Benzoide
Gefilterte Suchergebnisse
Benzylalkohol, 99 %, rein, Thermo Scientific Chemicals
CAS: 100-51-6 Summenformel: C7H8O Molekulargewicht (g/mol): 108.14 MDL-Nummer: MFCD00004599,MFCD03792087 InChI-Schlüssel: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC-Name: Phenylmethanol SMILES: OCC1=CC=CC=C1
| InChI-Schlüssel | WVDDGKGOMKODPV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Phenylmethanol |
| PubChem CID | 244 |
| CAS | 100-51-6 |
| ChEBI | CHEBI:17987 |
| MDL-Nummer | MFCD00004599,MFCD03792087 |
| Molekulargewicht (g/mol) | 108.14 |
| SMILES | OCC1=CC=CC=C1 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| Summenformel | C7H8O |
Styrol, 99 %, reinst, stabilisiert, Thermo Scientific Chemicals
CAS: 100-42-5 Summenformel: C8H8 Molekulargewicht (g/mol): 104.15 MDL-Nummer: MFCD00008612,MFCD00084450 InChI-Schlüssel: PPBRXRYQALVLMV-UHFFFAOYSA-N Synonym: Ethenylbenzol,Phenylethylen,Vinylbenzol,Benzol, Ethenyl,Cinnamol,Phenylethen,Phenethylen,Styrolen,phenethylene,styrolene PubChem CID: 7501 ChEBI: CHEBI:27452 IUPAC-Name: Styrol SMILES: C=CC1=CC=CC=C1
| InChI-Schlüssel | PPBRXRYQALVLMV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Styrol |
| PubChem CID | 7501 |
| CAS | 100-42-5 |
| ChEBI | CHEBI:27452 |
| MDL-Nummer | MFCD00008612,MFCD00084450 |
| Molekulargewicht (g/mol) | 104.15 |
| SMILES | C=CC1=CC=CC=C1 |
| Synonym | Ethenylbenzol,Phenylethylen,Vinylbenzol,Benzol, Ethenyl,Cinnamol,Phenylethen,Phenethylen,Styrolen,phenethylene,styrolene |
| Summenformel | C8H8 |
Benzophenon, 99 %, Thermo Scientific Chemicals
CAS: 119-61-9 Summenformel: C13H10O Molekulargewicht (g/mol): 182.222 MDL-Nummer: MFCD00003076 InChI-Schlüssel: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC-Name: Diphenylmethanon SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| InChI-Schlüssel | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diphenylmethanon |
| PubChem CID | 3102 |
| CAS | 119-61-9 |
| ChEBI | CHEBI:41308 |
| MDL-Nummer | MFCD00003076 |
| Molekulargewicht (g/mol) | 182.222 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| Summenformel | C13H10O |
Anisol, 99 %, rein, Thermo Scientific Chemicals
CAS: 100-66-3 Summenformel: C7H8O Molekulargewicht (g/mol): 108.14 InChI-Schlüssel: RDOXTESZEPMUJZ-UHFFFAOYSA-N Synonym: Methoxybenzol,Methylphenylether,Benzol, Methoxy,Phenylmethylether,Phenoxymethan,Phenolmethylether,Methoxy-Benzol,phenol methyl ether,methoxy-benzene PubChem CID: 7519 ChEBI: CHEBI:16579 IUPAC-Name: Anisol SMILES: COC1=CC=CC=C1
| InChI-Schlüssel | RDOXTESZEPMUJZ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Anisol |
| PubChem CID | 7519 |
| CAS | 100-66-3 |
| ChEBI | CHEBI:16579 |
| Molekulargewicht (g/mol) | 108.14 |
| SMILES | COC1=CC=CC=C1 |
| Synonym | Methoxybenzol,Methylphenylether,Benzol, Methoxy,Phenylmethylether,Phenoxymethan,Phenolmethylether,Methoxy-Benzol,phenol methyl ether,methoxy-benzene |
| Summenformel | C7H8O |
Eugenol 99 %, Thermo Scientific Chemicals
CAS: 97-53-0 Summenformel: C10H12O2 Molekulargewicht (g/mol): 164.20 MDL-Nummer: MFCD00008654 InChI-Schlüssel: RRAFCDWBNXTKKO-UHFFFAOYSA-N Synonym: eugenol,4-allylguaiacol,4-allyl-2-methoxyphenol,eugenic acid,allylguaiacol,caryophyllic acid,p-allylguaiacol,p-eugenol,2-methoxy-4-allylphenol,engenol PubChem CID: 3314 ChEBI: CHEBI:4917 SMILES: COC1=CC(CC=C)=CC=C1O
