Gefilterte Suchergebnisse
Kaliumchlorid, 3 M wässrige Lösung, Thermo Scientific Chemicals
CAS: 7447-40-7 Summenformel: ClK Molekulargewicht (g/mol): 74.55 MDL-Nummer: MFCD00011360 InChI-Schlüssel: WCUXLLCKKVVCTQ-UHFFFAOYSA-M Synonym: potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs PubChem CID: 4873 ChEBI: CHEBI:32588 IUPAC-Name: Kaliumchlorid SMILES: [Cl-].[K+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Kaliumchlorid |
| PubChem CID | 4873 |
| CAS | 7447-40-7 |
| ChEBI | CHEBI:32588 |
| MDL-Nummer | MFCD00011360 |
| Molekulargewicht (g/mol) | 74.55 |
| SMILES | [Cl-].[K+] |
| Synonym | potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs |
| Summenformel | ClK |
Kaliumdiphosphat, 98 %, reinst, Thermo Scientific Chemicals
CAS: 7320-34-5 Summenformel: K4O7P2 Molekulargewicht (g/mol): 330.33 MDL-Nummer: MFCD00011393 InChI-Schlüssel: RYCLIXPGLDDLTM-UHFFFAOYSA-J Synonym: potassium pyrophosphate,potassium diphosphate,tkpp,tetrapotassium diphosphate,tetrapotassium pyrophosphate,diphosphoric acid, tetrapotassium salt,tetrapotassium diphosphorate,unii-b9w4019h5g,pyrophosphoric acid, tetrapotassium salt,tetrapotassium phosphonato phosphate PubChem CID: 23740 IUPAC-Name: Tetrakalium; Phosphonatophosphat SMILES: [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O
| InChI-Schlüssel | RYCLIXPGLDDLTM-UHFFFAOYSA-J |
|---|---|
| IUPAC-Name | Tetrakalium; Phosphonatophosphat |
| PubChem CID | 23740 |
| CAS | 7320-34-5 |
| MDL-Nummer | MFCD00011393 |
| Molekulargewicht (g/mol) | 330.33 |
| SMILES | [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O |
| Synonym | potassium pyrophosphate,potassium diphosphate,tkpp,tetrapotassium diphosphate,tetrapotassium pyrophosphate,diphosphoric acid, tetrapotassium salt,tetrapotassium diphosphorate,unii-b9w4019h5g,pyrophosphoric acid, tetrapotassium salt,tetrapotassium phosphonato phosphate |
| Summenformel | K4O7P2 |
Kaliumcarbonat, ACS, 99.0 % min., Thermo Scientific Chemicals
CAS: 584-08-7 Summenformel: CK2O3 Molekulargewicht (g/mol): 138.21 MDL-Nummer: MFCD00011382 InChI-Schlüssel: BWHMMNNQKKPAPP-UHFFFAOYSA-L Synonym: potassium carbonate,dipotassium carbonate,potash,potassium carbonate, anhydrous,carbonic acid, dipotassium salt,carbonate of potash,pearl ash,salt of tartar,kaliumcarbonat,potassiumcarbonate PubChem CID: 11430 SMILES: [K+].[K+].[O-]C([O-])=O
| InChI-Schlüssel | BWHMMNNQKKPAPP-UHFFFAOYSA-L |
|---|---|
| PubChem CID | 11430 |
| CAS | 584-08-7 |
| MDL-Nummer | MFCD00011382 |
| Molekulargewicht (g/mol) | 138.21 |
| SMILES | [K+].[K+].[O-]C([O-])=O |
| Synonym | potassium carbonate,dipotassium carbonate,potash,potassium carbonate, anhydrous,carbonic acid, dipotassium salt,carbonate of potash,pearl ash,salt of tartar,kaliumcarbonat,potassiumcarbonate |
| Summenformel | CK2O3 |
Kalium-tert-pentoxid, 1 M (15 Gew.%)-Lösung in Cyclohexan, AcroSeal™, Thermo Scientific Chemicals
CAS: 41233-93-6 | C5H11KO | 126.24 g/mol
| Chemischer Name oder Material | Potassium tert-pentoxide |
|---|---|
| InChI-Schlüssel | ZRLVQFQTCMUIRM-UHFFFAOYSA-N |
| IUPAC-Name | Kalium; 2-Methylbutan-2-olat |
| Dichte | 0.8200g/mL |
| EINECS-Nummer | 255-272-5 |
| Relative Dichte | 0.82 |
| Molekulargewicht (g/mol) | 126.24 |
| SMILES | [K+].CCC(C)(C)[O-] |
| Formelmasse | 126.24 |
| Gesundheitsgefahr 2 | GHS-H-Hinweis Verursacht schwere Verätzungen der Haut und schwere Augenschäden. Kann Schläfrigkeit oder Benommenheit verursachen. Flüssigkeit und Dampf leicht entzündbar. Sehr giftig für Wasserorganismen mit langfristiger Wirkung. |
