Salze und anorganische Verbindungen
Eine Vielzahl von anorganischen Salzen und Elementarmetallen, die für großangelegte, industrielle und alltägliche Laboranwendungen verwendet werden können. Die Produkte sind in vielfältigen chemischen Zusammensetzungen, Mengen, Reinheiten und Reagenzgütegraden erhältlich.
Anorganika sind Elemente und Verbindungen, darunter Kohlenmonoxid, Kohlendioxid, Karbonate, Cyanide, Cyanate und Carbide, die keine Kohlenstoff-Wasserstoff-Bindung enthalten.. Zu dieser Gruppe gehören auch Kohlenstoffallotrope wie Graphit und Graphen.
Da zu den organische Verbindungen nur jene zählen, die Kohlenstoffatome enthalten, die an Wasserstoffatome gebunden sind, sind die meisten chemischen Elemente im Periodensystem der Elemente und die meisten Substanzen der materiellen Welt als anorganische Substanzen zu betrachten.
Gefilterte Suchergebnisse
Siliciumcarbidpulver, grob, 46er Körnung, Thermo Scientific Chemicals
CAS: 409-21-2 Summenformel: CSi Molekulargewicht (g/mol): 40.10 MDL-Nummer: MFCD00049531 InChI-Schlüssel: HBMJWWWQQXIZIP-UHFFFAOYSA-N Synonym: silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide PubChem CID: 9863 ChEBI: CHEBI:29390 SMILES: [C-]#[Si+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | HBMJWWWQQXIZIP-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 9863 |
| CAS | 409-21-2 |
| ChEBI | CHEBI:29390 |
| MDL-Nummer | MFCD00049531 |
| Molekulargewicht (g/mol) | 40.10 |
| SMILES | [C-]#[Si+] |
| Synonym | silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide |
| Summenformel | CSi |
Siliziumcarbidpulver, mittel, 120er Körnung, Thermo Scientific Chemicals
CAS: 409-21-2 Summenformel: CSi Molekulargewicht (g/mol): 40.10 MDL-Nummer: MFCD00049531 InChI-Schlüssel: HBMJWWWQQXIZIP-UHFFFAOYSA-N Synonym: silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide PubChem CID: 9863 ChEBI: CHEBI:29390 SMILES: [C-]#[Si+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | HBMJWWWQQXIZIP-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 9863 |
| CAS | 409-21-2 |
| ChEBI | CHEBI:29390 |
| MDL-Nummer | MFCD00049531 |
| Molekulargewicht (g/mol) | 40.10 |
| SMILES | [C-]#[Si+] |
| Synonym | silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide |
| Summenformel | CSi |
Silizium(IV)-oxid, 99.8 % (Metallbasis), Thermo Scientific Chemicals
CAS: 7631-86-9 Summenformel: O2Si Molekulargewicht (g/mol): 60.08 MDL-Nummer: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI-Schlüssel: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 SMILES: O=[Si]=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 24261 |
| CAS | 7631-86-9 |
| ChEBI | CHEBI:30563 |
| MDL-Nummer | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| Molekulargewicht (g/mol) | 60.08 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| Summenformel | O2Si |
Silizium(IV)-oxid, 99.995 % (Metallbasis), Thermo Scientific Chemicals
CAS: 7631-86-9 Summenformel: O2Si Molekulargewicht (g/mol): 60.08 MDL-Nummer: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI-Schlüssel: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC-Name: Silandion SMILES: O=[Si]=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Silandion |
| PubChem CID | 24261 |
| CAS | 7631-86-9 |
| ChEBI | CHEBI:30563 |
| MDL-Nummer | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| Molekulargewicht (g/mol) | 60.08 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| Summenformel | O2Si |
Silikonöl, für Schmelz- und Siedepunktbestimmungs-Apparate, Thermo Scientific Chemicals
CAS: 63148-62-9 Summenformel: (C2H6OSi)n Molekulargewicht (g/mol): NaN MDL-Nummer: MFCD00132673 Synonym: Poly(dimethylsiloxane) IUPAC-Name: Polydimethylsiloxane SMILES: C[Si](C)(-*)O-*
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| IUPAC-Name | Polydimethylsiloxane |
|---|---|
| CAS | 63148-62-9 |
| MDL-Nummer | MFCD00132673 |
| Molekulargewicht (g/mol) | NaN |
