Benzol und substituierte Derivate
Gefilterte Suchergebnisse
DAPT, Thermo Scientific Chemicals
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
Benzylalkohol, 99 %, rein, Thermo Scientific Chemicals
CAS: 100-51-6 Summenformel: C7H8O Molekulargewicht (g/mol): 108.14 MDL-Nummer: MFCD00004599,MFCD03792087 InChI-Schlüssel: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC-Name: Phenylmethanol SMILES: OCC1=CC=CC=C1
| InChI-Schlüssel | WVDDGKGOMKODPV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Phenylmethanol |
| PubChem CID | 244 |
| CAS | 100-51-6 |
| ChEBI | CHEBI:17987 |
| MDL-Nummer | MFCD00004599,MFCD03792087 |
| Molekulargewicht (g/mol) | 108.14 |
| SMILES | OCC1=CC=CC=C1 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| Summenformel | C7H8O |
p-Anisaldehyd +99 %, Thermo Scientific Chemicals
CAS: 123-11-5 Summenformel: C8H8O2 Molekulargewicht (g/mol): 136.15 MDL-Nummer: MFCD00003385 InChI-Schlüssel: ZRSNZINYAWTAHE-UHFFFAOYSA-N Synonym: p-anisaldehyde,anisaldehyde,anisic aldehyde,p-methoxybenzaldehyde,4-anisaldehyde,aubepine,p-anisic aldehyde,p-formylanisole,benzaldehyde, 4-methoxy,crategine PubChem CID: 31244 ChEBI: CHEBI:28235 IUPAC-Name: 4-Methoxybenzaldehyd SMILES: COC1=CC=C(C=C1)C=O
| InChI-Schlüssel | ZRSNZINYAWTAHE-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-Methoxybenzaldehyd |
| PubChem CID | 31244 |
| CAS | 123-11-5 |
| ChEBI | CHEBI:28235 |
| MDL-Nummer | MFCD00003385 |
| Molekulargewicht (g/mol) | 136.15 |
| SMILES | COC1=CC=C(C=C1)C=O |
| Synonym | p-anisaldehyde,anisaldehyde,anisic aldehyde,p-methoxybenzaldehyde,4-anisaldehyde,aubepine,p-anisic aldehyde,p-formylanisole,benzaldehyde, 4-methoxy,crategine |
| Summenformel | C8H8O2 |
Natriumsalicylat, 99 %, Thermo Scientific Chemicals
CAS: 54-21-7 Summenformel: C7H5NaO3 Molekulargewicht (g/mol): 160.104 MDL-Nummer: MFCD00002440 InChI-Schlüssel: ABBQHOQBGMUPJH-UHFFFAOYSA-M Synonym: sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl PubChem CID: 16760658 ChEBI: CHEBI:9180 IUPAC-Name: Natrium;2-Hydroxybenzoat SMILES: C1=CC=C(C(=C1)C(=O)[O-])O.[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium;2-Hydroxybenzoat |
| PubChem CID | 16760658 |
| CAS | 54-21-7 |
| ChEBI | CHEBI:9180 |
| MDL-Nummer | MFCD00002440 |
| Molekulargewicht (g/mol) | 160.104 |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] |
| Synonym | sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl |
| Summenformel | C7H5NaO3 |
4-Dimethylaminobenzaldehyd, 99+ %, Thermo Scientific Chemicals
CAS: 100-10-7 Summenformel: C9H11NO Molekulargewicht (g/mol): 149.19 MDL-Nummer: MFCD00003381 InChI-Schlüssel: BGNGWHSBYQYVRX-UHFFFAOYSA-N Synonym: 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal PubChem CID: 7479 IUPAC-Name: 4-(dimethylamino)benzaldehyde SMILES: CN(C)C1=CC=C(C=O)C=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | BGNGWHSBYQYVRX-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-(dimethylamino)benzaldehyde |
| PubChem CID | 7479 |
| CAS | 100-10-7 |
| MDL-Nummer | MFCD00003381 |
| Molekulargewicht (g/mol) | 149.19 |
