Färbereagenzien
Gefilterte Suchergebnisse
Thermo Scientific™ Gram-Färbeset
Mit dem Gram-Färbekit können Sie grampositive Organismen von gramnegativen Organismen unterscheiden.
Thermo Scientific Chemicals Methylenblau, rein, zertifiziert
CAS: 7220-79-3 Summenformel: C16H24ClN3O3S Molekulargewicht (g/mol): 373.90 MDL-Nummer: MFCD00150008 InChI-Schlüssel: XQAXGZLFSSPBMK-UHFFFAOYSA-M Synonym: Basic Blue 9 PubChem CID: 6099 ChEBI: CHEBI:6872 IUPAC-Name: [7-(Dimethylamin)Phenothiazin-3-Yliden]-Dimethylazan; Chlorid SMILES: O.O.O.[Cl-].CN(C)C1=CC2=[S+]C3=CC(=CC=C3N=C2C=C1)N(C)C
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | XQAXGZLFSSPBMK-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | [7-(Dimethylamin)Phenothiazin-3-Yliden]-Dimethylazan; Chlorid |
| PubChem CID | 6099 |
| CAS | 7220-79-3 |
| ChEBI | CHEBI:6872 |
| MDL-Nummer | MFCD00150008 |
| Molekulargewicht (g/mol) | 373.90 |
| SMILES | O.O.O.[Cl-].CN(C)C1=CC2=[S+]C3=CC(=CC=C3N=C2C=C1)N(C)C |
| Synonym | Basic Blue 9 |
| Summenformel | C16H24ClN3O3S |
Thermo Scientific Chemicals Methylenblau, 1 % w/v, wässrige Lösung
CAS: 122965-43-9 | C16H18ClN3S
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| Chemischer Name oder Material | Methylene Blue |
|---|---|
| Löslichkeitsinformationen | Miscible with ethanol,chloroform,glacial acetic acid and glycerol. Slightly miscible with pyridine. Immiscible with ethyl ether,xylene,oleic acid,ethanol and acetone. |
| Physikalische Form | Flüssig |
| Concentration or Composition (by Analyte or Components) | 3, 7-Bis(dimethylamino)phenothiazin-5-Iumchlorid-Hydrat:1,0%; Wasser:99% |
| CAS | 7732-18-5 |
| Empfohlene Lagerung | Umgebungstemperaturen |
| Dampfdruck | 23 hPa (17mm Hg) at 20°C |
| MDL-Nummer | MFCD00012111 |
| Prozentgehaltsbereich | 1% w/v aqueous solution |
| TSCA | Ja |
| Summenformel | C16H18ClN3S |
| Formelmasse | 319.86 |
Thermo Scientific Chemicals Thymolblau
CAS: 76-61-9 Summenformel: C27H30O5S Molekulargewicht (g/mol): 466.592 MDL-Nummer: MFCD00005869 InChI-Schlüssel: PRZSXZWFJHEZBJ-UHFFFAOYSA-N Synonym: TB,Thymolsulfonephthalein PubChem CID: 65565 IUPAC-Name: 4-[3-(4-Hydroxy-2-methyl-5-propan-2-ylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-5-methyl-2-propan-2-ylphenol SMILES: CC1=CC(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O
| InChI-Schlüssel | PRZSXZWFJHEZBJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-[3-(4-Hydroxy-2-methyl-5-propan-2-ylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-5-methyl-2-propan-2-ylphenol |
| PubChem CID | 65565 |
| CAS | 76-61-9 |
| MDL-Nummer | MFCD00005869 |
| Molekulargewicht (g/mol) | 466.592 |
| SMILES | CC1=CC(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O |
| Synonym | TB,Thymolsulfonephthalein |
| Summenformel | C27H30O5S |
Thermo Scientific Chemicals Methylblau
CAS: 28983-56-4 Summenformel: C37H26N3Na2O9S3 Molekulargewicht (g/mol): 798.79 MDL-Nummer: MFCD00058509 InChI-Schlüssel: TUHAIJABPUJAEY-UHFFFAOYSA-K Synonym: Acid blue 93; C.I. 42780 PubChem CID: 76956083 SMILES: [Na+].[Na+].[O-]S(=O)(=O)C1=CC=CC=C1NC1=CC=C(C=C1)C(C1=CC=C(NC2=CC=CC=C2S([O-])(=O)=O)C=C1)=C1C=CC(C=C1)=NC1=CC=CC=C1S([O-])(=O)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | TUHAIJABPUJAEY-UHFFFAOYSA-K |
