to aquatic life with long lasting effects. |
| Gesundheitsgefahr 3 | GHS P Statement IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. Obtain special instructions before use. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Avoid release to the environment. |
| PubChem CID | 3251421 |
| Farbe | Gelb |
| Gesundheitsgefahr 1 | Gefahr |
| Physikalische Form | Flüssig |
| CAS | 108-88-3 |
| MDL-Nummer | MFCD00010330 |
| Strukturformel | [(CH3)3Si]2NK |
| Reinheit (%) | 0.6 to 0.8 M (Total base) |
| Synonym | potassium bis trimethylsilyl amide,khmds,potassium hexamethyldisilazide,hexamethyldisilazane potassium salt,potassium bis trimethylsilyl azanide,potassium bis trimethylsilyl amide 1m sol. in thf,potassiumbis trimethylsilyl amide,hexamethyldislazane potassium salt,1,1,1,3,3,3-hexamethyldisilazane potassium salt,potassium bis-trimethylsilylamide |
| Summenformel | C6H18KNSi2 |
Kaliumhydroxid, volumetrische Acculute-Standardlösung, Endkonzentration 0.5 N, Thermo Scientific Chemicals
CAS: 1310-58-3 Summenformel: HKO Molekulargewicht (g/mol): 56.11 MDL-Nummer: MFCD00003553 InChI-Schlüssel: KWYUFKZDYYNOTN-UHFFFAOYSA-M Synonym: potassium hydroxide,caustic potash,potash lye,potassium hydrate,hydroxyde de potassium,potassa,potasse caustique,potassium hydroxide k oh,potassium hydroxide solution,caswell no. 693 PubChem CID: 14797 ChEBI: CHEBI:32035 IUPAC-Name: Kalium; Hydroxid SMILES: [OH-].[K+]
| InChI-Schlüssel | KWYUFKZDYYNOTN-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Kalium; Hydroxid |
| PubChem CID | 14797 |
| CAS | 1310-58-3 |
| ChEBI | CHEBI:32035 |
| MDL-Nummer | MFCD00003553 |
| Molekulargewicht (g/mol) | 56.11 |
| SMILES | [OH-].[K+] |
| Synonym | potassium hydroxide,caustic potash,potash lye,potassium hydrate,hydroxyde de potassium,potassa,potasse caustique,potassium hydroxide k oh,potassium hydroxide solution,caswell no. 693 |
| Summenformel | HKO |