| SMILES | C[Si](C)(-*)O-* |
| Synonym | Poly(dimethylsiloxane) |
| Summenformel | (C2H6OSi)n |
Silizium(IV)-oxid, Pulver, 1.5 Mikrometer, 99.9 %, Thermo Scientific Chemicals
CAS: 7631-86-9 Summenformel: O2Si Molekulargewicht (g/mol): 60.08 MDL-Nummer: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI-Schlüssel: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC-Name: Dioxosilan SMILES: O=[Si]=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Dioxosilan |
| PubChem CID | 24261 |
| CAS | 7631-86-9 |
| ChEBI | CHEBI:30563 |
| MDL-Nummer | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| Molekulargewicht (g/mol) | 60.08 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| Summenformel | O2Si |
Silikonöl, hohe Temperatur, nutzbarer Temperaturbereich: 25 bis 250 °C (offenes System) und 25 bis 315 °C (geschlossenes System), Thermo Scientific Chemicals
CAS: 68083-14-7 Summenformel: C16H22O2Si2 Molekulargewicht (g/mol): 302.52 MDL-Nummer: MFCD00132673 InChI-Schlüssel: ARWRSWALIGRKQA-UHFFFAOYSA-N Synonym: diphenyl-dimethylsiloxane copolymer,polydimethyl-diphenylsiloxane, viscosity 400cst. PubChem CID: 121233058 IUPAC-Name: Methoxy-dimethyl-[methyl(diphenyl)silyl]oxysilan SMILES: CO[Si](C)(C)O[Si](C)(C1=CC=CC=C1)C2=CC=CC=C2
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ARWRSWALIGRKQA-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Methoxy-dimethyl-[methyl(diphenyl)silyl]oxysilan |
| PubChem CID | 121233058 |
| CAS | 68083-14-7 |
| MDL-Nummer | MFCD00132673 |
| Molekulargewicht (g/mol) | 302.52 |
| SMILES | CO[Si](C)(C)O[Si](C)(C1=CC=CC=C1)C2=CC=CC=C2 |
| Synonym | diphenyl-dimethylsiloxane copolymer,polydimethyl-diphenylsiloxane, viscosity 400cst. |
| Summenformel | C16H22O2Si2 |
Sand, rein, 40 bis 100 mesh, Thermo Scientific Chemicals
CAS: 14808-60-7 Summenformel: O2Si Molekulargewicht (g/mol): 60.08 MDL-Nummer: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI-Schlüssel: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 SMILES: O=[Si]=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 24261 |
| CAS | 14808-60-7 |
| ChEBI | CHEBI:30563 |
| MDL-Nummer | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| Molekulargewicht (g/mol) | 60.08 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| Summenformel | O2Si |
(3-Glycidoxypropyl)trimethoxysilan, 97 %, Thermo Scientific Chemicals
CAS: 2530-83-8 Summenformel: C9H20O5Si Molekulargewicht (g/mol): 236.339 MDL-Nummer: MFCD00005144 InChI-Schlüssel: BPSIOYPQMFLKFR-UHFFFAOYSA-N Synonym: 3-glycidoxypropyltrimethoxysilane,3-glycidoxypropyl trimethoxysilane,glymo,silicone kbm 403,silane a 187,union carbide a-187,silan a 187,silane z 6040,silane-y-4087,3-glycidyloxypropyltrimethoxysilane PubChem CID: 17317 IUPAC-Name: Trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silan SMILES: CO[Si](CCCOCC1CO1)(OC)OC
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | BPSIOYPQMFLKFR-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silan |
| PubChem CID | 17317 |
| CAS | 2530-83-8 |
| MDL-Nummer | MFCD00005144 |
| Molekulargewicht (g/mol) | 236.339 |
| SMILES | CO[Si](CCCOCC1CO1)(OC)OC |
| Synonym | 3-glycidoxypropyltrimethoxysilane,3-glycidoxypropyl trimethoxysilane,glymo,silicone kbm 403,silane a 187,union carbide a-187,silan a 187,silane z 6040,silane-y-4087,3-glycidyloxypropyltrimethoxysilane |
| Summenformel | C9H20O5Si |
Sand, gewaschen, Thermo Scientific Chemicals
CAS: 14808-60-7 Summenformel: O2Si Molekulargewicht (g/mol): 60.08 MDL-Nummer: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI-Schlüssel: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC-Name: Dioxosilan SMILES: O=[Si]=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Dioxosilan |
| PubChem CID | 24261 |
| CAS | 14808-60-7 |
| ChEBI | CHEBI:30563 |
| MDL-Nummer | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| Molekulargewicht (g/mol) | 60.08 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| Summenformel | O2Si |
