Learn More
Xylazine hydrochloride, Thermo Scientific™
Agonist at the alpha-2 adrenergic receptor
Marke: Thermo Scientific Alfa Aesar J62394.06
| Menge | 5g |
|---|
Lernen Sie weitere Varianten dieses
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemische Identifikatoren
| 23076-35-9 | |
| 256.79 | |
| QYEFBJRXKKSABU-UHFFFAOYSA-N | |
| 68554 | |
| [H+].[Cl-].CC1=CC=CC(C)=C1NC1=NCCCS1 |
| C12H17ClN2S | |
| MFCD00058196 | |
| xylazine hydrochloride, xylazine hcl, n-2,6-dimethylphenyl-5,6-dihydro-4h-1,3-thiazin-2-amine hydrochloride, celactal, xylazine chloride, bay 1470 hydrochloride, unii-ngc3s0882s, ccris 8685, bay va 1470 | |
| hydrogen N-(2,6-dimethylphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine chloride |
Spezifikation
| Xylazine hydrochloride | |
| C12H17ClN2S | |
| 5g | |
| 6448471 | |
| xylazine hydrochloride, xylazine hcl, n-2,6-dimethylphenyl-5,6-dihydro-4h-1,3-thiazin-2-amine hydrochloride, celactal, xylazine chloride, bay 1470 hydrochloride, unii-ngc3s0882s, ccris 8685, bay va 1470 | |
| QYEFBJRXKKSABU-UHFFFAOYSA-N | |
| hydrogen N-(2,6-dimethylphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine chloride | |
| 68554 |
| 23076-35-9 | |
| MFCD00058196 | |
| UN2811 | |
| 14,10080 | |
| Soluble in water | |
| [H+].[Cl-].CC1=CC=CC(C)=C1NC1=NCCCS1 | |
| 256.79 | |
| 256.79 |
Indem Sie auf Absenden klicken, erklären Sie sich damit einverstanden, dass Fisher Scientific sich mit Ihnen in Verbindung setzen kann, um Ihr Feedback in diesem Formular zu bearbeiten. Wir werden Ihre Informationen nicht für andere Zwecke weitergeben. Alle bereitgestellten Kontaktinformationen werden in Übereinstimmung mit unserer Datenschutzrichtlinie aufbewahrt. Datenschutzrichtlinie.