Metallorganische Verbindungen
Gefilterte Suchergebnisse
Zincon-Mononatriumsalz, Thermo Scientific Chemicals
CAS: 62625-22-3 Summenformel: C20H16N4NaO6S Molekulargewicht (g/mol): 463.42 MDL-Nummer: MFCD00064385 InChI-Schlüssel: IABRINWJUBAIIE-JJECXDOKSA-N PubChem CID: 131856391 IUPAC-Name: 2-[2-[(Z)-N-[(Z)-(6-Oxo-3-sulfocyclohexa-2,4-dien-1-yliden)amino]-C-phenylcarbonimidoyl]hydrazinyl]benzoesäure; Natrium SMILES: C1=CC=C(C=C1)C(=NN=C2C=C(C=CC2=O)S(=O)(=O)O)NNC3=CC=CC=C3C(=O)O.[Na]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | IABRINWJUBAIIE-JJECXDOKSA-N |
|---|---|
| IUPAC-Name | 2-[2-[(Z)-N-[(Z)-(6-Oxo-3-sulfocyclohexa-2,4-dien-1-yliden)amino]-C-phenylcarbonimidoyl]hydrazinyl]benzoesäure; Natrium |
| PubChem CID | 131856391 |
| CAS | 62625-22-3 |
| MDL-Nummer | MFCD00064385 |
| Molekulargewicht (g/mol) | 463.42 |
| SMILES | C1=CC=C(C=C1)C(=NN=C2C=C(C=CC2=O)S(=O)(=O)O)NNC3=CC=CC=C3C(=O)O.[Na] |
| Summenformel | C20H16N4NaO6S |
Chlorophyllin, gekupfertes Trisodiumsalz, Thermo Scientific Chemicals
CAS: 11006-34-1 Summenformel: C34H31CuN4Na3O6 MDL-Nummer: MFCD00012149
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| CAS | 11006-34-1 |
|---|---|
| MDL-Nummer | MFCD00012149 |
| Summenformel | C34H31CuN4Na3O6 |
Chlorotrimethylsilan, 98 %, Thermo Scientific Chemicals
CAS: 75-77-4 Summenformel: C3H9ClSi Molekulargewicht (g/mol): 108.64 MDL-Nummer: MFCD00000502 InChI-Schlüssel: IJOOHPMOJXWVHK-UHFFFAOYSA-N Synonym: trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl PubChem CID: 6397 ChEBI: CHEBI:85069 IUPAC-Name: Chlor(trimethyl)silan SMILES: C[Si](C)(C)Cl
| InChI-Schlüssel | IJOOHPMOJXWVHK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Chlor(trimethyl)silan |
| PubChem CID | 6397 |
| CAS | 75-77-4 |
| ChEBI | CHEBI:85069 |
| MDL-Nummer | MFCD00000502 |
| Molekulargewicht (g/mol) | 108.64 |
| SMILES | C[Si](C)(C)Cl |
| Synonym | trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl |
| Summenformel | C3H9ClSi |
Diisobutylaluminiumhydrid, 1M Lösung in Cyclohexan, AcroSeal™, Thermo Scientific Chemicals
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Chemischer Name oder Material | Diisobutylaluminium hydride |
|---|---|
| Dichte | 0.7010g/mL |
| EINECS-Nummer | 214-729-9 |
| Relative Dichte | 0.701 |
| Molekulargewicht (g/mol) | 142.22 |
| Merck Index | 15, 3212 |
| Namenshinweis | 1M Solution in Hexane |
| Formelmasse | 142.22 |
| Gesundheitsgefahr 2 | GHS H Statement May be fatal if swallowed and enters airways. Toxic to aquatic life with long lasting effects. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. May cause damage to organs through p |
| Gesundheitsgefahr 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective g |
| Löslichkeitsinformationen | Solubility in water: reacts |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Physikalische Form | Lösung |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 110-54-3 |
| MDL-Nummer | MFCD00008928 |
| Strukturformel | [(CH3)2CHCH2]2AlH |
| Flammpunkt | −23°C |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Summenformel | C8H19Al |
| Schmelzpunkt | -70.0°C |
3-Aminopropyltriethoxysilan, 99 %, AcroSeal™, Thermo Scientific Chemicals
