Organische Kohlensäuren und Derivate
- (6)
- (2)
- (3)
- (1)
- (7)
- (2)
- (2)
- (3)
- (3)
- (1)
- (2)
- (2)
- (2)
- (3)
- (1)
- (2)
- (2)
- (4)
- (3)
- (1)
- (11)
- (2)
- (1)
- (3)
- (6)
- (5)
- (3)
- (5)
- (4)
- (8)
- (2)
- (1)
- (3)
- (6)
- (6)
- (1)
- (2)
- (2)
- (10)
- (1)
- (1)
- (4)
- (1)
- (12)
- (6)
- (1)
- (1)
- (2)
- (3)
- (1)
- (3)
- (1)
- (1)
- (1)
- (1)
- (19)
- (11)
- (3)
- (3)
- (21)
- (5)
- (10)
- (1)
- (7)
- (2)
- (25)
- (3)
- (2)
- (3)
- (4)
- (14)
- (3)
- (5)
- (3)
- (7)
- (2)
- (1)
- (1)
- (3)
- (2)
- (4)
- (5)
- (1)
- (2)
- (1)
- (3)
- (3)
- (5)
Gefilterte Suchergebnisse
Propylencarbonat, 99.50 %, Thermo Scientific Chemicals
CAS: 108-32-7 Summenformel: C4H6O3 Molekulargewicht (g/mol): 102.09 MDL-Nummer: MFCD00005385,MFCD00798264,MFCD00798265 InChI-Schlüssel: RUOJZAUFBMNUDX-UHFFFAOYNA-N Synonym: propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate PubChem CID: 7924 IUPAC-Name: 4-methyl-1,3-dioxolan-2-on SMILES: CC1COC(=O)O1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RUOJZAUFBMNUDX-UHFFFAOYNA-N |
|---|---|
| IUPAC-Name | 4-methyl-1,3-dioxolan-2-on |
| PubChem CID | 7924 |
| CAS | 108-32-7 |
| MDL-Nummer | MFCD00005385,MFCD00798264,MFCD00798265 |
| Molekulargewicht (g/mol) | 102.09 |
| SMILES | CC1COC(=O)O1 |
| Synonym | propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate |
| Summenformel | C4H6O3 |
Ethylencarbonat, +99 %, Thermo Scientific Chemicals
CAS: 96-49-1 Summenformel: C3H4O3 Molekulargewicht (g/mol): 88.06 MDL-Nummer: MFCD00005382 InChI-Schlüssel: KMTRUDSVKNLOMY-UHFFFAOYSA-N Synonym: ethylene carbonate,glycol carbonate,ethylene glycol carbonate,dioxolone-2,cyclic ethylene carbonate,ethylene carbonic acid,1,3-dioxacyclopentan-2-one,2-dioxolone,carbonic acid, cyclic ethylene ester,texacar ec PubChem CID: 7303 IUPAC-Name: 1,3-Dioxolan-2-on SMILES: C1COC(=O)O1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | KMTRUDSVKNLOMY-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1,3-Dioxolan-2-on |
| PubChem CID | 7303 |
| CAS | 96-49-1 |
| MDL-Nummer | MFCD00005382 |
| Molekulargewicht (g/mol) | 88.06 |
| SMILES | C1COC(=O)O1 |
| Synonym | ethylene carbonate,glycol carbonate,ethylene glycol carbonate,dioxolone-2,cyclic ethylene carbonate,ethylene carbonic acid,1,3-dioxacyclopentan-2-one,2-dioxolone,carbonic acid, cyclic ethylene ester,texacar ec |
| Summenformel | C3H4O3 |
Harnstoff, 99.5 %, zur Analyse, Thermo Scientific Chemicals
CAS: 57-13-6 Summenformel: CH4N2O Molekulargewicht (g/mol): 60.06 InChI-Schlüssel: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC-Name: Harnstoff SMILES: C(=O)(N)N
| InChI-Schlüssel | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Harnstoff |
| PubChem CID | 1176 |
| CAS | 57-13-6 |
| ChEBI | CHEBI:48376 |
| Molekulargewicht (g/mol) | 60.06 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| Summenformel | CH4N2O |
Dimethylcarbonat, 99+%, extra trocken, AcroSeal™, Thermo Scientific Chemicals
CAS: 616-38-6 Summenformel: C3H6O3 Molekulargewicht (g/mol): 90.08 MDL-Nummer: MFCD00008420 InChI-Schlüssel: IEJIGPNLZYLLBP-UHFFFAOYSA-N Synonym: methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 PubChem CID: 12021 ChEBI: CHEBI:36596 IUPAC-Name: Dimethylcarbonat SMILES: COC(=O)OC