| InChI-Schlüssel | RRAFCDWBNXTKKO-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 3314 |
| CAS | 97-53-0 |
| ChEBI | CHEBI:4917 |
| MDL-Nummer | MFCD00008654 |
| Molekulargewicht (g/mol) | 164.20 |
| SMILES | COC1=CC(CC=C)=CC=C1O |
| Synonym | eugenol,4-allylguaiacol,4-allyl-2-methoxyphenol,eugenic acid,allylguaiacol,caryophyllic acid,p-allylguaiacol,p-eugenol,2-methoxy-4-allylphenol,engenol |
| Summenformel | C10H12O2 |
Guaiacol, 99+%, Thermo Scientific Chemicals
CAS: 90-05-1 Summenformel: C7H8O2 Molekulargewicht (g/mol): 124.14 InChI-Schlüssel: LHGVFZTZFXWLCP-UHFFFAOYSA-N Synonym: guaiacol,o-methoxyphenol,2-hydroxyanisole,phenol, 2-methoxy,pyrocatechol monomethyl ether,methylcatechol,guaiastil,guaicol,1-hydroxy-2-methoxybenzene,pyroguaiac acid PubChem CID: 460 ChEBI: CHEBI:28591 IUPAC-Name: 2-Methoxyphenol SMILES: COC1=CC=CC=C1O
| InChI-Schlüssel | LHGVFZTZFXWLCP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Methoxyphenol |
| PubChem CID | 460 |
| CAS | 90-05-1 |
| ChEBI | CHEBI:28591 |
| Molekulargewicht (g/mol) | 124.14 |
| SMILES | COC1=CC=CC=C1O |
| Synonym | guaiacol,o-methoxyphenol,2-hydroxyanisole,phenol, 2-methoxy,pyrocatechol monomethyl ether,methylcatechol,guaiastil,guaicol,1-hydroxy-2-methoxybenzene,pyroguaiac acid |
| Summenformel | C7H8O2 |
Benzophenon, 99 %, rein, Thermo Scientific Chemicals
CAS: 119-61-9 Summenformel: C13H10O Molekulargewicht (g/mol): 182.22 InChI-Schlüssel: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC-Name: Diphenylmethanon SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diphenylmethanon |
| PubChem CID | 3102 |
| CAS | 119-61-9 |
| ChEBI | CHEBI:41308 |
| Molekulargewicht (g/mol) | 182.22 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| Summenformel | C13H10O |
4-Dimethylaminobenzaldehyd, 99+ %, Thermo Scientific Chemicals
CAS: 100-10-7 Summenformel: C9H11NO Molekulargewicht (g/mol): 149.19 MDL-Nummer: MFCD00003381 InChI-Schlüssel: BGNGWHSBYQYVRX-UHFFFAOYSA-N Synonym: 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal PubChem CID: 7479 IUPAC-Name: 4-(dimethylamino)benzaldehyde SMILES: CN(C)C1=CC=C(C=O)C=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | BGNGWHSBYQYVRX-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-(dimethylamino)benzaldehyde |
| PubChem CID | 7479 |
| CAS | 100-10-7 |
| MDL-Nummer | MFCD00003381 |
| Molekulargewicht (g/mol) | 149.19 |
| SMILES | CN(C)C1=CC=C(C=O)C=C1 |
| Synonym | 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal |
| Summenformel | C9H11NO |
4-Aminobenzoesäure, 99 %, Thermo Scientific Chemicals
CAS: 150-13-0 Summenformel: C7H7NO2 Molekulargewicht (g/mol): 137.14 MDL-Nummer: MFCD00007894 InChI-Schlüssel: ALYNCZNDIQEVRV-UHFFFAOYSA-N Synonym: p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino PubChem CID: 978 ChEBI: CHEBI:30753 IUPAC-Name: 4-Aminobenzoesäure SMILES: NC1=CC=C(C=C1)C(O)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ALYNCZNDIQEVRV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-Aminobenzoesäure |
| PubChem CID | 978 |
| CAS | 150-13-0 |
| ChEBI | CHEBI:30753 |
| MDL-Nummer | MFCD00007894 |
