Metallorganische Verbindungen
Gefilterte Suchergebnisse
| Chemischer Name oder Material | Lithium bis(trimethylsilyl)amide |
|---|---|
| InChI-Schlüssel | YNESATAKKCNGOF-UHFFFAOYSA-N |
| IUPAC-Name | Lithium; Bis(trimethylsilyl)azanid |
| Siedepunkt | 65.0°C |
| Dichte | 0.9000g/mL |
| EINECS-Nummer | 223-725-6 |
| Relative Dichte | 0.9 |
| Molekulargewicht (g/mol) | 167.33 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Formelmasse | 167.33 |
| Gesundheitsgefahr 2 | GHS-H-Hinweis Flüssigkeit und Dampf leicht entzündbar. Verursacht schwere Verätzungen der Haut und schwere Augenschäden. Kann die Atemwege reizen. Verdacht auf krebserregende Wirkung. Kann explosionsfähige Peroxide bilden. Reagiert heftig mit Wasser.<br/ |
| Gesundheitsgefahr 3 | GHS-P-Hinweis Von Hitze/Funken/offenen Flammen/heißen Oberflächen fernhalten. - Rauchen verboten. BEI BERÜHRUNG DER HAUT (oder des Haars): Alle kontaminierten Kleidungsstücke sofort ausziehen. Haut mit Wasser abwaschen [oder duschen]. Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| PubChem CID | 2733832 |
| Löslichkeitsinformationen | Solubility in water: reacts. |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| CAS | 109-99-9 |
| Strukturformel | ((CH3)3Si)2NLi |
| Flammpunkt | −21°C |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| Summenformel | C6H18LiNSi2 |
3-(Trimethoxysilyl)propylmethacrylat, 98 %, Thermo Scientific Chemicals
CAS: 2530-85-0 Summenformel: C10H20O5Si Molekulargewicht (g/mol): 248.35 MDL-Nummer: MFCD00008593 InChI-Schlüssel: XDLMVUHYZWKMMD-UHFFFAOYSA-N Synonym: 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester PubChem CID: 17318 IUPAC-Name: 3-Trimethoxysilylpropyl-2-methylprop-2-enoat SMILES: CC(=C)C(=O)OCCC[Si](OC)(OC)OC
| InChI-Schlüssel | XDLMVUHYZWKMMD-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Trimethoxysilylpropyl-2-methylprop-2-enoat |
| PubChem CID | 17318 |
| CAS | 2530-85-0 |
| MDL-Nummer | MFCD00008593 |
| Molekulargewicht (g/mol) | 248.35 |
| SMILES | CC(=C)C(=O)OCCC[Si](OC)(OC)OC |
| Synonym | 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester |
| Summenformel | C10H20O5Si |
Diisobutylaluminiumhydrid, Lösung mit 20 Gew.-% in Toluol, 1.2 M, AcroSeal™, Thermo Scientific Chemicals
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Chemischer Name oder Material | Diisobutylaluminium hydride |
|---|---|
| Siedepunkt | 110.0°C |
| Dichte | 0.8480g/mL |
| EINECS-Nummer | 214-729-9 |
| Relative Dichte | 0.848 |
| Molekulargewicht (g/mol) | 142.22 |
| Merck Index | 15, 3212 |
| Formelmasse | 142.22 |
| Gesundheitsgefahr 2 | GHS H-Satz Verursacht schwere Verätzungen der Haut und schwere Augenschäden. Kann bei Verschlucken und Eindringen in die Atemwege tödlich sein. Kann die Organe bei längerer oder wiederholter Exposition schädigen. Kann vermutlich das Kind im Mutterleib schädigen. Kann Schläfrigkeit und Benommenheit verursachen |
