Benzol und substituierte Derivate
Gefilterte Suchergebnisse
p-Anisaldehyd +99 %, Thermo Scientific Chemicals
CAS: 123-11-5 Summenformel: C8H8O2 Molekulargewicht (g/mol): 136.15 MDL-Nummer: MFCD00003385 InChI-Schlüssel: ZRSNZINYAWTAHE-UHFFFAOYSA-N Synonym: p-anisaldehyde,anisaldehyde,anisic aldehyde,p-methoxybenzaldehyde,4-anisaldehyde,aubepine,p-anisic aldehyde,p-formylanisole,benzaldehyde, 4-methoxy,crategine PubChem CID: 31244 ChEBI: CHEBI:28235 IUPAC-Name: 4-Methoxybenzaldehyd SMILES: COC1=CC=C(C=C1)C=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ZRSNZINYAWTAHE-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-Methoxybenzaldehyd |
| PubChem CID | 31244 |
| CAS | 123-11-5 |
| ChEBI | CHEBI:28235 |
| MDL-Nummer | MFCD00003385 |
| Molekulargewicht (g/mol) | 136.15 |
| SMILES | COC1=CC=C(C=C1)C=O |
| Synonym | p-anisaldehyde,anisaldehyde,anisic aldehyde,p-methoxybenzaldehyde,4-anisaldehyde,aubepine,p-anisic aldehyde,p-formylanisole,benzaldehyde, 4-methoxy,crategine |
| Summenformel | C8H8O2 |
Isoeugenol, Mischung aus cis/trans-Isomeren 99 %, Thermo Scientific Chemicals
CAS: 97-54-1 Summenformel: C10H12O2 Molekulargewicht (g/mol): 164.20 MDL-Nummer: MFCD00009285 InChI-Schlüssel: BJIOGJUNALELMI-ONEGZZNKSA-N Synonym: isoeugenol,e-isoeugenol,trans-isoeugenol,2-methoxy-4-propenylphenol,4-propenylguaiacol,4-hydroxy-3-methoxy-1-propenylbenzene,2-methoxy-4-prop-1-en-1-yl phenol,trans-p-propenylquaiacol,isoeugenol trans-form,4-hydroxy-3-methoxypropenylbenzene PubChem CID: 853433 ChEBI: CHEBI:50545 SMILES: COC1=CC(\C=C\C)=CC=C1O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | BJIOGJUNALELMI-ONEGZZNKSA-N |
|---|---|
| PubChem CID | 853433 |
| CAS | 97-54-1 |
| ChEBI | CHEBI:50545 |
| MDL-Nummer | MFCD00009285 |
| Molekulargewicht (g/mol) | 164.20 |
| SMILES | COC1=CC(\C=C\C)=CC=C1O |
| Synonym | isoeugenol,e-isoeugenol,trans-isoeugenol,2-methoxy-4-propenylphenol,4-propenylguaiacol,4-hydroxy-3-methoxy-1-propenylbenzene,2-methoxy-4-prop-1-en-1-yl phenol,trans-p-propenylquaiacol,isoeugenol trans-form,4-hydroxy-3-methoxypropenylbenzene |
| Summenformel | C10H12O2 |
4-Dimethylaminobenzaldehyd, 99+ %, Thermo Scientific Chemicals
CAS: 100-10-7 Summenformel: C9H11NO Molekulargewicht (g/mol): 149.19 MDL-Nummer: MFCD00003381 InChI-Schlüssel: BGNGWHSBYQYVRX-UHFFFAOYSA-N Synonym: 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal PubChem CID: 7479 IUPAC-Name: 4-(dimethylamino)benzaldehyde SMILES: CN(C)C1=CC=C(C=O)C=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | BGNGWHSBYQYVRX-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-(dimethylamino)benzaldehyde |
| PubChem CID | 7479 |
| CAS | 100-10-7 |
| MDL-Nummer | MFCD00003381 |
| Molekulargewicht (g/mol) | 149.19 |
| SMILES | CN(C)C1=CC=C(C=O)C=C1 |
| Synonym | 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal |
| Summenformel | C9H11NO |
3-Chlorperoxybenzoesäure, 70-75 %, Rest 3-Chlorbenzoesäure und Wasser, Thermo Scientific Chemicals
3-Chloroperoxybenzoesäure, 70–75 %, C7H5ClO3, CAS-Nummer-937-14-4, 535-80-8, 7732-18-5
| Dichte | 0.5600g/mL |
|---|---|
| ChEBI | CHEBI:52091 |
| Namenshinweis | 70 - 75% |
| CAS Min. % | 25.0 |
