Learn More
Benserazide hydrochloride, Thermo Scientific™
Inhibitor of L-aromatic amino acid decarboxylase
Marke: Thermo Scientific Alfa Aesar J64581.06
| Menge | 5g |
|---|
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsInhibitor of L-aromatic amino acid decarboxylaseBenserazide hydrochloride is used as an antiparkinsonian. It is a peripheral decarboxylase inhibitor. It is used as an inhibitor for aromatic L-aminoacid decarboxylase. Further, it serves as an inhibitor of tyrosine hydroxylase (TH) and Tryptophan hydroxylase (TPH) inhibitor.
Solubility
Soluble in water, dimethyl sulfoxide and methanol. Insoluble in ethanol and acetone.
Notes
Incompatible with strong oxidizing agents.
Chemische Identifikatoren
| 14919-77-8 | |
| 293.704 | |
| ULFCBIUXQQYDEI-UHFFFAOYSA-N | |
| 26964 | |
| 2-amino-3-hydroxy-N'-[(2,3,4-trihydroxyphenyl)methyl]propanehydrazide;hydrochloride |
| C10H16ClN3O5 | |
| MFCD00078571 | |
| benserazide hydrochloride, benserazide hcl, 2-amino-3-hydroxy-n'-2,3,4-trihydroxybenzyl propanehydrazide hydrochloride, ccris 5092, 2'-2,3,4-trihydroxybenzyl-dl-serinohydrazide monohydrochloride, benzerazide hydrochloride, dl-serine 2, dl-serine 2-2,3,4-trihydroxybenzyl hydrazine hydrochloride, 2-amino-3-hydroxy-n'-2,3,4-trihydroxyphenyl methyl propanehydrazide hydrochloride | |
| CHEBI:31262 | |
| C1=CC(=C(C(=C1CNNC(=O)C(CO)N)O)O)O.Cl |
Spezifikation
| Benserazide hydrochloride | |
| C10H16ClN3O5 | |
| 5g | |
| 14,1050 | |
| Soluble in water,dimethyl sulfoxide and methanol. Insoluble in ethanol and acetone. | |
| C1=CC(=C(C(=C1CNNC(=O)C(CO)N)O)O)O.Cl | |
| 293.704 | |
| CHEBI:31262 |
| 14919-77-8 | |
| MFCD00078571 | |
| Light sensitive | |
| benserazide hydrochloride, benserazide hcl, 2-amino-3-hydroxy-n'-2,3,4-trihydroxybenzyl propanehydrazide hydrochloride, ccris 5092, 2'-2,3,4-trihydroxybenzyl-dl-serinohydrazide monohydrochloride, benzerazide hydrochloride, dl-serine 2, dl-serine 2-2,3,4-trihydroxybenzyl hydrazine hydrochloride, 2-amino-3-hydroxy-n'-2,3,4-trihydroxyphenyl methyl propanehydrazide hydrochloride | |
| ULFCBIUXQQYDEI-UHFFFAOYSA-N | |
| 2-amino-3-hydroxy-N'-[(2,3,4-trihydroxyphenyl)methyl]propanehydrazide;hydrochloride | |
| 26964 | |
| 293.7 |
Indem Sie auf Absenden klicken, erklären Sie sich damit einverstanden, dass Fisher Scientific sich mit Ihnen in Verbindung setzen kann, um Ihr Feedback in diesem Formular zu bearbeiten. Wir werden Ihre Informationen nicht für andere Zwecke weitergeben. Alle bereitgestellten Kontaktinformationen werden in Übereinstimmung mit unserer Datenschutzrichtlinie aufbewahrt. Datenschutzrichtlinie.