Färbereagenzien
Gefilterte Suchergebnisse
Thermo Scientific Chemicals Methylenblau, rein, zertifiziert
CAS: 7220-79-3 Summenformel: C16H24ClN3O3S Molekulargewicht (g/mol): 373.90 MDL-Nummer: MFCD00150008 InChI-Schlüssel: XQAXGZLFSSPBMK-UHFFFAOYSA-M Synonym: Basic Blue 9 PubChem CID: 6099 ChEBI: CHEBI:6872 IUPAC-Name: [7-(Dimethylamin)Phenothiazin-3-Yliden]-Dimethylazan; Chlorid SMILES: O.O.O.[Cl-].CN(C)C1=CC2=[S+]C3=CC(=CC=C3N=C2C=C1)N(C)C
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | XQAXGZLFSSPBMK-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | [7-(Dimethylamin)Phenothiazin-3-Yliden]-Dimethylazan; Chlorid |
| PubChem CID | 6099 |
| CAS | 7220-79-3 |
| ChEBI | CHEBI:6872 |
| MDL-Nummer | MFCD00150008 |
| Molekulargewicht (g/mol) | 373.90 |
| SMILES | O.O.O.[Cl-].CN(C)C1=CC2=[S+]C3=CC(=CC=C3N=C2C=C1)N(C)C |
| Synonym | Basic Blue 9 |
| Summenformel | C16H24ClN3O3S |
Thermo Scientific™ Gram-Färbeset
Mit dem Gram-Färbekit können Sie grampositive Organismen von gramnegativen Organismen unterscheiden.
Thermo Scientific Chemicals Methylenblau, 1 % w/v, wässrige Lösung
CAS: 122965-43-9 | C16H18ClN3S
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| Chemischer Name oder Material | Methylene Blue |
|---|---|
| Löslichkeitsinformationen | Miscible with ethanol,chloroform,glacial acetic acid and glycerol. Slightly miscible with pyridine. Immiscible with ethyl ether,xylene,oleic acid,ethanol and acetone. |
| Physikalische Form | Flüssig |
| Concentration or Composition (by Analyte or Components) | 3, 7-Bis(dimethylamino)phenothiazin-5-Iumchlorid-Hydrat:1,0%; Wasser:99% |
| CAS | 7732-18-5 |
| Empfohlene Lagerung | Umgebungstemperaturen |
| Dampfdruck | 23 hPa (17mm Hg) at 20°C |
| MDL-Nummer | MFCD00012111 |
| Prozentgehaltsbereich | 1% w/v aqueous solution |
| TSCA | Ja |
| Summenformel | C16H18ClN3S |
| Formelmasse | 319.86 |
Thermo Scientific Chemicals Kresylviolett Acetat
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
Thermo Scientific Chemicals Methylblau
CAS: 28983-56-4 Summenformel: C37H26N3Na2O9S3 Molekulargewicht (g/mol): 798.79 MDL-Nummer: MFCD00058509 InChI-Schlüssel: TUHAIJABPUJAEY-UHFFFAOYSA-K Synonym: Acid blue 93; C.I. 42780 PubChem CID: 76956083 SMILES: [Na+].[Na+].[O-]S(=O)(=O)C1=CC=CC=C1NC1=CC=C(C=C1)C(C1=CC=C(NC2=CC=CC=C2S([O-])(=O)=O)C=C1)=C1C=CC(C=C1)=NC1=CC=CC=C1S([O-])(=O)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | TUHAIJABPUJAEY-UHFFFAOYSA-K |
|---|---|
| PubChem CID | 76956083 |
| CAS | 28983-56-4 |
| MDL-Nummer | MFCD00058509 |
| Molekulargewicht (g/mol) | 798.79 |
