Gefilterte Suchergebnisse
Trikaliumcitrat-Monohydrat, 99 +%, Thermo Scientific Chemicals
CAS: 6100-05-6 Summenformel: C6H7K3O8 Molekulargewicht (g/mol): 324.41 MDL-Nummer: MFCD00150442 InChI-Schlüssel: PJAHUDTUZRZBKM-UHFFFAOYSA-K Synonym: potassium citrate monohydrate,tripotassium citrate monohydrate,unii-ee90oni6ff,ee90oni6ff,citric acid tripotassium salt,urocit-k,ccris 6543,tri-potassium citrate monohydrate,potassium citrate tribasic monohydrate,citric acid, tripotassium salt, monohydrate PubChem CID: 2735208 ChEBI: CHEBI:64746 IUPAC-Name: Trimnatrium;2-hydroxypropan-1,2,3-tricarboxylat;dihydrat SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[K+].[K+].[K+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | PJAHUDTUZRZBKM-UHFFFAOYSA-K |
|---|---|
| IUPAC-Name | Trimnatrium;2-hydroxypropan-1,2,3-tricarboxylat;dihydrat |
| PubChem CID | 2735208 |
| CAS | 6100-05-6 |
| ChEBI | CHEBI:64746 |
| MDL-Nummer | MFCD00150442 |
| Molekulargewicht (g/mol) | 324.41 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[K+].[K+].[K+] |
| Synonym | potassium citrate monohydrate,tripotassium citrate monohydrate,unii-ee90oni6ff,ee90oni6ff,citric acid tripotassium salt,urocit-k,ccris 6543,tri-potassium citrate monohydrate,potassium citrate tribasic monohydrate,citric acid, tripotassium salt, monohydrate |
| Summenformel | C6H7K3O8 |
Ethylendiamintetraessigsäure, Eisen(III)-Mononatriumsalz, Thermo Scientific Chemicals
CAS: 15708-41-5 Summenformel: C10H12FeN2NaO8 Molekulargewicht (g/mol): 367.047 MDL-Nummer: MFCD00078215 InChI-Schlüssel: MKWYFZFMAMBPQK-UHFFFAOYSA-J Synonym: sodium feredetate,edta ferric sodium salt,calmosine,sodium ironedetate,edta iron iii sodium salt,ferisan,sytron,sequestrene nafe,sodium iron edta,ferric sodium edta PubChem CID: 27461 ChEBI: CHEBI:78292 IUPAC-Name: Natrium;-2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetat;eisen(3+) SMILES: C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Fe+3]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | MKWYFZFMAMBPQK-UHFFFAOYSA-J |
|---|---|
| IUPAC-Name | Natrium;-2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetat;eisen(3+) |
| PubChem CID | 27461 |
| CAS | 15708-41-5 |
| ChEBI | CHEBI:78292 |
| MDL-Nummer | MFCD00078215 |
| Molekulargewicht (g/mol) | 367.047 |
| SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Fe+3] |
| Synonym | sodium feredetate,edta ferric sodium salt,calmosine,sodium ironedetate,edta iron iii sodium salt,ferisan,sytron,sequestrene nafe,sodium iron edta,ferric sodium edta |
| Summenformel | C10H12FeN2NaO8 |
Aluminiumacetat, basisch, Hydrat, Thermo Scientific Chemicals
CAS: 142-03-0 Summenformel: C4H7AlO5 Molekulargewicht (g/mol): 162.08 MDL-Nummer: MFCD00008688 InChI-Schlüssel: HQQUTGFAWJNQIP-UHFFFAOYSA-K Synonym: aluminum acetate, basic hydrate,c4h7alo5.h2o,aluminum diacetate hydrate PubChem CID: 18502856 SMILES: CC(=O)O[Al](O)OC(C)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | HQQUTGFAWJNQIP-UHFFFAOYSA-K |