| InChI-Schlüssel | IEJIGPNLZYLLBP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Dimethylcarbonat |
| PubChem CID | 12021 |
| CAS | 616-38-6 |
| ChEBI | CHEBI:36596 |
| MDL-Nummer | MFCD00008420 |
| Molekulargewicht (g/mol) | 90.08 |
| SMILES | COC(=O)OC |
| Synonym | methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 |
| Summenformel | C3H6O3 |
Harnstoff,99%, Thermo Scientific Chemicals
CAS: 57-13-6 MDL-Nummer: MFCD00008022 InChI-Schlüssel: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC-Name: Harnstoff SMILES: C(=O)(N)N
| InChI-Schlüssel | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Harnstoff |
| PubChem CID | 1176 |
| CAS | 57-13-6 |
| ChEBI | CHEBI:48376 |
| MDL-Nummer | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
Harnstoff, 98 %, reinst, Perlen, Thermo Scientific Chemicals
CAS: 57-13-6 Summenformel: CH4N2O Molekulargewicht (g/mol): 60.06 MDL-Nummer: MFCD00008022 InChI-Schlüssel: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC-Name: Harnstoff SMILES: C(=O)(N)N
| InChI-Schlüssel | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Harnstoff |
| PubChem CID | 1176 |
| CAS | 57-13-6 |
| ChEBI | CHEBI:48376 |
| MDL-Nummer | MFCD00008022 |
| Molekulargewicht (g/mol) | 60.06 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| Summenformel | CH4N2O |
Triphosgen, 99 %, Thermo Scientific Chemicals
CAS: 32315-10-9 Summenformel: C3Cl6O3 Molekulargewicht (g/mol): 296.75 InChI-Schlüssel: UCPYLLCMEDAXFR-UHFFFAOYSA-N Synonym: triphosgene,bis trichloromethyl carbonate,methanol, trichloro-, carbonate 2:1,ditrichloromethyl carbonate,triphosgene bis-trichloromethyl carbonate,methanol, 1,1,1-trichloro-, 1,1'-carbonate,triphosgen,tri phosgene,tri-phosgene PubChem CID: 94429 IUPAC-Name: Bis(trichlormethyl)carbonat SMILES: C(=O)(OC(Cl)(Cl)Cl)OC(Cl)(Cl)Cl
| InChI-Schlüssel | UCPYLLCMEDAXFR-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Bis(trichlormethyl)carbonat |
| PubChem CID | 94429 |
| CAS | 32315-10-9 |
| Molekulargewicht (g/mol) | 296.75 |
| SMILES | C(=O)(OC(Cl)(Cl)Cl)OC(Cl)(Cl)Cl |
| Synonym | triphosgene,bis trichloromethyl carbonate,methanol, trichloro-, carbonate 2:1,ditrichloromethyl carbonate,triphosgene bis-trichloromethyl carbonate,methanol, 1,1,1-trichloro-, 1,1'-carbonate,triphosgen,tri phosgene,tri-phosgene |
| Summenformel | C3Cl6O3 |
Diethylcarbonat, 99%, Thermo Scientific Chemicals
CAS: 105-58-8 Summenformel: C5H10O3 Molekulargewicht (g/mol): 118.13 MDL-Nummer: MFCD00009107 InChI-Schlüssel: OIFBSDVPJOWBCH-UHFFFAOYSA-N Synonym: ethyl carbonate,carbonic acid, diethyl ester,carbonic acid diethyl ester,eufin,diatol,diaethylcarbonat,carbonic ether,ethoxyformic anhydride,diethylkarbonat,ethyl carbonate eto 2co PubChem CID: 7766 IUPAC-Name: Diethylcarbonat SMILES: CCOC(=O)OCC
| InChI-Schlüssel | OIFBSDVPJOWBCH-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diethylcarbonat |
| PubChem CID | 7766 |
| CAS | 105-58-8 |
| MDL-Nummer | MFCD00009107 |
| Molekulargewicht (g/mol) | 118.13 |
| SMILES | CCOC(=O)OCC |
| Synonym | ethyl carbonate,carbonic acid, diethyl ester,carbonic acid diethyl ester,eufin,diatol,diaethylcarbonat,carbonic ether,ethoxyformic anhydride,diethylkarbonat,ethyl carbonate eto 2co |
| Summenformel | C5H10O3 |
