Gefilterte Suchergebnisse
Natriumbenzoat, 99 %, Thermo Scientific Chemicals
CAS: 532-32-1 Summenformel: C7H5NaO2 Molekulargewicht (g/mol): 144.11 MDL-Nummer: MFCD00012463 InChI-Schlüssel: WXMKPNITSTVMEF-UHFFFAOYSA-M Synonym: sodium benzoate,benzoic acid, sodium salt,benzoic acid sodium salt,sobenate,antimol,benzoate sodium,benzoate of soda,benzoate, sodium,natrium benzoicum,caswell no. 746 PubChem CID: 517055 SMILES: [Na+].[O-]C(=O)C1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | WXMKPNITSTVMEF-UHFFFAOYSA-M |
|---|---|
| PubChem CID | 517055 |
| CAS | 532-32-1 |
| MDL-Nummer | MFCD00012463 |
| Molekulargewicht (g/mol) | 144.11 |
| SMILES | [Na+].[O-]C(=O)C1=CC=CC=C1 |
| Synonym | sodium benzoate,benzoic acid, sodium salt,benzoic acid sodium salt,sobenate,antimol,benzoate sodium,benzoate of soda,benzoate, sodium,natrium benzoicum,caswell no. 746 |
| Summenformel | C7H5NaO2 |
Benzamid 99 %, Thermo Scientific Chemicals
CAS: 55-21-0 Summenformel: C7H7NO Molekulargewicht (g/mol): 121.14 MDL-Nummer: MFCD00007968 InChI-Schlüssel: KXDAEFPNCMNJSK-UHFFFAOYSA-N Synonym: benzoic acid amide,benzoylamide,phenylcarboxyamide,phenylcarboxamide,benzenecarboxamide,amid kyseliny benzoove,amid kyseliny benzoove czech,phenyl carboxyamide,ccris 4594,benzoic acid,amide PubChem CID: 2331 ChEBI: CHEBI:28179 IUPAC-Name: Benzamid SMILES: C1=CC=C(C=C1)C(=O)N
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | KXDAEFPNCMNJSK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Benzamid |
| PubChem CID | 2331 |
| CAS | 55-21-0 |
| ChEBI | CHEBI:28179 |
| MDL-Nummer | MFCD00007968 |
| Molekulargewicht (g/mol) | 121.14 |
| SMILES | C1=CC=C(C=C1)C(=O)N |
| Synonym | benzoic acid amide,benzoylamide,phenylcarboxyamide,phenylcarboxamide,benzenecarboxamide,amid kyseliny benzoove,amid kyseliny benzoove czech,phenyl carboxyamide,ccris 4594,benzoic acid,amide |
| Summenformel | C7H7NO |
Natriumbutyrat, >98 %, Thermo Scientific Chemicals
CAS: 156-54-7 Summenformel: C4H7NaO2 Molekulargewicht (g/mol): 110.09 MDL-Nummer: MFCD00002816 InChI-Schlüssel: MFBOGIVSZKQAPD-UHFFFAOYSA-M Synonym: sodium butyrate,sodium butanoate,butyric acid sodium salt,butanoic acid, sodium salt,butyrate sodium,butyric acid, sodium salt,sodium n-butyrate,sodium propanecarboxylate,butyric acid, na,butanoic acid, sodium salt 1:1 PubChem CID: 5222465 ChEBI: CHEBI:64103 SMILES: [Na+].CCCC([O-])=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | MFBOGIVSZKQAPD-UHFFFAOYSA-M |
|---|---|
| PubChem CID | 5222465 |
| CAS | 156-54-7 |
| ChEBI | CHEBI:64103 |
| MDL-Nummer | MFCD00002816 |
| Molekulargewicht (g/mol) | 110.09 |
| SMILES | [Na+].CCCC([O-])=O |
| Synonym | sodium butyrate,sodium butanoate,butyric acid sodium salt,butanoic acid, sodium salt,butyrate sodium,butyric acid, sodium salt,sodium n-butyrate,sodium propanecarboxylate,butyric acid, na,butanoic acid, sodium salt 1:1 |
| Summenformel | C4H7NaO2 |
Ethylenebis(oxyethylennitrilo)tetraessigsäure, 98 %, Thermo Scientific Chemicals
CAS: 67-42-5 Summenformel: C14H24N2O10 Molekulargewicht (g/mol): 380.34 MDL-Nummer: MFCD00004291 InChI-Schlüssel: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC-Name: 2-[2-[2-[2-[bis(Carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]essigsäure SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | DEFVIWRASFVYLL-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-[2-[2-[2-[bis(Carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]essigsäure |
