Acrylsäuren und Derivate
Gefilterte Suchergebnisse
3-(Trimethoxysilyl)propylacrylat, 90 %, stabilisiert, Thermo Scientific Chemicals
CAS: 4369-14-6 Summenformel: C9H18O5Si Molekulargewicht (g/mol): 234.32 MDL-Nummer: MFCD00054803 InChI-Schlüssel: KBQVDAIIQCXKPI-UHFFFAOYSA-N Synonym: 3-trimethoxysilyl propyl acrylate,3-acryloyloxy propyltrimethoxysilane,3-acryloxypropyltrimethoxysilane,2-propenoic acid, 3-trimethoxysilyl propyl ester,3-acryloxypropyl trimethoxysilane,3-trimethoxysilyl propyl 2-propenoate,3-acryloyloxypropyltrimethoxysilane,3-acryloxypropyltrimethoxysilane, stab. with 100ppm bht,acmc-1aoz6,acrylic acid, 3-trimethoxysilyl propyl ester PubChem CID: 151204 IUPAC-Name: 3-Trimethoxysilylpropyl prop-2-enoat SMILES: CO[Si](CCCOC(=O)C=C)(OC)OC
| InChI-Schlüssel | KBQVDAIIQCXKPI-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Trimethoxysilylpropyl prop-2-enoat |
| PubChem CID | 151204 |
| CAS | 4369-14-6 |
| MDL-Nummer | MFCD00054803 |
| Molekulargewicht (g/mol) | 234.32 |
| SMILES | CO[Si](CCCOC(=O)C=C)(OC)OC |
| Synonym | 3-trimethoxysilyl propyl acrylate,3-acryloyloxy propyltrimethoxysilane,3-acryloxypropyltrimethoxysilane,2-propenoic acid, 3-trimethoxysilyl propyl ester,3-acryloxypropyl trimethoxysilane,3-trimethoxysilyl propyl 2-propenoate,3-acryloyloxypropyltrimethoxysilane,3-acryloxypropyltrimethoxysilane, stab. with 100ppm bht,acmc-1aoz6,acrylic acid, 3-trimethoxysilyl propyl ester |
| Summenformel | C9H18O5Si |
1,1,1,3,3,3-Hexafluorisopropylacrylat, 98 +%, stab. mit 50ppm 4-Methoxyphenol, Thermo Scientific Chemicals
CAS: 2160-89-6 Summenformel: C6H4F6O2 Molekulargewicht (g/mol): 222.09 MDL-Nummer: MFCD00040104 InChI-Schlüssel: MNSWITGNWZSAMC-UHFFFAOYSA-N Synonym: 1,1,1,3,3,3-hexafluoroisopropyl acrylate,hexafluoroisopropyl acrylate,1,1,1,3,3,3-hexafluoropropan-2-yl acrylate,2-propenoic acid, 2,2,2-trifluoro-1-trifluoromethyl ethyl ester,acrylic acid 1,1,1,3,3,3-hexafluoroisopropyl ester,hexafluoro-2-propyl acrylate,mnswitgnwzsamc-uhfffaoysa,1h-1-trifluoromethyl trifluoroethyl acrylate PubChem CID: 75096 IUPAC-Name: 1,1,1,3,3,3-Hexafluorpropan-2-yl-prop-2-enoat SMILES: FC(F)(F)C(OC(=O)C=C)C(F)(F)F
| InChI-Schlüssel | MNSWITGNWZSAMC-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1,1,1,3,3,3-Hexafluorpropan-2-yl-prop-2-enoat |
| PubChem CID | 75096 |
| CAS | 2160-89-6 |
| MDL-Nummer | MFCD00040104 |
| Molekulargewicht (g/mol) | 222.09 |
| SMILES | FC(F)(F)C(OC(=O)C=C)C(F)(F)F |
| Synonym | 1,1,1,3,3,3-hexafluoroisopropyl acrylate,hexafluoroisopropyl acrylate,1,1,1,3,3,3-hexafluoropropan-2-yl acrylate,2-propenoic acid, 2,2,2-trifluoro-1-trifluoromethyl ethyl ester,acrylic acid 1,1,1,3,3,3-hexafluoroisopropyl ester,hexafluoro-2-propyl acrylate,mnswitgnwzsamc-uhfffaoysa,1h-1-trifluoromethyl trifluoroethyl acrylate |