Dimethylcarbonat, 99 %, Thermo Scientific Chemicals
CAS: 616-38-6 Summenformel: C3H6O3 Molekulargewicht (g/mol): 90.08 MDL-Nummer: MFCD00008420 InChI-Schlüssel: IEJIGPNLZYLLBP-UHFFFAOYSA-N Synonym: methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 PubChem CID: 12021 ChEBI: CHEBI:36596 IUPAC-Name: Dimethylcarbonat SMILES: COC(=O)OC
| InChI-Schlüssel | IEJIGPNLZYLLBP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Dimethylcarbonat |
| PubChem CID | 12021 |
| CAS | 616-38-6 |
| ChEBI | CHEBI:36596 |
| MDL-Nummer | MFCD00008420 |
| Molekulargewicht (g/mol) | 90.08 |
| SMILES | COC(=O)OC |
| Synonym | methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 |
| Summenformel | C3H6O3 |
Diethylcarbonat, 99%, Thermo Scientific Chemicals
CAS: 105-58-8 Summenformel: C5H10O3 Molekulargewicht (g/mol): 118.13 MDL-Nummer: MFCD00009107 InChI-Schlüssel: OIFBSDVPJOWBCH-UHFFFAOYSA-N Synonym: ethyl carbonate,carbonic acid, diethyl ester,carbonic acid diethyl ester,eufin,diatol,diaethylcarbonat,carbonic ether,ethoxyformic anhydride,diethylkarbonat,ethyl carbonate eto 2co PubChem CID: 7766 IUPAC-Name: Diethylcarbonat SMILES: CCOC(=O)OCC
| InChI-Schlüssel | OIFBSDVPJOWBCH-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diethylcarbonat |
| PubChem CID | 7766 |
| CAS | 105-58-8 |
| MDL-Nummer | MFCD00009107 |
| Molekulargewicht (g/mol) | 118.13 |
| SMILES | CCOC(=O)OCC |
| Synonym | ethyl carbonate,carbonic acid, diethyl ester,carbonic acid diethyl ester,eufin,diatol,diaethylcarbonat,carbonic ether,ethoxyformic anhydride,diethylkarbonat,ethyl carbonate eto 2co |
| Summenformel | C5H10O3 |
N,N'-Dicyclohexylharnstoff 98 %, Thermo Scientific Chemicals
CAS: 2387-23-7 MDL-Nummer: MFCD00003829 InChI-Schlüssel: ADFXKUOMJKEIND-UHFFFAOYSA-N Synonym: n,n'-dicyclohexylurea,dicyclohexylurea,urea, n,n'-dicyclohexyl,unii-zv7823vvim,chembl1458,zv7823vvim,urea,3-dicyclohexyl,urea,n'-dicyclohexyl,n,n inverted exclamation marka-dicyclohexylurea,urea, 1,3-dicyclohexyl PubChem CID: 4277 IUPAC-Name: 1,3-Dicyclohexylharnstoff SMILES: C1CCC(CC1)NC(=O)NC2CCCCC2
| InChI-Schlüssel | ADFXKUOMJKEIND-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1,3-Dicyclohexylharnstoff |
| PubChem CID | 4277 |
| CAS | 2387-23-7 |
| MDL-Nummer | MFCD00003829 |
| SMILES | C1CCC(CC1)NC(=O)NC2CCCCC2 |
| Synonym | n,n'-dicyclohexylurea,dicyclohexylurea,urea, n,n'-dicyclohexyl,unii-zv7823vvim,chembl1458,zv7823vvim,urea,3-dicyclohexyl,urea,n'-dicyclohexyl,n,n inverted exclamation marka-dicyclohexylurea,urea, 1,3-dicyclohexyl |
Harnstoff Wasserstoffperoxid, 1 g Tabletten, stabilisiert, enthält35 Wt% H2 O2, Thermo Scientific Chemicals
CAS: 124-43-6 Summenformel: CH6N2O3 Molekulargewicht (g/mol): 94.07 InChI-Schlüssel: AQLJVWUFPCUVLO-UHFFFAOYSA-N Synonym: urea hydrogen peroxide,carbamide peroxide,percarbamide,urea peroxide,urea dioxide,hydrogen peroxide urea,urea hydroperoxide,hydroperit,hydroperite,percarbamid PubChem CID: 31294 ChEBI: CHEBI:75178 IUPAC-Name: Hydrogenperoxid-harnstoff SMILES: C(=O)(N)N.OO
| InChI-Schlüssel | AQLJVWUFPCUVLO-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Hydrogenperoxid-harnstoff |
| PubChem CID | 31294 |
| CAS | 124-43-6 |
| ChEBI | CHEBI:75178 |
| Molekulargewicht (g/mol) | 94.07 |