CAS: 919-30-2 Summenformel: C9H23NO3Si Molekulargewicht (g/mol): 221.37 MDL-Nummer: MFCD00008207,MFCD01324904 InChI-Schlüssel: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-Aminopropyltriethoxysilan,3-(Triethoxysilyl)propan-1-amin,1-Propanamin, 3-Triethoxysilyl,Silikon A-1100,Silan 1100,3-3-(Triethoxysilyl)propylamin,Propylamin, 3-Triethoxysilyl,Triethoxy-3-aminopropylsilan,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC-Name: 3-Triethoxysilylpropan-1-amin SMILES: CCO[Si](CCCN)(OCC)OCC
| InChI-Schlüssel | WYTZZXDRDKSJID-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Triethoxysilylpropan-1-amin |
| PubChem CID | 13521 |
| CAS | 919-30-2 |
| MDL-Nummer | MFCD00008207,MFCD01324904 |
| Molekulargewicht (g/mol) | 221.37 |
| SMILES | CCO[Si](CCCN)(OCC)OCC |
| Synonym | 3-Aminopropyltriethoxysilan,3-(Triethoxysilyl)propan-1-amin,1-Propanamin, 3-Triethoxysilyl,Silikon A-1100,Silan 1100,3-3-(Triethoxysilyl)propylamin,Propylamin, 3-Triethoxysilyl,Triethoxy-3-aminopropylsilan,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
| Summenformel | C9H23NO3Si |
3-(Trimethoxysilyl)propylmethacrylat, 98 %, Thermo Scientific Chemicals
CAS: 2530-85-0 Summenformel: C10H20O5Si Molekulargewicht (g/mol): 248.35 MDL-Nummer: MFCD00008593 InChI-Schlüssel: XDLMVUHYZWKMMD-UHFFFAOYSA-N Synonym: 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester PubChem CID: 17318 IUPAC-Name: 3-Trimethoxysilylpropyl-2-methylprop-2-enoat SMILES: CC(=C)C(=O)OCCC[Si](OC)(OC)OC
| InChI-Schlüssel | XDLMVUHYZWKMMD-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Trimethoxysilylpropyl-2-methylprop-2-enoat |
| PubChem CID | 17318 |
| CAS | 2530-85-0 |
| MDL-Nummer | MFCD00008593 |
| Molekulargewicht (g/mol) | 248.35 |
| SMILES | CC(=C)C(=O)OCCC[Si](OC)(OC)OC |
| Synonym | 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester |
| Summenformel | C10H20O5Si |
Tetraethylorthosilicat, 98 %, Thermo Scientific Chemicals
CAS: 78-10-4 Summenformel: C8H20O4Si Molekulargewicht (g/mol): 208.33 MDL-Nummer: MFCD00009062 InChI-Schlüssel: BOTDANWDWHJENH-UHFFFAOYSA-N Synonym: tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate PubChem CID: 6517 IUPAC-Name: Tetraethylsilikat SMILES: CCO[Si](OCC)(OCC)OCC
| InChI-Schlüssel | BOTDANWDWHJENH-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Tetraethylsilikat |
| PubChem CID | 6517 |
| CAS | 78-10-4 |
| MDL-Nummer | MFCD00009062 |
| Molekulargewicht (g/mol) | 208.33 |
| SMILES | CCO[Si](OCC)(OCC)OCC |
| Synonym | tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate |
| Summenformel | C8H20O4Si |
Bis[3-(Trietoxysilyl)propyl]tetrasulfid, S 22.3 % (typisch), Thermo Scientific Chemicals
CAS: 40372-72-3 Summenformel: C18H42O6S4Si2 Molekulargewicht (g/mol): 538.94 MDL-Nummer: MFCD00053751 InChI-Schlüssel: VTHOKNTVYKTUPI-UHFFFAOYSA-N Synonym: bis 3-triethoxysilyl propyl tetrasulfide,4,4,15,15-tetraethoxy-3,16-dioxa-8,9,10,11-tetrathia-4,15-disilaoctadecane,unii-j98v193zry,bis 3-triethoxysilyl propyl tetrasulphide,3,16-dioxa-8,9,10,11-tetrathia-4,15-disilaoctadecane, 4,4,15,15-tetraethoxy,silane coupler kh-858,acmc-1akw5,dsstox_cid_9362 PubChem CID: 162012 IUPAC-Name: Triethoxy-[3-(3-triethoxysilylpropyltetrasulfanyl)propyl]silan SMILES: CCO[Si](CCCSSSSCCC[Si](OCC)(OCC)OCC)(OCC)OCC
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | VTHOKNTVYKTUPI-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Triethoxy-[3-(3-triethoxysilylpropyltetrasulfanyl)propyl]silan |
| PubChem CID | 162012 |
| CAS | 40372-72-3 |
| MDL-Nummer | MFCD00053751 |
| Molekulargewicht (g/mol) | 538.94 |
