Organische Verbindungen
Organische Verbindungen sind eine Klasse chemischer Verbindungen, die ein oder mehrere Kohlenstoffatome enthalten, die kovalent miteinander und Atomen anderer Elemente wie Wasserstoff, Sauerstoff, Stickstoff, Schwefel usw. verbunden sind.
Kohlenstoffverbindungen oder -allotrope, die nur Kohlenstoffatome enthalten, werden als anorganische Verbindungen klassifiziert und weisen neue Eigenschaften auf.
Für diese Klasse von Chemikalien gibt es ein eine breite Palette von Anwendungen und sie umfasst Graphit, Diamant und das in jüngerer Zeit entdeckte Graphen, Fullerene und andere Kohlenstoffnanoröhren. Tatsächlich sind die meisten Elemente im Periodensystem der Elemente anorganische Verbindungen.
Gefilterte Suchergebnisse
Propylencarbonat, 99 %, Thermo Scientific Chemicals
CAS: 108-32-7 Summenformel: C4H6O3 Molekulargewicht (g/mol): 102.09 MDL-Nummer: MFCD00005385,MFCD00798264,MFCD00798265 InChI-Schlüssel: RUOJZAUFBMNUDX-UHFFFAOYNA-N Synonym: propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate PubChem CID: 7924 IUPAC-Name: 4-methyl-1,3-dioxolan-2-on SMILES: CC1COC(=O)O1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RUOJZAUFBMNUDX-UHFFFAOYNA-N |
|---|---|
| IUPAC-Name | 4-methyl-1,3-dioxolan-2-on |
| PubChem CID | 7924 |
| CAS | 108-32-7 |
| MDL-Nummer | MFCD00005385,MFCD00798264,MFCD00798265 |
| Molekulargewicht (g/mol) | 102.09 |
| SMILES | CC1COC(=O)O1 |
| Synonym | propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate |
| Summenformel | C4H6O3 |
Propylencarbonat, 99.50 %, Thermo Scientific Chemicals
CAS: 108-32-7 Summenformel: C4H6O3 Molekulargewicht (g/mol): 102.09 MDL-Nummer: MFCD00005385,MFCD00798264,MFCD00798265 InChI-Schlüssel: RUOJZAUFBMNUDX-UHFFFAOYNA-N Synonym: propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate PubChem CID: 7924 IUPAC-Name: 4-methyl-1,3-dioxolan-2-on SMILES: CC1COC(=O)O1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RUOJZAUFBMNUDX-UHFFFAOYNA-N |
|---|---|
| IUPAC-Name | 4-methyl-1,3-dioxolan-2-on |
| PubChem CID | 7924 |
| CAS | 108-32-7 |
| MDL-Nummer | MFCD00005385,MFCD00798264,MFCD00798265 |
| Molekulargewicht (g/mol) | 102.09 |
| SMILES | CC1COC(=O)O1 |
| Synonym | propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate |
| Summenformel | C4H6O3 |
Kohlenstoffschwarz, Acetylen, 100 % komprimiert, >99.9 %, Thermo Scientific Chemicals
CAS: 1333-86-4 Summenformel: C Molekulargewicht (g/mol): 12.01 MDL-Nummer: MFCD00133992 InChI-Schlüssel: OKTJSMMVPCPJKN-UHFFFAOYSA-N
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
|---|---|
| CAS | 1333-86-4 |
| MDL-Nummer | MFCD00133992 |
| Molekulargewicht (g/mol) | 12.01 |
| Summenformel | C |
Aktivkohlepulver, Norit GSX, dampfaktiviert, säuregewaschen, Thermo Scientific Chemicals
CAS: 7440-44-0 Summenformel: C Molekulargewicht (g/mol): 12.011 MDL-Nummer: MFCD00133992 InChI-Schlüssel: OKTJSMMVPCPJKN-UHFFFAOYSA-N Synonym: graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve PubChem CID: 5462310 ChEBI: CHEBI:27594 IUPAC-Name: Kohlenstoff SMILES: [C]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Kohlenstoff |
