Reaktive Nichtmetallsalze
Gefilterte Suchergebnisse
Phosphonitrilchlorid-Trimer, 98%
CAS: 940-71-6 Summenformel: Cl6N3P3 Molekulargewicht (g/mol): 347.65 MDL-Nummer: MFCD00006474 InChI-Schlüssel: UBIJTWDKTYCPMQ-UHFFFAOYSA-N Synonym: phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer PubChem CID: 220225 IUPAC-Name: 2,2,4,4,6,6-Hexachlor-1,3,5-triazo-2$l^{5},4$l^{5},6$l^{5}-triphosphocyclohexa-1,3,5-trien SMILES: N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl
| InChI-Schlüssel | UBIJTWDKTYCPMQ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2,2,4,4,6,6-Hexachlor-1,3,5-triazo-2$l^{5},4$l^{5},6$l^{5}-triphosphocyclohexa-1,3,5-trien |
| PubChem CID | 220225 |
| CAS | 940-71-6 |
| MDL-Nummer | MFCD00006474 |
| Molekulargewicht (g/mol) | 347.65 |
| SMILES | N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl |
| Synonym | phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer |
| Summenformel | Cl6N3P3 |
Sulfurylchlorid, 98.5 %, Thermo Scientific Chemicals
CAS: 7791-25-5 Summenformel: Cl2O2S Molekulargewicht (g/mol): 134.96 MDL-Nummer: MFCD00011451 InChI-Schlüssel: YBBRCQOCSYXUOC-UHFFFAOYSA-N Synonym: sulfuryl chloride,sulfonyl chloride,sulphuryl dichloride,sulphuryl chloride,sulfonyl dichloride,sulfuric dichloride,sulfuric oxychloride,sulfurylchlorid,caswell no. 816,sulfurylchloride PubChem CID: 24648 ChEBI: CHEBI:29291 IUPAC-Name: Sulfuryldichlorid SMILES: ClS(Cl)(=O)=O
| InChI-Schlüssel | YBBRCQOCSYXUOC-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Sulfuryldichlorid |
| PubChem CID | 24648 |
| CAS | 7791-25-5 |
| ChEBI | CHEBI:29291 |
| MDL-Nummer | MFCD00011451 |
| Molekulargewicht (g/mol) | 134.96 |
| SMILES | ClS(Cl)(=O)=O |
| Synonym | sulfuryl chloride,sulfonyl chloride,sulphuryl dichloride,sulphuryl chloride,sulfonyl dichloride,sulfuric dichloride,sulfuric oxychloride,sulfurylchlorid,caswell no. 816,sulfurylchloride |
| Summenformel | Cl2O2S |
Sulfurylchlorid, 97 %, Thermo Scientific Chemicals
CAS: 7791-25-5 Summenformel: Cl2O2S Molekulargewicht (g/mol): 134.96 MDL-Nummer: MFCD00011451 InChI-Schlüssel: YBBRCQOCSYXUOC-UHFFFAOYSA-N Synonym: sulfuryl chloride,sulfonyl chloride,sulphuryl dichloride,sulphuryl chloride,sulfonyl dichloride,sulfuric dichloride,sulfuric oxychloride,sulfurylchlorid,caswell no. 816,sulfurylchloride PubChem CID: 24648 ChEBI: CHEBI:29291 IUPAC-Name: Sulfuryldichlorid SMILES: ClS(Cl)(=O)=O
| InChI-Schlüssel | YBBRCQOCSYXUOC-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Sulfuryldichlorid |
| PubChem CID | 24648 |
| CAS | 7791-25-5 |
| ChEBI | CHEBI:29291 |
| MDL-Nummer | MFCD00011451 |
| Molekulargewicht (g/mol) | 134.96 |
| SMILES | ClS(Cl)(=O)=O |
| Synonym | sulfuryl chloride,sulfonyl chloride,sulphuryl dichloride,sulphuryl chloride,sulfonyl dichloride,sulfuric dichloride,sulfuric oxychloride,sulfurylchlorid,caswell no. 816,sulfurylchloride |
| Summenformel | Cl2O2S |
Phosphornitrilchlorid-Trimer, 98 %, Thermo Scientific Chemicals
CAS: 940-71-6 Summenformel: Cl6N3P3 Molekulargewicht (g/mol): 347.642 MDL-Nummer: MFCD00006474 InChI-Schlüssel: UBIJTWDKTYCPMQ-UHFFFAOYSA-N Synonym: phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer PubChem CID: 220225 IUPAC-Name: 2,2,4,4,6,6-Hexachlor-1,3,5-triazo-2$l^{5},4$l^{5},6$l^{5}-triphosphocyclohexa-1,3,5-trien SMILES: N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl
| InChI-Schlüssel | UBIJTWDKTYCPMQ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2,2,4,4,6,6-Hexachlor-1,3,5-triazo-2$l^{5},4$l^{5},6$l^{5}-triphosphocyclohexa-1,3,5-trien |
| PubChem CID | 220225 |
| CAS | 940-71-6 |
| MDL-Nummer | MFCD00006474 |
| Molekulargewicht (g/mol) | 347.642 |
| SMILES | N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl |
| Synonym | phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer |
| Summenformel | Cl6N3P3 |
Sulfurylchlorid, 1.0 M-Lösung in Dichlormethan, AcroSeal™, Thermo Scientific Chemicals
CAS: 7791-25-5 | Cl2O2S | 134.96 g/mol
| Chemischer Name oder Material | Sulfuryl chloride |
|---|---|
| InChI-Schlüssel | YBBRCQOCSYXUOC-UHFFFAOYSA-N |
| IUPAC-Name | Sulfuryldichlorid |
| Dichte | 1.3520g/mL |
| EINECS-Nummer | 232-245-6 |