|---|---|
| PubChem CID | 18502856 |
| CAS | 142-03-0 |
| MDL-Nummer | MFCD00008688 |
| Molekulargewicht (g/mol) | 162.08 |
| SMILES | CC(=O)O[Al](O)OC(C)=O |
| Synonym | aluminum acetate, basic hydrate,c4h7alo5.h2o,aluminum diacetate hydrate |
| Summenformel | C4H7AlO5 |
Zinn(II)2-Ethylhexanoat, 96 %, Thermo Scientific Chemicals
CAS: 301-10-0 Summenformel: C16H30O4Sn Molekulargewicht (g/mol): 405.122 MDL-Nummer: MFCD00002676 InChI-Schlüssel: KSBAEPSJVUENNK-UHFFFAOYSA-L Synonym: stannous octoate,tin ii 2-ethylhexanoate,tin octoate,tin ii bis 2-ethylhexanoate,tin 2+ bis 2-ethylhexanoate,tin ethylhexanoate,tin 2-ethylhexanoate,hexanoic acid, 2-ethyl-, tin 2+ salt,stannous 2-ethylhexoate,tin ii 2-ethylhexylate PubChem CID: 9318 IUPAC-Name: 2-Ethylhexanoat; Zinn(2+) SMILES: CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Sn+2]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | KSBAEPSJVUENNK-UHFFFAOYSA-L |
|---|---|
| IUPAC-Name | 2-Ethylhexanoat; Zinn(2+) |
| PubChem CID | 9318 |
| CAS | 301-10-0 |
| MDL-Nummer | MFCD00002676 |
| Molekulargewicht (g/mol) | 405.122 |
| SMILES | CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Sn+2] |
| Synonym | stannous octoate,tin ii 2-ethylhexanoate,tin octoate,tin ii bis 2-ethylhexanoate,tin 2+ bis 2-ethylhexanoate,tin ethylhexanoate,tin 2-ethylhexanoate,hexanoic acid, 2-ethyl-, tin 2+ salt,stannous 2-ethylhexoate,tin ii 2-ethylhexylate |
| Summenformel | C16H30O4Sn |
Natriumstearat, Thermo Scientific Chemicals
CAS: 822-16-2 Summenformel: C18H35NaO2 Molekulargewicht (g/mol): 306.466 MDL-Nummer: MFCD00036404 InChI-Schlüssel: RYYKJJJTJZKILX-UHFFFAOYSA-M Synonym: sodium stearate,sodium octadecanoate,octadecanoic acid, sodium salt,stearates,stearic acid, sodium salt,prodhygine,flexichem b,stearic acid sodium salt,bonderlube 235,unii-qu7e2xa9tg PubChem CID: 2724691 IUPAC-Name: Natrium; Otadecanoat SMILES: CCCCCCCCCCCCCCCCCC(=O)[O-].[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RYYKJJJTJZKILX-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium; Otadecanoat |
| PubChem CID | 2724691 |
| CAS | 822-16-2 |
| MDL-Nummer | MFCD00036404 |
| Molekulargewicht (g/mol) | 306.466 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].[Na+] |
| Synonym | sodium stearate,sodium octadecanoate,octadecanoic acid, sodium salt,stearates,stearic acid, sodium salt,prodhygine,flexichem b,stearic acid sodium salt,bonderlube 235,unii-qu7e2xa9tg |
| Summenformel | C18H35NaO2 |
Kaliummethansulfonat, 99 %, Thermo Scientific Chemicals