| PubChem CID | 5462310 |
| CAS | 7440-44-0 |
| ChEBI | CHEBI:27594 |
| MDL-Nummer | MFCD00133992 |
| Molekulargewicht (g/mol) | 12.011 |
| SMILES | [C] |
| Synonym | graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve |
| Summenformel | C |
Kohlenstoff, aktiviert, Norit ROW, 0.8-mm-Pellets, dampfaktiviert, Thermo Scientific Chemicals
CAS: 7440-44-0 Summenformel: C Molekulargewicht (g/mol): 12.011 MDL-Nummer: MFCD00133992 InChI-Schlüssel: OKTJSMMVPCPJKN-UHFFFAOYSA-N Synonym: graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve PubChem CID: 5462310 ChEBI: CHEBI:27594 IUPAC-Name: Kohlenstoff SMILES: [C]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Kohlenstoff |
| PubChem CID | 5462310 |
| CAS | 7440-44-0 |
| ChEBI | CHEBI:27594 |
| MDL-Nummer | MFCD00133992 |
| Molekulargewicht (g/mol) | 12.011 |
| SMILES | [C] |
| Synonym | graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve |
| Summenformel | C |
Glaskohlenstoffstab, 1 mm (0.04 Zoll) Durchmesser 1, Thermo Scientific Chemicals
In der Elektrochemie weit verbreitet als Elektrodenmaterial, ebenso wie bei Hochtemperaturtiegeln und als Teil einiger prothetischer Geräte.
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| Chemischer Name oder Material | Glassy carbon rod |
|---|---|
| Löslichkeitsinformationen | Insoluble in water. |
| Verpackung | Rörchen |
| EINECS-Nummer | 231-153-3 |
| Empfohlene Lagerung | Umgebungstemperaturen |
| MDL-Nummer | MFCD00133992 |
| TSCA | Ja |
Dimethylcarbonat, 99 %, Thermo Scientific Chemicals
CAS: 616-38-6 Summenformel: C3H6O3 Molekulargewicht (g/mol): 90.08 MDL-Nummer: MFCD00008420 InChI-Schlüssel: IEJIGPNLZYLLBP-UHFFFAOYSA-N Synonym: methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 PubChem CID: 12021 ChEBI: CHEBI:36596 IUPAC-Name: Dimethylcarbonat SMILES: COC(=O)OC
| InChI-Schlüssel | IEJIGPNLZYLLBP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Dimethylcarbonat |
| PubChem CID | 12021 |
| CAS | 616-38-6 |
| ChEBI | CHEBI:36596 |
| MDL-Nummer | MFCD00008420 |
| Molekulargewicht (g/mol) | 90.08 |
| SMILES | COC(=O)OC |
| Synonym | methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 |
| Summenformel | C3H6O3 |
Ethylencarbonat, +99 %, Thermo Scientific Chemicals
CAS: 96-49-1 Summenformel: C3H4O3 Molekulargewicht (g/mol): 88.06 MDL-Nummer: MFCD00005382 InChI-Schlüssel: KMTRUDSVKNLOMY-UHFFFAOYSA-N Synonym: ethylene carbonate,glycol carbonate,ethylene glycol carbonate,dioxolone-2,cyclic ethylene carbonate,ethylene carbonic acid,1,3-dioxacyclopentan-2-one,2-dioxolone,carbonic acid, cyclic ethylene ester,texacar ec PubChem CID: 7303 IUPAC-Name: 1,3-Dioxolan-2-on SMILES: C1COC(=O)O1
| InChI-Schlüssel | KMTRUDSVKNLOMY-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1,3-Dioxolan-2-on |
| PubChem CID | 7303 |
| CAS | 96-49-1 |
| MDL-Nummer | MFCD00005382 |
| Molekulargewicht (g/mol) | 88.06 |
| SMILES | C1COC(=O)O1 |
| Synonym | ethylene carbonate,glycol carbonate,ethylene glycol carbonate,dioxolone-2,cyclic ethylene carbonate,ethylene carbonic acid,1,3-dioxacyclopentan-2-one,2-dioxolone,carbonic acid, cyclic ethylene ester,texacar ec |
