Metallorganische Verbindungen
Gefilterte Suchergebnisse
| Chemischer Name oder Material | Lithium bis(trimethylsilyl)amide |
|---|---|
| InChI-Schlüssel | YNESATAKKCNGOF-UHFFFAOYSA-N |
| IUPAC-Name | Lithium; Bis(trimethylsilyl)azanid |
| Siedepunkt | 65.0°C |
| Dichte | 0.9000g/mL |
| EINECS-Nummer | 223-725-6 |
| Relative Dichte | 0.9 |
| Molekulargewicht (g/mol) | 167.33 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Formelmasse | 167.33 |
| Gesundheitsgefahr 2 | GHS-H-Hinweis Flüssigkeit und Dampf leicht entzündbar. Verursacht schwere Verätzungen der Haut und schwere Augenschäden. Kann die Atemwege reizen. Verdacht auf krebserregende Wirkung. Kann explosionsfähige Peroxide bilden. Reagiert heftig mit Wasser.<br/ |
| Gesundheitsgefahr 3 | GHS-P-Hinweis Von Hitze/Funken/offenen Flammen/heißen Oberflächen fernhalten. - Rauchen verboten. BEI BERÜHRUNG DER HAUT (oder des Haars): Alle kontaminierten Kleidungsstücke sofort ausziehen. Haut mit Wasser abwaschen [oder duschen]. Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| PubChem CID | 2733832 |
| Löslichkeitsinformationen | Solubility in water: reacts. |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| CAS | 109-99-9 |
| Strukturformel | ((CH3)3Si)2NLi |
| Flammpunkt | −21°C |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| Summenformel | C6H18LiNSi2 |
3-(Trimethoxysilyl)propylmethacrylat, 98 %, Thermo Scientific Chemicals
CAS: 2530-85-0 Summenformel: C10H20O5Si Molekulargewicht (g/mol): 248.35 MDL-Nummer: MFCD00008593 InChI-Schlüssel: XDLMVUHYZWKMMD-UHFFFAOYSA-N Synonym: 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester PubChem CID: 17318 IUPAC-Name: 3-Trimethoxysilylpropyl-2-methylprop-2-enoat SMILES: CC(=C)C(=O)OCCC[Si](OC)(OC)OC
| InChI-Schlüssel | XDLMVUHYZWKMMD-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Trimethoxysilylpropyl-2-methylprop-2-enoat |
| PubChem CID | 17318 |
| CAS | 2530-85-0 |
| MDL-Nummer | MFCD00008593 |
| Molekulargewicht (g/mol) | 248.35 |
| SMILES | CC(=C)C(=O)OCCC[Si](OC)(OC)OC |
| Synonym | 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester |
| Summenformel | C10H20O5Si |
Diisobutylaluminiumhydrid, 1M Lösung in Cyclohexan, AcroSeal™, Thermo Scientific Chemicals
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Chemischer Name oder Material | Diisobutylaluminium hydride |
|---|---|
| Dichte | 0.7010g/mL |
| EINECS-Nummer | 214-729-9 |
| Relative Dichte | 0.701 |
| Molekulargewicht (g/mol) | 142.22 |
| Merck Index | 15, 3212 |
| Namenshinweis | 1M Solution in Hexane |
| Formelmasse | 142.22 |
| Gesundheitsgefahr 2 | GHS H Statement May be fatal if swallowed and enters airways. Toxic to aquatic life with long lasting effects. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. May cause damage to organs through p |
| Gesundheitsgefahr 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective g |
| Löslichkeitsinformationen | Solubility in water: reacts |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Physikalische Form | Lösung |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 110-54-3 |
| MDL-Nummer | MFCD00008928 |
| Strukturformel | [(CH3)2CHCH2]2AlH |
| Flammpunkt | −23°C |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Summenformel | C8H19Al |
| Schmelzpunkt | -70.0°C |
Diisobutylaluminiumhydrid, Lösung mit 20 Gew.-% in Toluol, 1.2 M, AcroSeal™, Thermo Scientific Chemicals
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Chemischer Name oder Material | Diisobutylaluminium hydride |
|---|---|
| Siedepunkt | 110.0°C |
| Dichte | 0.8480g/mL |
| EINECS-Nummer | 214-729-9 |
| Relative Dichte | 0.848 |
| Molekulargewicht (g/mol) | 142.22 |
| Merck Index | 15, 3212 |
| Formelmasse | 142.22 |