| SMILES | CN(C)C1=CC=C(C=O)C=C1 |
| Synonym | 4-dimethylamino benzaldehyde,p-dimethylaminobenzaldehyde,ehrlich's reagent,p-formyldimethylaniline,benzaldehyde, 4-dimethylamino,p-dimethylamino benzaldehyde,p-formyl-n,n-dimethylaniline,n,n-dimethyl-p-aminobenzaldehyde,p-n,n-dimethylamino benzaldehyde,4-dimethylaminobenzenecarbonal |
| Summenformel | C9H11NO |
Tetrakis(triphenylphosphin)palladium(0), 99 %, Thermo Scientific Chemicals
CAS: 14221-01-3 Summenformel: C72H60P4Pd Molekulargewicht (g/mol): 1155.59 MDL-Nummer: MFCD00010012 InChI-Schlüssel: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC-Name: palladium;triphenylphosphan SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | palladium;triphenylphosphan |
| PubChem CID | 11979704 |
| CAS | 14221-01-3 |
| MDL-Nummer | MFCD00010012 |
| Molekulargewicht (g/mol) | 1155.59 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| Summenformel | C72H60P4Pd |
3,4-Diaminobenzoesäure, 97 %, Thermo Scientific Chemicals
CAS: 619-05-6 Summenformel: C7H8N2O2 Molekulargewicht (g/mol): 152.15 MDL-Nummer: MFCD00007726 InChI-Schlüssel: HEMGYNNCNNODNX-UHFFFAOYSA-N Synonym: benzoic acid, 3,4-diamino,4-carboxyphenyldiamine,3,4-diamino benzoic acid,4-carboxy-o-phenylenediamine,3,4-diaminobenzoicacid,acmc-209mxf,3,4-diaminobenzoesaeure,3,4 diaminobenzoic acid,3,4-diaminobenzenoic acid,3,4-diamino-benzoic acid PubChem CID: 69263 IUPAC-Name: 3,4-diaminobenzoesäure SMILES: C1=CC(=C(C=C1C(=O)O)N)N
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | HEMGYNNCNNODNX-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3,4-diaminobenzoesäure |
| PubChem CID | 69263 |
| CAS | 619-05-6 |
| MDL-Nummer | MFCD00007726 |
| Molekulargewicht (g/mol) | 152.15 |
| SMILES | C1=CC(=C(C=C1C(=O)O)N)N |
| Synonym | benzoic acid, 3,4-diamino,4-carboxyphenyldiamine,3,4-diamino benzoic acid,4-carboxy-o-phenylenediamine,3,4-diaminobenzoicacid,acmc-209mxf,3,4-diaminobenzoesaeure,3,4 diaminobenzoic acid,3,4-diaminobenzenoic acid,3,4-diamino-benzoic acid |
| Summenformel | C7H8N2O2 |
Benzoesäure, 99,6 %, ACS-Reagenz
CAS: 65-85-0 Summenformel: C7H6O2 Molekulargewicht (g/mol): 122.12 InChI-Schlüssel: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC-Name: Benzoesäure SMILES: C1=CC=C(C=C1)C(=O)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Benzoesäure |
| PubChem CID | 243 |
| CAS | 65-85-0 |
| ChEBI | CHEBI:30746 |
| Molekulargewicht (g/mol) | 122.12 |
| SMILES | C1=CC=C(C=C1)C(=O)O |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| Summenformel | C7H6O2 |
5,5'-Di-thio-bis-(2-Nitrobenzoesäure), 99 %, Thermo Scientific Chemicals
CAS: 69-78-3 Summenformel: C14H8N2O8S2 Molekulargewicht (g/mol): 396.34 MDL-Nummer: MFCD00007140 InChI-Schlüssel: KIUMMUBSPKGMOY-UHFFFAOYSA-N Synonym: dtnb,5,5'-dithiobis 2-nitrobenzoic acid,ellman's reagent,3-carboxy-4-nitrophenyl disulfide,dithionitrobenzoic acid,dithiobisnitrobenzoic acid,5,5'-disulfanediylbis 2-nitrobenzoic acid,benzoic acid, 3,3'-dithiobis 6-nitro,3,3'-dithiobis 6-nitrobenzoic acid,5,5'-dithio-bis 2-nitrobenzoic acid PubChem CID: 6254 ChEBI: CHEBI:86228 IUPAC-Name: 5-[(3-Carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoesäure SMILES: OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | KIUMMUBSPKGMOY-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 5-[(3-Carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoesäure |
