Alkylhalogenide
Gefilterte Suchergebnisse
2-Brom-2-Methylpropan, stabilisiert, 96 %, Thermo Scientific Chemicals
CAS: 507-19-7 Summenformel: C4H9Br Molekulargewicht (g/mol): 137.02 MDL-Nummer: MFCD00000125 InChI-Schlüssel: RKSOPLXZQNSWAS-UHFFFAOYSA-N Synonym: tert-butyl bromide,t-butyl bromide,trimethylbromomethane,propane, 2-bromo-2-methyl,bromotrimethylmethane,2-bromoisobutane,tertiarybutyl bromide,tert-butylbromide,2-methyl-2-bromopropane,1-bromo-1,1-dimethylethane PubChem CID: 10485 IUPAC-Name: 2-Brom-2-Methylpropan SMILES: CC(C)(C)Br
| InChI-Schlüssel | RKSOPLXZQNSWAS-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Brom-2-Methylpropan |
| PubChem CID | 10485 |
| CAS | 507-19-7 |
| MDL-Nummer | MFCD00000125 |
| Molekulargewicht (g/mol) | 137.02 |
| SMILES | CC(C)(C)Br |
| Synonym | tert-butyl bromide,t-butyl bromide,trimethylbromomethane,propane, 2-bromo-2-methyl,bromotrimethylmethane,2-bromoisobutane,tertiarybutyl bromide,tert-butylbromide,2-methyl-2-bromopropane,1-bromo-1,1-dimethylethane |
| Summenformel | C4H9Br |
1-Brombutan, 99 %, Thermo Scientific Chemicals
CAS: 109-65-9 Summenformel: C4H9Br Molekulargewicht (g/mol): 137.02 MDL-Nummer: MFCD00000260 InChI-Schlüssel: MPPPKRYCTPRNTB-UHFFFAOYSA-N Synonym: butyl bromide,n-butyl bromide,bromobutane,butane, 1-bromo,1-butyl bromide,butane, bromo,n-butylbromide,1-bromo-butane,unii-sav6y78u3d,ccris 831 PubChem CID: 8002 IUPAC-Name: 1-Brombutan SMILES: CCCCBr
| InChI-Schlüssel | MPPPKRYCTPRNTB-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1-Brombutan |
| PubChem CID | 8002 |
| CAS | 109-65-9 |
| MDL-Nummer | MFCD00000260 |
| Molekulargewicht (g/mol) | 137.02 |
| SMILES | CCCCBr |
| Synonym | butyl bromide,n-butyl bromide,bromobutane,butane, 1-bromo,1-butyl bromide,butane, bromo,n-butylbromide,1-bromo-butane,unii-sav6y78u3d,ccris 831 |
| Summenformel | C4H9Br |
Dichlormethan, wasserfrei, >99.7 %, Thermo Scientific Chemicals
CAS: 75-09-2 Summenformel: CH2Cl2 Molekulargewicht (g/mol): 84.93 MDL-Nummer: MFCD00000881 InChI-Schlüssel: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC-Name: Dichlormethan SMILES: ClCCl
| InChI-Schlüssel | YMWUJEATGCHHMB-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Dichlormethan |
| PubChem CID | 6344 |
| CAS | 75-09-2 |
| ChEBI | CHEBI:15767 |
| MDL-Nummer | MFCD00000881 |
| Molekulargewicht (g/mol) | 84.93 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Summenformel | CH2Cl2 |
Iodoform, 99+ %, Thermo Scientific Chemicals
CAS: 75-47-8 Summenformel: CHI3 Molekulargewicht (g/mol): 393.72 MDL-Nummer: MFCD00001069 InChI-Schlüssel: OKJPEAGHQZHRQV-UHFFFAOYSA-N Synonym: triiodomethane,methane, triiodo,carbon triiodide,jodoform,trijodmethane,dezinfekt v,jodoform czech,trijodmethane czech,ccris 346,unii-kxi2j76489 PubChem CID: 6374 ChEBI: CHEBI:37758 IUPAC-Name: Iodform SMILES: C(I)(I)I
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | OKJPEAGHQZHRQV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Iodform |
| PubChem CID | 6374 |
| CAS | 75-47-8 |
| ChEBI | CHEBI:37758 |
| MDL-Nummer | MFCD00001069 |
| Molekulargewicht (g/mol) | 393.72 |