| Formelmasse | 172.57 |
| RTECS-Nummer | SD9470000 |
| PubChem CID | 70297 |
| Physikalische Form | Feuchtes Pulver |
| Fieser | 01,135; 02,68; 03,49; 04,85; 05,120; 06,110; 07,62; 08,97; 09,108; 10,92; 11,122; 12,118; 13,76; 15,86; 16,80; 17,76 |
| Strukturformel | ClC6H4CO3H |
| Prozentgehaltsbereich | di-m-Chlorobenzoyl peroxide: < 0.1% Typical (HPLC) |
| Reinheit (%) | 70-75% |
| Summenformel | C7H5ClO3 |
| Schmelzpunkt | 92.0°C to 94.0°C |
| InChI-Schlüssel | NHQDETIJWKXCTC-UHFFFAOYSA-N |
| IUPAC-Name | 3-Chlorbenzecarboperoxsäure |
| EINECS-Nummer | 213-322-3 |
| Relative Dichte | 0.56 |
| Molekulargewicht (g/mol) | 172.56 |
| SMILES | OOC(=O)C1=CC=CC(Cl)=C1 |
| Merck Index | 15,2154 |
| CAS Max. % | 30.0 |
| Gesundheitsgefahr 2 | GHS-H-Hinweis Verursacht schwere Verätzungen der Haut und schwere Augenschäden. Gesundheitsschädlich bei Verschlucken. Erwärmung kann Brand verursachen. |
| Gesundheitsgefahr 3 | GHS-P-Hinweis Schutzhandschuhe/Schutzkleidung/Augenschutz/Gesichtsschutz tragen. Von Hitze/Funken/offenen Flammen/heißen Oberflächen fernhalten. - Rauchen verboten. Von Kleidung/brennbaren Materialien fernhalten/aufbewahren. BEI VERSCHLUCKEN: rin |
| Löslichkeitsinformationen | Solubility in water: insoluble. Other solubilities: soluble in koh, soluble in chloroform and acetone |
| Farbe | Weiß |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| CAS | 7732-18-5 |
| MDL-Nummer | MFCD00002127 |
| Synonym | 3-chloroperoxybenzoic acid,3-chloroperbenzoic acid,mcpba,m-chloroperbenzoic acid,m-chloroperoxybenzoic acid,meta-chloroperoxybenzoic acid,benzenecarboperoxoic acid, 3-chloro,m-chlorobenzoyl hydroperoxide,meta-chloroperbenzoic acid,3-chlorobenzoperoxoic acid |
| TSCA | TSCA |
| Beilstein | 09,IV,972 |
Eugenol 99 %, Thermo Scientific Chemicals
CAS: 97-53-0 Summenformel: C10H12O2 Molekulargewicht (g/mol): 164.20 MDL-Nummer: MFCD00008654 InChI-Schlüssel: RRAFCDWBNXTKKO-UHFFFAOYSA-N Synonym: eugenol,4-allylguaiacol,4-allyl-2-methoxyphenol,eugenic acid,allylguaiacol,caryophyllic acid,p-allylguaiacol,p-eugenol,2-methoxy-4-allylphenol,engenol PubChem CID: 3314 ChEBI: CHEBI:4917 SMILES: COC1=CC(CC=C)=CC=C1O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RRAFCDWBNXTKKO-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 3314 |
| CAS | 97-53-0 |
| ChEBI | CHEBI:4917 |
| MDL-Nummer | MFCD00008654 |
| Molekulargewicht (g/mol) | 164.20 |
| SMILES | COC1=CC(CC=C)=CC=C1O |
| Synonym | eugenol,4-allylguaiacol,4-allyl-2-methoxyphenol,eugenic acid,allylguaiacol,caryophyllic acid,p-allylguaiacol,p-eugenol,2-methoxy-4-allylphenol,engenol |
| Summenformel | C10H12O2 |
2-Phenoxyethanol, 99 %, Thermo Scientific Chemicals
CAS: 122-99-6 Summenformel: C8H10O2 Molekulargewicht (g/mol): 138.17 MDL-Nummer: MFCD00002857 InChI-Schlüssel: QCDWFXQBSFUVSP-UHFFFAOYSA-N Synonym: phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane PubChem CID: 31236 ChEBI: CHEBI:64275 IUPAC-Name: 2-Phenoxyethanol SMILES: C1=CC=C(C=C1)OCCO
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | QCDWFXQBSFUVSP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Phenoxyethanol |
| PubChem CID | 31236 |