| Molekulargewicht (g/mol) | 137.14 |
| SMILES | NC1=CC=C(C=C1)C(O)=O |
| Synonym | p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino |
| Summenformel | C7H7NO2 |
Benzoesäure, 99.6 %, zur Analyse ACS, Thermo Scientific Chemicals
CAS: 65-85-0 Summenformel: C7H6O2 Molekulargewicht (g/mol): 122.12 InChI-Schlüssel: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC-Name: Benzoesäure SMILES: C1=CC=C(C=C1)C(=O)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Benzoesäure |
| PubChem CID | 243 |
| CAS | 65-85-0 |
| ChEBI | CHEBI:30746 |
| Molekulargewicht (g/mol) | 122.12 |
| SMILES | C1=CC=C(C=C1)C(=O)O |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| Summenformel | C7H6O2 |
3,5-Dinitrosalicysäure, 98 %, Thermo Scientific Chemicals
CAS: 609-99-4 Summenformel: C7H4N2O7 Molekulargewicht (g/mol): 228.12 MDL-Nummer: MFCD00007104 InChI-Schlüssel: LWFUFLREGJMOIZ-UHFFFAOYSA-N Synonym: 3,5-dinitrosalicylic acid,2-hydroxy-3,5-dinitrobenzoic acid,3,5-dinitro-2-hydroxybenzoic acid,3,5-dinitrosalicylate,benzoic acid, 2-hydroxy-3,5-dinitro,salicylic acid, 3,5-dinitro,dnsa,o-dncp,o-dinitrocarboxylphenol,3,5-dinitro-2-salicylic acid PubChem CID: 11873 ChEBI: CHEBI:53648 SMILES: C1=C(C=C(C(=C1[N+](=O)[O-])O)C(=O)O)[N+](=O)[O-]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | LWFUFLREGJMOIZ-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 11873 |
| CAS | 609-99-4 |
| ChEBI | CHEBI:53648 |
| MDL-Nummer | MFCD00007104 |
| Molekulargewicht (g/mol) | 228.12 |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)C(=O)O)[N+](=O)[O-] |
| Synonym | 3,5-dinitrosalicylic acid,2-hydroxy-3,5-dinitrobenzoic acid,3,5-dinitro-2-hydroxybenzoic acid,3,5-dinitrosalicylate,benzoic acid, 2-hydroxy-3,5-dinitro,salicylic acid, 3,5-dinitro,dnsa,o-dncp,o-dinitrocarboxylphenol,3,5-dinitro-2-salicylic acid |
| Summenformel | C7H4N2O7 |
1,3,5-Trimethoxybenzol, 99 %, Thermo Scientific Chemicals
CAS: 621-23-8 Summenformel: C9H12O3 Molekulargewicht (g/mol): 168.19 MDL-Nummer: MFCD00008385 InChI-Schlüssel: LKUDPHPHKOZXCD-UHFFFAOYSA-N Synonym: phloroglucinol trimethyl ether,sym-trimethoxybenzene,benzene, 1,3,5-trimethoxy,1,3,5-trimethyoxybenzene,unii-00vji3vg3d,1,3,5-trimethoxy benzene,o,o,o-1,3,5-trimethylresorcinol,00vji3vg3d,dsstox_cid_25963,dsstox_rid_81259 PubChem CID: 69301 ChEBI: CHEBI:31038 IUPAC-Name: 1,3,5-Trimethoxybenzol SMILES: COC1=CC(OC)=CC(OC)=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | LKUDPHPHKOZXCD-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1,3,5-Trimethoxybenzol |
| PubChem CID | 69301 |
| CAS | 621-23-8 |
| ChEBI | CHEBI:31038 |
| MDL-Nummer | MFCD00008385 |
| Molekulargewicht (g/mol) | 168.19 |
| SMILES | COC1=CC(OC)=CC(OC)=C1 |
| Synonym | phloroglucinol trimethyl ether,sym-trimethoxybenzene,benzene, 1,3,5-trimethoxy,1,3,5-trimethyoxybenzene,unii-00vji3vg3d,1,3,5-trimethoxy benzene,o,o,o-1,3,5-trimethylresorcinol,00vji3vg3d,dsstox_cid_25963,dsstox_rid_81259 |
| Summenformel | C9H12O3 |
DL-α-Methoxyphenylessigsäure, 99 %, Thermo Scientific Chemicals
