Learn More
Dextran, MW ca 500,000, Thermo Scientific™
Dextran, CAS # 9004-54-0, is a glucose polymer. It is mainly used to increase electronegativity and reduce erythrocyte aggregation and platelet adhesiveness (anticoagulant activity).
Marke: Thermo Scientific Alfa Aesar J63702.36
| Menge | 500g |
|---|
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
General Description
- Dextran is a glucose polymer biosynthesized by the non-pathogenic Leuconostoc mesenteroides
Application
- Dextran is a complex branched glucan that can be used to enhance electronegativity and reduce erythrocyte aggregation and platelet adhesiveness (anticoagulant activity)
- This compound promotes the activation of plasminogen by inhibiting α-2 antiplasmin
- Dextran can be used to reduce thrombosis in animal models
- It is used in osmotic stress techniques where osmotic pressure is applied to biological molecules
- Dextran can be used as an immobilization agent in biosensors
Chemische Identifikatoren
| 9004-54-0 | |
| 504.438 | |
| FZWBNHMXJMCXLU-UHFFFAOYSA-N | |
| 4125253 | |
| C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)OCC(C(C(C(C=O)O)O)O)O)O)O)O)O)O)O)O |
| C18H32O16 | |
| MFCD00130935 | |
| dextran, dextran, mw-86.000 aver., 2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy hexanal, 2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxymethyl oxan-2-yl oxyhexanal, 2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxymethyl tetrahydropyran-2-yl oxy-hexanal | |
| 2,3,4,5-tetrahydroxy-6-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhexanal |
Spezifikation
| Dextran | |
| C18H32O16 | |
| 14,2948 | |
| Soluble in water,dimethyl sulfoxide,ethylene glycol and glycerol. | |
| FZWBNHMXJMCXLU-UHFFFAOYSA-N | |
| 2,3,4,5-tetrahydroxy-6-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhexanal | |
| 4125253 |
| 9004-54-0 | |
| MFCD00130935 | |
| dextran, dextran, mw-86.000 aver., 2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy hexanal, 2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxymethyl oxan-2-yl oxyhexanal, 2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxymethyl tetrahydropyran-2-yl oxy-hexanal | |
| 500g | |
| C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)OCC(C(C(C(C=O)O)O)O)O)O)O)O)O)O)O)O | |
| 504.438 | |
| ≈500 kd |
Bitte geben Sie uns Ihr Feedback zu den Produktinhalten, indem Sie das folgende Formular ausfüllen.