| CAS | 122-99-6 |
| ChEBI | CHEBI:64275 |
| MDL-Nummer | MFCD00002857 |
| Molekulargewicht (g/mol) | 138.17 |
| SMILES | C1=CC=C(C=C1)OCCO |
| Synonym | phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane |
| Summenformel | C8H10O2 |
Benzoesäure, 99.6 %, zur Analyse ACS, Thermo Scientific Chemicals
CAS: 65-85-0 Summenformel: C7H6O2 Molekulargewicht (g/mol): 122.12 InChI-Schlüssel: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC-Name: Benzoesäure SMILES: C1=CC=C(C=C1)C(=O)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Benzoesäure |
| PubChem CID | 243 |
| CAS | 65-85-0 |
| ChEBI | CHEBI:30746 |
| Molekulargewicht (g/mol) | 122.12 |
| SMILES | C1=CC=C(C=C1)C(=O)O |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| Summenformel | C7H6O2 |
DL-α-Methoxyphenylessigsäure, 99 %, Thermo Scientific Chemicals
CAS: 7021-09-2 Summenformel: C9H10O3 Molekulargewicht (g/mol): 166.18 InChI-Schlüssel: DIWVBIXQCNRCFE-UHFFFAOYNA-N Synonym: methoxyphenylacetic acid,methoxy phenyl acetic acid,dl-alpha-methoxyphenylacetic acid,acetic acid, methoxyphenyl,alpha-methoxyphenylacetic acid,o-methyl-dl-mandelic acid,benzeneacetic acid, .alpha.-methoxy,2-methoxy-2-phenyl-acetic acid,methyloxy phenyl acetic acid,.alpha.-methoxyphenylacetic acid PubChem CID: 107202 IUPAC-Name: 2-Methoxy-2-Phenylessigsäure SMILES: COC(C1=CC=CC=C1)C(=O)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | DIWVBIXQCNRCFE-UHFFFAOYNA-N |
|---|---|
| IUPAC-Name | 2-Methoxy-2-Phenylessigsäure |
| PubChem CID | 107202 |
| CAS | 7021-09-2 |
| Molekulargewicht (g/mol) | 166.18 |
| SMILES | COC(C1=CC=CC=C1)C(=O)O |
| Synonym | methoxyphenylacetic acid,methoxy phenyl acetic acid,dl-alpha-methoxyphenylacetic acid,acetic acid, methoxyphenyl,alpha-methoxyphenylacetic acid,o-methyl-dl-mandelic acid,benzeneacetic acid, .alpha.-methoxy,2-methoxy-2-phenyl-acetic acid,methyloxy phenyl acetic acid,.alpha.-methoxyphenylacetic acid |
| Summenformel | C9H10O3 |
Thermo Scientific Chemicals p-Terphenyl, 99+%
CAS: 92-94-4 Summenformel: C18H14 Molekulargewicht (g/mol): 230.31 MDL-Nummer: MFCD00003061 InChI-Schlüssel: XJKSTNDFUHDPQJ-UHFFFAOYSA-N Synonym: p-terphenyl,1,1':4',1-terphenyl,p-diphenylbenzene,p-triphenyl,santowax p,4-phenylbiphenyl,4-phenyldiphenyl,para-terphenyl,biphenyl, 4-phenyl,pyrogallol tannin PubChem CID: 7115 ChEBI: CHEBI:52242 IUPAC-Name: 1,4-Diphenylbenzol SMILES: C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | XJKSTNDFUHDPQJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1,4-Diphenylbenzol |
| PubChem CID | 7115 |
| CAS | 92-94-4 |
| ChEBI | CHEBI:52242 |
| MDL-Nummer | MFCD00003061 |
| Molekulargewicht (g/mol) | 230.31 |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3 |
| Synonym | p-terphenyl,1,1':4',1-terphenyl,p-diphenylbenzene,p-triphenyl,santowax p,4-phenylbiphenyl,4-phenyldiphenyl,para-terphenyl,biphenyl, 4-phenyl,pyrogallol tannin |
| Summenformel | C18H14 |
Methylsalicylat, 99 %, Thermo Scientific Chemicals