CAS: 2386-56-3 Summenformel: CH3KO3S Molekulargewicht (g/mol): 134.19 MDL-Nummer: MFCD00070544 InChI-Schlüssel: XWIJIXWOZCRYEL-UHFFFAOYSA-M Synonym: potassium methanesulfonate,methanesulfonic acid, potassium salt,potassium mesylate,potassium methylsulfonate,potassium methyl sulfonate,potassium methanesulphonate,unii-s99ib3em17,methanesulfonic acid potassium salt,methanesulfonic acid,potassium salt 1:1,methanesulfonic acid, potassium salt 1:1 PubChem CID: 23666501 IUPAC-Name: Kalium;methansulfonat SMILES: CS(=O)(=O)[O-].[K+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | XWIJIXWOZCRYEL-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Kalium;methansulfonat |
| PubChem CID | 23666501 |
| CAS | 2386-56-3 |
| MDL-Nummer | MFCD00070544 |
| Molekulargewicht (g/mol) | 134.19 |
| SMILES | CS(=O)(=O)[O-].[K+] |
| Synonym | potassium methanesulfonate,methanesulfonic acid, potassium salt,potassium mesylate,potassium methylsulfonate,potassium methyl sulfonate,potassium methanesulphonate,unii-s99ib3em17,methanesulfonic acid potassium salt,methanesulfonic acid,potassium salt 1:1,methanesulfonic acid, potassium salt 1:1 |
| Summenformel | CH3KO3S |
Dinatriumhydrogencitrat-Sesquihydrat, 99 %, Thermo Scientific Chemicals
CAS: 5-4-6132 Summenformel: C12H18Na4O17 Molekulargewicht (g/mol): 526.22 MDL-Nummer: MFCD00150445 InChI-Schlüssel: HGPVLOQNBSHYEI-UHFFFAOYNA-J Synonym: unii-cz1032cekr,cz1032cekr,sodium citrate dibasic sesquihydrate,disodium citrate sesquihydrate,disodium hydrogen citrate 1.5 h2o,sodium hydrogen citrate sesquihydrate,citric acid, disodium salt, sesquihydrate,tetrasodium, 3-carboxy-3-hydroxypentanedioate, trihydrate,sodium citrate dibasic sesquihydrate, purum p.a t,1,2,3-propanetricarboxylic acid, 2-hydroxy-, disodium salt, hydrate 2:3 PubChem CID: 117063816 IUPAC-Name: Tetranatrium;-2-(carboxymethyl)-2-hydroxybutandioat;trihydrat SMILES: C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.[Na+].[Na+].[Na+].[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | HGPVLOQNBSHYEI-UHFFFAOYNA-J |
|---|---|
| IUPAC-Name | Tetranatrium;-2-(carboxymethyl)-2-hydroxybutandioat;trihydrat |
| PubChem CID | 117063816 |
| CAS | 5-4-6132 |
| MDL-Nummer | MFCD00150445 |
| Molekulargewicht (g/mol) | 526.22 |
| SMILES | C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.[Na+].[Na+].[Na+].[Na+] |
| Synonym | unii-cz1032cekr,cz1032cekr,sodium citrate dibasic sesquihydrate,disodium citrate sesquihydrate,disodium hydrogen citrate 1.5 h2o,sodium hydrogen citrate sesquihydrate,citric acid, disodium salt, sesquihydrate,tetrasodium, 3-carboxy-3-hydroxypentanedioate, trihydrate,sodium citrate dibasic sesquihydrate, purum p.a t,1,2,3-propanetricarboxylic acid, 2-hydroxy-, disodium salt, hydrate 2:3 |
| Summenformel | C12H18Na4O17 |
Trinatriumcitrat, wasserfrei, 99 %, Thermo Scientific Chemicals