| Gesundheitsgefahr 3 | GHS-P-Satz Staub/Rauch/Gas/Nebel/Dampf/Aerosol nicht einatmen. Schutzhandschuhe/Schutzkleidung/Augenschutz/Gesichtsschutz tragen. BEI KONTAKT MIT AUGEN:Einige Minuten lang behutsam mit Wasser ausspülen. Eventuell vorhandene Kontaktlinsen nach Möglichkeit entfernen. |
| PubChem CID | 23683543 |
| Löslichkeitsinformationen | Solubility in water: hydrolyzes |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Fieser | 01,939 |
| CAS | 110-82-7 |
| Brechungsindex | 1.4211 |
| MDL-Nummer | MFCD00064808 |
| Strukturformel | C2H5C(CH3)2OK |
| Flammpunkt | −18°C |
| Synonym | potassium 2-methylbutan-2-olate,potassium tert-amylate,potassium tert-pentoxide,potassium tert-pentylate,potassium tert-pentoxide solution,potassium 2-methyl-2-butoxide,2-butanol, 2-methyl-, potassium salt,potassium tert-amyloxide,2-butanol, 2-methyl-, potassium salt 1:1 |
| Summenformel | C5H11KO |
Kaliumthiobenzoat, 95 %, Thermo Scientific Chemicals
CAS: 28170-13-0 Summenformel: C7H6KOS Molekulargewicht (g/mol): 177.28 MDL-Nummer: MFCD28399074 InChI-Schlüssel: LSBMSRUYNGEWKI-UHFFFAOYSA-N Synonym: benzenecarbothioic acid potassium PubChem CID: 87087528 IUPAC-Name: Benzencarbothiosche S-Säure; Kalium SMILES: [K].SC(=O)C1=CC=CC=C1
| InChI-Schlüssel | LSBMSRUYNGEWKI-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Benzencarbothiosche S-Säure; Kalium |
| PubChem CID | 87087528 |
| CAS | 28170-13-0 |
| MDL-Nummer | MFCD28399074 |
| Molekulargewicht (g/mol) | 177.28 |
| SMILES | [K].SC(=O)C1=CC=CC=C1 |
| Synonym | benzenecarbothioic acid potassium |
| Summenformel | C7H6KOS |
Oxonsäure-Kaliumsalz, 98 %, Thermo Scientific Chemicals
CAS: 2207-75-2 Summenformel: C4H2KN3O4 Molekulargewicht (g/mol): 195.18 MDL-Nummer: MFCD00010565 InChI-Schlüssel: IAPCTXZQXAVYNG-UHFFFAOYSA-M Synonym: potassium oxonate,oteracil potassium,oxonic acid potassium salt,allantoxanic acid potassium salt,potassium azaorotate,oxonic acid, potassium salt,oxonate, potassium,oxonate,allantoxanic acid PubChem CID: 2723920 ChEBI: CHEBI:80230 SMILES: [K+].[O-]C(=O)C1=NC(=O)NC(=O)N1
| InChI-Schlüssel | IAPCTXZQXAVYNG-UHFFFAOYSA-M |
|---|---|
| PubChem CID | 2723920 |
| CAS | 2207-75-2 |
| ChEBI | CHEBI:80230 |
| MDL-Nummer | MFCD00010565 |
| Molekulargewicht (g/mol) | 195.18 |
| SMILES | [K+].[O-]C(=O)C1=NC(=O)NC(=O)N1 |
| Synonym | potassium oxonate,oteracil potassium,oxonic acid potassium salt,allantoxanic acid potassium salt,potassium azaorotate,oxonic acid, potassium salt,oxonate, potassium,oxonate,allantoxanic acid |
| Summenformel | C4H2KN3O4 |
Kaliumiodat, 98 %, Thermo Scientific Chemicals
CAS: 5-6-7758 Summenformel: IKO3 Molekulargewicht (g/mol): 214.00 MDL-Nummer: MFCD00011406 InChI-Schlüssel: JLKDVMWYMMLWTI-UHFFFAOYSA-M Synonym: potassium iodate,potassium triodate,caswell no. 693a,iodic acid, potassium salt,unii-i139e44nhl,potassium iodine oxide kio3,iodic acid hio3 , potassium salt,epa pesticide chemical code 075703,iodic acid hio3 , potassium salt 1:1,kaliumjodat PubChem CID: 23665710 IUPAC-Name: Kalium; Iodat SMILES: [O-]I(=O)=O.[K+]
| InChI-Schlüssel | JLKDVMWYMMLWTI-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Kalium; Iodat |
| PubChem CID | 23665710 |
| CAS | 5-6-7758 |
| MDL-Nummer | MFCD00011406 |
| Molekulargewicht (g/mol) | 214.00 |
| SMILES | [O-]I(=O)=O.[K+] |
| Synonym | potassium iodate,potassium triodate,caswell no. 693a,iodic acid, potassium salt,unii-i139e44nhl,potassium iodine oxide kio3,iodic acid hio3 , potassium salt,epa pesticide chemical code 075703,iodic acid hio3 , potassium salt 1:1,kaliumjodat |
| Summenformel | IKO3 |