|---|---|
| PubChem CID | 76956083 |
| CAS | 28983-56-4 |
| MDL-Nummer | MFCD00058509 |
| Molekulargewicht (g/mol) | 798.79 |
| SMILES | [Na+].[Na+].[O-]S(=O)(=O)C1=CC=CC=C1NC1=CC=C(C=C1)C(C1=CC=C(NC2=CC=CC=C2S([O-])(=O)=O)C=C1)=C1C=CC(C=C1)=NC1=CC=CC=C1S([O-])(=O)=O |
| Synonym | Acid blue 93; C.I. 42780 |
| Summenformel | C37H26N3Na2O9S3 |
Thermo Scientific Chemicals Methylenblau-Hydrat, 96+%, hochreines biologisches Färbemittel
CAS: 122965-43-9 Summenformel: C16H18ClN3S Molekulargewicht (g/mol): 319.85 MDL-Nummer: MFCD00150006 InChI-Schlüssel: CXKWCBBOMKCUKX-UHFFFAOYSA-M Synonym: Basic Blue 9 hydrate,C.I. 52015 hydrate PubChem CID: 16211647 IUPAC-Name: [7-(Dimethylamino)Phenothiazin-3-Yliden]-Dimethylazanium; Chlorid; Trihydrat SMILES: [Cl-].CN(C)C1=CC=C2N=C3C=CC(C=C3SC2=C1)=[N+](C)C
| InChI-Schlüssel | CXKWCBBOMKCUKX-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | [7-(Dimethylamino)Phenothiazin-3-Yliden]-Dimethylazanium; Chlorid; Trihydrat |
| PubChem CID | 16211647 |
| CAS | 122965-43-9 |
| MDL-Nummer | MFCD00150006 |
| Molekulargewicht (g/mol) | 319.85 |
| SMILES | [Cl-].CN(C)C1=CC=C2N=C3C=CC(C=C3SC2=C1)=[N+](C)C |
| Synonym | Basic Blue 9 hydrate,C.I. 52015 hydrate |
| Summenformel | C16H18ClN3S |
Thermo Scientific Chemicals Kongo-Rot, Indikatorqualität
CAS: 573-58-0 Summenformel: C32H22N6Na2O6S2 Molekulargewicht (g/mol): 696.664 MDL-Nummer: MFCD00004028 InChI-Schlüssel: IQFVPQOLBLOTPF-UHFFFAOYSA-L Synonym: C.I. 22120 PubChem CID: 11313 ChEBI: CHEBI:34653 IUPAC-Name: Dinatrium;4-Amino-3-[[4-[4-[(1-Amino-4-Sulfonatonaphthalin-2-yl)Diazenyl]Phenyl]Phenyl]Diazenyl]Naphthalin-1-Sulfonat SMILES: C1=CC=C2C(=C1)C(=CC(=C2N)N=NC3=CC=C(C=C3)C4=CC=C(C=C4)N=NC5=C(C6=CC=CC=C6C(=C5)S(=O)(=O)[O-])N)S(=O)(=O)[O-].[Na+].[Na+]
| InChI-Schlüssel | IQFVPQOLBLOTPF-UHFFFAOYSA-L |
|---|---|
| IUPAC-Name | Dinatrium;4-Amino-3-[[4-[4-[(1-Amino-4-Sulfonatonaphthalin-2-yl)Diazenyl]Phenyl]Phenyl]Diazenyl]Naphthalin-1-Sulfonat |
| PubChem CID | 11313 |
| CAS | 573-58-0 |
| ChEBI | CHEBI:34653 |
| MDL-Nummer | MFCD00004028 |
| Molekulargewicht (g/mol) | 696.664 |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2N)N=NC3=CC=C(C=C3)C4=CC=C(C=C4)N=NC5=C(C6=CC=CC=C6C(=C5)S(=O)(=O)[O-])N)S(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | C.I. 22120 |
| Summenformel | C32H22N6Na2O6S2 |
Thermo Scientific Chemicals Kresylviolett Acetat
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
Thermo Scientific Chemicals Safranin O, 85 %
CAS: 477-73-6 Summenformel: C20H19ClN4 Molekulargewicht (g/mol): 350.85 MDL-Nummer: MFCD00011759 InChI-Schlüssel: QRYAEWIQIBAZOJ-UHFFFAOYSA-N Synonym: Basic Red 2,C.I. 50240,3, 7-Diamino-2, 8-dimethyl-5-phenylphenazinium chloride PubChem CID: 2723800 IUPAC-Name: 3,7-Dimethyl-10-Phenylphenazin-10-ium-2,8-Diamin; Chlorid SMILES: [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1
| InChI-Schlüssel | QRYAEWIQIBAZOJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3,7-Dimethyl-10-Phenylphenazin-10-ium-2,8-Diamin; Chlorid |