| Gesundheitsgefahr 3 | GHS-P-Hinweis BEI VERSCHLUCKEN: Mund spülen. KEIN Erbrechen herbeiführen. Augenschutz/Gesichtsschutz tragen. BEI KONTAKT MIT DEN AUGEN:Einige Minuten lang vorsichtig mit Wasser ausspülen. Eventuell vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter ausspülen. |
| Löslichkeitsinformationen | Solubility in water: reacts violently. Other solubilities: miscible with saturated aliphatic and aromatic,hydrocarbons |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Physikalische Form | Lösung |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 108-88-3 |
| MDL-Nummer | MFCD00008928 |
| Strukturformel | [(CH3)2CHCH2]2AIH |
| Flammpunkt | 4°C |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Summenformel | C8H19Al |
3-Aminopropyltriethoxysilan, 99 %, Thermo Scientific Chemicals
CAS: 919-30-2 Summenformel: C9H23NO3Si Molekulargewicht (g/mol): 221.37 MDL-Nummer: MFCD00008207,MFCD01324904 InChI-Schlüssel: WYTZZXDRDKSJID-UHFFFAOYSA-N Synonym: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC-Name: 3-Triethoxysilylpropan-1-amin SMILES: CCO[Si](CCCN)(OCC)OCC
| InChI-Schlüssel | WYTZZXDRDKSJID-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 3-Triethoxysilylpropan-1-amin |
| PubChem CID | 13521 |
| CAS | 919-30-2 |
| MDL-Nummer | MFCD00008207,MFCD01324904 |
| Molekulargewicht (g/mol) | 221.37 |
| SMILES | CCO[Si](CCCN)(OCC)OCC |
| Synonym | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
| Summenformel | C9H23NO3Si |
Diisobutylaluminiumhydrid, 1M Lösung in Cyclohexan, AcroSeal™, Thermo Scientific Chemicals
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Chemischer Name oder Material | Diisobutylaluminium hydride |
|---|---|
| Dichte | 0.7010g/mL |
| EINECS-Nummer | 214-729-9 |
| Relative Dichte | 0.701 |
| Molekulargewicht (g/mol) | 142.22 |
| Merck Index | 15, 3212 |
| Namenshinweis | 1M Solution in Hexane |
| Formelmasse | 142.22 |
| Gesundheitsgefahr 2 | GHS H Statement May be fatal if swallowed and enters airways. Toxic to aquatic life with long lasting effects. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. May cause damage to organs through p |
| Gesundheitsgefahr 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective g |
| Löslichkeitsinformationen | Solubility in water: reacts |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Physikalische Form | Lösung |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 110-54-3 |
| MDL-Nummer | MFCD00008928 |
| Strukturformel | [(CH3)2CHCH2]2AlH |
| Flammpunkt | −23°C |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Summenformel | C8H19Al |
| Schmelzpunkt | -70.0°C |
Hexamethyldisiloxan, ≥ 98 %, Thermo Scientific Chemicals
CAS: 107-46-0 InChI-Schlüssel: UQEAIHBTYFGYIE-UHFFFAOYSA-N Synonym: hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide PubChem CID: 24764 ChEBI: CHEBI:78002 IUPAC-Name: Trimethyl(trimethylsilyloxy)silan SMILES: C[Si](C)(C)O[Si](C)(C)C
| InChI-Schlüssel | UQEAIHBTYFGYIE-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Trimethyl(trimethylsilyloxy)silan |
| PubChem CID | 24764 |
| CAS | 107-46-0 |
| ChEBI | CHEBI:78002 |
| SMILES | C[Si](C)(C)O[Si](C)(C)C |