CAS: 7021-09-2 Summenformel: C9H10O3 Molekulargewicht (g/mol): 166.18 InChI-Schlüssel: DIWVBIXQCNRCFE-UHFFFAOYNA-N Synonym: methoxyphenylacetic acid,methoxy phenyl acetic acid,dl-alpha-methoxyphenylacetic acid,acetic acid, methoxyphenyl,alpha-methoxyphenylacetic acid,o-methyl-dl-mandelic acid,benzeneacetic acid, .alpha.-methoxy,2-methoxy-2-phenyl-acetic acid,methyloxy phenyl acetic acid,.alpha.-methoxyphenylacetic acid PubChem CID: 107202 IUPAC-Name: 2-Methoxy-2-Phenylessigsäure SMILES: COC(C1=CC=CC=C1)C(=O)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | DIWVBIXQCNRCFE-UHFFFAOYNA-N |
|---|---|
| IUPAC-Name | 2-Methoxy-2-Phenylessigsäure |
| PubChem CID | 107202 |
| CAS | 7021-09-2 |
| Molekulargewicht (g/mol) | 166.18 |
| SMILES | COC(C1=CC=CC=C1)C(=O)O |
| Synonym | methoxyphenylacetic acid,methoxy phenyl acetic acid,dl-alpha-methoxyphenylacetic acid,acetic acid, methoxyphenyl,alpha-methoxyphenylacetic acid,o-methyl-dl-mandelic acid,benzeneacetic acid, .alpha.-methoxy,2-methoxy-2-phenyl-acetic acid,methyloxy phenyl acetic acid,.alpha.-methoxyphenylacetic acid |
| Summenformel | C9H10O3 |
Terephthalsäure, 98+ %, Thermo Scientific Chemicals
CAS: 100-21-0 Summenformel: C8H6O4 Molekulargewicht (g/mol): 166.132 MDL-Nummer: MFCD00002558 InChI-Schlüssel: KKEYFWRCBNTPAC-UHFFFAOYSA-N Synonym: p-phthalic acid,1,4-benzenedicarboxylic acid,benzene-1,4-dicarboxylic acid,p-dicarboxybenzene,p-benzenedicarboxylic acid,p-carboxybenzoic acid,acide terephtalique,para-phthalic acid,tephthol,1,4-dicarboxybenzene PubChem CID: 7489 ChEBI: CHEBI:15702 IUPAC-Name: Terephthalsäure SMILES: C1=CC(=CC=C1C(=O)O)C(=O)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | KKEYFWRCBNTPAC-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Terephthalsäure |
| PubChem CID | 7489 |
| CAS | 100-21-0 |
| ChEBI | CHEBI:15702 |
| MDL-Nummer | MFCD00002558 |
| Molekulargewicht (g/mol) | 166.132 |
| SMILES | C1=CC(=CC=C1C(=O)O)C(=O)O |
| Synonym | p-phthalic acid,1,4-benzenedicarboxylic acid,benzene-1,4-dicarboxylic acid,p-dicarboxybenzene,p-benzenedicarboxylic acid,p-carboxybenzoic acid,acide terephtalique,para-phthalic acid,tephthol,1,4-dicarboxybenzene |
| Summenformel | C8H6O4 |
Lanolin Thermo Scientific Chemicals
CAS: 8006-54-0 MDL-Nummer: MFCD00081740 Synonym: dmt-2'o-tbdms-rc ac phosphoramidite,dmt-2'o-tbdms-rc ac phosphoramidite, configured for abi,dmt-2'o-tbdms-rc ac phosphoramidite, configured for mermade,ac-c-ce phosphoramidite,dmt-2'o-tbdms-rc ac amidite,dmt-2'o-tbdms-rc ac pharmadite r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for ??kta r and oligopilot r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for perkinelmer, configured for polygen,dmt-2'o-tbdms-rc ac phosphoramidite, configured for polygen, configured for perkinelmer
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| CAS | 8006-54-0 |
|---|---|
| MDL-Nummer | MFCD00081740 |
| Synonym | dmt-2'o-tbdms-rc ac phosphoramidite,dmt-2'o-tbdms-rc ac phosphoramidite, configured for abi,dmt-2'o-tbdms-rc ac phosphoramidite, configured for mermade,ac-c-ce phosphoramidite,dmt-2'o-tbdms-rc ac amidite,dmt-2'o-tbdms-rc ac pharmadite r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for ??kta r and oligopilot r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for perkinelmer, configured for polygen,dmt-2'o-tbdms-rc ac phosphoramidite, configured for polygen, configured for perkinelmer |