CAS: 68-04-2 Summenformel: C6H5Na3O7 Molekulargewicht (g/mol): 258.07 MDL-Nummer: MFCD00012462 InChI-Schlüssel: HRXKRNGNAMMEHJ-UHFFFAOYSA-K Synonym: sodium citrate,trisodium citrate,citrosodine,sodium citrate anhydrous,citrosodina,natrocitral,citnatin,citreme,citrosodna,trisodium citrate, anhydrous PubChem CID: 6224 ChEBI: CHEBI:53258 IUPAC-Name: trisodium 2-hydroxypropane-1,2,3-tricarboxylate SMILES: [Na+].[Na+].[Na+].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | HRXKRNGNAMMEHJ-UHFFFAOYSA-K |
|---|---|
| IUPAC-Name | trisodium 2-hydroxypropane-1,2,3-tricarboxylate |
| PubChem CID | 6224 |
| CAS | 68-04-2 |
| ChEBI | CHEBI:53258 |
| MDL-Nummer | MFCD00012462 |
| Molekulargewicht (g/mol) | 258.07 |
| SMILES | [Na+].[Na+].[Na+].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O |
| Synonym | sodium citrate,trisodium citrate,citrosodine,sodium citrate anhydrous,citrosodina,natrocitral,citnatin,citreme,citrosodna,trisodium citrate, anhydrous |
| Summenformel | C6H5Na3O7 |
Dinatriumterephthalat, 99+ %, Thermo Scientific Chemicals
CAS: 10028-70-3 Summenformel: C8H4Na2O4 Molekulargewicht (g/mol): 210.096 MDL-Nummer: MFCD00013137 InChI-Schlüssel: VIQSRHWJEKERKR-UHFFFAOYSA-L Synonym: disodium terephthalate,terephthalic acid disodium salt,terephthalic acid, disodium salt,sodium terephthalate,unii-gi30zoc0oo,gi30zoc0oo,disodiumterephthalate,acmc-1bvw0,disodium terephthalate 5g,1,4-benzenedicarboxylicacid, sodium salt 1:? PubChem CID: 82305 IUPAC-Name: disodium;terephthalat SMILES: C1=CC(=CC=C1C(=O)[O-])C(=O)[O-].[Na+].[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | VIQSRHWJEKERKR-UHFFFAOYSA-L |
|---|---|
| IUPAC-Name | disodium;terephthalat |
| PubChem CID | 82305 |
| CAS | 10028-70-3 |
| MDL-Nummer | MFCD00013137 |
| Molekulargewicht (g/mol) | 210.096 |
| SMILES | C1=CC(=CC=C1C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| Synonym | disodium terephthalate,terephthalic acid disodium salt,terephthalic acid, disodium salt,sodium terephthalate,unii-gi30zoc0oo,gi30zoc0oo,disodiumterephthalate,acmc-1bvw0,disodium terephthalate 5g,1,4-benzenedicarboxylicacid, sodium salt 1:? |
| Summenformel | C8H4Na2O4 |
Eisen(II)-phthalcyanin, 96 %, Thermo Scientific Chemicals
CAS: 132-16-1 Summenformel: C32H16FeN8 Molekulargewicht (g/mol): 568.38 MDL-Nummer: MFCD00015953 InChI-Schlüssel: MIINHRNQLVVCEW-UHFFFAOYSA-N Synonym: iron phthalocyanine,iron ii phthalocyanine,ferrous phthalocyanine,phthalocyanine iron ii,fepc,29h,31h-phthalocyaninato 2--n29,n30,n31,n32 iron,iron, 29h,31h-phthalocyaninato 2--n29,n39,n31,n32-, sp-4-1,iron, 29h,31h-phthalocyaninato 2--kappan29,kappan30,kappan31,kappan32-, sp-4-1 PubChem CID: 2735065 IUPAC-Name: λ²-Eisen(2+)-2,11,20,29,37,38,39,40-octaazanonacyclo[28.6.1.1³,¹⁰.1¹²,¹⁹.1²¹,²⁸.0⁴,⁹.0¹³,¹⁸.0²²,²⁷.0³¹,³⁶]tetraconta-1(36),2,4,6,8,10(40),11,13,15,17,19,21(38),22,24,26,28,30,32,34-nonadecaen-37,39-diid SMILES: [Fe++].[N-]1C2=NC3=NC(=NC4=C5C=CC=CC5=C([N-]4)N=C4N=C(N=C1C1=CC=CC=C21)C1=CC=CC=C41)C1=CC=CC=C31
