Gefilterte Suchergebnisse
Kupfer(II)-Acetylacetonat, 98 %, Thermo Scientific Chemicals
CAS: 13395-16-9 Summenformel: C10H14CuO4 Molekulargewicht (g/mol): 261.76 MDL-Nummer: MFCD00000016 InChI-Schlüssel: QYJPSWYYEKYVEJ-FDGPNNRMSA-L Synonym: 2, 4-Pentanedione, metal derivative,Cupric acetylacetonate IUPAC-Name: copper(2+) bis((2Z)-4-oxopent-2-en-2-olate) SMILES: [Cu++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | QYJPSWYYEKYVEJ-FDGPNNRMSA-L |
|---|---|
| IUPAC-Name | copper(2+) bis((2Z)-4-oxopent-2-en-2-olate) |
| CAS | 13395-16-9 |
| MDL-Nummer | MFCD00000016 |
| Molekulargewicht (g/mol) | 261.76 |
| SMILES | [Cu++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | 2, 4-Pentanedione, metal derivative,Cupric acetylacetonate |
| Summenformel | C10H14CuO4 |
Hexamethyldisiloxan, ≥ 98 %, Thermo Scientific Chemicals
CAS: 107-46-0 InChI-Schlüssel: UQEAIHBTYFGYIE-UHFFFAOYSA-N Synonym: hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide PubChem CID: 24764 ChEBI: CHEBI:78002 IUPAC-Name: Trimethyl(trimethylsilyloxy)silan SMILES: C[Si](C)(C)O[Si](C)(C)C
| InChI-Schlüssel | UQEAIHBTYFGYIE-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Trimethyl(trimethylsilyloxy)silan |
| PubChem CID | 24764 |
| CAS | 107-46-0 |
| ChEBI | CHEBI:78002 |
| SMILES | C[Si](C)(C)O[Si](C)(C)C |
| Synonym | hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide |
Chlorotrimethylsilan, 98 %, Thermo Scientific Chemicals
CAS: 75-77-4 Summenformel: C3H9ClSi Molekulargewicht (g/mol): 108.64 MDL-Nummer: MFCD00000502 InChI-Schlüssel: IJOOHPMOJXWVHK-UHFFFAOYSA-N Synonym: trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl PubChem CID: 6397 ChEBI: CHEBI:85069 IUPAC-Name: Chlor(trimethyl)silan SMILES: C[Si](C)(C)Cl
| InChI-Schlüssel | IJOOHPMOJXWVHK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Chlor(trimethyl)silan |
| PubChem CID | 6397 |
| CAS | 75-77-4 |
| ChEBI | CHEBI:85069 |
| MDL-Nummer | MFCD00000502 |
| Molekulargewicht (g/mol) | 108.64 |
| SMILES | C[Si](C)(C)Cl |
| Synonym | trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl |
| Summenformel | C3H9ClSi |
Tetraethylorthosilicat, 98 %, Thermo Scientific Chemicals
CAS: 78-10-4 Summenformel: C8H20O4Si Molekulargewicht (g/mol): 208.33 MDL-Nummer: MFCD00009062 InChI-Schlüssel: BOTDANWDWHJENH-UHFFFAOYSA-N Synonym: tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate PubChem CID: 6517 IUPAC-Name: Tetraethylsilikat SMILES: CCO[Si](OCC)(OCC)OCC
| InChI-Schlüssel | BOTDANWDWHJENH-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Tetraethylsilikat |
| PubChem CID | 6517 |
| CAS | 78-10-4 |
| MDL-Nummer | MFCD00009062 |
| Molekulargewicht (g/mol) | 208.33 |
| SMILES | CCO[Si](OCC)(OCC)OCC |
| Synonym | tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate |
| Summenformel | C8H20O4Si |
3-Aminopropyltriethoxysilan, 99 %, AcroSeal™, Thermo Scientific Chemicals
