Learn More
Bumetanide, 98+%, Thermo Scientific™
Inhibitor of the sodium-potassium-chloride cotransporter
Marke: Thermo Scientific Alfa Aesar J62302.06
| Menge | 5g |
|---|
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsBumetanide has been observed to block the depolarization of GABA in cortical development studies. It is been used as a specific inhibitor of Na+-K+-2Cl- cotransporter NKCC1
Solubility
Soluble in ethanol (10 mg/ml), DMSO (25 mg/ml), acetone, benzene, methanol, propylene glycol, and water (<1mg/mL).
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Keep away from acids.
Chemische Identifikatoren
| 28395-03-1 | |
| 364.416 | |
| MAEIEVLCKWDQJH-UHFFFAOYSA-N | |
| 2471 | |
| 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoic acid |
| C17H20N2O5S | |
| MFCD00078949 | |
| bumetanide, 3-butylamino-4-phenoxy-5-sulfamoylbenzoic acid, bumex, burinex, fordiuran, lunetoron, fontego, segurex, bumetanida, bumetanidum | |
| CHEBI:3213 | |
| CCCCNC1=C(C(=CC(=C1)C(=O)O)S(=O)(=O)N)OC2=CC=CC=C2 |
Spezifikation
| Bumetanide | |
| C17H20N2O5S | |
| 5g | |
| bumetanide, 3-butylamino-4-phenoxy-5-sulfamoylbenzoic acid, bumex, burinex, fordiuran, lunetoron, fontego, segurex, bumetanida, bumetanidum | |
| MAEIEVLCKWDQJH-UHFFFAOYSA-N | |
| 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoic acid | |
| 2471 | |
| 364.4 |
| 28395-03-1 | |
| MFCD00078949 | |
| 14,1484 | |
| Soluble in ethanol (10mg/ml),DMSO (25mg/ml),acetone,benzene,methanol,propylene glycol,and water (<1mg/ml). | |
| CCCCNC1=C(C(=CC(=C1)C(=O)O)S(=O)(=O)N)OC2=CC=CC=C2 | |
| 364.416 | |
| CHEBI:3213 | |
| ≥98% |
Indem Sie auf Absenden klicken, erklären Sie sich damit einverstanden, dass Fisher Scientific sich mit Ihnen in Verbindung setzen kann, um Ihr Feedback in diesem Formular zu bearbeiten. Wir werden Ihre Informationen nicht für andere Zwecke weitergeben. Alle bereitgestellten Kontaktinformationen werden in Übereinstimmung mit unserer Datenschutzrichtlinie aufbewahrt. Datenschutzrichtlinie.