| Summenformel | C6H4F6O2 |
Methylacrylat, 99 %, stabilisiert, Thermo Scientific Chemicals
CAS: 96-33-3 Summenformel: C4H6O2 Molekulargewicht (g/mol): 86.09 MDL-Nummer: MFCD00008627 InChI-Schlüssel: BAPJBEWLBFYGME-UHFFFAOYSA-N Synonym: methyl acrylate,methylacrylate,acrylic acid methyl ester,2-propenoic acid, methyl ester,methyl 2-propenoate,methyl propenoate,methylacrylaat,metilacrilato,methyl-acrylat,methoxycarbonylethylene PubChem CID: 7294 ChEBI: CHEBI:82482 IUPAC-Name: Methyl-2-propenat SMILES: COC(=O)C=C
| InChI-Schlüssel | BAPJBEWLBFYGME-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Methyl-2-propenat |
| PubChem CID | 7294 |
| CAS | 96-33-3 |
| ChEBI | CHEBI:82482 |
| MDL-Nummer | MFCD00008627 |
| Molekulargewicht (g/mol) | 86.09 |
| SMILES | COC(=O)C=C |
| Synonym | methyl acrylate,methylacrylate,acrylic acid methyl ester,2-propenoic acid, methyl ester,methyl 2-propenoate,methyl propenoate,methylacrylaat,metilacrilato,methyl-acrylat,methoxycarbonylethylene |
| Summenformel | C4H6O2 |
tert-Butylacrylat, 99 %, stab mit 15 ppm4-Methoxyphenol, Thermo Scientific Chemicals
CAS: 1663-39-4 Summenformel: C7H12O2 Molekulargewicht (g/mol): 128.17 MDL-Nummer: MFCD00008809 InChI-Schlüssel: ISXSCDLOGDJUNJ-UHFFFAOYSA-N Synonym: tert-butyl acrylate,t-butyl acrylate,tert-butyl propenoate,2-propenoic acid, 1,1-dimethylethyl ester,acrylic acid tert-butyl ester,tert-butylacrylate,acrylic acid, tert-butyl ester,unii-92m2cd1o3g,ccris 7035,2-propenoic acid tert-butyl ester PubChem CID: 15458 IUPAC-Name: tert-Butyl-prop-2-enoat SMILES: CC(C)(C)OC(=O)C=C
| InChI-Schlüssel | ISXSCDLOGDJUNJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | tert-Butyl-prop-2-enoat |
| PubChem CID | 15458 |
| CAS | 1663-39-4 |
| MDL-Nummer | MFCD00008809 |
| Molekulargewicht (g/mol) | 128.17 |
| SMILES | CC(C)(C)OC(=O)C=C |
| Synonym | tert-butyl acrylate,t-butyl acrylate,tert-butyl propenoate,2-propenoic acid, 1,1-dimethylethyl ester,acrylic acid tert-butyl ester,tert-butylacrylate,acrylic acid, tert-butyl ester,unii-92m2cd1o3g,ccris 7035,2-propenoic acid tert-butyl ester |
| Summenformel | C7H12O2 |
Methylacrylat, 99%, stab. Mit ca.15 ppm4 -Methoxyphenol, Thermo Scientific Chemicals
CAS: 96-33-3 Summenformel: C4H6O2 Molekulargewicht (g/mol): 86.09 MDL-Nummer: MFCD00008627 InChI-Schlüssel: BAPJBEWLBFYGME-UHFFFAOYSA-N Synonym: methyl acrylate,methylacrylate,acrylic acid methyl ester,2-propenoic acid, methyl ester,methyl 2-propenoate,methyl propenoate,methylacrylaat,metilacrilato,methyl-acrylat,methoxycarbonylethylene PubChem CID: 7294 ChEBI: CHEBI:82482 IUPAC-Name: Methyl-2-propenat SMILES: COC(=O)C=C
| InChI-Schlüssel | BAPJBEWLBFYGME-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Methyl-2-propenat |