| PubChem CID | 6254 |
| CAS | 69-78-3 |
| ChEBI | CHEBI:86228 |
| MDL-Nummer | MFCD00007140 |
| Molekulargewicht (g/mol) | 396.34 |
| SMILES | OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O |
| Synonym | dtnb,5,5'-dithiobis 2-nitrobenzoic acid,ellman's reagent,3-carboxy-4-nitrophenyl disulfide,dithionitrobenzoic acid,dithiobisnitrobenzoic acid,5,5'-disulfanediylbis 2-nitrobenzoic acid,benzoic acid, 3,3'-dithiobis 6-nitro,3,3'-dithiobis 6-nitrobenzoic acid,5,5'-dithio-bis 2-nitrobenzoic acid |
| Summenformel | C14H8N2O8S2 |
Methylendi-p-phenyl diisocyanat, 98 %, Flocken, Thermo Scientific Chemicals
CAS: 101-68-8 Summenformel: C15H10N2O2 Molekulargewicht (g/mol): 250.26 MDL-Nummer: MFCD00036131 InChI-Schlüssel: UPMLOUAZCHDJJD-UHFFFAOYSA-N Synonym: 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate PubChem CID: 7570 ChEBI: CHEBI:53218 IUPAC-Name: 1-Isocyanat-4-[(4-isocyanatphenyl)methyl]Benzol SMILES: C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | UPMLOUAZCHDJJD-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1-Isocyanat-4-[(4-isocyanatphenyl)methyl]Benzol |
| PubChem CID | 7570 |
| CAS | 101-68-8 |
| ChEBI | CHEBI:53218 |
| MDL-Nummer | MFCD00036131 |
| Molekulargewicht (g/mol) | 250.26 |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O |
| Synonym | 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate |
| Summenformel | C15H10N2O2 |
4-Aminobenzoesäure, 99 %, Thermo Scientific Chemicals
CAS: 150-13-0 Summenformel: C7H7NO2 Molekulargewicht (g/mol): 137.14 MDL-Nummer: MFCD00007894 InChI-Schlüssel: ALYNCZNDIQEVRV-UHFFFAOYSA-N Synonym: p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino PubChem CID: 978 ChEBI: CHEBI:30753 IUPAC-Name: 4-Aminobenzoesäure SMILES: NC1=CC=C(C=C1)C(O)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ALYNCZNDIQEVRV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-Aminobenzoesäure |
| PubChem CID | 978 |
| CAS | 150-13-0 |
| ChEBI | CHEBI:30753 |
| MDL-Nummer | MFCD00007894 |
| Molekulargewicht (g/mol) | 137.14 |
| SMILES | NC1=CC=C(C=C1)C(O)=O |
| Synonym | p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino |
| Summenformel | C7H7NO2 |
Triphenylphosphin, >99 %, Thermo Scientific Chemicals
CAS: 603-35-0 Summenformel: C18H15P Molekulargewicht (g/mol): 262.29 MDL-Nummer: MFCD00003043 MFCD20489348 InChI-Schlüssel: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC-Name: Triphenylphosphan SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Triphenylphosphan |
| PubChem CID | 11776 |
| CAS | 603-35-0 |
| MDL-Nummer | MFCD00003043 MFCD20489348 |
| Molekulargewicht (g/mol) | 262.29 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| Summenformel | C18H15P |