CAS: 919-30-2 Summenformel: C9H23NO3Si Molekulargewicht (g/mol): 221.37 MDL-Nummer: MFCD00008207,MFCD01324904 InChI-Schlüssel: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-Aminopropyltriethoxysilan,3-(Triethoxysilyl)propan-1-amin,1-Propanamin, 3-Triethoxysilyl,Silikon A-1100,Silan 1100,3-3-(Triethoxysilyl)propylamin,Propylamin, 3-Triethoxysilyl,Triethoxy-3-aminopropylsilan,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC-Name: 3-Triethoxysilylpropan-1-amin SMILES: CCO[Si](CCCN)(OCC)OCC
| InChI-Schlüssel | WYTZZXDRDKSJID-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Triethoxysilylpropan-1-amin |
| PubChem CID | 13521 |
| CAS | 919-30-2 |
| MDL-Nummer | MFCD00008207,MFCD01324904 |
| Molekulargewicht (g/mol) | 221.37 |
| SMILES | CCO[Si](CCCN)(OCC)OCC |
| Synonym | 3-Aminopropyltriethoxysilan,3-(Triethoxysilyl)propan-1-amin,1-Propanamin, 3-Triethoxysilyl,Silikon A-1100,Silan 1100,3-3-(Triethoxysilyl)propylamin,Propylamin, 3-Triethoxysilyl,Triethoxy-3-aminopropylsilan,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
| Summenformel | C9H23NO3Si |
Dichlorodimethylsilan, 99+ %, AcroSeal™, Thermo Scientific Chemicals
CAS: 75-78-5 Summenformel: C2H6Cl2Si Molekulargewicht (g/mol): 129.06 MDL-Nummer: MFCD00000491 InChI-Schlüssel: LIKFHECYJZWXFJ-UHFFFAOYSA-N Synonym: dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane PubChem CID: 6398 IUPAC-Name: Dichlor(dimethyl)silan SMILES: C[Si](C)(Cl)Cl
| InChI-Schlüssel | LIKFHECYJZWXFJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Dichlor(dimethyl)silan |
| PubChem CID | 6398 |
| CAS | 75-78-5 |
| MDL-Nummer | MFCD00000491 |
| Molekulargewicht (g/mol) | 129.06 |
| SMILES | C[Si](C)(Cl)Cl |
| Synonym | dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane |
| Summenformel | C2H6Cl2Si |
3-Aminopropyltriethoxysilan, 99 %, Thermo Scientific Chemicals
CAS: 919-30-2 Summenformel: C9H23NO3Si Molekulargewicht (g/mol): 221.37 MDL-Nummer: MFCD00008207,MFCD01324904 InChI-Schlüssel: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC-Name: 3-Triethoxysilylpropan-1-amin SMILES: CCO[Si](CCCN)(OCC)OCC
| InChI-Schlüssel | WYTZZXDRDKSJID-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Triethoxysilylpropan-1-amin |
| PubChem CID | 13521 |
| CAS | 919-30-2 |
| MDL-Nummer | MFCD00008207,MFCD01324904 |
| Molekulargewicht (g/mol) | 221.37 |
| SMILES | CCO[Si](CCCN)(OCC)OCC |
| Synonym | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
| Summenformel | C9H23NO3Si |
Ethylaluminiumdichlorid, 0.9 M-Lösung in Heptan, AcroSeal™, Thermo Scientific Chemicals
CAS: 563-43-9 Summenformel: C2H5AlCl2 Molekulargewicht (g/mol): 126.94 MDL-Nummer: MFCD00000457 InChI-Schlüssel: UAIZDWNSWGTKFZ-UHFFFAOYSA-L Synonym: ethylaluminum dichloride,aluminum, dichloroethyl,dichloroethylaluminum,ethyldichloroaluminum,dichloromonoethylaluminum,ethylaluminium dichloride,dichloro ethyl alumane,ethyl aluminum dichloride,hsdb 317,dichloro ethyl aluminum IUPAC-Name: Dichlor(ethyl)aluman SMILES: CC[Al](Cl)Cl
| InChI-Schlüssel | UAIZDWNSWGTKFZ-UHFFFAOYSA-L |