| Gesundheitsgefahr 2 | GHS-H-Hinweis Verursacht schwere Verätzungen der Haut und schwere Augenschäden. Kann beim Verschlucken und Eindringen in die Atemwege tödlich sein. Kann die Organe bei längerer oder wiederholter Exposition schädigen. Kann vermutlich das Kind im Mutterleib schädigen. Kann Schläfrigkeit und Benommenheit verursachen |
| Gesundheitsgefahr 3 | GHS-P-Hinweis BEI VERSCHLUCKEN: Mund spülen. KEIN Erbrechen herbeiführen. Augenschutz/Gesichtsschutz tragen. BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang vorsichtig mit Wasser ausspülen. Eventuell vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter ausspülen. |
| Löslichkeitsinformationen | Solubility in water: reacts violently. Other solubilities: miscible with saturated aliphatic and aromatic,hydrocarbons |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Physikalische Form | Lösung |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 108-88-3 |
| MDL-Nummer | MFCD00008928 |
| Strukturformel | [(CH3)2CHCH2]2AIH |
| Flammpunkt | 4°C |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Summenformel | C8H19Al |
3-Aminopropyltriethoxysilan, 99 %, Thermo Scientific Chemicals
CAS: 919-30-2 Summenformel: C9H23NO3Si Molekulargewicht (g/mol): 221.37 MDL-Nummer: MFCD00008207,MFCD01324904 InChI-Schlüssel: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC-Name: 3-Triethoxysilylpropan-1-amin SMILES: CCO[Si](CCCN)(OCC)OCC
| InChI-Schlüssel | WYTZZXDRDKSJID-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Triethoxysilylpropan-1-amin |
| PubChem CID | 13521 |
| CAS | 919-30-2 |
| MDL-Nummer | MFCD00008207,MFCD01324904 |
| Molekulargewicht (g/mol) | 221.37 |
| SMILES | CCO[Si](CCCN)(OCC)OCC |
| Synonym | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
| Summenformel | C9H23NO3Si |
N,O-Bis-(Trimethylsilyl)-Trifluoracetamid, mit 1 % Trimethylsilylchlorid, Thermo Scientific Chemicals
CAS: 25561-30-2 Summenformel: C8H18F3NOSi2 Molekulargewicht (g/mol): 257.4 MDL-Nummer: MFCD00008269 InChI-Schlüssel: XCOBLONWWXQEBS-GHXNOFRVSA-N Synonym: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate PubChem CID: 9601896 IUPAC-Name: Trimethylsilyl-(1Z)-2,2,2-trifluor-N-trimethylsilylethanimidat SMILES: C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C
| InChI-Schlüssel | XCOBLONWWXQEBS-GHXNOFRVSA-N |
|---|---|
| IUPAC-Name | Trimethylsilyl-(1Z)-2,2,2-trifluor-N-trimethylsilylethanimidat |
| PubChem CID | 9601896 |
| CAS | 25561-30-2 |
| MDL-Nummer | MFCD00008269 |
| Molekulargewicht (g/mol) | 257.4 |
| SMILES | C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| Synonym | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
| Summenformel | C8H18F3NOSi2 |
Kupfer(II)-Acetylacetonat, 98 %, Thermo Scientific Chemicals
CAS: 13395-16-9 Summenformel: C10H14CuO4 Molekulargewicht (g/mol): 261.76 MDL-Nummer: MFCD00000016 InChI-Schlüssel: QYJPSWYYEKYVEJ-FDGPNNRMSA-L Synonym: 2, 4-Pentanedione, metal derivative,Cupric acetylacetonate IUPAC-Name: copper(2+) bis((2Z)-4-oxopent-2-en-2-olate) SMILES: [Cu++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | QYJPSWYYEKYVEJ-FDGPNNRMSA-L |
|---|---|
| IUPAC-Name | copper(2+) bis((2Z)-4-oxopent-2-en-2-olate) |
| CAS | 13395-16-9 |
| MDL-Nummer | MFCD00000016 |
| Molekulargewicht (g/mol) | 261.76 |
| SMILES | [Cu++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | 2, 4-Pentanedione, metal derivative,Cupric acetylacetonate |
| Summenformel | C10H14CuO4 |
Chlorotrimethylsilan, 98 %, Thermo Scientific Chemicals
CAS: 75-77-4 Summenformel: C3H9ClSi Molekulargewicht (g/mol): 108.64 MDL-Nummer: MFCD00000502 InChI-Schlüssel: IJOOHPMOJXWVHK-UHFFFAOYSA-N Synonym: trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl PubChem CID: 6397 ChEBI: CHEBI:85069 IUPAC-Name: Chlor(trimethyl)silan SMILES: C[Si](C)(C)Cl