| SMILES | CCO[Si](CCCSSSSCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| Synonym | bis 3-triethoxysilyl propyl tetrasulfide,4,4,15,15-tetraethoxy-3,16-dioxa-8,9,10,11-tetrathia-4,15-disilaoctadecane,unii-j98v193zry,bis 3-triethoxysilyl propyl tetrasulphide,3,16-dioxa-8,9,10,11-tetrathia-4,15-disilaoctadecane, 4,4,15,15-tetraethoxy,silane coupler kh-858,acmc-1akw5,dsstox_cid_9362 |
| Summenformel | C18H42O6S4Si2 |
3-Glycidoxypropyltrimethoxysilan, 97%
CAS: 2530-83-8 Summenformel: C9H20O5Si Molekulargewicht (g/mol): 236.34 InChI-Schlüssel: BPSIOYPQMFLKFR-UHFFFAOYSA-N Synonym: 3-glycidoxypropyltrimethoxysilane,3-glycidoxypropyl trimethoxysilane,glymo,silicone kbm 403,silane a 187,union carbide a-187,silan a 187,silane z 6040,silane-y-4087,3-glycidyloxypropyltrimethoxysilane PubChem CID: 17317 IUPAC-Name: Trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silan SMILES: CO[Si](CCCOCC1CO1)(OC)OC
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | BPSIOYPQMFLKFR-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silan |
| PubChem CID | 17317 |
| CAS | 2530-83-8 |
| Molekulargewicht (g/mol) | 236.34 |
| SMILES | CO[Si](CCCOCC1CO1)(OC)OC |
| Synonym | 3-glycidoxypropyltrimethoxysilane,3-glycidoxypropyl trimethoxysilane,glymo,silicone kbm 403,silane a 187,union carbide a-187,silan a 187,silane z 6040,silane-y-4087,3-glycidyloxypropyltrimethoxysilane |
| Summenformel | C9H20O5Si |
Kupfer(II)-Acetylacetonat, 98 %, Thermo Scientific Chemicals
CAS: 13395-16-9 Summenformel: C10H14CuO4 Molekulargewicht (g/mol): 261.76 MDL-Nummer: MFCD00000016 InChI-Schlüssel: QYJPSWYYEKYVEJ-FDGPNNRMSA-L Synonym: 2, 4-Pentanedione, metal derivative,Cupric acetylacetonate IUPAC-Name: copper(2+) bis((2Z)-4-oxopent-2-en-2-olate) SMILES: [Cu++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | QYJPSWYYEKYVEJ-FDGPNNRMSA-L |
|---|---|
| IUPAC-Name | copper(2+) bis((2Z)-4-oxopent-2-en-2-olate) |
| CAS | 13395-16-9 |
| MDL-Nummer | MFCD00000016 |
| Molekulargewicht (g/mol) | 261.76 |
| SMILES | [Cu++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | 2, 4-Pentanedione, metal derivative,Cupric acetylacetonate |
| Summenformel | C10H14CuO4 |
N-[3-(Trimethoxysilyl)propyl]ethylendiamin, 97 %, Thermo Scientific Chemicals
CAS: 1760-24-3 Summenformel: C8H22N2O3Si Molekulargewicht (g/mol): 222.36 MDL-Nummer: MFCD00008173 InChI-Schlüssel: PHQOGHDTIVQXHL-UHFFFAOYSA-N Synonym: n-3-trimethoxysilyl propyl ethylenediamine,n-2-aminoethyl-3-aminopropyltrimethoxysilane,3-2-aminoethylamino propyltrimethoxysilane,en-aptas,silicone a-1120,prosil 3128,aas-m,n1-3-trimethoxysilyl propyl ethane-1,2-diamine,unii-28zcs5ga8g,3-2-aminoethyl aminopropyl trimethoxysilane PubChem CID: 15659 IUPAC-Name: N'-(3-Trimethoxysilylpropyl)ethan-1,2-diamin SMILES: CO[Si](CCCNCCN)(OC)OC
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | PHQOGHDTIVQXHL-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | N'-(3-Trimethoxysilylpropyl)ethan-1,2-diamin |
| PubChem CID | 15659 |
| CAS | 1760-24-3 |
| MDL-Nummer | MFCD00008173 |
| Molekulargewicht (g/mol) | 222.36 |
| SMILES | CO[Si](CCCNCCN)(OC)OC |
| Synonym | n-3-trimethoxysilyl propyl ethylenediamine,n-2-aminoethyl-3-aminopropyltrimethoxysilane,3-2-aminoethylamino propyltrimethoxysilane,en-aptas,silicone a-1120,prosil 3128,aas-m,n1-3-trimethoxysilyl propyl ethane-1,2-diamine,unii-28zcs5ga8g,3-2-aminoethyl aminopropyl trimethoxysilane |
| Summenformel | C8H22N2O3Si |