CAS: 119-36-8 Summenformel: C8H8O3 Molekulargewicht (g/mol): 152.15 MDL-Nummer: MFCD00002214 InChI-Schlüssel: OSWPMRLSEDHDFF-UHFFFAOYSA-N Synonym: methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester PubChem CID: 4133 ChEBI: CHEBI:31832 IUPAC-Name: Methyl 2-Hydroxybenzoat SMILES: COC(=O)C1=CC=CC=C1O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | OSWPMRLSEDHDFF-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Methyl 2-Hydroxybenzoat |
| PubChem CID | 4133 |
| CAS | 119-36-8 |
| ChEBI | CHEBI:31832 |
| MDL-Nummer | MFCD00002214 |
| Molekulargewicht (g/mol) | 152.15 |
| SMILES | COC(=O)C1=CC=CC=C1O |
| Synonym | methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester |
| Summenformel | C8H8O3 |
Ethylbenzoat, 99+%, Thermo Scientific Chemicals
CAS: 93-89-0 Summenformel: C9H10O2 Molekulargewicht (g/mol): 150.18 MDL-Nummer: MFCD00009109 InChI-Schlüssel: MTZQAGJQAFMTAQ-UHFFFAOYSA-N Synonym: benzoic acid, ethyl ester,benzoic ether,ethyl benzenecarboxylate,ethylbenzoate,benzoyl ethyl ether,benzoic acid ethyl ester,ethylester kyseliny benzoove,natural,unii-j115brj15h,fema no. 2422 PubChem CID: 7165 IUPAC-Name: Ethylbenzoat SMILES: CCOC(=O)C1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | MTZQAGJQAFMTAQ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Ethylbenzoat |
| PubChem CID | 7165 |
| CAS | 93-89-0 |
| MDL-Nummer | MFCD00009109 |
| Molekulargewicht (g/mol) | 150.18 |
| SMILES | CCOC(=O)C1=CC=CC=C1 |
| Synonym | benzoic acid, ethyl ester,benzoic ether,ethyl benzenecarboxylate,ethylbenzoate,benzoyl ethyl ether,benzoic acid ethyl ester,ethylester kyseliny benzoove,natural,unii-j115brj15h,fema no. 2422 |
| Summenformel | C9H10O2 |
Triphenylphosphin, 99 %, Thermo Scientific Chemicals
CAS: 603-35-0 Summenformel: C18H15P Molekulargewicht (g/mol): 262.29 MDL-Nummer: MFCD00003043 MFCD20489348 InChI-Schlüssel: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC-Name: Triphenylphosphan SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Triphenylphosphan |
| PubChem CID | 11776 |
| CAS | 603-35-0 |
| MDL-Nummer | MFCD00003043 MFCD20489348 |
| Molekulargewicht (g/mol) | 262.29 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| Summenformel | C18H15P |
p-Anisinsäure 98 %, Thermo Scientific Chemicals
CAS: 100-09-4 Summenformel: C8H8O3 Molekulargewicht (g/mol): 152.15 MDL-Nummer: MFCD00002542 InChI-Schlüssel: ZEYHEAKUIGZSGI-UHFFFAOYSA-N Synonym: p-anisic acid,anisic acid,p-methoxybenzoic acid,draconic acid,4-anisic acid,benzoic acid, 4-methoxy,anisic acid, para,4-methoxybenzoate,para-anisic acid,anisic acid, p-isomer PubChem CID: 7478 ChEBI: CHEBI:40813 IUPAC-Name: 4-Methoxybenzoesäure SMILES: COC1=CC=C(C=C1)C(O)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ZEYHEAKUIGZSGI-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-Methoxybenzoesäure |
| PubChem CID | 7478 |
| CAS | 100-09-4 |
| ChEBI | CHEBI:40813 |
| MDL-Nummer | MFCD00002542 |
| Molekulargewicht (g/mol) | 152.15 |
| SMILES | COC1=CC=C(C=C1)C(O)=O |
| Synonym | p-anisic acid,anisic acid,p-methoxybenzoic acid,draconic acid,4-anisic acid,benzoic acid, 4-methoxy,anisic acid, para,4-methoxybenzoate,para-anisic acid,anisic acid, p-isomer |
| Summenformel | C8H8O3 |
4-Nitrobenzaldehyd, 99 %, Thermo Scientific Chemicals