| Synonym | hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide |
Chlorotrimethylsilan, 98 %, Thermo Scientific Chemicals
CAS: 75-77-4 Summenformel: C3H9ClSi Molekulargewicht (g/mol): 108.64 MDL-Nummer: MFCD00000502 InChI-Schlüssel: IJOOHPMOJXWVHK-UHFFFAOYSA-N Synonym: trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl PubChem CID: 6397 ChEBI: CHEBI:85069 IUPAC-Name: Chlor(trimethyl)silan SMILES: C[Si](C)(C)Cl
| InChI-Schlüssel | IJOOHPMOJXWVHK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Chlor(trimethyl)silan |
| PubChem CID | 6397 |
| CAS | 75-77-4 |
| ChEBI | CHEBI:85069 |
| MDL-Nummer | MFCD00000502 |
| Molekulargewicht (g/mol) | 108.64 |
| SMILES | C[Si](C)(C)Cl |
| Synonym | trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl |
| Summenformel | C3H9ClSi |
Hexamethyldisilazan, 98 %, Thermo Scientific Chemicals
CAS: 999-97-3 Summenformel: C6H19NSi2 Molekulargewicht (g/mol): 161.395 MDL-Nummer: MFCD00008259 InChI-Schlüssel: FFUAGWLWBBFQJT-UHFFFAOYSA-N Synonym: hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl PubChem CID: 13838 ChEBI: CHEBI:85068 IUPAC-Name: [Dimethyl-(trimethylsilylamino)silyl]methan SMILES: C[Si](C)(C)N[Si](C)(C)C
| InChI-Schlüssel | FFUAGWLWBBFQJT-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | [Dimethyl-(trimethylsilylamino)silyl]methan |
| PubChem CID | 13838 |
| CAS | 999-97-3 |
| ChEBI | CHEBI:85068 |
| MDL-Nummer | MFCD00008259 |
| Molekulargewicht (g/mol) | 161.395 |
| SMILES | C[Si](C)(C)N[Si](C)(C)C |
| Synonym | hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl |
| Summenformel | C6H19NSi2 |
N-Methyl-N-(trimethylsilyl)trifluoracetamid, 97 %, Thermo Scientific Chemicals
CAS: 24589-78-4 Summenformel: C6H12F3NOSi Molekulargewicht (g/mol): 199.25 MDL-Nummer: MFCD00000411 InChI-Schlüssel: MSPCIZMDDUQPGJ-UHFFFAOYSA-N Synonym: mstfa,n-methyl-n-trimethylsilyl trifluoroacetamide,2,2,2-trifluoro-n-methyl-n-trimethylsilyl acetamide,n-methyl-n-trimethylsilyltrifluoroacetamide,acetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl,n-methyl-n-trimethylsilyl-trifluoroacetamide,acmc-209tfm PubChem CID: 32510 ChEBI: CHEBI:85064 IUPAC-Name: 2,2,2-Trifluor-N-methyl-N-trimethylsilylacetamid SMILES: CN(C(=O)C(F)(F)F)[Si](C)(C)C
| InChI-Schlüssel | MSPCIZMDDUQPGJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2,2,2-Trifluor-N-methyl-N-trimethylsilylacetamid |
| PubChem CID | 32510 |
| CAS | 24589-78-4 |
| ChEBI | CHEBI:85064 |
| MDL-Nummer | MFCD00000411 |
| Molekulargewicht (g/mol) | 199.25 |
| SMILES | CN(C(=O)C(F)(F)F)[Si](C)(C)C |
| Synonym | mstfa,n-methyl-n-trimethylsilyl trifluoroacetamide,2,2,2-trifluoro-n-methyl-n-trimethylsilyl acetamide,n-methyl-n-trimethylsilyltrifluoroacetamide,acetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl,n-methyl-n-trimethylsilyl-trifluoroacetamide,acmc-209tfm |
| Summenformel | C6H12F3NOSi |
N,O-Bis-(Trimethylsilyl)-Trifluoracetamid, mit 1 % Trimethylsilylchlorid, Thermo Scientific Chemicals
