Benzoide
Gefilterte Suchergebnisse
Benzylalkohol, 99 %, rein, Thermo Scientific Chemicals
CAS: 100-51-6 Summenformel: C7H8O Molekulargewicht (g/mol): 108.14 MDL-Nummer: MFCD00004599,MFCD03792087 InChI-Schlüssel: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC-Name: Phenylmethanol SMILES: OCC1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | WVDDGKGOMKODPV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Phenylmethanol |
| PubChem CID | 244 |
| CAS | 100-51-6 |
| ChEBI | CHEBI:17987 |
| MDL-Nummer | MFCD00004599,MFCD03792087 |
| Molekulargewicht (g/mol) | 108.14 |
| SMILES | OCC1=CC=CC=C1 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| Summenformel | C7H8O |
Benzoesäure, 99,6 %, ACS-Reagenz
CAS: 65-85-0 Summenformel: C7H6O2 Molekulargewicht (g/mol): 122.12 InChI-Schlüssel: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC-Name: Benzoesäure SMILES: C1=CC=C(C=C1)C(=O)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Benzoesäure |
| PubChem CID | 243 |
| CAS | 65-85-0 |
| ChEBI | CHEBI:30746 |
| Molekulargewicht (g/mol) | 122.12 |
| SMILES | C1=CC=C(C=C1)C(=O)O |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| Summenformel | C7H6O2 |
Guaiacol, 99+%, Thermo Scientific Chemicals
CAS: 90-05-1 Summenformel: C7H8O2 Molekulargewicht (g/mol): 124.14 InChI-Schlüssel: LHGVFZTZFXWLCP-UHFFFAOYSA-N Synonym: guaiacol,o-methoxyphenol,2-hydroxyanisole,phenol, 2-methoxy,pyrocatechol monomethyl ether,methylcatechol,guaiastil,guaicol,1-hydroxy-2-methoxybenzene,pyroguaiac acid PubChem CID: 460 ChEBI: CHEBI:28591 IUPAC-Name: 2-Methoxyphenol SMILES: COC1=CC=CC=C1O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | LHGVFZTZFXWLCP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Methoxyphenol |
| PubChem CID | 460 |
| CAS | 90-05-1 |
| ChEBI | CHEBI:28591 |
| Molekulargewicht (g/mol) | 124.14 |
| SMILES | COC1=CC=CC=C1O |
| Synonym | guaiacol,o-methoxyphenol,2-hydroxyanisole,phenol, 2-methoxy,pyrocatechol monomethyl ether,methylcatechol,guaiastil,guaicol,1-hydroxy-2-methoxybenzene,pyroguaiac acid |
| Summenformel | C7H8O2 |
Benzophenon, 99 %, Thermo Scientific Chemicals
CAS: 119-61-9 Summenformel: C13H10O Molekulargewicht (g/mol): 182.222 MDL-Nummer: MFCD00003076 InChI-Schlüssel: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC-Name: Diphenylmethanon SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| InChI-Schlüssel | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diphenylmethanon |
| PubChem CID | 3102 |
| CAS | 119-61-9 |
| ChEBI | CHEBI:41308 |
| MDL-Nummer | MFCD00003076 |
| Molekulargewicht (g/mol) | 182.222 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| Summenformel | C13H10O |
4-Dimethylaminobenzaldehyd, 99+ %, Thermo Scientific Chemicals
CAS: 100-10-7 Summenformel: C9H11NO Molekulargewicht (g/mol): 149.19 MDL-Nummer: MFCD00003381 InChI-Schlüssel: BGNGWHSBYQYVRX-UHFFFAOYSA-N Synonym: 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal PubChem CID: 7479 IUPAC-Name: 4-(dimethylamino)benzaldehyde SMILES: CN(C)C1=CC=C(C=O)C=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | BGNGWHSBYQYVRX-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-(dimethylamino)benzaldehyde |
| PubChem CID | 7479 |
| CAS | 100-10-7 |
| MDL-Nummer | MFCD00003381 |
| Molekulargewicht (g/mol) | 149.19 |
| SMILES | CN(C)C1=CC=C(C=O)C=C1 |
| Synonym | 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal |
| Summenformel | C9H11NO |
4-Aminobenzoesäure, 99 %, Thermo Scientific Chemicals
CAS: 150-13-0 Summenformel: C7H7NO2 Molekulargewicht (g/mol): 137.14 MDL-Nummer: MFCD00007894 InChI-Schlüssel: ALYNCZNDIQEVRV-UHFFFAOYSA-N Synonym: p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino PubChem CID: 978 ChEBI: CHEBI:30753 IUPAC-Name: 4-Aminobenzoesäure SMILES: NC1=CC=C(C=C1)C(O)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ALYNCZNDIQEVRV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-Aminobenzoesäure |