| SMILES | C(I)(I)I |
| Synonym | triiodomethane,methane, triiodo,carbon triiodide,jodoform,trijodmethane,dezinfekt v,jodoform czech,trijodmethane czech,ccris 346,unii-kxi2j76489 |
| Summenformel | CHI3 |
Cyclohexylbromid, 99 %, Thermo Scientific Chemicals
CAS: 108-85-0 Summenformel: C6H11Br Molekulargewicht (g/mol): 163.06 MDL-Nummer: MFCD00003819 InChI-Schlüssel: AQNQQHJNRPDOQV-UHFFFAOYSA-N Synonym: cyclohexyl bromide,cyclohexane, bromo,1-bromocyclohexane,unii-ya0ums4rny,bromo-cyclohexane,ya0ums4rny,cyclohexylbromide,bromocylcohexane,bromocyclohexane,ksc178g7n PubChem CID: 7960 IUPAC-Name: Bromoyclohexan SMILES: BrC1CCCCC1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | AQNQQHJNRPDOQV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Bromoyclohexan |
| PubChem CID | 7960 |
| CAS | 108-85-0 |
| MDL-Nummer | MFCD00003819 |
| Molekulargewicht (g/mol) | 163.06 |
| SMILES | BrC1CCCCC1 |
| Synonym | cyclohexyl bromide,cyclohexane, bromo,1-bromocyclohexane,unii-ya0ums4rny,bromo-cyclohexane,ya0ums4rny,cyclohexylbromide,bromocylcohexane,bromocyclohexane,ksc178g7n |
| Summenformel | C6H11Br |
Diiodmethan, 99+ %, stabilisiert, Thermo Scientific Chemicals
CAS: 75-11-6 Summenformel: CH2I2 Molekulargewicht (g/mol): 267.84 MDL-Nummer: MFCD00001079 InChI-Schlüssel: NZZFYRREKKOMAT-UHFFFAOYSA-N Synonym: methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane PubChem CID: 6346 IUPAC-Name: Diiodomethan SMILES: ICI
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | NZZFYRREKKOMAT-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diiodomethan |
| PubChem CID | 6346 |
| CAS | 75-11-6 |
| MDL-Nummer | MFCD00001079 |
| Molekulargewicht (g/mol) | 267.84 |
| SMILES | ICI |
| Synonym | methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane |
| Summenformel | CH2I2 |
Diiodmethan, 99 %, stab., Thermo Scientific Chemicals
CAS: 75-11-6 Summenformel: CH2I2 Molekulargewicht (g/mol): 267.84 MDL-Nummer: MFCD00001079 InChI-Schlüssel: NZZFYRREKKOMAT-UHFFFAOYSA-N Synonym: methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane PubChem CID: 6346 IUPAC-Name: Diiodomethan SMILES: ICI
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | NZZFYRREKKOMAT-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diiodomethan |
| PubChem CID | 6346 |
| CAS | 75-11-6 |
| MDL-Nummer | MFCD00001079 |
| Molekulargewicht (g/mol) | 267.84 |
| SMILES | ICI |
| Synonym | methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane |
| Summenformel | CH2I2 |
1H,1H,2H,2H-Perfluoroctanol, 97 %, Thermo Scientific Chemicals
CAS: 647-42-7 Summenformel: C8H5F13O Molekulargewicht (g/mol): 364.106 MDL-Nummer: MFCD00042143 InChI-Schlüssel: GRJRKPMIRMSBNK-UHFFFAOYSA-N Synonym: 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octanol,2-perfluorohexyl ethanol,1h,1h,2h,2h-perfluorooctan-1-ol,1h,1h,2h,2h-perfluorooctanol,1h,1h,2h,2h-perfluoro-1-octanol,unii-g2r5yo5n3v,1-octanol, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro,1h,1h,2h,2h-tridecafluoro-1-n-octanol,g2r5yo5n3v,1,1,2,2-tetrahydroperfluoro-1-octanol PubChem CID: 69537 IUPAC-Name: 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoroctan-1-ol SMILES: C(CO)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | GRJRKPMIRMSBNK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoroctan-1-ol |