CAS: 25561-30-2 Summenformel: C8H18F3NOSi2 Molekulargewicht (g/mol): 257.4 MDL-Nummer: MFCD00008269 InChI-Schlüssel: XCOBLONWWXQEBS-GHXNOFRVSA-N Synonym: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate PubChem CID: 9601896 IUPAC-Name: Trimethylsilyl-(1Z)-2,2,2-trifluor-N-trimethylsilylethanimidat SMILES: C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C
| InChI-Schlüssel | XCOBLONWWXQEBS-GHXNOFRVSA-N |
|---|---|
| IUPAC-Name | Trimethylsilyl-(1Z)-2,2,2-trifluor-N-trimethylsilylethanimidat |
| PubChem CID | 9601896 |
| CAS | 25561-30-2 |
| MDL-Nummer | MFCD00008269 |
| Molekulargewicht (g/mol) | 257.4 |
| SMILES | C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| Synonym | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
| Summenformel | C8H18F3NOSi2 |
Bis-(trimethylsilyl)-lithiumamid, 1 M Lösung in THF/Ethylbenzol, AcroSeal™, Thermo Scientific Chemicals
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| Chemischer Name oder Material | Bis-(trimethylsilyl)-lithiumamid |
|---|---|
| InChI-Schlüssel | YNESATAKKCNGOF-UHFFFAOYSA-N |
| IUPAC-Name | Lithium; Bis(trimethylsilyl)azanid |
| Dichte | 0.8900 g/ml |
| EINECS-Nummer | 223-725-6 |
| Relative Dichte | 0.89 |
| Molekulargewicht (g/mol) | 167.33 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Namenshinweis | 1 M-Lösung in THF/Ethylbenzol |
| Formelmasse | 167.33 |
| Gesundheitsgefahr 2 | GHS-H-Satz Verursacht schwere Verätzungen der Haut und schwere Augenschäden Kann die Atemwege reizen. Leicht entzündliche Flüssigkeiten oder Dämpfe. Verdacht auf krebserregende Wirkung. Reagiert heftig mit Wasser. Kann explosionsfähige Peroxide bilden. Kann Schläfrigkeit oder Benommenheit verursachen. |
| Gesundheitsgefahr 3 | GHS-P-Satz Von Hitze/Funken/offenen Flammen/heißen Oberflächen fernhalten. - Rauchen verboten. Schutzhandschuhe/Augenschutz/Gesichtsschutz tragen. BEI BERÜHRUNG MIT DER HAUT (oder dem Haar): Alle kontaminierten Kleidungsstücke sofort ausziehen. Haut mit Wasser abwaschen/duschen. Sofort GIFTINFORMATIONSZENTRUM/Arzt anrufen. BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser ausspülen. Eventuell Vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter ausspülen. BEI VERSCHLUCKEN: Mund ausspülen. KEIN Erbrechen herbeiführen. |
| PubChem CID | 2733832 |
| Löslichkeitsinformationen | Solubility in water: decomposes |
| Farbe | Gelb bis Braun |
| Gesundheitsgefahr 1 | GHS-Signalwort: Gefahr |
| Physikalische Form | Trübe Lösung |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| CAS | 100-41-4 |
| MDL-Nummer | MFCD00008261 |
| Flammpunkt | −21 °C |
| Reinheit (%) | 18 bis 22 % aktive Base (als LiNSi) |
| Synonym | Lithiumbistrimethylsilylamid,Lithiumhexamethyldisilazid,Lithium-bis-trimethylsilyl-Amid,Lithium-bis-Trimethylsilyl-Azanid,Lithium-bis-Trimethylsilylamid,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| TSCA | TSCA |
| Summenformel | C6H18LiNSi2 |
Bromotrimethylsilan, 98 %, Thermo Scientific Chemicals
