man

Test

CAS RN 101152-94-7

ClH3CNH3CONH2H

CAS RN 101152-94-7

IUPAC Name: hydrogen (1R,2S)-2-(aminomethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide chloride
Synonyme: hydrogen milnacipran chloride
Molekulargewicht (g/mol): 282.81
Summenformel: C15H23ClN2O
InChi Key: XNCDYJFPRPDERF-PBCQUBLHSA-N
SMILES: [H+].[Cl-].CCN(CC)C(=O)[C@@]1(C[C@@H]1CN)C1=CC=CC=C1

Gefilterte Suchergebnisse

Produkte von einigen unserer Lieferanten werden in den gefilterten Suchergebnissen nicht angezeigt. Bitte deaktivieren Sie alle Filter, um diese Produkte zu sehen.

Ergebnisse verfeinern