Learn More
Benzotropine methanesulfonate, Thermo Scientific™
Muscarinic receptor antagonist
Marke: Thermo Scientific Alfa Aesar J61954.MC
| Menge | 100mg |
|---|
Lernen Sie weitere Varianten dieses
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
SolubilitySoluble in water (81 mg/ml at 25°C), DMSO (50 mg/ml at 25°C), ethanol (81 mg/ml at 25°C), and ether (very slightly).
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from oxidizing agents. Store at 4°C.
Chemische Identifikatoren
| 132-17-2 | |
| 403.54 | |
| CPFJLLXFNPCTDW-STYNFMPRSA-N | |
| 3246155 | |
| CS(O)(=O)=O.CN1[C@@H]2CC[C@@H]1CC(C2)OC(C1=CC=CC=C1)C1=CC=CC=C1 |
| C22H29NO4S | |
| MFCD00074784 | |
| benztropine mesylate, cogentin, benztropine mesilate, benztropine methanesulfonate, unii-wmj8tl7510, benztropine methylsulfonate, benzatropine mesilate, benzatropine mesylate, benzotropine mesylate, cobrentin methanesulfonate | |
| (1R,5R)-3-(diphenylmethoxy)-8-methyl-8-azabicyclo[3.2.1]octane; methanesulfonic acid |
Spezifikation
| Benzotropine methanesulfonate | |
| C22H29NO4S | |
| 100mg | |
| 14,1121 | |
| Soluble in water (81mg/ml at 25°C),DMSO (50mg/ml at 25°C),ethanol (81mg/ml at 25°C),and ether (very slightly). | |
| CS(O)(=O)=O.CN1[C@@H]2CC[C@@H]1CC(C2)OC(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 403.54 | |
| 403.54 |
| 132-17-2 | |
| MFCD00074784 | |
| UN2811 | |
| benztropine mesylate, cogentin, benztropine mesilate, benztropine methanesulfonate, unii-wmj8tl7510, benztropine methylsulfonate, benzatropine mesilate, benzatropine mesylate, benzotropine mesylate, cobrentin methanesulfonate | |
| CPFJLLXFNPCTDW-STYNFMPRSA-N | |
| (1R,5R)-3-(diphenylmethoxy)-8-methyl-8-azabicyclo[3.2.1]octane; methanesulfonic acid | |
| 3246155 |
Bitte geben Sie uns Ihr Feedback zu den Produktinhalten, indem Sie das folgende Formular ausfüllen.