Natriumtetraethylborat, 97 %, rein, Thermo Scientific Chemicals
CAS: 15523-24-7 Summenformel: C8H20BNa Molekulargewicht (g/mol): 150.04 MDL-Nummer: MFCD00061547 InChI-Schlüssel: SZSBMTRYJRHYNI-UHFFFAOYSA-N Synonym: sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g PubChem CID: 23681030 IUPAC-Name: Natrium; Tetraethylboranuid SMILES: [B-](CC)(CC)(CC)CC.[Na+]
| InChI-Schlüssel | SZSBMTRYJRHYNI-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Natrium; Tetraethylboranuid |
| PubChem CID | 23681030 |
| CAS | 15523-24-7 |
| MDL-Nummer | MFCD00061547 |
| Molekulargewicht (g/mol) | 150.04 |
| SMILES | [B-](CC)(CC)(CC)CC.[Na+] |
| Synonym | sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g |
| Summenformel | C8H20BNa |
| Chemischer Name oder Material | Lithium bis(trimethylsilyl)amide |
|---|---|
| InChI-Schlüssel | YNESATAKKCNGOF-UHFFFAOYSA-N |
| IUPAC-Name | Lithium; Bis(trimethylsilyl)azanid |
| Siedepunkt | 65.0°C |
| Dichte | 0.9000g/mL |
| EINECS-Nummer | 223-725-6 |
| Relative Dichte | 0.9 |
| Molekulargewicht (g/mol) | 167.33 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Formelmasse | 167.33 |
| Gesundheitsgefahr 2 | GHS-H-Hinweis Flüssigkeit und Dampf leicht entzündbar. Verursacht schwere Verätzungen der Haut und schwere Augenschäden. Kann die Atemwege reizen. Verdacht auf krebserregende Wirkung. Kann explosionsfähige Peroxide bilden. Reagiert heftig mit Wasser.<br/ |
| Gesundheitsgefahr 3 | GHS-P-Hinweis Von Hitze/Funken/offenen Flammen/heißen Oberflächen fernhalten. - Rauchen verboten. BEI BERÜHRUNG DER HAUT (oder des Haars): Alle kontaminierten Kleidungsstücke sofort ausziehen. Haut mit Wasser abwaschen [oder duschen]. Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| PubChem CID | 2733832 |
| Löslichkeitsinformationen | Solubility in water: reacts. |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| CAS | 109-99-9 |
| Strukturformel | ((CH3)3Si)2NLi |
| Flammpunkt | −21°C |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| Summenformel | C6H18LiNSi2 |
Lithium-Bis-(Trimethylsilyl)-lithiumamid, 95 %, Thermo Scientific Chemicals
CAS: 4039-32-1 Summenformel: C6H18LiNSi2 Molekulargewicht (g/mol): 167.33 MDL-Nummer: MFCD00008261 InChI-Schlüssel: YNESATAKKCNGOF-UHFFFAOYSA-N Synonym: lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide PubChem CID: 2733832 IUPAC-Name: Lithium; Bis(trimethylsilyl)azanid SMILES: [Li+].C[Si](C)(C)[N-][Si](C)(C)C
| InChI-Schlüssel | YNESATAKKCNGOF-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Lithium; Bis(trimethylsilyl)azanid |
| PubChem CID | 2733832 |
| CAS | 4039-32-1 |
| MDL-Nummer | MFCD00008261 |
| Molekulargewicht (g/mol) | 167.33 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| Summenformel | C6H18LiNSi2 |
3-Aminopropyltriethoxysilan, 99 %, Thermo Scientific Chemicals
CAS: 919-30-2 Summenformel: C9H23NO3Si Molekulargewicht (g/mol): 221.37 MDL-Nummer: MFCD00008207,MFCD01324904 InChI-Schlüssel: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC-Name: 3-Triethoxysilylpropan-1-amin SMILES: CCO[Si](CCCN)(OCC)OCC
| InChI-Schlüssel | WYTZZXDRDKSJID-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Triethoxysilylpropan-1-amin |
| PubChem CID | 13521 |
| CAS | 919-30-2 |
| MDL-Nummer | MFCD00008207,MFCD01324904 |
| Molekulargewicht (g/mol) | 221.37 |
| SMILES | CCO[Si](CCCN)(OCC)OCC |
| Synonym | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
| Summenformel | C9H23NO3Si |