| Summenformel | C3H4O3 |
Ethylencarbonat, 99 %, Thermo Scientific Chemicals
CAS: 96-49-1 Summenformel: C3H4O3 Molekulargewicht (g/mol): 88.062 MDL-Nummer: MFCD00005382 InChI-Schlüssel: KMTRUDSVKNLOMY-UHFFFAOYSA-N Synonym: ethylene carbonate,glycol carbonate,ethylene glycol carbonate,dioxolone-2,cyclic ethylene carbonate,ethylene carbonic acid,1,3-dioxacyclopentan-2-one,2-dioxolone,carbonic acid, cyclic ethylene ester,texacar ec PubChem CID: 7303 IUPAC-Name: 1,3-Dioxolan-2-on SMILES: C1COC(=O)O1
| InChI-Schlüssel | KMTRUDSVKNLOMY-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1,3-Dioxolan-2-on |
| PubChem CID | 7303 |
| CAS | 96-49-1 |
| MDL-Nummer | MFCD00005382 |
| Molekulargewicht (g/mol) | 88.062 |
| SMILES | C1COC(=O)O1 |
| Synonym | ethylene carbonate,glycol carbonate,ethylene glycol carbonate,dioxolone-2,cyclic ethylene carbonate,ethylene carbonic acid,1,3-dioxacyclopentan-2-one,2-dioxolone,carbonic acid, cyclic ethylene ester,texacar ec |
| Summenformel | C3H4O3 |
Diphenylcarbonat, 99%, Thermo Scientific Chemicals
CAS: 102-09-0 Summenformel: C13H10O3 Molekulargewicht (g/mol): 214.22 InChI-Schlüssel: ROORDVPLFPIABK-UHFFFAOYSA-N Synonym: carbonic acid, diphenyl ester,phenyl carbonate,diphenylcarbonate,carbonic acid diphenyl ester,phenyl carbonate pho 2co,unii-ywv401idyn,ph2co3,pho 2co,ywv401idyn,phenyl phenoxyformate PubChem CID: 7597 ChEBI: CHEBI:34722 IUPAC-Name: Diphenylcarbonat SMILES: C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2
| InChI-Schlüssel | ROORDVPLFPIABK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diphenylcarbonat |
| PubChem CID | 7597 |
| CAS | 102-09-0 |
| ChEBI | CHEBI:34722 |
| Molekulargewicht (g/mol) | 214.22 |
| SMILES | C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2 |
| Synonym | carbonic acid, diphenyl ester,phenyl carbonate,diphenylcarbonate,carbonic acid diphenyl ester,phenyl carbonate pho 2co,unii-ywv401idyn,ph2co3,pho 2co,ywv401idyn,phenyl phenoxyformate |
| Summenformel | C13H10O3 |
Propylene carbonate, MP Biomedicals™
CAS: 108-32-7 Summenformel: C4H6O3 Molekulargewicht (g/mol): 102.09 MDL-Nummer: MFCD00005385,MFCD00798264,MFCD00798265 InChI-Schlüssel: RUOJZAUFBMNUDX-UHFFFAOYNA-N Synonym: propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate PubChem CID: 7924 IUPAC-Name: 4-methyl-1,3-dioxolan-2-on SMILES: CC1COC(=O)O1
| InChI-Schlüssel | RUOJZAUFBMNUDX-UHFFFAOYNA-N |
|---|---|
| IUPAC-Name | 4-methyl-1,3-dioxolan-2-on |
| PubChem CID | 7924 |
| CAS | 108-32-7 |
| MDL-Nummer | MFCD00005385,MFCD00798264,MFCD00798265 |
| Molekulargewicht (g/mol) | 102.09 |
| SMILES | CC1COC(=O)O1 |
| Synonym | propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate |
| Summenformel | C4H6O3 |
Diethylcarbonat, 99%, Thermo Scientific Chemicals
CAS: 105-58-8 Summenformel: C5H10O3 Molekulargewicht (g/mol): 118.13 MDL-Nummer: MFCD00009107 InChI-Schlüssel: OIFBSDVPJOWBCH-UHFFFAOYSA-N Synonym: ethyl carbonate,carbonic acid, diethyl ester,carbonic acid diethyl ester,eufin,diatol,diaethylcarbonat,carbonic ether,ethoxyformic anhydride,diethylkarbonat,ethyl carbonate eto 2co PubChem CID: 7766 IUPAC-Name: Diethylcarbonat SMILES: CCOC(=O)OCC