| InChI-Schlüssel | IJOOHPMOJXWVHK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Chlor(trimethyl)silan |
| PubChem CID | 6397 |
| CAS | 75-77-4 |
| ChEBI | CHEBI:85069 |
| MDL-Nummer | MFCD00000502 |
| Molekulargewicht (g/mol) | 108.64 |
| SMILES | C[Si](C)(C)Cl |
| Synonym | trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl |
| Summenformel | C3H9ClSi |
Dimethylaluminiumchlorid, 0.9M-Lösung in Heptan, AcroSeal™, Thermo Scientific Chemicals
CAS: 1184-58-3 MDL-Nummer: MFCD00000458 InChI-Schlüssel: JGHYBJVUQGTEEB-UHFFFAOYSA-M Synonym: aluminum, chlorodimethyl,dimethylaluminum chloride,dimethylaluminium chloride,chlorodimethylaluminum,dimethylaluminum chloride solution, 1.0 m in hexanes,chloro dimethyl alumane,dimethylaluminum chloride solution PubChem CID: 79147 IUPAC-Name: Chlor(dimethyl)aluman SMILES: C[Al](C)Cl
| InChI-Schlüssel | JGHYBJVUQGTEEB-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Chlor(dimethyl)aluman |
| PubChem CID | 79147 |
| CAS | 1184-58-3 |
| MDL-Nummer | MFCD00000458 |
| SMILES | C[Al](C)Cl |
| Synonym | aluminum, chlorodimethyl,dimethylaluminum chloride,dimethylaluminium chloride,chlorodimethylaluminum,dimethylaluminum chloride solution, 1.0 m in hexanes,chloro dimethyl alumane,dimethylaluminum chloride solution |
N-Methyl-N-(trimethylsilyl)trifluoracetamid, 97 %, Thermo Scientific Chemicals
CAS: 24589-78-4 Summenformel: C6H12F3NOSi Molekulargewicht (g/mol): 199.25 MDL-Nummer: MFCD00000411 InChI-Schlüssel: MSPCIZMDDUQPGJ-UHFFFAOYSA-N Synonym: mstfa,n-methyl-n-trimethylsilyl trifluoroacetamide,2,2,2-trifluoro-n-methyl-n-trimethylsilyl acetamide,n-methyl-n-trimethylsilyltrifluoroacetamide,acetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl,n-methyl-n-trimethylsilyl-trifluoroacetamide,acmc-209tfm PubChem CID: 32510 ChEBI: CHEBI:85064 IUPAC-Name: 2,2,2-Trifluor-N-methyl-N-trimethylsilylacetamid SMILES: CN(C(=O)C(F)(F)F)[Si](C)(C)C
| InChI-Schlüssel | MSPCIZMDDUQPGJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2,2,2-Trifluor-N-methyl-N-trimethylsilylacetamid |
| PubChem CID | 32510 |
| CAS | 24589-78-4 |
| ChEBI | CHEBI:85064 |
| MDL-Nummer | MFCD00000411 |
| Molekulargewicht (g/mol) | 199.25 |
| SMILES | CN(C(=O)C(F)(F)F)[Si](C)(C)C |
| Synonym | mstfa,n-methyl-n-trimethylsilyl trifluoroacetamide,2,2,2-trifluoro-n-methyl-n-trimethylsilyl acetamide,n-methyl-n-trimethylsilyltrifluoroacetamide,acetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl,n-methyl-n-trimethylsilyl-trifluoroacetamide,acmc-209tfm |
| Summenformel | C6H12F3NOSi |
Natriumtetraethylborat, 97 %, rein, Thermo Scientific Chemicals
CAS: 15523-24-7 Summenformel: C8H20BNa Molekulargewicht (g/mol): 150.04 MDL-Nummer: MFCD00061547 InChI-Schlüssel: SZSBMTRYJRHYNI-UHFFFAOYSA-N Synonym: sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g PubChem CID: 23681030 IUPAC-Name: Natrium; Tetraethylboranuid SMILES: [B-](CC)(CC)(CC)CC.[Na+]
| InChI-Schlüssel | SZSBMTRYJRHYNI-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Natrium; Tetraethylboranuid |
| PubChem CID | 23681030 |
| CAS | 15523-24-7 |
| MDL-Nummer | MFCD00061547 |
| Molekulargewicht (g/mol) | 150.04 |
| SMILES | [B-](CC)(CC)(CC)CC.[Na+] |
| Synonym | sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g |
| Summenformel | C8H20BNa |
Bis-(trimethylsilyl)-lithiumamid, 1 M Lösung in THF/Ethylbenzol, AcroSeal™, Thermo Scientific Chemicals
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| Chemischer Name oder Material | Bis-(trimethylsilyl)-lithiumamid |
|---|---|
| InChI-Schlüssel | YNESATAKKCNGOF-UHFFFAOYSA-N |
| IUPAC-Name | Lithium; Bis(trimethylsilyl)azanid |
| Dichte | 0.8900 g/ml |
| EINECS-Nummer | 223-725-6 |
| Relative Dichte | 0.89 |