| PubChem CID | 7294 |
| CAS | 96-33-3 |
| ChEBI | CHEBI:82482 |
| MDL-Nummer | MFCD00008627 |
| Molekulargewicht (g/mol) | 86.09 |
| SMILES | COC(=O)C=C |
| Synonym | methyl acrylate,methylacrylate,acrylic acid methyl ester,2-propenoic acid, methyl ester,methyl 2-propenoate,methyl propenoate,methylacrylaat,metilacrilato,methyl-acrylat,methoxycarbonylethylene |
| Summenformel | C4H6O2 |
2-Ethylhexylacrylat +99 %, stabilisiert, Thermo Scientific Chemicals
CAS: 103-11-7 Summenformel: C11H20O2 Molekulargewicht (g/mol): 184.28 MDL-Nummer: MFCD00009495 InChI-Schlüssel: GOXQRTZXKQZDDN-UHFFFAOYSA-N Synonym: 2-ethylhexyl acrylate,2-propenoic acid, 2-ethylhexyl ester,2-ethyl-1-hexyl acrylate,2-ethylhexyl 2-propenoate,acrylic acid, 2-ethylhexyl ester,2-ethylhexylacrylate,acrylic acid 2-ethylhexyl ester,1-hexanol, 2-ethyl-, acrylate,ccris 3430,2-ethylhexylester kyseliny akrylove PubChem CID: 7636 ChEBI: CHEBI:82465 IUPAC-Name: 2-Ethylhexyl-prop-2-enoat SMILES: CCCCC(CC)COC(=O)C=C
| InChI-Schlüssel | GOXQRTZXKQZDDN-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Ethylhexyl-prop-2-enoat |
| PubChem CID | 7636 |
| CAS | 103-11-7 |
| ChEBI | CHEBI:82465 |
| MDL-Nummer | MFCD00009495 |
| Molekulargewicht (g/mol) | 184.28 |
| SMILES | CCCCC(CC)COC(=O)C=C |
| Synonym | 2-ethylhexyl acrylate,2-propenoic acid, 2-ethylhexyl ester,2-ethyl-1-hexyl acrylate,2-ethylhexyl 2-propenoate,acrylic acid, 2-ethylhexyl ester,2-ethylhexylacrylate,acrylic acid 2-ethylhexyl ester,1-hexanol, 2-ethyl-, acrylate,ccris 3430,2-ethylhexylester kyseliny akrylove |
| Summenformel | C11H20O2 |
2-Methoxyethylacrylat, 98 %, stab. mit ca.50-100ppm 4-Methoxyphenol, Thermo Scientific Chemicals
CAS: 3121-61-7 Summenformel: C6H10O3 Molekulargewicht (g/mol): 130.14 MDL-Nummer: MFCD00048149,MFCD00803685 InChI-Schlüssel: HFCUBKYHMMPGBY-UHFFFAOYSA-N Synonym: 2-methoxyethyl acrylate,methoxyethyl acrylate,2-methoxyethoxy acrylate,2-propenoic acid, 2-methoxyethyl ester,methyl cellosolve acrylate,2-methoxyethanol, acrylate,ethylene glycol monomethyl ether acrylate,acrylic acid, 2-methoxyethyl ester,ethylene glycol methyl ether acrylate,sipomer mca PubChem CID: 18392 IUPAC-Name: 2-Methoxyethylprop-2-enoat SMILES: COCCOC(=O)C=C
| InChI-Schlüssel | HFCUBKYHMMPGBY-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Methoxyethylprop-2-enoat |
| PubChem CID | 18392 |
| CAS | 3121-61-7 |
| MDL-Nummer | MFCD00048149,MFCD00803685 |
| Molekulargewicht (g/mol) | 130.14 |
| SMILES | COCCOC(=O)C=C |
| Synonym | 2-methoxyethyl acrylate,methoxyethyl acrylate,2-methoxyethoxy acrylate,2-propenoic acid, 2-methoxyethyl ester,methyl cellosolve acrylate,2-methoxyethanol, acrylate,ethylene glycol monomethyl ether acrylate,acrylic acid, 2-methoxyethyl ester,ethylene glycol methyl ether acrylate,sipomer mca |