| PubChem CID | 6207 |
| CAS | 67-42-5 |
| ChEBI | CHEBI:30740 |
| MDL-Nummer | MFCD00004291 |
| Molekulargewicht (g/mol) | 380.34 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| Summenformel | C14H24N2O10 |
4-Nitrophenylphosphat, Dinatriumsalz, Hexahydrat, 98+%, Thermo Scientific Chemicals
CAS: 333338-18-4 Summenformel: C6H4NNa2O6P Molekulargewicht (g/mol): 263.05 MDL-Nummer: MFCD00007319 InChI-Schlüssel: VIYFPAMJCJLZKD-UHFFFAOYSA-L Synonym: pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system PubChem CID: 77949 IUPAC-Name: Dinatrium;(4-nitrophenyl)phosphat SMILES: [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | VIYFPAMJCJLZKD-UHFFFAOYSA-L |
|---|---|
| IUPAC-Name | Dinatrium;(4-nitrophenyl)phosphat |
| PubChem CID | 77949 |
| CAS | 333338-18-4 |
| MDL-Nummer | MFCD00007319 |
| Molekulargewicht (g/mol) | 263.05 |
| SMILES | [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 |
| Synonym | pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system |
| Summenformel | C6H4NNa2O6P |
Kaliumformiat, 99 % (Wasser<2 %), Thermo Scientific Chemicals
CAS: 590-29-4 Summenformel: CHKO2 Molekulargewicht (g/mol): 84.115 MDL-Nummer: MFCD00013100 InChI-Schlüssel: WFIZEGIEIOHZCP-UHFFFAOYSA-M Synonym: potassium formate,formic acid potassium salt,formic acid, potassium salt,formic acid, k salt,hcook,mravencan draselny czech,hco2k,formic acid, potassium salt 1:1,potassium formira,64-18-6 parent PubChem CID: 2735122 ChEBI: CHEBI:63316 IUPAC-Name: Calium;formiat SMILES: C(=O)[O-].[K+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | WFIZEGIEIOHZCP-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Calium;formiat |
| PubChem CID | 2735122 |
| CAS | 590-29-4 |
| ChEBI | CHEBI:63316 |
| MDL-Nummer | MFCD00013100 |
| Molekulargewicht (g/mol) | 84.115 |
| SMILES | C(=O)[O-].[K+] |
| Synonym | potassium formate,formic acid potassium salt,formic acid, potassium salt,formic acid, k salt,hcook,mravencan draselny czech,hco2k,formic acid, potassium salt 1:1,potassium formira,64-18-6 parent |
| Summenformel | CHKO2 |
N,N-Dimethylacetamid, wasserfrei, 99.8 %, Thermo Scientific Chemicals
CAS: 127-19-5 Summenformel: C4H9NO Molekulargewicht (g/mol): 87.12 MDL-Nummer: MFCD00008686 InChI-Schlüssel: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC-Name: N,N-Dimethylacetamid SMILES: CN(C)C(C)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | N,N-Dimethylacetamid |
| PubChem CID | 31374 |
| CAS | 127-19-5 |
| ChEBI | CHEBI:84254 |
| MDL-Nummer | MFCD00008686 |
| Molekulargewicht (g/mol) | 87.12 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| Summenformel | C4H9NO |
Taurin, 99 %, Thermo Scientific Chemicals
CAS: 107-35-7 Summenformel: C2H7NO3S Molekulargewicht (g/mol): 125.14 MDL-Nummer: MFCD00008197 InChI-Schlüssel: XOAAWQZATWQOTB-UHFFFAOYSA-N Synonym: taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid PubChem CID: 1123 ChEBI: CHEBI:15891 IUPAC-Name: 2-Aminoethansulfonsäure SMILES: NCCS(O)(=O)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | XOAAWQZATWQOTB-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Aminoethansulfonsäure |
| PubChem CID | 1123 |
| CAS | 107-35-7 |
| ChEBI | CHEBI:15891 |
| MDL-Nummer | MFCD00008197 |
| Molekulargewicht (g/mol) | 125.14 |