| PubChem CID | 69537 |
| CAS | 647-42-7 |
| MDL-Nummer | MFCD00042143 |
| Molekulargewicht (g/mol) | 364.106 |
| SMILES | C(CO)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| Synonym | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octanol,2-perfluorohexyl ethanol,1h,1h,2h,2h-perfluorooctan-1-ol,1h,1h,2h,2h-perfluorooctanol,1h,1h,2h,2h-perfluoro-1-octanol,unii-g2r5yo5n3v,1-octanol, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro,1h,1h,2h,2h-tridecafluoro-1-n-octanol,g2r5yo5n3v,1,1,2,2-tetrahydroperfluoro-1-octanol |
| Summenformel | C8H5F13O |
Jodmethan, 99+%, stab. mit Kupfer, Thermo Scientific Chemicals
CAS: 74-88-4 Summenformel: CH3I Molekulargewicht (g/mol): 141.94 MDL-Nummer: MFCD00001073 InChI-Schlüssel: INQOMBQAUSQDDS-UHFFFAOYSA-N Synonym: methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek PubChem CID: 6328 ChEBI: CHEBI:39282 IUPAC-Name: Iodmethan SMILES: CI
| InChI-Schlüssel | INQOMBQAUSQDDS-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Iodmethan |
| PubChem CID | 6328 |
| CAS | 74-88-4 |
| ChEBI | CHEBI:39282 |
| MDL-Nummer | MFCD00001073 |
| Molekulargewicht (g/mol) | 141.94 |
| SMILES | CI |
| Synonym | methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek |
| Summenformel | CH3I |
Cyclopentylbromid, 98 %, Thermo Scientific Chemicals
CAS: 137-43-9 Summenformel: C5H9Br Molekulargewicht (g/mol): 149.03 MDL-Nummer: MFCD00001359 InChI-Schlüssel: BRTFVKHPEHKBQF-UHFFFAOYSA-N Synonym: cyclopentyl bromide,cyclopentylbromide,cyclopentane, bromo,bromo cyclopentane,bromo-cyclopentane,bromocyclopentan,cylopentylbromide,cyclopentyl-bromide,sfphabilimup@,4-bromocyclopentane PubChem CID: 8728 IUPAC-Name: Bromoyclopentan SMILES: C1CCC(C1)Br
| InChI-Schlüssel | BRTFVKHPEHKBQF-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Bromoyclopentan |
| PubChem CID | 8728 |
| CAS | 137-43-9 |
| MDL-Nummer | MFCD00001359 |
| Molekulargewicht (g/mol) | 149.03 |
| SMILES | C1CCC(C1)Br |
| Synonym | cyclopentyl bromide,cyclopentylbromide,cyclopentane, bromo,bromo cyclopentane,bromo-cyclopentane,bromocyclopentan,cylopentylbromide,cyclopentyl-bromide,sfphabilimup@,4-bromocyclopentane |
| Summenformel | C5H9Br |
1,2-Dibromethan, 99 %, Thermo Scientific Chemicals
CAS: 106-93-4 Summenformel: C2H4Br2 Molekulargewicht (g/mol): 187.862 MDL-Nummer: MFCD00000233 InChI-Schlüssel: PAAZPARNPHGIKF-UHFFFAOYSA-N Synonym: ethylene dibromide,ethylene bromide,sym-dibromoethane,ethane, 1,2-dibromo,alpha,beta-dibromoethane,bromuro di etile,1,2-dibromaethan,1,2-dibroomethaan,1,2-ethylene dibromide,aadibroom PubChem CID: 7839 ChEBI: CHEBI:28534 IUPAC-Name: 1,2-Dibromethan SMILES: C(CBr)Br
| InChI-Schlüssel | PAAZPARNPHGIKF-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1,2-Dibromethan |
| PubChem CID | 7839 |
| CAS | 106-93-4 |
| ChEBI | CHEBI:28534 |
| MDL-Nummer | MFCD00000233 |
| Molekulargewicht (g/mol) | 187.862 |
| SMILES | C(CBr)Br |