CAS: 2857-97-8 Summenformel: C3H9BrSi Molekulargewicht (g/mol): 153.1 InChI-Schlüssel: IYYIVELXUANFED-UHFFFAOYSA-N Synonym: trimethylsilyl bromide,trimethylbromosilane,silane, bromotrimethyl,trimethylsilicon bromide,tmsbr,trimethylsilylbromide,bromotrimethyl silane,tmbs,bromo trimethyl silane,tms bromide PubChem CID: 76113 IUPAC-Name: Brom(trimethyl)silan SMILES: C[Si](C)(C)Br
| InChI-Schlüssel | IYYIVELXUANFED-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Brom(trimethyl)silan |
| PubChem CID | 76113 |
| CAS | 2857-97-8 |
| Molekulargewicht (g/mol) | 153.1 |
| SMILES | C[Si](C)(C)Br |
| Synonym | trimethylsilyl bromide,trimethylbromosilane,silane, bromotrimethyl,trimethylsilicon bromide,tmsbr,trimethylsilylbromide,bromotrimethyl silane,tmbs,bromo trimethyl silane,tms bromide |
| Summenformel | C3H9BrSi |
Dichlorodimethylsilan, 99+ %, AcroSeal™, Thermo Scientific Chemicals
CAS: 75-78-5 Summenformel: C2H6Cl2Si Molekulargewicht (g/mol): 129.06 MDL-Nummer: MFCD00000491 InChI-Schlüssel: LIKFHECYJZWXFJ-UHFFFAOYSA-N Synonym: dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane PubChem CID: 6398 IUPAC-Name: Dichlor(dimethyl)silan SMILES: C[Si](C)(Cl)Cl
| InChI-Schlüssel | LIKFHECYJZWXFJ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Dichlor(dimethyl)silan |
| PubChem CID | 6398 |
| CAS | 75-78-5 |
| MDL-Nummer | MFCD00000491 |
| Molekulargewicht (g/mol) | 129.06 |
| SMILES | C[Si](C)(Cl)Cl |
| Synonym | dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane |
| Summenformel | C2H6Cl2Si |
Tetraethylorthosilikat, AcroSeal™, Thermo Scientific Chemicals
CAS: 78-10-4 Summenformel: C8H20O4Si Molekulargewicht (g/mol): 208.33 InChI-Schlüssel: BOTDANWDWHJENH-UHFFFAOYSA-N Synonym: tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate PubChem CID: 6517 IUPAC-Name: Tetraethylsilikat SMILES: CCO[Si](OCC)(OCC)OCC
| InChI-Schlüssel | BOTDANWDWHJENH-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Tetraethylsilikat |
| PubChem CID | 6517 |
| CAS | 78-10-4 |
| Molekulargewicht (g/mol) | 208.33 |
| SMILES | CCO[Si](OCC)(OCC)OCC |
| Synonym | tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate |
| Summenformel | C8H20O4Si |
Iodotrimethylsilan, 95–97 %, stabilisiert, Thermo Scientific Chemicals
CAS: 16029-98-4 Summenformel: C3H9ISi Molekulargewicht (g/mol): 200.1 MDL-Nummer: MFCD00001028 InChI-Schlüssel: CSRZQMIRAZTJOY-UHFFFAOYSA-N Synonym: trimethylsilyl iodide,trimethyliodosilane,silane, iodotrimethyl,iodo trimethyl silane,trimethylsilyliodide,tms-iodide,iodotrimethysilane,iodotrimetylsilane,tms iodide,iodo trimethylsilane PubChem CID: 85247 IUPAC-Name: Iod(trimethyl)silan SMILES: C[Si](C)(C)I
| InChI-Schlüssel | CSRZQMIRAZTJOY-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Iod(trimethyl)silan |
| PubChem CID | 85247 |
| CAS | 16029-98-4 |
| MDL-Nummer | MFCD00001028 |
| Molekulargewicht (g/mol) | 200.1 |
| SMILES | C[Si](C)(C)I |
| Synonym | trimethylsilyl iodide,trimethyliodosilane,silane, iodotrimethyl,iodo trimethyl silane,trimethylsilyliodide,tms-iodide,iodotrimethysilane,iodotrimetylsilane,tms iodide,iodo trimethylsilane |
| Summenformel | C3H9ISi |