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | MIINHRNQLVVCEW-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | λ²-Eisen(2+)-2,11,20,29,37,38,39,40-octaazanonacyclo[28.6.1.1³,¹⁰.1¹²,¹⁹.1²¹,²⁸.0⁴,⁹.0¹³,¹⁸.0²²,²⁷.0³¹,³⁶]tetraconta-1(36),2,4,6,8,10(40),11,13,15,17,19,21(38),22,24,26,28,30,32,34-nonadecaen-37,39-diid |
| PubChem CID | 2735065 |
| CAS | 132-16-1 |
| MDL-Nummer | MFCD00015953 |
| Molekulargewicht (g/mol) | 568.38 |
| SMILES | [Fe++].[N-]1C2=NC3=NC(=NC4=C5C=CC=CC5=C([N-]4)N=C4N=C(N=C1C1=CC=CC=C21)C1=CC=CC=C41)C1=CC=CC=C31 |
| Synonym | iron phthalocyanine,iron ii phthalocyanine,ferrous phthalocyanine,phthalocyanine iron ii,fepc,29h,31h-phthalocyaninato 2--n29,n30,n31,n32 iron,iron, 29h,31h-phthalocyaninato 2--n29,n39,n31,n32-, sp-4-1,iron, 29h,31h-phthalocyaninato 2--kappan29,kappan30,kappan31,kappan32-, sp-4-1 |
| Summenformel | C32H16FeN8 |
n-Butyllithium, 2.5-M-Lösung in Hexanen, AcroSeal™, Thermo Scientific Chemicals
CAS: 109-72-8 Summenformel: C4H9Li Molekulargewicht (g/mol): 64.06 MDL-Nummer: MFCD00009414 InChI-Schlüssel: MZRVEZGGRBJDDB-UHFFFAOYSA-N Synonym: n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc PubChem CID: 61028 SMILES: [Li]CCCC
| InChI-Schlüssel | MZRVEZGGRBJDDB-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 61028 |
| CAS | 109-72-8 |
| MDL-Nummer | MFCD00009414 |
| Molekulargewicht (g/mol) | 64.06 |
| SMILES | [Li]CCCC |
| Synonym | n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc |
| Summenformel | C4H9Li |
n-Butyllithium, 1.6-M-Lösung in Hexanen, AcroSeal™, Thermo Scientific Chemicals
CAS: 109-72-8 Summenformel: C4H9Li Molekulargewicht (g/mol): 64.06 MDL-Nummer: MFCD00009414 InChI-Schlüssel: MZRVEZGGRBJDDB-UHFFFAOYSA-N Synonym: n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc PubChem CID: 61028 SMILES: [Li]CCCC
| InChI-Schlüssel | MZRVEZGGRBJDDB-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 61028 |
| CAS | 109-72-8 |
| MDL-Nummer | MFCD00009414 |
| Molekulargewicht (g/mol) | 64.06 |
| SMILES | [Li]CCCC |
| Synonym | n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc |
| Summenformel | C4H9Li |
Lithiumdiisopropylamid, 2 M Lösung in THF/n-Heptan/Ethylbenzol, AcroSeal™, Thermo Scientific Chemicals
CAS: 4111-54-0 Summenformel: C6H14LiN Molekulargewicht (g/mol): 107.125 MDL-Nummer: MFCD00064449 InChI-Schlüssel: ZCSHNCUQKCANBX-UHFFFAOYSA-N Synonym: lithium diisopropylamide,unii-ol028kiw1i,lithium di-isopropylamide,lithium diisopropyl amide,2-propanamine, n-1-methylethyl-, lithium salt,ol028kiw1i,lithium di propan-2-yl azanide,2-propanamine, n-1-methylethyl-, lithium salt 1:1,lithium n,n-diisopropylamide,ipr2nli PubChem CID: 2724682 IUPAC-Name: Lithium;di(Propan-2-yl)Azanid SMILES: [Li+].CC(C)[N-]C(C)C
| InChI-Schlüssel | ZCSHNCUQKCANBX-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Lithium;di(Propan-2-yl)Azanid |
| PubChem CID | 2724682 |
| CAS | 4111-54-0 |
| MDL-Nummer | MFCD00064449 |
| Molekulargewicht (g/mol) | 107.125 |