| SMILES | NCCS(O)(=O)=O |
| Synonym | taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid |
| Summenformel | C2H7NO3S |
Propylencarbonat, 99.50 %, Thermo Scientific Chemicals
CAS: 108-32-7 Summenformel: C4H6O3 Molekulargewicht (g/mol): 102.09 MDL-Nummer: MFCD00005385,MFCD00798264,MFCD00798265 InChI-Schlüssel: RUOJZAUFBMNUDX-UHFFFAOYNA-N Synonym: propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate PubChem CID: 7924 IUPAC-Name: 4-methyl-1,3-dioxolan-2-on SMILES: CC1COC(=O)O1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RUOJZAUFBMNUDX-UHFFFAOYNA-N |
|---|---|
| IUPAC-Name | 4-methyl-1,3-dioxolan-2-on |
| PubChem CID | 7924 |
| CAS | 108-32-7 |
| MDL-Nummer | MFCD00005385,MFCD00798264,MFCD00798265 |
| Molekulargewicht (g/mol) | 102.09 |
| SMILES | CC1COC(=O)O1 |
| Synonym | propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate |
| Summenformel | C4H6O3 |
Thermo Scientific Chemicals D-Calciumpantothenat, 98 %
CAS: 137-08-6 Summenformel: C18H32CaN2O10 Molekulargewicht (g/mol): 476.54 MDL-Nummer: MFCD00002766 InChI-Schlüssel: FAPWYRCQGJNNSJ-DXHDTSSINA-L Synonym: calcium pantothenate,d-pantothenic acid hemicalcium salt,d-pantothenic acid, calcium salt,pantothenic acid, calcium salt, d,r-n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-beta-alanine calcium salt,beta-alanine, n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-, calcium salt, r PubChem CID: 131847364 IUPAC-Name: calcium bis(3-[(2R)-2,4-dihydroxy-3,3-dimethylbutanamido]propanoate) SMILES: [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | FAPWYRCQGJNNSJ-DXHDTSSINA-L |
|---|---|
| IUPAC-Name | calcium bis(3-[(2R)-2,4-dihydroxy-3,3-dimethylbutanamido]propanoate) |
| PubChem CID | 131847364 |
| CAS | 137-08-6 |
| MDL-Nummer | MFCD00002766 |
| Molekulargewicht (g/mol) | 476.54 |
| SMILES | [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O |
| Synonym | calcium pantothenate,d-pantothenic acid hemicalcium salt,d-pantothenic acid, calcium salt,pantothenic acid, calcium salt, d,r-n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-beta-alanine calcium salt,beta-alanine, n-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl-, calcium salt, r |
| Summenformel | C18H32CaN2O10 |
Thermo Scientific Chemicals Ethylendiamintetraessigsäure, 99%, rein
CAS: 60-00-4 Summenformel: C10H16N2O8 Molekulargewicht (g/mol): 292.24 MDL-Nummer: MFCD00003541 InChI-Schlüssel: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC-Name: 2-[2-[Bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]essigsäure SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-[2-[Bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]essigsäure |
| PubChem CID | 6049 |
| CAS | 60-00-4 |
| ChEBI | CHEBI:42191 |
| MDL-Nummer | MFCD00003541 |
| Molekulargewicht (g/mol) | 292.24 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| Summenformel | C10H16N2O8 |
Triethylphosphat, 98+%, Thermo Scientific Chemicals
CAS: 78-40-0 Summenformel: C6H15O4P Molekulargewicht (g/mol): 182.16 MDL-Nummer: MFCD00009077 InChI-Schlüssel: DQWPFSLDHJDLRL-UHFFFAOYSA-N Synonym: triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester PubChem CID: 6535 ChEBI: CHEBI:45927 IUPAC-Name: Triethylphosphat SMILES: CCOP(=O)(OCC)OCC
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | DQWPFSLDHJDLRL-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Triethylphosphat |