|---|---|
| IUPAC-Name | Dichlor(ethyl)aluman |
| CAS | 563-43-9 |
| MDL-Nummer | MFCD00000457 |
| Molekulargewicht (g/mol) | 126.94 |
| SMILES | CC[Al](Cl)Cl |
| Synonym | ethylaluminum dichloride,aluminum, dichloroethyl,dichloroethylaluminum,ethyldichloroaluminum,dichloromonoethylaluminum,ethylaluminium dichloride,dichloro ethyl alumane,ethyl aluminum dichloride,hsdb 317,dichloro ethyl aluminum |
| Summenformel | C2H5AlCl2 |
Diisobutylaluminiumhydrid, Lösung mit 20 Gew.-% in Toluol, 1.2 M, AcroSeal™, Thermo Scientific Chemicals
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Chemischer Name oder Material | Diisobutylaluminium hydride |
|---|---|
| Siedepunkt | 110.0°C |
| Dichte | 0.8480g/mL |
| EINECS-Nummer | 214-729-9 |
| Relative Dichte | 0.848 |
| Molekulargewicht (g/mol) | 142.22 |
| Merck Index | 15, 3212 |
| Formelmasse | 142.22 |
| Gesundheitsgefahr 2 | GHS H-Satz Verursacht schwere Verätzungen der Haut und schwere Augenschäden. Kann bei Verschlucken und Eindringen in die Atemwege tödlich sein. Kann die Organe bei längerer oder wiederholter Exposition schädigen. Kann vermutlich das Kind im Mutterleib schädigen. Kann Schläfrigkeit und Benommenheit verursachen |
| Gesundheitsgefahr 3 | GHS-P-Hinweis BEI VERSCHLUCKEN: Mund spülen. KEIN Erbrechen herbeiführen. Augenschutz/Gesichtsschutz tragen. BEI KONTAKT MIT DEN AUGEN:Einige Minuten lang vorsichtig mit Wasser ausspülen. Eventuell vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter ausspülen. |
| Löslichkeitsinformationen | Solubility in water: reacts violently. Other solubilities: miscible with saturated aliphatic and aromatic,hydrocarbons |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Physikalische Form | Lösung |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 108-88-3 |
| MDL-Nummer | MFCD00008928 |
| Strukturformel | [(CH3)2CHCH2]2AIH |
| Flammpunkt | 4°C |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Summenformel | C8H19Al |
Lithium-Bis-(Trimethylsilyl)-lithiumamid, 95 %, Thermo Scientific Chemicals
CAS: 4039-32-1 Summenformel: C6H18LiNSi2 Molekulargewicht (g/mol): 167.33 MDL-Nummer: MFCD00008261 InChI-Schlüssel: YNESATAKKCNGOF-UHFFFAOYSA-N Synonym: lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide PubChem CID: 2733832 IUPAC-Name: Lithium; Bis(trimethylsilyl)azanid SMILES: [Li+].C[Si](C)(C)[N-][Si](C)(C)C
| InChI-Schlüssel | YNESATAKKCNGOF-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Lithium; Bis(trimethylsilyl)azanid |
| PubChem CID | 2733832 |
| CAS | 4039-32-1 |
| MDL-Nummer | MFCD00008261 |
| Molekulargewicht (g/mol) | 167.33 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| Summenformel | C6H18LiNSi2 |
Lithium-Tri-sec.-Butylborhydrid, 1 M Lösung in THF, AcroSeal™, Thermo Scientific Chemicals