| SMILES | [Li+].CC(C)[N-]C(C)C |
| Synonym | lithium diisopropylamide,unii-ol028kiw1i,lithium di-isopropylamide,lithium diisopropyl amide,2-propanamine, n-1-methylethyl-, lithium salt,ol028kiw1i,lithium di propan-2-yl azanide,2-propanamine, n-1-methylethyl-, lithium salt 1:1,lithium n,n-diisopropylamide,ipr2nli |
| Summenformel | C6H14LiN |
Diisobutylaluminiumhydrid, Lösung mit 20 Gew.-% in Toluol, 1.2 M, AcroSeal™, Thermo Scientific Chemicals
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Chemischer Name oder Material | Diisobutylaluminium hydride |
|---|---|
| Siedepunkt | 110.0°C |
| Dichte | 0.8480g/mL |
| EINECS-Nummer | 214-729-9 |
| Relative Dichte | 0.848 |
| Molekulargewicht (g/mol) | 142.22 |
| Merck Index | 15, 3212 |
| Formelmasse | 142.22 |
| Gesundheitsgefahr 2 | GHS-H-Hinweis Verursacht schwere Verätzungen der Haut und schwere Augenschäden. Kann beim Verschlucken und Eindringen in die Atemwege tödlich sein. Kann die Organe bei längerer oder wiederholter Exposition schädigen. Kann vermutlich das Kind im Mutterleib schädigen. Kann Schläfrigkeit und Benommenheit verursachen |
| Gesundheitsgefahr 3 | GHS-P-Hinweis BEI VERSCHLUCKEN: Mund spülen. KEIN Erbrechen herbeiführen. Augenschutz/Gesichtsschutz tragen. BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang vorsichtig mit Wasser ausspülen. Eventuell vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter ausspülen. |
| Löslichkeitsinformationen | Solubility in water: reacts violently. Other solubilities: miscible with saturated aliphatic and aromatic,hydrocarbons |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Physikalische Form | Lösung |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 108-88-3 |
| MDL-Nummer | MFCD00008928 |
| Strukturformel | [(CH3)2CHCH2]2AIH |
| Flammpunkt | 4°C |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Summenformel | C8H19Al |
Trimethylaluminium, 1.0 M Lösung in Heptan, AcroSeal™, Thermo Scientific Chemicals
CAS: 75-24-1 Summenformel: C3H9Al Molekulargewicht (g/mol): 72.087 MDL-Nummer: MFCD00008252 InChI-Schlüssel: JLTRXTDYQLMHGR-UHFFFAOYSA-N Synonym: trimethylaluminum,trimethylaluminium,aluminum, trimethyl,trimethylalane,unii-av210lg46j,ch3 3al,aluminum trimethanide,aluminum trimethyl,trimethylaluminum solution,trimethylaluminum, elec. gr. PubChem CID: 16682925 IUPAC-Name: Trimethylaluman SMILES: C[Al](C)C
| InChI-Schlüssel | JLTRXTDYQLMHGR-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Trimethylaluman |
| PubChem CID | 16682925 |
| CAS | 75-24-1 |
| MDL-Nummer | MFCD00008252 |
| Molekulargewicht (g/mol) | 72.087 |
| SMILES | C[Al](C)C |
| Synonym | trimethylaluminum,trimethylaluminium,aluminum, trimethyl,trimethylalane,unii-av210lg46j,ch3 3al,aluminum trimethanide,aluminum trimethyl,trimethylaluminum solution,trimethylaluminum, elec. gr. |
| Summenformel | C3H9Al |