Gefilterte Suchergebnisse
Thermo Scientific Chemicals Ethidiumbromid-Entfärbebeutel mit Aktivierungslösung
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
Thermo Scientific Chemicals Tris(hydroxymethyl)aminomethanhydrochlorid, 1 M Lsg., pH 7.4, Rnase-frei
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
Natriumacetat, 3 M wässr. Lösg., pH-Wert 5.2, autoklaviert, Thermo Scientific Chemicals
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
Thermo Scientific Chemicals Bradford-Färbereagenz, gebrauchsfertige Lösung.
Zur Bestimmung der Proteinkonzentration (100 bis 1500 μg)
| Gesundheitsgefahr 2 | GHS H-Hinweis H314-H318-H371 Verursacht schwere Verätzungen der Haut und schwere Augenschäden. Verursacht schwere Augenschäden. Kann die Organe schädigen. |
|---|---|
| Chemischer Name oder Material | Bradford Dye Reagent |
| Gesundheitsgefahr 3 | P234-P260-P264b-P270-P271-P280-P303+P361+P353-P304+P340-P305+P351+P338-P310-P330-P331-P363-P390-P501c |
| Löslichkeitsinformationen | Miscible with water. |
| UN-Nummer | UN1805 |
| Farbe | Blau |
| Gesundheitsgefahr 1 | H290-H302+H332-H314-H335-H371 |
| Physikalische Form | Flüssig |
| Empfohlene Lagerung | Kühl lagern |
| TSCA | Nein |
| DOT-Informationen | Transportgefahrenklasse:8; Verpackungsgruppe:III; richtiger Versandname:PHOSPHORSÄURELÖSUNG |
| Namenshinweis | Ready-to-Use soln. |
Thermo Scientific Chemicals Phenol:Chloroform:Isoamylalkohol25:24:1, gebrauchsfertige gesättigte wässr. Lösg., pH-Wert 5.2
CAS: 136112-00-0 Summenformel: C12H19Cl3O2 Molekulargewicht (g/mol): 301.632 MDL-Nummer: MFCD00133763 InChI-Schlüssel: ZYWFEOZQIUMEGL-UHFFFAOYSA-N Synonym: phenol-chloroform-isoamyl alcohol mixture,chloroform; isoamyl alcohol; phenol,phenol chloroform isoamyl alcohol,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 125:24:1,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 25:24:1,phenol-chloroform-isoamyl alcohol mixture, vetec tm reagent grade, 25:24:1,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 49.5:49.5:1,phenol:chloroform:isoamyl alcohol 25:24:1, ready-to-use saturated aqueous solution, ph 5.2, with alkaline buffer,phenol:chloroform:isoamyl alcohol 25:24:1, ready-to-use saturated aqueous solution, ph 6.7, with alkaline buffer PubChem CID: 66587205 IUPAC-Name: Chloroform; 3-Methylbutan-1-ol; Phenol SMILES: CC(C)CCO.C1=CC=C(C=C1)O.C(Cl)(Cl)Cl
| InChI-Schlüssel | ZYWFEOZQIUMEGL-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Chloroform; 3-Methylbutan-1-ol; Phenol |
| PubChem CID | 66587205 |
| CAS | 136112-00-0 |
| MDL-Nummer | MFCD00133763 |
| Molekulargewicht (g/mol) | 301.632 |
| SMILES | CC(C)CCO.C1=CC=C(C=C1)O.C(Cl)(Cl)Cl |
| Synonym | phenol-chloroform-isoamyl alcohol mixture,chloroform; isoamyl alcohol; phenol,phenol chloroform isoamyl alcohol,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 125:24:1,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 25:24:1,phenol-chloroform-isoamyl alcohol mixture, vetec tm reagent grade, 25:24:1,phenol-chloroform-isoamyl alcohol mixture, bioultra, for molecular biology, 49.5:49.5:1,phenol:chloroform:isoamyl alcohol 25:24:1, ready-to-use saturated aqueous solution, ph 5.2, with alkaline buffer,phenol:chloroform:isoamyl alcohol 25:24:1, ready-to-use saturated aqueous solution, ph 6.7, with alkaline buffer |
