Learn More
(S)-3,5-DHPG, Tocris Bioscience™

Selective group I mGlu agonist; active enantiomer of 3,5-DHPG (Cat. No. 0342)
Marke: Tocris Bioscience 0805/5
Beschreibung
Selective group I mGlu receptor agonist.Available as part of the Group I mGlu Receptor Tocriset™ and Mixed mGlu Receptor Tocriset™ . Racemate also available.
Spezifikation
| (S)-3, 5-DHPG | |
| C8H9NO4 | |
| s-3,5-dihydroxyphenylglycine, s-3,5-dhpg, l-3,5-dihydroxyphenylglycine, s-dhpg, unii-cf5g2g268a, chembl39221, 2s-2-amino-2-3,5-dihydroxyphenyl acetic acid, benzeneacetic acid, alpha-amino-3,5-dihydroxy-, alphas, tocris-0342, tocris-0805 | |
| NC(C(O)=O)C1=CC(O)=CC(O)=C1 | |
| 183.16 | |
| 443586 | |
| 183.16 |
| 162870-29-3 | |
| MFCD11044457 | |
| HOOWCUZPEFNHDT-UHFFFAOYNA-N | |
| 2-amino-2-(3,5-dihydroxyphenyl)acetic acid | |
| 5mg | |
| CHEBI:29474 | |
| >98% |
Das Fisher Scientific Encompass-Programm bietet Artikel an, die nicht Teil unseres Vertriebsportfolios sind. Diese Produkte verfügen in der Regel nicht über Bilder oder detaillierte Beschreibungen. Wir sind jedoch bestrebt, Ihr Einkaufserlebnis zu verbessern. Bitte verwenden Sie das untenstehende Formular, um uns Feedback zum Inhalt dieses Produkts zu geben.