Silicium(IV)-acetat, Thermo Scientific Chemicals
CAS: 562-90-3 Summenformel: C8H12O8Si Molekulargewicht (g/mol): 264.26 MDL-Nummer: MFCD00026184 InChI-Schlüssel: YZVRVDPMGYFCGL-UHFFFAOYSA-N Synonym: silicon tetraacetate,tetraacetoxysilane,tetraacetyl orthosilicate,unii-vz7lp47epp,vz7lp47epp,silicon iv acetate, anhydrous,acetic acid, 1,1',1,1'-tetraanhydride with silicic acid h4sio4,triacetoxysilyl acetate,silanetetrol, tetraacetate PubChem CID: 68419 IUPAC-Name: Triacetyloxysilylacetat SMILES: CC(=O)O[Si](OC(C)=O)(OC(C)=O)OC(C)=O
| InChI-Schlüssel | YZVRVDPMGYFCGL-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Triacetyloxysilylacetat |
| PubChem CID | 68419 |
| CAS | 562-90-3 |
| MDL-Nummer | MFCD00026184 |
| Molekulargewicht (g/mol) | 264.26 |
| SMILES | CC(=O)O[Si](OC(C)=O)(OC(C)=O)OC(C)=O |
| Synonym | silicon tetraacetate,tetraacetoxysilane,tetraacetyl orthosilicate,unii-vz7lp47epp,vz7lp47epp,silicon iv acetate, anhydrous,acetic acid, 1,1',1,1'-tetraanhydride with silicic acid h4sio4,triacetoxysilyl acetate,silanetetrol, tetraacetate |
| Summenformel | C8H12O8Si |
Silizium(IV)-bromid, Thermo Scientific Chemicals
CAS: 7789-66-4 Summenformel: Br4Si Molekulargewicht (g/mol): 347.701 MDL-Nummer: MFCD00049530 InChI-Schlüssel: AIFMYMZGQVTROK-UHFFFAOYSA-N Synonym: silicon iv bromide,silicon tetrabromide,silane, tetrabromo,sibr4,unii-8gac9ywl42,8gac9ywl42,silicon bromide,acmc-20ajqj PubChem CID: 82247 IUPAC-Name: Tetrabromsilan SMILES: [Si](Br)(Br)(Br)Br
| InChI-Schlüssel | AIFMYMZGQVTROK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Tetrabromsilan |
| PubChem CID | 82247 |
| CAS | 7789-66-4 |
| MDL-Nummer | MFCD00049530 |
| Molekulargewicht (g/mol) | 347.701 |
| SMILES | [Si](Br)(Br)(Br)Br |
| Synonym | silicon iv bromide,silicon tetrabromide,silane, tetrabromo,sibr4,unii-8gac9ywl42,8gac9ywl42,silicon bromide,acmc-20ajqj |
| Summenformel | Br4Si |
Siliciumcarbidpulver, fein, 320er Körnung, Thermo Scientific Chemicals
CAS: 409-21-2 Summenformel: CSi Molekulargewicht (g/mol): 40.10 MDL-Nummer: MFCD00049531 InChI-Schlüssel: HBMJWWWQQXIZIP-UHFFFAOYSA-N Synonym: silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide PubChem CID: 9863 ChEBI: CHEBI:29390 IUPAC-Name: methanidylidynesilylium SMILES: [C-]#[Si+]
| InChI-Schlüssel | HBMJWWWQQXIZIP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | methanidylidynesilylium |
| PubChem CID | 9863 |
| CAS | 409-21-2 |
| ChEBI | CHEBI:29390 |
| MDL-Nummer | MFCD00049531 |
| Molekulargewicht (g/mol) | 40.10 |
| SMILES | [C-]#[Si+] |
| Synonym | silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide |
| Summenformel | CSi |
Siliziumoxid, Katalysatorträger, Thermo Scientific Chemicals
CAS: 7631-86-9 Summenformel: O2Si Molekulargewicht (g/mol): 60.08 MDL-Nummer: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI-Schlüssel: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC-Name: Dioxosilan SMILES: O=[Si]=O
| InChI-Schlüssel | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Dioxosilan |
| PubChem CID | 24261 |
| CAS | 7631-86-9 |
| ChEBI | CHEBI:30563 |
| MDL-Nummer | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| Molekulargewicht (g/mol) | 60.08 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| Summenformel | O2Si |
Silizium(IV)-oxid, 99.5 %, Thermo Scientific Chemicals
CAS: 14808-60-7 Summenformel: O2Si Molekulargewicht (g/mol): 60.08 MDL-Nummer: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI-Schlüssel: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 SMILES: O=[Si]=O
| InChI-Schlüssel | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 24261 |
| CAS | 14808-60-7 |
| ChEBI | CHEBI:30563 |
| MDL-Nummer | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| Molekulargewicht (g/mol) | 60.08 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| Summenformel | O2Si |