2,4-Dichlorphenoxyessigsäure, 97 %, Thermo Scientific Chemicals
CAS: 94-75-7 Summenformel: C8H6Cl2O3 Molekulargewicht (g/mol): 221.033 MDL-Nummer: MFCD00004300 InChI-Schlüssel: OVSKIKFHRZPJSS-UHFFFAOYSA-N Synonym: 2,4-dichlorophenoxyacetic acid,2-2,4-dichlorophenoxy acetic acid,2,4-dichlorophenoxy acetic acid,hedonal,rhodia,agrotect,fernesta,fernimine,netagrone,tributon PubChem CID: 1486 ChEBI: CHEBI:28854 IUPAC-Name: 2-(2,4-Dichlorphenoxy)Essigsäure SMILES: C1=CC(=C(C=C1Cl)Cl)OCC(=O)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | OVSKIKFHRZPJSS-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-(2,4-Dichlorphenoxy)Essigsäure |
| PubChem CID | 1486 |
| CAS | 94-75-7 |
| ChEBI | CHEBI:28854 |
| MDL-Nummer | MFCD00004300 |
| Molekulargewicht (g/mol) | 221.033 |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCC(=O)O |
| Synonym | 2,4-dichlorophenoxyacetic acid,2-2,4-dichlorophenoxy acetic acid,2,4-dichlorophenoxy acetic acid,hedonal,rhodia,agrotect,fernesta,fernimine,netagrone,tributon |
| Summenformel | C8H6Cl2O3 |
4-Hydroxy-3-Methoxybenzylalkohol, 99 %, Thermo Scientific Chemicals
CAS: 498-00-0 Summenformel: C8H10O3 Molekulargewicht (g/mol): 154.17 MDL-Nummer: MFCD00004659 InChI-Schlüssel: ZENOXNGFMSCLLL-UHFFFAOYSA-N Synonym: vanillyl alcohol,4-hydroxy-3-methoxybenzyl alcohol,4-hydroxymethyl-2-methoxyphenol,vanillin alcohol,vanillic alcohol,4-hydroxy-3-methoxybenzenemethanol,benzenemethanol, 4-hydroxy-3-methoxy,vanillol,4-hydroxy-3-methoxybenzylalcohol,4-hydroxy-3-methoxyphenylmethanol PubChem CID: 62348 ChEBI: CHEBI:18353 IUPAC-Name: 4-(Hydroxymethyl)-2-Methoxyphenol SMILES: COC1=CC(CO)=CC=C1O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ZENOXNGFMSCLLL-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-(Hydroxymethyl)-2-Methoxyphenol |
| PubChem CID | 62348 |
| CAS | 498-00-0 |
| ChEBI | CHEBI:18353 |
| MDL-Nummer | MFCD00004659 |
| Molekulargewicht (g/mol) | 154.17 |
| SMILES | COC1=CC(CO)=CC=C1O |
| Synonym | vanillyl alcohol,4-hydroxy-3-methoxybenzyl alcohol,4-hydroxymethyl-2-methoxyphenol,vanillin alcohol,vanillic alcohol,4-hydroxy-3-methoxybenzenemethanol,benzenemethanol, 4-hydroxy-3-methoxy,vanillol,4-hydroxy-3-methoxybenzylalcohol,4-hydroxy-3-methoxyphenylmethanol |
| Summenformel | C8H10O3 |
Methylsalicylat, 98 %, Thermo Scientific Chemicals
CAS: 119-36-8 Summenformel: C8H8O3 Molekulargewicht (g/mol): 152.149 MDL-Nummer: MFCD00002214 InChI-Schlüssel: OSWPMRLSEDHDFF-UHFFFAOYSA-N Synonym: methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester PubChem CID: 4133 ChEBI: CHEBI:31832 IUPAC-Name: Methyl 2-Hydroxybenzoat SMILES: COC(=O)C1=CC=CC=C1O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | OSWPMRLSEDHDFF-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Methyl 2-Hydroxybenzoat |
| PubChem CID | 4133 |
| CAS | 119-36-8 |
| ChEBI | CHEBI:31832 |
| MDL-Nummer | MFCD00002214 |
| Molekulargewicht (g/mol) | 152.149 |
| SMILES | COC(=O)C1=CC=CC=C1O |
| Synonym | methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester |
| Summenformel | C8H8O3 |