| Summenformel | C12H19Cl3O2 |
Natriumhydroxid, 10 N wässr. Lösg., Thermo Scientific Chemicals
CAS: 1310-73-2 Summenformel: HNaO Molekulargewicht (g/mol): 39.997 MDL-Nummer: MFCD00003548 InChI-Schlüssel: HEMHJVSKTPXQMS-UHFFFAOYSA-M Synonym: sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic PubChem CID: 14798 ChEBI: CHEBI:32145 IUPAC-Name: Natrium;Hydroxid SMILES: [OH-].[Na+]
| InChI-Schlüssel | HEMHJVSKTPXQMS-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium;Hydroxid |
| PubChem CID | 14798 |
| CAS | 1310-73-2 |
| ChEBI | CHEBI:32145 |
| MDL-Nummer | MFCD00003548 |
| Molekulargewicht (g/mol) | 39.997 |
| SMILES | [OH-].[Na+] |
| Synonym | sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic |
| Summenformel | HNaO |
| Chemischer Name oder Material | Saponin permeating solution |
|---|---|
| Löslichkeitsinformationen | Difficult to mix. |
| Physikalische Form | Flüssig |
| Empfohlene Lagerung | Umgebungstemperaturen |
| Konzentration | 0.5% w/v soln. in PBS (10X) |
| TSCA | No |
Jod-Monochlorid, 1 M Lösg. In Dichlormethan, Thermo Scientific Chemicals
CAS: 7790-99-0 Summenformel: ClI Molekulargewicht (g/mol): 162.35 MDL-Nummer: MFCD00011354 InChI-Schlüssel: QZRGKCOWNLSUDK-UHFFFAOYSA-N Synonym: iodine monochloride,iodine chloride,iodochlorine,iodine chloride icl,chloroiodide,wijs' chloride,iodinemonochloride,chlorine iodide,unii-0smg5nlu45,protochlorure d'iode french PubChem CID: 24640 IUPAC-Name: Iodochlorid SMILES: ClI
| InChI-Schlüssel | QZRGKCOWNLSUDK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Iodochlorid |
| PubChem CID | 24640 |
| CAS | 7790-99-0 |
| MDL-Nummer | MFCD00011354 |
| Molekulargewicht (g/mol) | 162.35 |
| SMILES | ClI |
| Synonym | iodine monochloride,iodine chloride,iodochlorine,iodine chloride icl,chloroiodide,wijs' chloride,iodinemonochloride,chlorine iodide,unii-0smg5nlu45,protochlorure d'iode french |
| Summenformel | ClI |
Ammoniak, 7 M in Methanol, Thermo Scientific Chemicals
CAS: 7664-41-7 Summenformel: H3N Molekulargewicht (g/mol): 17.03 MDL-Nummer: MFCD00011418 InChI-Schlüssel: QGZKDVFQNNGYKY-UHFFFAOYSA-N Synonym: ammonia,ammonia gas,spirit of hartshorn,nitro-sil,ammoniakgas,ammonia anhydrous,anhydrous ammonia,ammonia, anhydrous,ammoniak,am-fol PubChem CID: 222 ChEBI: CHEBI:16134 IUPAC-Name: Azan SMILES: N
| InChI-Schlüssel | QGZKDVFQNNGYKY-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Azan |
| PubChem CID | 222 |
| CAS | 7664-41-7 |
| ChEBI | CHEBI:16134 |
| MDL-Nummer | MFCD00011418 |
| Molekulargewicht (g/mol) | 17.03 |
| SMILES | N |
| Synonym | ammonia,ammonia gas,spirit of hartshorn,nitro-sil,ammoniakgas,ammonia anhydrous,anhydrous ammonia,ammonia, anhydrous,ammoniak,am-fol |
| Summenformel | H3N |
Polyethyleneimin, M.W. 60,000, 50 % w/w wässr. Lösg., Thermo Scientific Chemicals
CAS: 9002-98-6 Summenformel: ((C2H5N)zC2H4N)y(C2H5N)x Molekulargewicht (g/mol): 43.07 MDL-Nummer: MFCD00084427 InChI-Schlüssel: NOWKCMXCCJGMRR-UHFFFAOYSA-N Synonym: ethyleneimine,ethylenimine,azacyclopropane,dimethyleneimine,ethylene imine,polyethyleneimine,dihydroazirene,everamine,aziran,polymin PubChem CID: 9033 ChEBI: CHEBI:30969 IUPAC-Name: Aziridin SMILES: *-CCNCCN(-*)CCN-*