| PubChem CID | 6535 |
| CAS | 78-40-0 |
| ChEBI | CHEBI:45927 |
| MDL-Nummer | MFCD00009077 |
| Molekulargewicht (g/mol) | 182.16 |
| SMILES | CCOP(=O)(OCC)OCC |
| Synonym | triethylphosphate,phosphoric acid, triethyl ester,tris ethyl phosphate,triethoxyphosphine oxide,triethylfosfat,ethyl phosphate eto 3po,triethylfosfat czech,ethyl phosphate van,unii-qih4k96k7j,phosphoric acid triethyl ester |
| Summenformel | C6H15O4P |
Zitronensäure, Trinatriumsalz-Dihydrat, 99 %, rein, Thermo Scientific Chemicals
CAS: 1545801 Summenformel: C6H9Na3O9 Molekulargewicht (g/mol): 294.1 MDL-Nummer: MFCD00150031 InChI-Schlüssel: NLJMYIDDQXHKNR-UHFFFAOYSA-K Synonym: trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate PubChem CID: 71474 ChEBI: CHEBI:32142 IUPAC-Name: Trinatrium;2-Hydroxypropan-1,2,3-Tricarboxylat;Dihydrat SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | NLJMYIDDQXHKNR-UHFFFAOYSA-K |
|---|---|
| IUPAC-Name | Trinatrium;2-Hydroxypropan-1,2,3-Tricarboxylat;Dihydrat |
| PubChem CID | 71474 |
| CAS | 1545801 |
| ChEBI | CHEBI:32142 |
| MDL-Nummer | MFCD00150031 |
| Molekulargewicht (g/mol) | 294.1 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+] |
| Synonym | trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate |
| Summenformel | C6H9Na3O9 |
L-Ascorbinsäure-Natriumsalz, 99 %, Thermo Scientific Chemicals
CAS: 134-03-2 Summenformel: C6H7NaO6 Molekulargewicht (g/mol): 198.11 MDL-Nummer: MFCD00082340 InChI-Schlüssel: IFVCRSPJFHGFCG-HXPAKLQESA-N Synonym: sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate PubChem CID: 131674100 IUPAC-Name: (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-on;hydridonatrium SMILES: [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | IFVCRSPJFHGFCG-HXPAKLQESA-N |
|---|---|
| IUPAC-Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-on;hydridonatrium |
| PubChem CID | 131674100 |
| CAS | 134-03-2 |
| MDL-Nummer | MFCD00082340 |
| Molekulargewicht (g/mol) | 198.11 |
| SMILES | [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| Synonym | sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate |
| Summenformel | C6H7NaO6 |
1-Butansulfonsäure, Natriumsalz, wasserfrei, +99 %, Thermo Scientific Chemicals
CAS: 2386-54-1 Summenformel: C4H9NaO3S Molekulargewicht (g/mol): 160.16 MDL-Nummer: MFCD00007540 InChI-Schlüssel: XQCHMGAOAWZUPI-UHFFFAOYSA-M Synonym: sodium 1-butanesulfonate,sodium butane-1-sulfonate,1-butanesulfonic acid sodium salt,sodium butylsulfonate,1-butanesulfonic acid, sodium salt,sodium butane-1-sulphonate,sodium butanesulfonate,ipc-alks-4,1-butanesulfonic acid, sodium salt 1:1,acmc-1cdot PubChem CID: 4096517 IUPAC-Name: Natrium;butan-1-sulfonat SMILES: [Na+].CCCCS([O-])(=O)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | XQCHMGAOAWZUPI-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium;butan-1-sulfonat |
| PubChem CID | 4096517 |
| CAS | 2386-54-1 |
| MDL-Nummer | MFCD00007540 |
| Molekulargewicht (g/mol) | 160.16 |
| SMILES | [Na+].CCCCS([O-])(=O)=O |
| Synonym | sodium 1-butanesulfonate,sodium butane-1-sulfonate,1-butanesulfonic acid sodium salt,sodium butylsulfonate,1-butanesulfonic acid, sodium salt,sodium butane-1-sulphonate,sodium butanesulfonate,ipc-alks-4,1-butanesulfonic acid, sodium salt 1:1,acmc-1cdot |
| Summenformel | C4H9NaO3S |