CAS: 38721-52-7 Summenformel: C12H28BLi Molekulargewicht (g/mol): 190.11 MDL-Nummer: MFCD00011708 InChI-Schlüssel: ACJKNTZKEFMEAK-UHFFFAOYNA-N Synonym: lithium tri-sec-butylhydroborate,l-selectridesolution,lithium tri-sec-butylborohydride solution,l-selectride™ solution,lithium tri butan-2-yl boron 1-,lithium tri-sec-butylborohydride l-selectride , 1m in thf,lithium tri-sec-butylborohydride 1.0 m solution in thf, spcseal,lithium tri-sec-butylborohydride, 1.0m solution in thf, packaged under argon in resealable chemseal bottles IUPAC-Name: Lithium(1+)-Tris(Butan-2-yl)Boranuid SMILES: [Li+].CCC(C)[BH-](C(C)CC)C(C)CC
| InChI-Schlüssel | ACJKNTZKEFMEAK-UHFFFAOYNA-N |
|---|---|
| IUPAC-Name | Lithium(1+)-Tris(Butan-2-yl)Boranuid |
| CAS | 38721-52-7 |
| MDL-Nummer | MFCD00011708 |
| Molekulargewicht (g/mol) | 190.11 |
| SMILES | [Li+].CCC(C)[BH-](C(C)CC)C(C)CC |
| Synonym | lithium tri-sec-butylhydroborate,l-selectridesolution,lithium tri-sec-butylborohydride solution,l-selectride™ solution,lithium tri butan-2-yl boron 1-,lithium tri-sec-butylborohydride l-selectride , 1m in thf,lithium tri-sec-butylborohydride 1.0 m solution in thf, spcseal,lithium tri-sec-butylborohydride, 1.0m solution in thf, packaged under argon in resealable chemseal bottles |
| Summenformel | C12H28BLi |
Methyltrichlorosilan, +98 %, Thermo Scientific Chemicals
CAS: 75-79-6 Summenformel: CH3Cl3Si Molekulargewicht (g/mol): 149.48 InChI-Schlüssel: JLUFWMXJHAVVNN-UHFFFAOYSA-N Synonym: methyltrichlorosilane,trichloro methyl silane,silane, trichloromethyl,methyl-trichlorsilan,methylsilicochloroform,trichloromethylsilicon,methylsilyl trichloride,monomethyltrichlorosilane,silane, methyltrichloro,trichlor-methylsilan PubChem CID: 6399 IUPAC-Name: Trichlor(methyl)silan SMILES: C[Si](Cl)(Cl)Cl
| InChI-Schlüssel | JLUFWMXJHAVVNN-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Trichlor(methyl)silan |
| PubChem CID | 6399 |
| CAS | 75-79-6 |
| Molekulargewicht (g/mol) | 149.48 |
| SMILES | C[Si](Cl)(Cl)Cl |
| Synonym | methyltrichlorosilane,trichloro methyl silane,silane, trichloromethyl,methyl-trichlorsilan,methylsilicochloroform,trichloromethylsilicon,methylsilyl trichloride,monomethyltrichlorosilane,silane, methyltrichloro,trichlor-methylsilan |
| Summenformel | CH3Cl3Si |
N,O-Bis(trimethylsilyl)trifluoracetamid, ≥ 98 %, Thermo Scientific Chemicals
CAS: 25561-30-2 Summenformel: C8H18F3NOSi2 Molekulargewicht (g/mol): 257.39 MDL-Nummer: MFCD00008269 InChI-Schlüssel: XCOBLONWWXQEBS-GHXNOFRVSA-N Synonym: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate PubChem CID: 9601896 IUPAC-Name: Trimethylsilyl-(1Z)-2,2,2-trifluor-N-trimethylsilylethanimidat SMILES: C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C
| InChI-Schlüssel | XCOBLONWWXQEBS-GHXNOFRVSA-N |
|---|---|
| IUPAC-Name | Trimethylsilyl-(1Z)-2,2,2-trifluor-N-trimethylsilylethanimidat |
| PubChem CID | 9601896 |
| CAS | 25561-30-2 |
| MDL-Nummer | MFCD00008269 |
| Molekulargewicht (g/mol) | 257.39 |
| SMILES | C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| Synonym | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
| Summenformel | C8H18F3NOSi2 |