| SMILES | [Na+].[Na+].[O-]S(=O)(=O)C1=CC=CC=C1NC1=CC=C(C=C1)C(C1=CC=C(NC2=CC=CC=C2S([O-])(=O)=O)C=C1)=C1C=CC(C=C1)=NC1=CC=CC=C1S([O-])(=O)=O |
| Synonym | Acid blue 93; C.I. 42780 |
| Summenformel | C37H26N3Na2O9S3 |
Thermo Scientific Chemicals Thymolblau
CAS: 76-61-9 Summenformel: C27H30O5S Molekulargewicht (g/mol): 466.592 MDL-Nummer: MFCD00005869 InChI-Schlüssel: PRZSXZWFJHEZBJ-UHFFFAOYSA-N Synonym: TB,Thymolsulfonephthalein PubChem CID: 65565 IUPAC-Name: 4-[3-(4-Hydroxy-2-methyl-5-propan-2-ylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-5-methyl-2-propan-2-ylphenol SMILES: CC1=CC(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O
| InChI-Schlüssel | PRZSXZWFJHEZBJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-[3-(4-Hydroxy-2-methyl-5-propan-2-ylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-5-methyl-2-propan-2-ylphenol |
| PubChem CID | 65565 |
| CAS | 76-61-9 |
| MDL-Nummer | MFCD00005869 |
| Molekulargewicht (g/mol) | 466.592 |
| SMILES | CC1=CC(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O |
| Synonym | TB,Thymolsulfonephthalein |
| Summenformel | C27H30O5S |
Thermo Scientific Chemicals Methylenblau-Hydrat, 96+%, hochreines biologisches Färbemittel
CAS: 122965-43-9 Summenformel: C16H18ClN3S Molekulargewicht (g/mol): 319.85 MDL-Nummer: MFCD00150006 InChI-Schlüssel: CXKWCBBOMKCUKX-UHFFFAOYSA-M Synonym: Basic Blue 9 hydrate,C.I. 52015 hydrate PubChem CID: 16211647 IUPAC-Name: [7-(Dimethylamino)Phenothiazin-3-Yliden]-Dimethylazanium; Chlorid; Trihydrat SMILES: [Cl-].CN(C)C1=CC=C2N=C3C=CC(C=C3SC2=C1)=[N+](C)C
| InChI-Schlüssel | CXKWCBBOMKCUKX-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | [7-(Dimethylamino)Phenothiazin-3-Yliden]-Dimethylazanium; Chlorid; Trihydrat |
| PubChem CID | 16211647 |
| CAS | 122965-43-9 |
| MDL-Nummer | MFCD00150006 |
| Molekulargewicht (g/mol) | 319.85 |
| SMILES | [Cl-].CN(C)C1=CC=C2N=C3C=CC(C=C3SC2=C1)=[N+](C)C |
| Synonym | Basic Blue 9 hydrate,C.I. 52015 hydrate |
| Summenformel | C16H18ClN3S |
Thermo Scientific Chemicals Safranin O, 85 %
CAS: 477-73-6 Summenformel: C20H19ClN4 Molekulargewicht (g/mol): 350.85 MDL-Nummer: MFCD00011759 InChI-Schlüssel: QRYAEWIQIBAZOJ-UHFFFAOYSA-N Synonym: Basic Red 2,C.I. 50240,3, 7-Diamino-2, 8-dimethyl-5-phenylphenazinium chloride PubChem CID: 2723800 IUPAC-Name: 3,7-Dimethyl-10-Phenylphenazin-10-ium-2,8-Diamin; Chlorid SMILES: [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1
| InChI-Schlüssel | QRYAEWIQIBAZOJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3,7-Dimethyl-10-Phenylphenazin-10-ium-2,8-Diamin; Chlorid |
| PubChem CID | 2723800 |
| CAS | 477-73-6 |
| MDL-Nummer | MFCD00011759 |