| PubChem CID | 2723800 |
| CAS | 477-73-6 |
| MDL-Nummer | MFCD00011759 |
| Molekulargewicht (g/mol) | 350.85 |
| SMILES | [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1 |
| Synonym | Basic Red 2,C.I. 50240,3, 7-Diamino-2, 8-dimethyl-5-phenylphenazinium chloride |
| Summenformel | C20H19ClN4 |
Thermo Scientific Chemicals Nilrot 99 %
CAS: 7385-67-3 Summenformel: C20H18N2O2 Molekulargewicht (g/mol): 318.38 MDL-Nummer: MFCD00011639 InChI-Schlüssel: VOFUROIFQGPCGE-UHFFFAOYSA-N Synonym: Nile blue A oxazone PubChem CID: 65182 ChEBI: CHEBI:52169 SMILES: CCN(CC)C1=CC=C2N=C3C(OC2=C1)=CC(=O)C1=CC=CC=C31
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | VOFUROIFQGPCGE-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 65182 |
| CAS | 7385-67-3 |
| ChEBI | CHEBI:52169 |
| MDL-Nummer | MFCD00011639 |
| Molekulargewicht (g/mol) | 318.38 |
| SMILES | CCN(CC)C1=CC=C2N=C3C(OC2=C1)=CC(=O)C1=CC=CC=C31 |
| Synonym | Nile blue A oxazone |
| Summenformel | C20H18N2O2 |
Methylenblau Trihydrat, Thermo Scientific Chemicals
CAS: 7220-79-3 Summenformel: C16H24ClN3O3S Molekulargewicht (g/mol): 373.90 MDL-Nummer: MFCD00150008 InChI-Schlüssel: XQAXGZLFSSPBMK-UHFFFAOYSA-M Synonym: C.I. 52015; Basic Blue 9 PubChem CID: 104827 IUPAC-Name: [7-(dimethylamino)phenothiazin-3-yliden]-dimethylazanium; Chlorid; Trihydrat SMILES: O.O.O.[Cl-].CN(C)C1=CC2=[S+]C3=CC(=CC=C3N=C2C=C1)N(C)C
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | XQAXGZLFSSPBMK-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | [7-(dimethylamino)phenothiazin-3-yliden]-dimethylazanium; Chlorid; Trihydrat |
| PubChem CID | 104827 |
| CAS | 7220-79-3 |
| MDL-Nummer | MFCD00150008 |
| Molekulargewicht (g/mol) | 373.90 |
| SMILES | O.O.O.[Cl-].CN(C)C1=CC2=[S+]C3=CC(=CC=C3N=C2C=C1)N(C)C |
| Synonym | C.I. 52015; Basic Blue 9 |
| Summenformel | C16H24ClN3O3S |
Fluorescamin, rein, Thermo Scientific Chemicals
CAS: 38183-12-9 Summenformel: C17H10O4 Molekulargewicht (g/mol): 278.26 MDL-Nummer: MFCD00005928 InChI-Schlüssel: ZFKJVJIDPQDDFY-UHFFFAOYNA-N PubChem CID: 37927 IUPAC-Name: 4'-phenylspiro[2-benzofuran-3,2'-furan]-1,3'-dion SMILES: O=C1OC2(OC=C(C2=O)C2=CC=CC=C2)C2=CC=CC=C12
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ZFKJVJIDPQDDFY-UHFFFAOYNA-N |
|---|---|
| IUPAC-Name | 4'-phenylspiro[2-benzofuran-3,2'-furan]-1,3'-dion |
| PubChem CID | 37927 |
| CAS | 38183-12-9 |
| MDL-Nummer | MFCD00005928 |
| Molekulargewicht (g/mol) | 278.26 |
| SMILES | O=C1OC2(OC=C(C2=O)C2=CC=CC=C2)C2=CC=CC=C12 |
| Summenformel | C17H10O4 |
Thermo Scientific Chemicals Kresolrot, Indikatorqualität, rein
CAS: 1733-12-6 Summenformel: C21H18O5S Molekulargewicht (g/mol): 382.43 MDL-Nummer: MFCD00005878 InChI-Schlüssel: OBRMNDMBJQTZHV-UHFFFAOYSA-N PubChem CID: 73013 ChEBI: CHEBI:86218 IUPAC-Name: 4-[3-(4-Hydroxy-3-Methylphenyl)-1,1-Dioxo-2,1$l^{6}-Benzoxathiol-3-yl]-3-Methylphenol SMILES: CC1=CC(=CC=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(C)=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | OBRMNDMBJQTZHV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-[3-(4-Hydroxy-3-Methylphenyl)-1,1-Dioxo-2,1$l^{6}-Benzoxathiol-3-yl]-3-Methylphenol |