| Synonym | ethylene dibromide,ethylene bromide,sym-dibromoethane,ethane, 1,2-dibromo,alpha,beta-dibromoethane,bromuro di etile,1,2-dibromaethan,1,2-dibroomethaan,1,2-ethylene dibromide,aadibroom |
| Summenformel | C2H4Br2 |
1,2-Dibromethan, 99 %, Thermo Scientific Chemicals
CAS: 106-93-4 Summenformel: C2H4Br2 Molekulargewicht (g/mol): 187.86 InChI-Schlüssel: PAAZPARNPHGIKF-UHFFFAOYSA-N Synonym: ethylene dibromide,ethylene bromide,sym-dibromoethane,ethane, 1,2-dibromo,alpha,beta-dibromoethane,bromuro di etile,1,2-dibromaethan,1,2-dibroomethaan,1,2-ethylene dibromide,aadibroom PubChem CID: 7839 ChEBI: CHEBI:28534 IUPAC-Name: 1,2-Dibromethan SMILES: C(CBr)Br
| InChI-Schlüssel | PAAZPARNPHGIKF-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1,2-Dibromethan |
| PubChem CID | 7839 |
| CAS | 106-93-4 |
| ChEBI | CHEBI:28534 |
| Molekulargewicht (g/mol) | 187.86 |
| SMILES | C(CBr)Br |
| Synonym | ethylene dibromide,ethylene bromide,sym-dibromoethane,ethane, 1,2-dibromo,alpha,beta-dibromoethane,bromuro di etile,1,2-dibromaethan,1,2-dibroomethaan,1,2-ethylene dibromide,aadibroom |
| Summenformel | C2H4Br2 |
2-Brombutan, 99+ %, Thermo Scientific Chemicals
CAS: 78-76-2 Summenformel: C4H9Br Molekulargewicht (g/mol): 137.02 MDL-Nummer: MFCD00000156 InChI-Schlüssel: UPSXAPQYNGXVBF-UHFFFAOYSA-N Synonym: sec-butyl bromide,butane, 2-bromo,2-butyl bromide,methylethylbromomethane,2-bromo-butane,secondary butyl bromide,sec-butylbromide,1-bromo-1-methylpropane,ccris 106,bromobutane, 2 PubChem CID: 6554 IUPAC-Name: 2-Brombutan SMILES: CCC(C)Br
| InChI-Schlüssel | UPSXAPQYNGXVBF-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Brombutan |
| PubChem CID | 6554 |
| CAS | 78-76-2 |
| MDL-Nummer | MFCD00000156 |
| Molekulargewicht (g/mol) | 137.02 |
| SMILES | CCC(C)Br |
| Synonym | sec-butyl bromide,butane, 2-bromo,2-butyl bromide,methylethylbromomethane,2-bromo-butane,secondary butyl bromide,sec-butylbromide,1-bromo-1-methylpropane,ccris 106,bromobutane, 2 |
| Summenformel | C4H9Br |
3-Brom-2-Methylpropen, 97 %, Thermo Scientific Chemicals
CAS: 1458-98-6 Summenformel: C4H7Br Molekulargewicht (g/mol): 135.00 MDL-Nummer: MFCD00134155 InChI-Schlüssel: USEGQJLHQSTGHW-UHFFFAOYSA-N Synonym: 3-bromo-2-methylpropene,3-bromo-2-methyl-1-propene,methallyl bromide,2-bromomethyl prop-1-ene,2-methylallyl bromide,1-propene, 3-bromo-2-methyl,3-bromo-2-methyl-prop-1-ene,3-bromo-2-methylpropene, stabilized with hydroquinone,methallylbromide,methylallyl bromide PubChem CID: 357785 IUPAC-Name: 3-Brom-2-Methylprop-1-en SMILES: CC(=C)CBr
| InChI-Schlüssel | USEGQJLHQSTGHW-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Brom-2-Methylprop-1-en |
| PubChem CID | 357785 |
| CAS | 1458-98-6 |
| MDL-Nummer | MFCD00134155 |
| Molekulargewicht (g/mol) | 135.00 |
| SMILES | CC(=C)CBr |
| Synonym | 3-bromo-2-methylpropene,3-bromo-2-methyl-1-propene,methallyl bromide,2-bromomethyl prop-1-ene,2-methylallyl bromide,1-propene, 3-bromo-2-methyl,3-bromo-2-methyl-prop-1-ene,3-bromo-2-methylpropene, stabilized with hydroquinone,methallylbromide,methylallyl bromide |
| Summenformel | C4H7Br |