| PubChem CID | 978 |
| CAS | 150-13-0 |
| ChEBI | CHEBI:30753 |
| MDL-Nummer | MFCD00007894 |
| Molekulargewicht (g/mol) | 137.14 |
| SMILES | NC1=CC=C(C=C1)C(O)=O |
| Synonym | p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino |
| Summenformel | C7H7NO2 |
1,3,5-Trimethoxybenzol, 99 %, Thermo Scientific Chemicals
CAS: 621-23-8 Summenformel: C9H12O3 Molekulargewicht (g/mol): 168.19 MDL-Nummer: MFCD00008385 InChI-Schlüssel: LKUDPHPHKOZXCD-UHFFFAOYSA-N Synonym: phloroglucinol trimethyl ether,sym-trimethoxybenzene,benzene, 1,3,5-trimethoxy,1,3,5-trimethyoxybenzene,unii-00vji3vg3d,1,3,5-trimethoxy benzene,o,o,o-1,3,5-trimethylresorcinol,00vji3vg3d,dsstox_cid_25963,dsstox_rid_81259 PubChem CID: 69301 ChEBI: CHEBI:31038 IUPAC-Name: 1,3,5-Trimethoxybenzol SMILES: COC1=CC(OC)=CC(OC)=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | LKUDPHPHKOZXCD-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1,3,5-Trimethoxybenzol |
| PubChem CID | 69301 |
| CAS | 621-23-8 |
| ChEBI | CHEBI:31038 |
| MDL-Nummer | MFCD00008385 |
| Molekulargewicht (g/mol) | 168.19 |
| SMILES | COC1=CC(OC)=CC(OC)=C1 |
| Synonym | phloroglucinol trimethyl ether,sym-trimethoxybenzene,benzene, 1,3,5-trimethoxy,1,3,5-trimethyoxybenzene,unii-00vji3vg3d,1,3,5-trimethoxy benzene,o,o,o-1,3,5-trimethylresorcinol,00vji3vg3d,dsstox_cid_25963,dsstox_rid_81259 |
| Summenformel | C9H12O3 |
Benzylalkohol, Thermo Scientific Chemicals
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
Triphenylphosphin, 99 %, Thermo Scientific Chemicals
CAS: 603-35-0 Summenformel: C18H15P Molekulargewicht (g/mol): 262.29 MDL-Nummer: MFCD00003043 MFCD20489348 InChI-Schlüssel: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC-Name: Triphenylphosphan SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Triphenylphosphan |
| PubChem CID | 11776 |
| CAS | 603-35-0 |
| MDL-Nummer | MFCD00003043 MFCD20489348 |
| Molekulargewicht (g/mol) | 262.29 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| Summenformel | C18H15P |
2-Phenoxyethanol, 94 %, Thermo Scientific Chemicals
CAS: 122-99-6 Summenformel: C8H10O2 Molekulargewicht (g/mol): 138.166 MDL-Nummer: MFCD00002857 InChI-Schlüssel: QCDWFXQBSFUVSP-UHFFFAOYSA-N Synonym: phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane PubChem CID: 31236 ChEBI: CHEBI:64275 IUPAC-Name: 2-Phenoxyethanol SMILES: C1=CC=C(C=C1)OCCO
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | QCDWFXQBSFUVSP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Phenoxyethanol |
| PubChem CID | 31236 |
| CAS | 122-99-6 |
| ChEBI | CHEBI:64275 |
| MDL-Nummer | MFCD00002857 |
| Molekulargewicht (g/mol) | 138.166 |
| SMILES | C1=CC=C(C=C1)OCCO |
| Synonym | phenoxyethanol,ethylene glycol monophenyl ether,phenyl cellosolve,ethanol, 2-phenoxy,phenoxytol,phenoxethol,phenoxetol,ethylene glycol phenyl ether,phenoxyethyl alcohol,1-hydroxy-2-phenoxyethane |
| Summenformel | C8H10O2 |
3-Phenylphenol 90 %, Thermo Scientific Chemicals
CAS: 580-51-8 Summenformel: C12H10O Molekulargewicht (g/mol): 170.21 MDL-Nummer: MFCD00002294 InChI-Schlüssel: UBXYXCRCOKCZIT-UHFFFAOYSA-N Synonym: 3-hydroxybiphenyl,1,1'-biphenyl-3-ol,biphenyl-3-ol,m-phenylphenol,m-hydroxydiphenyl,3-biphenylol,m-hydroxybiphenyl,3-hydroxydiphenyl,3-phenyl phenol,unii-zu11x47h4o PubChem CID: 11381 ChEBI: CHEBI:34338 IUPAC-Name: 3-Phenylphenol SMILES: OC1=CC=CC(=C1)C1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | UBXYXCRCOKCZIT-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Phenylphenol |
| PubChem CID | 11381 |
| CAS | 580-51-8 |
| ChEBI | CHEBI:34338 |
| MDL-Nummer | MFCD00002294 |
| Molekulargewicht (g/mol) | 170.21 |
| SMILES | OC1=CC=CC(=C1)C1=CC=CC=C1 |
