Learn More
Quinapril hydrochloride, 98%, Thermo Scientific™
Angiotensin-converting enzyme inhibitor
Marke: Thermo Scientific Alfa Aesar J61913.03
| Menge | 1g |
|---|
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemische Identifikatoren
| 82586-55-8 | |
| 474.982 | |
| IBBLRJGOOANPTQ-JKVLGAQCSA-N | |
| 54891 | |
| (3S)-2-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;hydrochloride |
| C25H31ClN2O5 | |
| MFCD00889215 | |
| quinapril hydrochloride, accupril, accuprin, acequin, quinazil, korec, quinapril hcl, lidaltrin, acuitel, ectren | |
| CHEBI:8714 | |
| CCOC(=O)C(CCC1=CC=CC=C1)NC(C)C(=O)N2CC3=CC=CC=C3CC2C(=O)O.Cl |
Spezifikation
| Quinapril hydrochloride | |
| C25H31ClN2O5 | |
| 1g | |
| quinapril hydrochloride, accupril, accuprin, acequin, quinazil, korec, quinapril hcl, lidaltrin, acuitel, ectren | |
| CCOC(=O)C(CCC1=CC=CC=C1)NC(C)C(=O)N2CC3=CC=CC=C3CC2C(=O)O.Cl | |
| 474.982 | |
| CHEBI:8714 | |
| 98% |
| 82586-55-8 | |
| MFCD00889215 | |
| 14,8051 | |
| IBBLRJGOOANPTQ-JKVLGAQCSA-N | |
| (3S)-2-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;hydrochloride | |
| 54891 | |
| 474.99 |
Bitte geben Sie uns Ihr Feedback zu den Produktinhalten, indem Sie das folgende Formular ausfüllen.