CAS: 555-16-8 Summenformel: C7H5NO3 Molekulargewicht (g/mol): 151.12 MDL-Nummer: MFCD00007346 InChI-Schlüssel: BXRFQSNOROATLV-UHFFFAOYSA-N Synonym: p-nitrobenzaldehyde,benzaldehyde, 4-nitro,p-formylnitrobenzene,benzaldehyde, p-nitro,4-nitrobenzaldehydde,4-nitro-benzaldehyde,4-formylnitrobenzene,p-nitro benzaldehyde,4-nitro benzaldehyde,ccris 1675 PubChem CID: 541 ChEBI: CHEBI:66926 IUPAC-Name: 4-Nitrobenzaldehyd SMILES: [O-][N+](=O)C1=CC=C(C=O)C=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | BXRFQSNOROATLV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-Nitrobenzaldehyd |
| PubChem CID | 541 |
| CAS | 555-16-8 |
| ChEBI | CHEBI:66926 |
| MDL-Nummer | MFCD00007346 |
| Molekulargewicht (g/mol) | 151.12 |
| SMILES | [O-][N+](=O)C1=CC=C(C=O)C=C1 |
| Synonym | p-nitrobenzaldehyde,benzaldehyde, 4-nitro,p-formylnitrobenzene,benzaldehyde, p-nitro,4-nitrobenzaldehydde,4-nitro-benzaldehyde,4-formylnitrobenzene,p-nitro benzaldehyde,4-nitro benzaldehyde,ccris 1675 |
| Summenformel | C7H5NO3 |
Triphenylphosphin-Kupfer(I)-hydrid Hexamer, 96 %, Thermo Scientific Chemicals
CAS: 33636-93-0 Summenformel: C108H96Cu6P6 Molekulargewicht (g/mol): 1961.07 MDL-Nummer: MFCD00221518 InChI-Schlüssel: IZZFKTUYPRVQID-UHFFFAOYSA-T Synonym: stryker's reagent,triphenylphosphine copper hydride hexamer,triphenylphosphine-copper i hydride hexamer,unii-8x3r32m7xu,hydrido triphenylphosphine copper i hexamer,stryker's reagent mi,triphenylphosphine cuprous hydride,triphenylphosphine copper i hydride hexamer,copper, hexa-mu3-hydrohexakis triphenylphosphine hexa-, octahedro,cuprous hydride triphenylphosphine hexamer PubChem CID: 11982471 IUPAC-Name: hexahydrogen [2,3,4,5,6-pentakis(triphenylphosphaniumyl)heptacyclo[2.2.0.0¹,³.0²,⁵.0²,⁶.0³,⁵.0⁴,⁶]hexacopper-1-yl]triphenylphosphanium SMILES: [H+].[H+].[H+].[H+].[H+].[H+].C1=CC=C(C=C1)[P+](C1=CC=CC=C1)(C1=CC=CC=C1)[Cu]123[Cu]45([P+](C6=CC=CC=C6)(C6=CC=CC=C6)C6=CC=CC=C6)[Cu]11([P+](C6=CC=CC=C6)(C6=CC=CC=C6)C6=CC=CC=C6)[Cu]22([P+](C6=CC=CC=C6)(C6=CC=CC=C6)C6=CC=CC=C6)[Cu]34([P+](C3=CC=CC=C3)(C3=CC=CC=C3)C3=CC=CC=C3)[Cu]512[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | IZZFKTUYPRVQID-UHFFFAOYSA-T |
|---|---|
| IUPAC-Name | hexahydrogen [2,3,4,5,6-pentakis(triphenylphosphaniumyl)heptacyclo[2.2.0.0¹,³.0²,⁵.0²,⁶.0³,⁵.0⁴,⁶]hexacopper-1-yl]triphenylphosphanium |
| PubChem CID | 11982471 |
| CAS | 33636-93-0 |
| MDL-Nummer | MFCD00221518 |
| Molekulargewicht (g/mol) | 1961.07 |
| SMILES | [H+].[H+].[H+].[H+].[H+].[H+].C1=CC=C(C=C1)[P+](C1=CC=CC=C1)(C1=CC=CC=C1)[Cu]123[Cu]45([P+](C6=CC=CC=C6)(C6=CC=CC=C6)C6=CC=CC=C6)[Cu]11([P+](C6=CC=CC=C6)(C6=CC=CC=C6)C6=CC=CC=C6)[Cu]22([P+](C6=CC=CC=C6)(C6=CC=CC=C6)C6=CC=CC=C6)[Cu]34([P+](C3=CC=CC=C3)(C3=CC=CC=C3)C3=CC=CC=C3)[Cu]512[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | stryker's reagent,triphenylphosphine copper hydride hexamer,triphenylphosphine-copper i hydride hexamer,unii-8x3r32m7xu,hydrido triphenylphosphine copper i hexamer,stryker's reagent mi,triphenylphosphine cuprous hydride,triphenylphosphine copper i hydride hexamer,copper, hexa-mu3-hydrohexakis triphenylphosphine hexa-, octahedro,cuprous hydride triphenylphosphine hexamer |
| Summenformel | C108H96Cu6P6 |