| Molekulargewicht (g/mol) | 167.33 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Namenshinweis | 1 M-Lösung in THF/Ethylbenzol |
| Formelmasse | 167.33 |
| Gesundheitsgefahr 2 | GHS-H-Satz Verursacht schwere Verätzungen der Haut und schwere Augenschäden Kann die Atemwege reizen. Leicht entzündliche Flüssigkeiten oder Dämpfe. Verdacht auf krebserregende Wirkung. Reagiert heftig mit Wasser. Kann explosionsfähige Peroxide bilden. Kann Schläfrigkeit oder Benommenheit verursachen. |
| Gesundheitsgefahr 3 | GHS-P-Satz Von Hitze/Funken/offenen Flammen/heißen Oberflächen fernhalten. - Rauchen verboten. Schutzhandschuhe/Augenschutz/Gesichtsschutz tragen. BEI BERÜHRUNG MIT DER HAUT (oder dem Haar): Alle kontaminierten Kleidungsstücke sofort ausziehen. Haut mit Wasser abwaschen/duschen. Sofort GIFTINFORMATIONSZENTRUM/Arzt anrufen. BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser ausspülen. Eventuell Vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter ausspülen. BEI VERSCHLUCKEN: Mund ausspülen. KEIN Erbrechen herbeiführen. |
| PubChem CID | 2733832 |
| Löslichkeitsinformationen | Solubility in water: decomposes |
| Farbe | Gelb bis Braun |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Physikalische Form | Trübe Lösung |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| CAS | 100-41-4 |
| MDL-Nummer | MFCD00008261 |
| Flammpunkt | −21 °C |
| Reinheit (%) | 18 bis 22 % aktive Base (als LiNSi) |
| Synonym | Lithiumbistrimethylsilylamid,Lithiumhexamethyldisilazid,Lithium-bis-trimethylsilyl-Amid,Lithium-bis-Trimethylsilyl-Azanid,Lithium-bis-Trimethylsilylamid,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| TSCA | TSCA |
| Summenformel | C6H18LiNSi2 |
N,O-Bis(trimethylsilyl)trifluoracetamid, ≥ 98 %, Thermo Scientific Chemicals
CAS: 25561-30-2 Summenformel: C8H18F3NOSi2 Molekulargewicht (g/mol): 257.39 MDL-Nummer: MFCD00008269 InChI-Schlüssel: XCOBLONWWXQEBS-GHXNOFRVSA-N Synonym: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate PubChem CID: 9601896 IUPAC-Name: Trimethylsilyl-(1Z)-2,2,2-trifluor-N-trimethylsilylethanimidat SMILES: C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C
| InChI-Schlüssel | XCOBLONWWXQEBS-GHXNOFRVSA-N |
|---|---|
| IUPAC-Name | Trimethylsilyl-(1Z)-2,2,2-trifluor-N-trimethylsilylethanimidat |
| PubChem CID | 9601896 |
| CAS | 25561-30-2 |
| MDL-Nummer | MFCD00008269 |
| Molekulargewicht (g/mol) | 257.39 |
| SMILES | C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| Synonym | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
| Summenformel | C8H18F3NOSi2 |
3-Aminopropyltriethoxysilan, 99 %, AcroSeal™, Thermo Scientific Chemicals
CAS: 919-30-2 Summenformel: C9H23NO3Si Molekulargewicht (g/mol): 221.37 MDL-Nummer: MFCD00008207,MFCD01324904 InChI-Schlüssel: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-Aminopropyltriethoxysilan,3-(Triethoxysilyl)propan-1-amin,1-Propanamin, 3-Triethoxysilyl,Silikon A-1100,Silan 1100,3-3-(Triethoxysilyl)propylamin,Propylamin, 3-Triethoxysilyl,Triethoxy-3-aminopropylsilan,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC-Name: 3-Triethoxysilylpropan-1-amin SMILES: CCO[Si](CCCN)(OCC)OCC
| InChI-Schlüssel | WYTZZXDRDKSJID-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Triethoxysilylpropan-1-amin |
| PubChem CID | 13521 |
| CAS | 919-30-2 |
| MDL-Nummer | MFCD00008207,MFCD01324904 |
| Molekulargewicht (g/mol) | 221.37 |
| SMILES | CCO[Si](CCCN)(OCC)OCC |
| Synonym | 3-Aminopropyltriethoxysilan,3-(Triethoxysilyl)propan-1-amin,1-Propanamin, 3-Triethoxysilyl,Silikon A-1100,Silan 1100,3-3-(Triethoxysilyl)propylamin,Propylamin, 3-Triethoxysilyl,Triethoxy-3-aminopropylsilan,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
| Summenformel | C9H23NO3Si |