| Synonym | 3-hydroxybiphenyl,1,1'-biphenyl-3-ol,biphenyl-3-ol,m-phenylphenol,m-hydroxydiphenyl,3-biphenylol,m-hydroxybiphenyl,3-hydroxydiphenyl,3-phenyl phenol,unii-zu11x47h4o |
| Summenformel | C12H10O |
Thermo Scientific Chemicals Basisches Fuchsin
CAS: 632-99-5 Summenformel: C20H20ClN3 Molekulargewicht (g/mol): 337.85 MDL-Nummer: MFCD00012569 InChI-Schlüssel: AXDJCCTWPBKUKL-UHFFFAOYSA-N Synonym: basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic PubChem CID: 12447 IUPAC-Name: hydrogen 4-[(4-aminophenyl)(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline chloride SMILES: [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | AXDJCCTWPBKUKL-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | hydrogen 4-[(4-aminophenyl)(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline chloride |
| PubChem CID | 12447 |
| CAS | 632-99-5 |
| MDL-Nummer | MFCD00012569 |
| Molekulargewicht (g/mol) | 337.85 |
| SMILES | [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1 |
| Synonym | basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic |
| Summenformel | C20H20ClN3 |
Salicylsäure, Natriumsalz, 99+%, Thermo Scientific Chemicals
CAS: 54-21-7 Summenformel: C7H5NaO3 Molekulargewicht (g/mol): 160.104 MDL-Nummer: MFCD00002440 InChI-Schlüssel: ABBQHOQBGMUPJH-UHFFFAOYSA-M Synonym: sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl PubChem CID: 16760658 ChEBI: CHEBI:9180 IUPAC-Name: Natrium;2-Hydroxybenzoat SMILES: C1=CC=C(C(=C1)C(=O)[O-])O.[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium;2-Hydroxybenzoat |
| PubChem CID | 16760658 |
| CAS | 54-21-7 |
| ChEBI | CHEBI:9180 |
| MDL-Nummer | MFCD00002440 |
| Molekulargewicht (g/mol) | 160.104 |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] |
| Synonym | sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl |
| Summenformel | C7H5NaO3 |
4-Hydroxy-3-Methoxybenzylalkohol, 99 %, Thermo Scientific Chemicals
CAS: 498-00-0 Summenformel: C8H10O3 Molekulargewicht (g/mol): 154.17 MDL-Nummer: MFCD00004659 InChI-Schlüssel: ZENOXNGFMSCLLL-UHFFFAOYSA-N Synonym: vanillyl alcohol,4-hydroxy-3-methoxybenzyl alcohol,4-hydroxymethyl-2-methoxyphenol,vanillin alcohol,vanillic alcohol,4-hydroxy-3-methoxybenzenemethanol,benzenemethanol, 4-hydroxy-3-methoxy,vanillol,4-hydroxy-3-methoxybenzylalcohol,4-hydroxy-3-methoxyphenylmethanol PubChem CID: 62348 ChEBI: CHEBI:18353 IUPAC-Name: 4-(Hydroxymethyl)-2-Methoxyphenol SMILES: COC1=CC(CO)=CC=C1O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ZENOXNGFMSCLLL-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-(Hydroxymethyl)-2-Methoxyphenol |
| PubChem CID | 62348 |
| CAS | 498-00-0 |
| ChEBI | CHEBI:18353 |
| MDL-Nummer | MFCD00004659 |
| Molekulargewicht (g/mol) | 154.17 |
| SMILES | COC1=CC(CO)=CC=C1O |
| Synonym | vanillyl alcohol,4-hydroxy-3-methoxybenzyl alcohol,4-hydroxymethyl-2-methoxyphenol,vanillin alcohol,vanillic alcohol,4-hydroxy-3-methoxybenzenemethanol,benzenemethanol, 4-hydroxy-3-methoxy,vanillol,4-hydroxy-3-methoxybenzylalcohol,4-hydroxy-3-methoxyphenylmethanol |
| Summenformel | C8H10O3 |
Methylsalicylat, 98 %, Thermo Scientific Chemicals
CAS: 119-36-8 Summenformel: C8H8O3 Molekulargewicht (g/mol): 152.149 MDL-Nummer: MFCD00002214 InChI-Schlüssel: OSWPMRLSEDHDFF-UHFFFAOYSA-N Synonym: methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester PubChem CID: 4133 ChEBI: CHEBI:31832 IUPAC-Name: Methyl 2-Hydroxybenzoat SMILES: COC(=O)C1=CC=CC=C1O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | OSWPMRLSEDHDFF-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Methyl 2-Hydroxybenzoat |
| PubChem CID | 4133 |
| CAS | 119-36-8 |
| ChEBI | CHEBI:31832 |
| MDL-Nummer | MFCD00002214 |
| Molekulargewicht (g/mol) | 152.149 |
| SMILES | COC(=O)C1=CC=CC=C1O |
| Synonym | methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester |
| Summenformel | C8H8O3 |