| Summenformel | C6H10O3 |
4-Hydroxybutylacrylat, 95 %, stab. mit ca. 500 ppm 4-Methoxyphenol, Thermo Scientific Chemicals
CAS: 2478-10-6 MDL-Nummer: MFCD00010261
| CAS | 2478-10-6 |
|---|---|
| MDL-Nummer | MFCD00010261 |
Butylacrylat, 99+%, stabilisiert, Thermo Scientific Chemicals
CAS: 141-32-2 Summenformel: C7H12O2 Molekulargewicht (g/mol): 128.17 MDL-Nummer: MFCD00009446 InChI-Schlüssel: CQEYYJKEWSMYFG-UHFFFAOYSA-N Synonym: butyl acrylate,n-butyl acrylate,acrylic acid butyl ester,n-butyl propenoate,2-propenoic acid, butyl ester,butyl 2-propenoate,butylacrylate,acrylic acid, butyl ester,acrylic acid n-butyl ester,butylester kyseliny akrylove PubChem CID: 8846 ChEBI: CHEBI:3245 IUPAC-Name: Butyl Prop-2-enoat SMILES: CCCCOC(=O)C=C
| InChI-Schlüssel | CQEYYJKEWSMYFG-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Butyl Prop-2-enoat |
| PubChem CID | 8846 |
| CAS | 141-32-2 |
| ChEBI | CHEBI:3245 |
| MDL-Nummer | MFCD00009446 |
| Molekulargewicht (g/mol) | 128.17 |
| SMILES | CCCCOC(=O)C=C |
| Synonym | butyl acrylate,n-butyl acrylate,acrylic acid butyl ester,n-butyl propenoate,2-propenoic acid, butyl ester,butyl 2-propenoate,butylacrylate,acrylic acid, butyl ester,acrylic acid n-butyl ester,butylester kyseliny akrylove |
| Summenformel | C7H12O2 |
2,2,2-Trifluorethylacrylat, 98%, stab. mit200 ppm4 -Methoxyphenol, Thermo Scientific Chemicals
CAS: 407-47-6 Summenformel: C5H5F3O2 Molekulargewicht (g/mol): 154.088 MDL-Nummer: MFCD00000444 InChI-Schlüssel: VBHXIMACZBQHPX-UHFFFAOYSA-N Synonym: 2,2,2-trifluoroethyl acrylate,2-propenoic acid, 2,2,2-trifluoroethyl ester,2-propenoic acid, trifluoroethyl ester,2,2,2-trifluoroethylacrylate,acrylic acid, 2,2,2-trifluoroethyl ester,acrylic acid 2,2,2-trifluoroethyl ester,tfol-a,acmc-20aokw,trifluoroethyl acrylate,pubchem12647 PubChem CID: 67889 IUPAC-Name: 2,2,2-Trifluorethylprop-2-enoat SMILES: C=CC(=O)OCC(F)(F)F
| InChI-Schlüssel | VBHXIMACZBQHPX-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2,2,2-Trifluorethylprop-2-enoat |
| PubChem CID | 67889 |
| CAS | 407-47-6 |
| MDL-Nummer | MFCD00000444 |
| Molekulargewicht (g/mol) | 154.088 |
| SMILES | C=CC(=O)OCC(F)(F)F |
| Synonym | 2,2,2-trifluoroethyl acrylate,2-propenoic acid, 2,2,2-trifluoroethyl ester,2-propenoic acid, trifluoroethyl ester,2,2,2-trifluoroethylacrylate,acrylic acid, 2,2,2-trifluoroethyl ester,acrylic acid 2,2,2-trifluoroethyl ester,tfol-a,acmc-20aokw,trifluoroethyl acrylate,pubchem12647 |
| Summenformel | C5H5F3O2 |
2,2,3,3,3-Pentafluorpropylacrylat, 97 %, Thermo Scientific Chemicals