| Molekulargewicht (g/mol) | 350.85 |
| SMILES | [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1 |
| Synonym | Basic Red 2,C.I. 50240,3, 7-Diamino-2, 8-dimethyl-5-phenylphenazinium chloride |
| Summenformel | C20H19ClN4 |
Thermo Scientific Chemicals Kongo-Rot, Indikatorqualität
CAS: 573-58-0 Summenformel: C32H22N6Na2O6S2 Molekulargewicht (g/mol): 696.664 MDL-Nummer: MFCD00004028 InChI-Schlüssel: IQFVPQOLBLOTPF-UHFFFAOYSA-L Synonym: C.I. 22120 PubChem CID: 11313 ChEBI: CHEBI:34653 IUPAC-Name: Dinatrium;4-Amino-3-[[4-[4-[(1-Amino-4-Sulfonatonaphthalin-2-yl)Diazenyl]Phenyl]Phenyl]Diazenyl]Naphthalin-1-Sulfonat SMILES: C1=CC=C2C(=C1)C(=CC(=C2N)N=NC3=CC=C(C=C3)C4=CC=C(C=C4)N=NC5=C(C6=CC=CC=C6C(=C5)S(=O)(=O)[O-])N)S(=O)(=O)[O-].[Na+].[Na+]
| InChI-Schlüssel | IQFVPQOLBLOTPF-UHFFFAOYSA-L |
|---|---|
| IUPAC-Name | Dinatrium;4-Amino-3-[[4-[4-[(1-Amino-4-Sulfonatonaphthalin-2-yl)Diazenyl]Phenyl]Phenyl]Diazenyl]Naphthalin-1-Sulfonat |
| PubChem CID | 11313 |
| CAS | 573-58-0 |
| ChEBI | CHEBI:34653 |
| MDL-Nummer | MFCD00004028 |
| Molekulargewicht (g/mol) | 696.664 |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2N)N=NC3=CC=C(C=C3)C4=CC=C(C=C4)N=NC5=C(C6=CC=CC=C6C(=C5)S(=O)(=O)[O-])N)S(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | C.I. 22120 |
| Summenformel | C32H22N6Na2O6S2 |
Thermo Scientific Chemicals Bromphenolblau
CAS: 115-39-9 Summenformel: C19H10Br4O5S Molekulargewicht (g/mol): 669.96 MDL-Nummer: MFCD00005875 InChI-Schlüssel: UDSAIICHUKSCKT-UHFFFAOYSA-N Synonym: Bromphenol Blue PubChem CID: 8272 ChEBI: CHEBI:59424 IUPAC-Name: 2,6-Dibromo-4-[3-(3,5-Dibromo-4-Hydroxyphenyl)-1,1-Dioxo-2,1$l^{6}-Benzoxathiol-3-yl]-Phenol SMILES: C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | UDSAIICHUKSCKT-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2,6-Dibromo-4-[3-(3,5-Dibromo-4-Hydroxyphenyl)-1,1-Dioxo-2,1$l^{6}-Benzoxathiol-3-yl]-Phenol |
| PubChem CID | 8272 |
| CAS | 115-39-9 |
| ChEBI | CHEBI:59424 |
| MDL-Nummer | MFCD00005875 |
| Molekulargewicht (g/mol) | 669.96 |
| SMILES | C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br |
| Synonym | Bromphenol Blue |
| Summenformel | C19H10Br4O5S |
Erythrosin B, Thermo Scientific Chemicals
CAS: 16423-68-0 MDL-Nummer: MFCD00144257 PubChem CID: 131676154
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| PubChem CID | 131676154 |
|---|---|
| CAS | 16423-68-0 |
| MDL-Nummer | MFCD00144257 |
Tiron, Thermo Scientific Chemicals