| InChI-Schlüssel | NOWKCMXCCJGMRR-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Aziridin |
| PubChem CID | 9033 |
| CAS | 9002-98-6 |
| ChEBI | CHEBI:30969 |
| MDL-Nummer | MFCD00084427 |
| Molekulargewicht (g/mol) | 43.07 |
| SMILES | *-CCNCCN(-*)CCN-* |
| Synonym | ethyleneimine,ethylenimine,azacyclopropane,dimethyleneimine,ethylene imine,polyethyleneimine,dihydroazirene,everamine,aziran,polymin |
| Summenformel | ((C2H5N)zC2H4N)y(C2H5N)x |
| Chemischer Name oder Material | Deblock trichloroacetic acid soln. |
|---|---|
| UN-Nummer | UN2810 |
| Dichte | 1.325 |
| Konzentration | 3% w/w in dichloromethane |
| Gesundheitsgefahr 2 | GHS H-Hinweis H318-H351-H315 Verursacht schwere Augenschäden. Steht im Verdacht, Krebs zu erzeugen. Verursacht Hautreizungen. |
| Gesundheitsgefahr 3 | P201-P202-P261-P264b-P271-P281-P302+P352-P304+P340-P305+P351+P338-P308+P313-P310-P332+P313-P362-P501c |
| Farbe | Farblos |
| Gesundheitsgefahr 1 | Gehäuse H315-H318-H336-H350 |
| Physikalische Form | Flüssig |
| Empfohlene Lagerung | Umgebungstemperaturen |
| MDL-Nummer | MFCD00004177 |
| Synonym | DEBLK soln. |
| TSCA | Ja |
| DOT-Informationen | Gefahrenklasse:8; Verpackungsgruppe:III |
Kaliumchlorid, 1 M, wässr. Lösg., Thermo Scientific Chemicals
CAS: 7447-40-7 Summenformel: ClK Molekulargewicht (g/mol): 74.55 MDL-Nummer: MFCD00011360 InChI-Schlüssel: WCUXLLCKKVVCTQ-UHFFFAOYSA-M Synonym: potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs PubChem CID: 4873 ChEBI: CHEBI:32588 IUPAC-Name: Kaliumchlorid SMILES: [Cl-].[K+]
| InChI-Schlüssel | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Kaliumchlorid |
| PubChem CID | 4873 |
| CAS | 7447-40-7 |
| ChEBI | CHEBI:32588 |
| MDL-Nummer | MFCD00011360 |
| Molekulargewicht (g/mol) | 74.55 |
| SMILES | [Cl-].[K+] |
| Synonym | potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs |
| Summenformel | ClK |
| Chemischer Name oder Material | Bromine |
|---|---|
| InChI-Schlüssel | CPELXLSAUQHCOX-UHFFFAOYSA-M |
| IUPAC-Name | Bromid |
| Dichte | 3.111 |
| ChEBI | CHEBI:29224 |
| Molekulargewicht (g/mol) | 79.91 |
| Konzentration | 0.90 to 1.10M |
| SMILES | [Br-] |
| Merck Index | 15, 1401 |
| Namenshinweis | 1M solution in acetic acid |
| Formelmasse | 159.82 |
| Gesundheitsgefahr 2 | GHS P-SatzLebensgefahr bei Einatmen.Verursacht schwere Verätzungen der Haut und schwere AugenschädenSehr giftig für Wasserorganismen.Flüssigkeit und Dampf entzündbar. |
| Gesundheitsgefahr 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Avoid release to the environment. |
| PubChem CID | 24408 |
| Löslichkeitsinformationen | Solubility in water: soluble. |
| Farbe | Rot |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Physikalische Form | Flüssig |
| CAS | 64-19-7 |
| MDL-Nummer | MFCD00010896 |
| Strukturformel | Br2 |
| Flammpunkt | 40°C |
| Synonym | bromine,dibromine,brom,bromine solution,brome,bromo,broom,bromine water,bromo italian,bromo spanish |
| Summenformel | Br |