CAS: 356-86-5 Summenformel: C6H5F5O2 Molekulargewicht (g/mol): 204.10 MDL-Nummer: MFCD00039257 InChI-Schlüssel: JDVGNKIUXZQTFD-UHFFFAOYSA-N Synonym: 2,2,3,3,3-pentafluoropropyl acrylate,1h,1h-pentafluoropropyl acrylate,2-propenoic acid, 2,2,3,3,3-pentafluoropropyl ester,acmc-20aokp,acrylic acid=2,2,3,3,3-pentafluoropropyl ester,acrylic acid 2,2,3,3,3-pentafluoropropyl ester,2-propenoic acid,2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl acrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl acrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor PubChem CID: 67744 IUPAC-Name: 2,2,3,3,3-Pentafluorpropyl-prop-2-enoat SMILES: FC(F)(F)C(F)(F)COC(=O)C=C
| InChI-Schlüssel | JDVGNKIUXZQTFD-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2,2,3,3,3-Pentafluorpropyl-prop-2-enoat |
| PubChem CID | 67744 |
| CAS | 356-86-5 |
| MDL-Nummer | MFCD00039257 |
| Molekulargewicht (g/mol) | 204.10 |
| SMILES | FC(F)(F)C(F)(F)COC(=O)C=C |
| Synonym | 2,2,3,3,3-pentafluoropropyl acrylate,1h,1h-pentafluoropropyl acrylate,2-propenoic acid, 2,2,3,3,3-pentafluoropropyl ester,acmc-20aokp,acrylic acid=2,2,3,3,3-pentafluoropropyl ester,acrylic acid 2,2,3,3,3-pentafluoropropyl ester,2-propenoic acid,2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl acrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl acrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor |
| Summenformel | C6H5F5O2 |
Isobutylacrylat, 99 %, stab mit 100 ppm4-Methoxyphenol, Thermo Scientific Chemicals
CAS: 106-63-8 Summenformel: C7H12O2 Molekulargewicht (g/mol): 128.17 MDL-Nummer: MFCD00042865 InChI-Schlüssel: CFVWNXQPGQOHRJ-UHFFFAOYSA-N Synonym: isobutyl acrylate,isobutyl propenoate,isobutyl 2-propenoate,2-propenoic acid, 2-methylpropyl ester,acrylic acid, isobutyl ester,2-methylpropyl acrylate,isobutylester kyseliny akrylove,propenoic acid, isobutyl ester,ccris 4828,hsdb 610 PubChem CID: 7819 IUPAC-Name: 2-Methylpropyl-prop-2-enoat SMILES: CC(C)COC(=O)C=C
| InChI-Schlüssel | CFVWNXQPGQOHRJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-Methylpropyl-prop-2-enoat |
| PubChem CID | 7819 |
| CAS | 106-63-8 |
| MDL-Nummer | MFCD00042865 |
| Molekulargewicht (g/mol) | 128.17 |
| SMILES | CC(C)COC(=O)C=C |
| Synonym | isobutyl acrylate,isobutyl propenoate,isobutyl 2-propenoate,2-propenoic acid, 2-methylpropyl ester,acrylic acid, isobutyl ester,2-methylpropyl acrylate,isobutylester kyseliny akrylove,propenoic acid, isobutyl ester,ccris 4828,hsdb 610 |
| Summenformel | C7H12O2 |
Ethylacrylat, 99 %, stab. mit ca. 20 ppm 4-Methoxyphenol, Thermo Scientific Chemicals
CAS: 140-88-5 Summenformel: C5H8O2 Molekulargewicht (g/mol): 100.12 MDL-Nummer: MFCD00009188 InChI-Schlüssel: JIGUQPWFLRLWPJ-UHFFFAOYSA-N Synonym: ethyl acrylate,acrylic acid ethyl ester,ethyl propenoate,2-propenoic acid, ethyl ester,ethyl 2-propenoate,ethylacrylaat,ethylakrylat,etil acrilato,acrylic acid, ethyl ester,aethylacrylat PubChem CID: 8821 ChEBI: CHEBI:82327 IUPAC-Name: Butyl-2-propenoat SMILES: CCOC(=O)C=C