CAS: 149-45-1 Summenformel: C6H10Na2O8S2 Molekulargewicht (g/mol): 320.238 MDL-Nummer: MFCD00149531 InChI-Schlüssel: HEOKHLCODUWALT-UHFFFAOYSA-N Synonym: 4,5-Dihydroxy-1,3-benzenedisulfonic acid, disodium salt monohydrate PubChem CID: 131674010 IUPAC-Name: 4,5-Dihydroxybenzol-1,3-Disulfonsäure;molekularer Wasserstoff;Natrium SMILES: [HH].[HH].C1=C(C=C(C(=C1S(=O)(=O)O)O)O)S(=O)(=O)O.[Na].[Na]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | HEOKHLCODUWALT-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4,5-Dihydroxybenzol-1,3-Disulfonsäure;molekularer Wasserstoff;Natrium |
| PubChem CID | 131674010 |
| CAS | 149-45-1 |
| MDL-Nummer | MFCD00149531 |
| Molekulargewicht (g/mol) | 320.238 |
| SMILES | [HH].[HH].C1=C(C=C(C(=C1S(=O)(=O)O)O)O)S(=O)(=O)O.[Na].[Na] |
| Synonym | 4,5-Dihydroxy-1,3-benzenedisulfonic acid, disodium salt monohydrate |
| Summenformel | C6H10Na2O8S2 |
Thermo Scientific Chemicals Rhodamin B, 98+%
CAS: 81-88-9 Summenformel: C28H31ClN2O3 Molekulargewicht (g/mol): 479.02 MDL-Nummer: MFCD00011931 InChI-Schlüssel: PYWVYCXTNDRMGF-UHFFFAOYSA-N Synonym: Basic Violet 10,C.I. 45170 PubChem CID: 6694 ChEBI: CHEBI:52334 IUPAC-Name: [9-(2-Carboxyphenyl)-6 -(Diethylamino)Xanthen-3-Ylidene]-Diethylazanium;Chlorid SMILES: [Cl-].CCN(CC)C1=CC2=[O+]C3=CC(=CC=C3C(C3=CC=CC=C3C(O)=O)=C2C=C1)N(CC)CC
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | PYWVYCXTNDRMGF-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | [9-(2-Carboxyphenyl)-6 -(Diethylamino)Xanthen-3-Ylidene]-Diethylazanium;Chlorid |
| PubChem CID | 6694 |
| CAS | 81-88-9 |
| ChEBI | CHEBI:52334 |
| MDL-Nummer | MFCD00011931 |
| Molekulargewicht (g/mol) | 479.02 |
| SMILES | [Cl-].CCN(CC)C1=CC2=[O+]C3=CC(=CC=C3C(C3=CC=CC=C3C(O)=O)=C2C=C1)N(CC)CC |
| Synonym | Basic Violet 10,C.I. 45170 |
| Summenformel | C28H31ClN2O3 |
Thermo Scientific Chemicals Lissamin-Grün-B, rein
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
Thermo Scientific Chemicals Bromocresolgrün, ACS
CAS: 76-60-8 Summenformel: C21H14Br4O5S Molekulargewicht (g/mol): 698.014 MDL-Nummer: MFCD00005874 InChI-Schlüssel: FRPHFZCDPYBUAU-UHFFFAOYSA-N PubChem CID: 6451 IUPAC-Name: 2,6-Dibrom-4-[3-(3,5-Dibrom-4-Hydroxy-2-Methylphenyl)-1,1-Dioxo-2,1$l^{6}-Benzoxathiol-3-yl]-3-Methylphenol SMILES: CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)O)Br)Br)O)Br
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | FRPHFZCDPYBUAU-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2,6-Dibrom-4-[3-(3,5-Dibrom-4-Hydroxy-2-Methylphenyl)-1,1-Dioxo-2,1$l^{6}-Benzoxathiol-3-yl]-3-Methylphenol |
| PubChem CID | 6451 |
| CAS | 76-60-8 |
| MDL-Nummer | MFCD00005874 |
| Molekulargewicht (g/mol) | 698.014 |
| SMILES | CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)O)Br)Br)O)Br |
| Summenformel | C21H14Br4O5S |