| Aussehen | Clear pale yellow solution |
| Relative Dichte | 1.352 |
| ChEBI | CHEBI:29291 |
| Molekulargewicht (g/mol) | 134.96 |
| SMILES | ClS(Cl)(=O)=O |
| Merck Index | 15, 9110 |
| Namenshinweis | 1.0M Solution in Dichloromethane |
| Formelmasse | 134.97 |
| Gesundheitsgefahr 2 | GHS H-Satz Kann vermutlich Krebs erzeugen. Verursacht schwere Verätzungen der Haut und schwere Augenschäden. Kann Schläfrigkeit oder Benommenheit verursachen. Giftig bei Einatmen. Reagiert heftig mit Wasser. |
| Gesundheitsgefahr 3 | GHS-P-Hinweis Schutzhandschuhe/Schutzkleidung/Augenschutz/Gesichtsschutz tragen. BEI VERSCHLUCKEN: Mund ausspülen. KEIN Erbrechen herbeiführen. BEI KONTAKT MIT DEN AUGEN:Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter ausspülen. |
| PubChem CID | 24648 |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Concentration or Composition (by Analyte or Components) | 1M, exact strength on the certificate of analysis |
| CAS | 75-09-2 |
| MDL-Nummer | MFCD00011451 |
| Strukturformel | SO2Cl2 |
| Synonym | sulfuryl chloride,sulfonyl chloride,sulphuryl dichloride,sulphuryl chloride,sulfonyl dichloride,sulfuric dichloride,sulfuric oxychloride,sulfurylchlorid,caswell no. 816,sulfurylchloride |
| Summenformel | Cl2O2S |
Thiophosgen, 85 %, Thermo Scientific Chemicals
CAS: 463-71-8 MDL-Nummer: MFCD00004918 InChI-Schlüssel: ZWZVWGITAAIFPS-UHFFFAOYSA-N Synonym: thiophosgene,carbonothioic dichloride,carbon chlorosulfide,thiocarbonyl chloride,thiocarbonic dichloride,dichlorothiocarbonyl,thiofosgen,phosgene, thio,thiokarbonylchlorid,carbonyl chloride, thio PubChem CID: 10040 ChEBI: CHEBI:29366 IUPAC-Name: Thiocarbonyldichlorid SMILES: C(=S)(Cl)Cl
| InChI-Schlüssel | ZWZVWGITAAIFPS-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Thiocarbonyldichlorid |
| PubChem CID | 10040 |
| CAS | 463-71-8 |
| ChEBI | CHEBI:29366 |
| MDL-Nummer | MFCD00004918 |
| SMILES | C(=S)(Cl)Cl |
| Synonym | thiophosgene,carbonothioic dichloride,carbon chlorosulfide,thiocarbonyl chloride,thiocarbonic dichloride,dichlorothiocarbonyl,thiofosgen,phosgene, thio,thiokarbonylchlorid,carbonyl chloride, thio |
| Chemischer Name oder Material | Phosphorus tribromide |
|---|---|
| InChI-Schlüssel | IPNPIHIZVLFAFP-UHFFFAOYSA-N |
| IUPAC-Name | Tribromophosphan |
| Dichte | 1.4880g/mL |
| EINECS-Nummer | 232-178-2 |
| Relative Dichte | 1.488 |
| Molekulargewicht (g/mol) | 270.69 |
| SMILES | P(Br)(Br)Br |
| Merck Index | 15, 7469 |
| Namenshinweis | 1.0M Solution in Dichloromethane |
| Formelmasse | 270.69 |
| Gesundheitsgefahr 2 | GHS-H-Hinweis Kann bei Einatmen Krebs erzeugen. Verursacht schwere Verätzungen der Haut und schwere Augenschäden. Kann die Atemwege reizen. Kann Schläfrigkeit und Benommenheit verursachen. Reagiert heftig mit Wasser. |
| Gesundheitsgefahr 3 | GHS-P-Hinweis Schutzhandschuhe/Schutzkleidung/Augenschutz/Gesichtsschutz tragen. BEI VERSCHLUCKEN: Mund ausspülen. KEIN Erbrechen herbeiführen. BEI BERÜHRUNG MIT DER HAUT (oder dem Haar):Alle kontaminierten Kleidungsstücke sofort ausziehen. Haut mit Wasser abspülen. |
| PubChem CID | 24614 |
| Farbe | Farblos bis hellgelb |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Concentration or Composition (by Analyte or Components) | 0.9 to 1.1M |
| Physikalische Form | Flüssigkeit |
| CAS | 75-09-2 |
| MDL-Nummer | MFCD00011436 |
| Strukturformel | PBr2 |
| Synonym | phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine |
| Summenformel | Br3P |
Phosphortribromid, 99 %, Thermo Scientific Chemicals
CAS: 7789-60-8 Summenformel: Br3P Molekulargewicht (g/mol): 270.69 MDL-Nummer: MFCD00011436 InChI-Schlüssel: IPNPIHIZVLFAFP-UHFFFAOYSA-N Synonym: phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine PubChem CID: 24614 IUPAC-Name: Tribromophosphan SMILES: P(Br)(Br)Br
| InChI-Schlüssel | IPNPIHIZVLFAFP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Tribromophosphan |
| PubChem CID | 24614 |
| CAS | 7789-60-8 |
| MDL-Nummer | MFCD00011436 |
| Molekulargewicht (g/mol) | 270.69 |
| SMILES | P(Br)(Br)Br |
| Synonym | phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine |
| Summenformel | Br3P |