| InChI-Schlüssel | JIGUQPWFLRLWPJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Butyl-2-propenoat |
| PubChem CID | 8821 |
| CAS | 140-88-5 |
| ChEBI | CHEBI:82327 |
| MDL-Nummer | MFCD00009188 |
| Molekulargewicht (g/mol) | 100.12 |
| SMILES | CCOC(=O)C=C |
| Synonym | ethyl acrylate,acrylic acid ethyl ester,ethyl propenoate,2-propenoic acid, ethyl ester,ethyl 2-propenoate,ethylacrylaat,ethylakrylat,etil acrilato,acrylic acid, ethyl ester,aethylacrylat |
| Summenformel | C5H8O2 |
tert-Butylacrylat, 99 %, stabilisiert, Thermo Scientific Chemicals
CAS: 1663-39-4 Summenformel: C7H12O2 Molekulargewicht (g/mol): 128.17 MDL-Nummer: MFCD00008809 InChI-Schlüssel: ISXSCDLOGDJUNJ-UHFFFAOYSA-N Synonym: tert-butyl acrylate,t-butyl acrylate,tert-butyl propenoate,2-propenoic acid, 1,1-dimethylethyl ester,acrylic acid tert-butyl ester,tert-butylacrylate,acrylic acid, tert-butyl ester,unii-92m2cd1o3g,ccris 7035,2-propenoic acid tert-butyl ester PubChem CID: 15458 IUPAC-Name: tert-Butyl-prop-2-enoat SMILES: CC(C)(C)OC(=O)C=C
| InChI-Schlüssel | ISXSCDLOGDJUNJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | tert-Butyl-prop-2-enoat |
| PubChem CID | 15458 |
| CAS | 1663-39-4 |
| MDL-Nummer | MFCD00008809 |
| Molekulargewicht (g/mol) | 128.17 |
| SMILES | CC(C)(C)OC(=O)C=C |
| Synonym | tert-butyl acrylate,t-butyl acrylate,tert-butyl propenoate,2-propenoic acid, 1,1-dimethylethyl ester,acrylic acid tert-butyl ester,tert-butylacrylate,acrylic acid, tert-butyl ester,unii-92m2cd1o3g,ccris 7035,2-propenoic acid tert-butyl ester |
| Summenformel | C7H12O2 |
N-Butylacrylat,98 + %, stab. Mit bis zu50 ppm4 -Methoxyphenol, Thermo Scientific Chemicals
CAS: 141-32-2 Summenformel: C7H12O2 Molekulargewicht (g/mol): 128.171 MDL-Nummer: MFCD00009446 InChI-Schlüssel: CQEYYJKEWSMYFG-UHFFFAOYSA-N Synonym: butyl acrylate,n-butyl acrylate,acrylic acid butyl ester,n-butyl propenoate,2-propenoic acid, butyl ester,butyl 2-propenoate,butylacrylate,acrylic acid, butyl ester,acrylic acid n-butyl ester,butylester kyseliny akrylove PubChem CID: 8846 ChEBI: CHEBI:3245 IUPAC-Name: Butyl Prop-2-enoat SMILES: CCCCOC(=O)C=C
| InChI-Schlüssel | CQEYYJKEWSMYFG-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Butyl Prop-2-enoat |
| PubChem CID | 8846 |
| CAS | 141-32-2 |
| ChEBI | CHEBI:3245 |
| MDL-Nummer | MFCD00009446 |
| Molekulargewicht (g/mol) | 128.171 |
| SMILES | CCCCOC(=O)C=C |
| Synonym | butyl acrylate,n-butyl acrylate,acrylic acid butyl ester,n-butyl propenoate,2-propenoic acid, butyl ester,butyl 2-propenoate,butylacrylate,acrylic acid, butyl ester,acrylic acid n-butyl ester,butylester kyseliny akrylove |
| Summenformel | C7H12O2 |