Learn More
Ammonium dichromate, ACS, 99.5% min, Thermo Scientific™
Catalysts, source of pure nitrogen, in lithography
Marke: Thermo Scientific Alfa Aesar 013444.A3
| Menge | 2kg |
|---|
Lernen Sie weitere Varianten dieses
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemische Identifikatoren
| Cr2H8N2O7 | |
| MFCD00010879 | |
| ammonium dichromate, ammonium bichromate, diammonium dichromate, ammonium dichromate vi, ammoniumbichromaat dutch, ammoniumdichromaat dutch, ammoniumdichromat german, unii-5j18bp595g, hsdb 481 | |
| diazanium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
Spezifikation
| Ammonium dichromate | |
| 2kg | |
| Cr2H8N2O7 | |
| ammonium dichromate, ammonium bichromate, diammonium dichromate, ammonium dichromate vi, ammoniumbichromaat dutch, ammoniumdichromaat dutch, ammoniumdichromat german, unii-5j18bp595g, hsdb 481 | |
| JOSWYUNQBRPBDN-UHFFFAOYSA-P | |
| diazanium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
| 24600 | |
| ACS Reagent |
| 7789-09-5 | |
| 99.5% | |
| MFCD00010879 | |
| Freely soluble in water.Soluble in water and alcohol. Insoluble in acetone. | |
| [NH4+].[NH4+].[O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-] | |
| 252.06 | |
| 252.1 |
Bitte geben Sie uns Ihr Feedback zu den Produktinhalten, indem Sie das folgende Formular ausfüllen.