| InChI-Schlüssel | OIFBSDVPJOWBCH-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diethylcarbonat |
| PubChem CID | 7766 |
| CAS | 105-58-8 |
| MDL-Nummer | MFCD00009107 |
| Molekulargewicht (g/mol) | 118.13 |
| SMILES | CCOC(=O)OCC |
| Synonym | ethyl carbonate,carbonic acid, diethyl ester,carbonic acid diethyl ester,eufin,diatol,diaethylcarbonat,carbonic ether,ethoxyformic anhydride,diethylkarbonat,ethyl carbonate eto 2co |
| Summenformel | C5H10O3 |
Diethylcarbonat, 99%, Thermo Scientific Chemicals
CAS: 105-58-8 Summenformel: C5H10O3 Molekulargewicht (g/mol): 118.13 MDL-Nummer: MFCD00009107 InChI-Schlüssel: OIFBSDVPJOWBCH-UHFFFAOYSA-N Synonym: ethyl carbonate,carbonic acid, diethyl ester,carbonic acid diethyl ester,eufin,diatol,diaethylcarbonat,carbonic ether,ethoxyformic anhydride,diethylkarbonat,ethyl carbonate eto 2co PubChem CID: 7766 IUPAC-Name: Diethylcarbonat SMILES: CCOC(=O)OCC
| InChI-Schlüssel | OIFBSDVPJOWBCH-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diethylcarbonat |
| PubChem CID | 7766 |
| CAS | 105-58-8 |
| MDL-Nummer | MFCD00009107 |
| Molekulargewicht (g/mol) | 118.13 |
| SMILES | CCOC(=O)OCC |
| Synonym | ethyl carbonate,carbonic acid, diethyl ester,carbonic acid diethyl ester,eufin,diatol,diaethylcarbonat,carbonic ether,ethoxyformic anhydride,diethylkarbonat,ethyl carbonate eto 2co |
| Summenformel | C5H10O3 |
Diethylcarbonat, 99%, Thermo Scientific Chemicals
CAS: 105-58-8 Summenformel: C5H10O3 Molekulargewicht (g/mol): 118.13 MDL-Nummer: MFCD00009107 InChI-Schlüssel: OIFBSDVPJOWBCH-UHFFFAOYSA-N Synonym: ethyl carbonate,carbonic acid, diethyl ester,carbonic acid diethyl ester,eufin,diatol,diaethylcarbonat,carbonic ether,ethoxyformic anhydride,diethylkarbonat,ethyl carbonate eto 2co PubChem CID: 7766 IUPAC-Name: Diethylcarbonat SMILES: CCOC(=O)OCC
| InChI-Schlüssel | OIFBSDVPJOWBCH-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diethylcarbonat |
| PubChem CID | 7766 |
| CAS | 105-58-8 |
| MDL-Nummer | MFCD00009107 |
| Molekulargewicht (g/mol) | 118.13 |
| SMILES | CCOC(=O)OCC |
| Synonym | ethyl carbonate,carbonic acid, diethyl ester,carbonic acid diethyl ester,eufin,diatol,diaethylcarbonat,carbonic ether,ethoxyformic anhydride,diethylkarbonat,ethyl carbonate eto 2co |
| Summenformel | C5H10O3 |
Dimethylcarbonat, 99 %, Thermo Scientific Chemicals
CAS: 616-38-6 Summenformel: C3H6O3 Molekulargewicht (g/mol): 90.08 MDL-Nummer: MFCD00008420 InChI-Schlüssel: IEJIGPNLZYLLBP-UHFFFAOYSA-N Synonym: methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 PubChem CID: 12021 ChEBI: CHEBI:36596 IUPAC-Name: Dimethylcarbonat SMILES: COC(=O)OC
| InChI-Schlüssel | IEJIGPNLZYLLBP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Dimethylcarbonat |
| PubChem CID | 12021 |
| CAS | 616-38-6 |
| ChEBI | CHEBI:36596 |
| MDL-Nummer | MFCD00008420 |
| Molekulargewicht (g/mol) | 90.08 |
| SMILES | COC(=O)OC |
| Synonym | methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 |
| Summenformel | C3H6O3 |