| PubChem CID | 73013 |
| CAS | 1733-12-6 |
| ChEBI | CHEBI:86218 |
| MDL-Nummer | MFCD00005878 |
| Molekulargewicht (g/mol) | 382.43 |
| SMILES | CC1=CC(=CC=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(C)=C1 |
| Summenformel | C21H18O5S |
Thermo Scientific Chemicals Alcianblau 8GX
CAS: 33864-99-2 Summenformel: C56H68Cl4CuN16S4 Molekulargewicht (g/mol): 1298.86 MDL-Nummer: MFCD00010720 InChI-Schlüssel: XRWQTDIELZDCPS-UHFFFAOYSA-J Synonym: Ingrain blue 1; C.I. 74240 PubChem CID: 17749099 IUPAC-Name: (9Z,18Z,26Z,35Z)-4,14,22,32-tetrakis({[(dimethylamino)(dimethyliminiumyl)methyl]sulfanyl}methyl)-9,18,27,36,37,39,40,41-octaaza-38-cupradecacyclo[17.17.3.1¹⁰,¹⁷.1²⁸,³⁵.0²,⁷.0⁸,³⁷.0¹¹,¹⁶.0²⁰,²⁵.0²⁶,³⁹.0²⁹,³⁴]hentetraconta-1,3,5,7,9,11(16),12,14,17(41),18,20,22,24,26,28(40),29(34),30,32,35-nonadecaene-38,38-bis(ylium) tetrachloride SMILES: [Cl-].[Cl-].[Cl-].[Cl-].CN(C)C(SCC1=CC2=C(C=C1)\C1=N\C3=C4C=CC(CSC(N(C)C)=[N+](C)C)=CC4=C4\N=C5/N=C(/N=C6\N([Cu++]N34)\C(=N/C2=N1)C1=CC(CSC(N(C)C)=[N+](C)C)=CC=C61)C1=C5C=C(CSC(N(C)C)=[N+](C)C)C=C1)=[N+](C)C
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | XRWQTDIELZDCPS-UHFFFAOYSA-J |
|---|---|
| IUPAC-Name | (9Z,18Z,26Z,35Z)-4,14,22,32-tetrakis({[(dimethylamino)(dimethyliminiumyl)methyl]sulfanyl}methyl)-9,18,27,36,37,39,40,41-octaaza-38-cupradecacyclo[17.17.3.1¹⁰,¹⁷.1²⁸,³⁵.0²,⁷.0⁸,³⁷.0¹¹,¹⁶.0²⁰,²⁵.0²⁶,³⁹.0²⁹,³⁴]hentetraconta-1,3,5,7,9,11(16),12,14,17(41),18,20,22,24,26,28(40),29(34),30,32,35-nonadecaene-38,38-bis(ylium) tetrachloride |
| PubChem CID | 17749099 |
| CAS | 33864-99-2 |
| MDL-Nummer | MFCD00010720 |
| Molekulargewicht (g/mol) | 1298.86 |
| SMILES | [Cl-].[Cl-].[Cl-].[Cl-].CN(C)C(SCC1=CC2=C(C=C1)\C1=N\C3=C4C=CC(CSC(N(C)C)=[N+](C)C)=CC4=C4\N=C5/N=C(/N=C6\N([Cu++]N34)\C(=N/C2=N1)C1=CC(CSC(N(C)C)=[N+](C)C)=CC=C61)C1=C5C=C(CSC(N(C)C)=[N+](C)C)C=C1)=[N+](C)C |
| Synonym | Ingrain blue 1; C.I. 74240 |
| Summenformel | C56H68Cl4CuN16S4 |
Thermo Scientific Chemicals Bromkresolgrün, rein, Indikator-Gütegrad
CAS: 76-60-8 Summenformel: C21H14Br4O5S Molekulargewicht (g/mol): 698.014 MDL-Nummer: MFCD00005874 InChI-Schlüssel: FRPHFZCDPYBUAU-UHFFFAOYSA-N Synonym: 3',3'',5',5''-Tetrabromo-m-cresolsulfonephthalein,BCG,3', 3'', 5' PubChem CID: 6451 IUPAC-Name: 2,6-Dibrom-4-[3-(3,5-Dibrom-4-Hydroxy-2-Methylphenyl)-1,1-Dioxo-2,1$l^{6}-Benzoxathiol-3-yl]-3-Methylphenol SMILES: CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)O)Br)Br)O)Br
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | FRPHFZCDPYBUAU-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2,6-Dibrom-4-[3-(3,5-Dibrom-4-Hydroxy-2-Methylphenyl)-1,1-Dioxo-2,1$l^{6}-Benzoxathiol-3-yl]-3-Methylphenol |
| PubChem CID | 6451 |
| CAS | 76-60-8 |
| MDL-Nummer | MFCD00005874 |
| Molekulargewicht (g/mol) | 698.014 |
| SMILES | CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)O)Br)Br)O)Br |
| Synonym | 3',3'',5',5''-Tetrabromo-m-cresolsulfonephthalein,BCG,3', 3'', 5' |
| Summenformel | C21H14Br4O5S |