| SMILES | C(=O)(N)N.OO |
| Synonym | urea hydrogen peroxide,carbamide peroxide,percarbamide,urea peroxide,urea dioxide,hydrogen peroxide urea,urea hydroperoxide,hydroperit,hydroperite,percarbamid |
| Summenformel | CH6N2O3 |
1,3-Dimethyl-3,4,5,6-tetrahydro-2(1H)-Pyrimidinon, 97%, rein, Thermo Scientific Chemicals
CAS: 7226-23-5 Summenformel: C6H12N2O Molekulargewicht (g/mol): 128.17 MDL-Nummer: MFCD00006550 InChI-Schlüssel: GUVUOGQBMYCBQP-UHFFFAOYSA-N Synonym: 1,3-dimethyl-3,4,5,6-tetrahydro-2 1h-pyrimidinone,1,3-dimethyltetrahydropyrimidin-2 1h-one,dmpu,dimethylpropyleneurea,2 1h-pyrimidinone, tetrahydro-1,3-dimethyl,n,n'-dimethylpropyleneurea,n,n'-dimethyltrimethyleneurea,ccris 4322,n,n'-dimethylpropylene urea,tetrahydro-1,3-dimethyl-2 1h pyrimidine PubChem CID: 81646 IUPAC-Name: 1,3-Dimethyl-1,3-diazinan-2-on SMILES: CN1CCCN(C1=O)C
| InChI-Schlüssel | GUVUOGQBMYCBQP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1,3-Dimethyl-1,3-diazinan-2-on |
| PubChem CID | 81646 |
| CAS | 7226-23-5 |
| MDL-Nummer | MFCD00006550 |
| Molekulargewicht (g/mol) | 128.17 |
| SMILES | CN1CCCN(C1=O)C |
| Synonym | 1,3-dimethyl-3,4,5,6-tetrahydro-2 1h-pyrimidinone,1,3-dimethyltetrahydropyrimidin-2 1h-one,dmpu,dimethylpropyleneurea,2 1h-pyrimidinone, tetrahydro-1,3-dimethyl,n,n'-dimethylpropyleneurea,n,n'-dimethyltrimethyleneurea,ccris 4322,n,n'-dimethylpropylene urea,tetrahydro-1,3-dimethyl-2 1h pyrimidine |
| Summenformel | C6H12N2O |
Methylharnstoff, 97%, Thermo Scientific Chemicals
CAS: 598-50-5 Summenformel: C2H6N2O Molekulargewicht (g/mol): 74.08 MDL-Nummer: MFCD00007950 InChI-Schlüssel: XGEGHDBEHXKFPX-UHFFFAOYSA-N Synonym: 1-methylurea,n-methylurea,monomethylurea,urea, methyl,methyl urea,urea, n-methyl,methylmocovina,methylmocovina czech,methylharnstoff german,n-methyl urea PubChem CID: 11719 ChEBI: CHEBI:44383 IUPAC-Name: Methylharnstoff SMILES: CNC(=O)N
| InChI-Schlüssel | XGEGHDBEHXKFPX-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Methylharnstoff |
| PubChem CID | 11719 |
| CAS | 598-50-5 |
| ChEBI | CHEBI:44383 |
| MDL-Nummer | MFCD00007950 |
| Molekulargewicht (g/mol) | 74.08 |
| SMILES | CNC(=O)N |
| Synonym | 1-methylurea,n-methylurea,monomethylurea,urea, methyl,methyl urea,urea, n-methyl,methylmocovina,methylmocovina czech,methylharnstoff german,n-methyl urea |
| Summenformel | C2H6N2O |
Vinylencarbonat, 98 %, Thermo Scientific Chemicals
CAS: 872-36-6 Summenformel: C3H2O3 Molekulargewicht (g/mol): 86.05 MDL-Nummer: MFCD00005380 InChI-Schlüssel: VAYTZRYEBVHVLE-UHFFFAOYSA-N Synonym: vinylene carbonate,vinyl carbonate,carbonic acid, cyclic vinylene ester,wln: t5ovoj,vinylenecarbonate,vinyleny carbonate,carbonic acid vinylene,1,3-dioxo-2-one,vinylene carbonate vc,acmc-209qj3 PubChem CID: 13385 SMILES: O=C1OC=CO1
| InChI-Schlüssel | VAYTZRYEBVHVLE-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 13385 |
| CAS | 872-36-6 |
| MDL-Nummer | MFCD00005380 |
| Molekulargewicht (g/mol) | 86.05 |
| SMILES | O=C1OC=CO1 |
| Synonym | vinylene carbonate,vinyl carbonate,carbonic acid, cyclic vinylene ester,wln: t5ovoj,vinylenecarbonate,vinyleny carbonate,carbonic acid vinylene,1,3-dioxo-2-one,vinylene carbonate vc,acmc-209qj3 |
| Summenformel | C3H2O3 |